{ "ANCILLARIES": { "hL": { "A": [ -28867.616510299034, -408.32764578887225, 7.548365590820917, -0.052163621882971814, 0.0002057712744341983, -4.788129101534506e-07, 6.099749446943092e-10, -3.2963218791561845e-13 ], "B": [ 1, -0.0025697731053347032 ], "Tmax": 386.311, "Tmin": 154.56, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 233.17397640253148, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "hLV": { "A": [ 86.79457780148834, 914.1349239678427, -13.262154702014032, 0.09203780806864338, -0.0003702221753264052, 8.747255761170569e-07, -1.1299461194395474e-09, 6.191408673303206e-13 ], "B": [ 1, -0.002565989658259806 ], "Tmax": 386.311, "Tmin": 154.56, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 578.9444284184676, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "pS": { "T_r": 386.411, "Tmax": 386.4109999999993, "Tmin": 154.56, "description": "p' = pc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 0.12140204459119008, "n": [ -0.002091012267118934, -6.995494450649338, 0.9348417755500018, -3.706406451221934, -66.08072669965013, 122.73360925177805 ], "reducing_value": 4520000.0, "t": [ 0.049, 0.993, 1.692, 3.445, 15.803, 17.838 ], "type": "pL", "using_tau_r": true }, "rhoL": { "T_r": 386.411, "Tmax": 386.4109999999993, "Tmin": 154.56, "description": "rho' = rhoc*(1+sum(n_i*theta^t_i))", "max_abserror_percentage": 2.482115019286124, "n": [ 0.27636163699950356, 2.512764633534828, 162.80865128111427, 345.16760517849104, -475.5953680253087, -1773.7454734026196 ], "reducing_value": 5571.452362568319, "t": [ 0.091, 0.499, 16.122, 16.122, 19.05, 19.528 ], "type": "rhoLnoexp", "using_tau_r": false }, "rhoV": { "T_r": 386.411, "Tmax": 386.4109999999993, "Tmin": 154.56, "description": "rho'' = rhoc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 1.6145478143872904, "n": [ -24.05629942535681, 24.599913141549887, -10.746520376686876, 5.86362610412505, -3.7063275045589696, -4.904962359487088 ], "reducing_value": 5571.452362568319, "t": [ 0.162, 0.168, 0.621, 0.787, 2.442, 7.345 ], "type": "rhoV", "using_tau_r": true }, "sL": { "A": [ -233.64650626598558, 0.7585563357562883, 0.01180875890337456, -0.0001266865329861127, 5.844607283922734e-07, -1.4694220816579647e-09, 1.954421344420955e-12, -1.0812524818277703e-15 ], "B": [ 1, -0.002574054362632238 ], "Tmax": 386.311, "Tmin": 154.56, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 0.4764532808162656, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "sLV": { "A": [ 919.3815579526404, -13.370362446647205, 0.09317217535422671, -0.0003771265228945937, 9.002377842223549e-07, -1.1864992134769906e-09, 6.884143637985191e-13, -3.608613653440682e-17 ], "B": [ 1, -0.0025657819102800593 ], "Tmax": 386.311, "Tmin": 154.56, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 