{ "ANCILLARIES": { "hL": { "A": [ -69041.89733741916, 308.42675717177536, 0.13353592877558096, -0.0050809117004381255, 3.0406225295410942e-05, -1.0358243527184946e-07, 1.828746026290058e-10, -1.3331847526159053e-13 ], "B": [ 1, -0.002870618311820848 ], "Tmax": 344.91999999999996, "Tmin": 125.45, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 240.5387300704815, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "hLV": { "A": [ 30569.82796801364, 63.279424417861996, -4.147712978479395, 0.040465458588006875, -0.0002084228115298255, 6.096456648796958e-07, -9.585021616085793e-10, 6.341202227062449e-13 ], "B": [ 1, -0.0028652191455249246 ], "Tmax": 344.91999999999996, "Tmin": 125.45, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 517.0323482530728, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "pS": { "T_r": 345.02, "Tmax": 345.01999999999936, "Tmin": 125.45000000000002, "description": "p'' = pc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 0.018024375182712493, "n": [ -8.242713023595973, 19.087798455338692, -17.233089915234846, -1.422792519033736, -3.3648176664863447, -10.213938754091759 ], "reducing_value": 2640000.0, "t": [ 1.008, 1.599, 1.665, 2.07, 4.314, 17.759 ], "type": "pV", "using_tau_r": true }, "rhoL": { "T_r": 345.02, "Tmax": 345.01999999999936, "Tmin": 125.45000000000002, "description": "rho' = rhoc*(1+sum(n_i*theta^t_i))", "max_abserror_percentage": 0.30131835528779405, "n": [ 7.303753750603384, -7.730626041358162, 3.674253188196436, -3.58395389631866, 5.552496612344577, -211.54319300173208 ], "reducing_value": 3340.0000000000005, "t": [ 0.517, 0.714, 1.159, 3.98, 5