1.5108013660437791, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "surface_tension": { "BibTeX": "Mulero-JPCRD-2012", "Tc": 386.411, "a": [ 0.05808 ], "description": "sigma = sum(a_i*(1-T/Tc)^n_i)", "n": [ 1.2115 ] } }, "EOS": [ { "BibTeX_CP0": "", "BibTeX_EOS": "Outcalt-JPCRD-1996-R152A", "STATES": { "hs_anchor": { "T": 425.05210000000005, "T_units": "K", "hmolar": 36478.67647082188, "hmolar_units": "J/mol", "p": 7579325.6967821205, "p_units": "Pa", "rhomolar": 5014.305, "rhomolar_units": "mol/m^3", "smolar": 129.8862036915725, "smolar_units": "J/mol/K" }, "reducing": { "T": 386.411, "T_units": "K", "hmolar": 31546.566796021732, "hmolar_units": "J/mol", "p": 4520000, "p_units": "Pa", "rhomolar": 5571.45, "rhomolar_units": "mol/m^3", "smolar": 119.1451081368333, "smolar_units": "J/mol/K" }, "sat_min_liquid": { "T": 154.56, "T_units": "K", "hmolar": 911.1725809307966, "hmolar_units": "J/mol", "p": 64.13864973694703, "p_units": "Pa", "rhomolar": 18060.71838709593, "rhomolar_units": "mol/m^3", "smolar": 7.392879116265615, "smolar_units": "J/mol/K" }, "sat_min_vapor": { "T": 154.56, "T_units": "K", "hmolar": 27696.619137464157, "hmolar_units": "J/mol", "p": 64.1385975843717, "p_units": "Pa", "rhomolar": 0.04991911360310319, "rhomolar_units": "mol/m^3", "smolar": 180.6941637616753, "smolar_units": "J/mol/K" } }, "T_max": 500, "T_max_units": "K", "Ttriple": 154.56, "Ttriple_units": "K", "acentric": 0.275217114532099, "acentric_units": "-", "alpha0": [ { "a1": 0, "a2": 0, "type": "IdealGasHelmholtzLead" }, { "a": -1, "type": "IdealGasHelmholtzLogTau" }, { "T0": 298.15, "Tc": 386.411, "c": [ 3.354951, 0.0109864910678, 2.50161504325e-05, -2.78744429549e-08 ], "t": [ 0, 1, 2, 3 ], "type": "IdealGasHelmholtzCP0PolyT" }, { "a1": -14.5767531651083, "a2": 11.1518708142201, "reference": "IIR", "type": "IdealGasHelmholtzEnthalpyEntropyOffset" } ], "alphar": [ { "d": [ 0, 0, 0, 1.0, 1.0, 1.0, 1.0, 1.0, 2.0, 2.0, 2.0, 2.0, 3.0, 3.0, 3.0, 4.0, 5.0, 5.0, 6.0, 7.0, 7.0, 8.0, 0, 0, 0, 2, 2, 2, 4, 4, 4, 6, 6, 6, 8, 8, 8, 10, 10, 10 ], "l": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2 ], "n": [ -3.546579500185174, -0.3646312799563631, 0.03332333306112814, -0.6809684338301859, 7.3521264810280345, -11.247306378057127, 5.499167142976577, -2.401863270213656, -0.07090364464394744, -0.2132008868213696, 0.19783973673284622, 1.824947698265976, -0.08605464767044602, 0.8881373668542004, -0.9661273471407773, -0.09852234785295554, 0.018341936863418316, -0.03385502040688226, 0.012492110085780536, -0.002210567071037713, 0.002168791332779416, -0.0002335976904702689, 3.546579500185174, 0.3646312799563631, -0.03332333306112814, 2.7613383040168675, -0.06911857102367282, -0.03332333306112814, 0.7827613268561544, -0.03455928551183641, 0.13781353206688696, 0.18617312581521558, -0.03411193928992716, 0.04593784402229564, 0.021647001270605898, -0.00852798482248179, 0.006203940397171849, 0.0018521029114874563, 0.00101674662708817, 0.0012407880794343697 ], "t": [ 3, 4, 5, 0.0, 0.5, 1.0, 2.0, 3.0, 0.0, 1.0, 2.0, 3.0, 0.0, 1.0, 2.0, 1.0, 2.0, 3.0, 2.0, 2.0, 3.0, 3.0, 3, 4, 5, 3, 4, 5, 3, 4, 5, 3, 4, 5, 3, 4, 5, 3, 4, 5 ], "type": "ResidualHelmholtzPower" } ], "critical_region_splines": { "T_max": 386.411, "T_min": 386.2879808473738, "_note": "Coefficients for the critical cubic spline. T = c[0]*rho^3 + c[1]*rho^2 + c[2]*rho + c[3] with rho in mol/m^3 and T in K", "cL": [ -1.1446811820239007e-10, 1.646295645058246e-06, -0.007684872988074046, 397.9206701191548 ], "cV": [ 1.0521854870590392e-10, -2.0174071540863595e-06, 0.012681483095329345, 360.1823139464937 ], "rhomolar_max": 6176.35151183272, "rhomolar_min": 4954.90121849081 }, "gas_constant": 8.314471, "gas_constant_units": "J/mol/K", "molar_mass": 0.066051, "molar_mass_units": "kg/mol", "p_max": 58000000, "p_max_units": "Pa", "pseudo_pure": false }, { "BibTeX_CP0": "TillnerRoth-IJT-1995", "BibTeX_EOS": "Span-IJT-2003C", "STATES": { "reducing": { "T": 386.411, "T_units": "K", "hmolar": 31546.56419141521, "hmolar_units": "J/mol", "p": 4520000, "p_units": "Pa", "rhomolar": 5571.452362568319, "rhomolar_units": "mol/m^3", "smolar": 119.14510139628291, "smolar_units": "J/mol/K" }, "sat_min_liquid": { "T": 154.56, "T_units": "K", "p": 0.06408986801291847, "p_units": "Pa", "rhomolar": 18031.095642133463, "rhomolar_units": "mol/m^3" }, "sat_min_vapor": { "T": 154.56, "T_units": "K", "p": 0.06408986801291847, "p_units": "Pa", "rhomolar": 0.04989056799859409, "rhomolar_units": "mol/m^3" } }, "T_max": 500, "T_max_units": "K", "Ttriple": 154.56, "Ttriple_units": "K", "acentric": 0.275217114532099, "acentric_units": "-", "alpha0": [ { "a1": 10.87227, "a2": 6.839515, "type": "IdealGasHelmholtzLead" }, { "a": -1, "type": "IdealGasHelmholtzLogTau" }, { "n": [ -20.78887, -0.6539092, 0.03342831 ], "t": [ -0.25, -2, -4 ], "type": "IdealGasHelmholtzPower" }, { "a1": -0.00575158142139323, "a2": 0.00491802084015653, "reference": "IIR", "type": "IdealGasHelmholtzEnthalpyEntropyOffset" } ], "alphar": [ { "d": [ 1, 1, 1, 3, 7, 1, 2, 5, 1, 1, 4, 2 ], "l": [ 0, 0, 0, 0, 0, 1, 1, 1, 2, 2, 2, 3 ], "n": [ 0.95702326, -2.3707196, 0.18748463, 0.063800843, 0.00016625977, 0.082208165, 0.57243518, 0.0039476701, -0.23848654, -0.080711618, -0.073103558, -0.015538724 ], "t": [ 0.25, 1.25, 1.5, 0.25, 0.875, 2.375, 2, 2.125, 3.5, 6.5, 4.75, 12.5 ], "type": "ResidualHelmholtzPower" } ], "gas_constant": 8.31451, "gas_constant_units": "J/mol/K", "molar_mass": 0.066051, "molar_mass_units": "kg/mol", "p_max": 58000000, "p_max_units": "Pa", "pseudo_pure": false } ], "INFO": { "2DPNG_URL": "http://www.chemspider.com/ImagesHandler.ashx?id=6128", "ALIASES": [ "R152a" ], "CAS": "75-37-6", "CHEMSPIDER_ID": 6128, "ENVIRONMENTAL": { "ASHRAE34": "A2", "FH": 4, "GWP100": 124.0, "GWP20": 437.0, "GWP500": 38.0, "HH": 1, "Name": "R152A", "ODP": -1.0, "PH": 1 }, "FORMULA": "C_{2}F_{2}H_{4}", "INCHI_KEY": "NPNPZTNLOVBDOC-UHFFFAOYSA-N", "INCHI_STRING": "InChI=1S/C2H4F2/c1-2(3)4/h2H,1H3", "NAME": "R152A", "REFPROP_NAME": "R152A", "SMILES": "CC(F)F" }, "STATES": { "critical": { "T": 386.411, "T_units": "K", "hmolar": 31542.80872801791, "hmolar_units": "J/mol", "p": 4520000.0, "p_units": "Pa", "rhomolar": 5571.452362568319, "rhomolar_units": "mol/m^3", "smolar": 119.13697259149954, "smolar_units": "J/mol/K" }, "triple_liquid": { "T": 154.56, "T_units": "K", "hmolar": 911.1725809307966, "hmolar_units": "J/mol", "p": 64.13864973694703, "p_units": "Pa", "rhomolar": 18060.71838709593, "rhomolar_units": "mol/m^3", "smolar": 7.392879116265615, "smolar_units": "J/mol/K" }, "triple_vapor": { "T": 154.56, "T_units": "K", "hmolar": 27696.619137464157, "hmolar_units": "J/mol", "p": 64.1385975843717, "p_units": "Pa", "rhomolar": 0.04991911360310319, "rhomolar_units": "mol/m^3", "smolar": 180.6941637616753, "smolar_units": "J/mol/K" } }, "TRANSPORT": { "conductivity": { "BibTeX": "Krauss-IJT-1996", "critical": { "GAMMA": 0.0487, "R0": 1.03, "gamma": 1.239, "qD": 2288329519.45, "type": "simplified_Olchowy_Sengers", "zeta0": 1.894e-10 }, "dilute": { "A": [ -0.014942, 9.73283e-05 ], "B": [ 1.0 ], "T_reducing": 1, "T_reducing_units": "K", "m": [ 0 ], "n": [ 0, 1 ], "type": "ratio_of_polynomials" }, "residual": { "B": [ 0.0106039395, 0.0136956435, -0.0062916315, 0.0019794274499999997 ], "T_reducing": 386.411, "T_reducing_units": "K", "d": [ 1, 2, 3, 4 ], "rhomass_reducing": 368.0, "rhomass_reducing_units": "kg/m^3", "t": [ 0, 0, 0, 0 ], "type": "polynomial" } }, "viscosity": [ { "BibTeX": "Bell-PURDUE-2016-ETA", "C": 0.86166, "c_liq": [ 0.6100913843, 0.4508958312, -0.017063, 0.000564 ], "c_vap": [ 0.0, 1.2, -0.308598, 0.035317 ], "rhosr_critical": -71960.49367077358, "type": "rhosr-CS", "x_crossover": 2 }, { "BibTeX": "Krauss-IJT-1996", "dilute": { "C": 2.6695992007227643e-08, "a": [ 0.4425728, -0.5138403, 0.1547566, -0.02821844, 0.001578286 ], "molar_mass": 0.06605, "molar_mass_units": "kg/mol", "t": [ 0, 1, 2, 3, 4 ], "type": "collision_integral" }, "epsilon_over_k": 354.84, "epsilon_over_k_units": "K", "higher_order": { "T_reduce": 386.411, "T_reduce_units": "K", "a": [ -3.772282824e-06, 2.647627488e-05, -1.578969e-05, 5.52346488e-06 ], "d1": [ 1, 2, 3, 4 ], "d2": [ 0 ], "f": [ 2.087674344e-05 ], "g": [ 2.91733 ], "gamma": [ 0, 0, 0, 0 ], "h": [ 0 ], "l": [ 1, 1, 1, 1 ], "p": [ 1 ], "q": [ 0 ], "rhomolar_reduce": 5571.536714610144, "rhomolar_reduce_units": "mol/m^3", "t1": [ 0, 0, 0, 0 ], "t2": [ 0 ], "type": "modified_Batschinski_Hildebrand" }, "sigma_eta": 4.6115e-10, "sigma_eta_units": "m" } ] } }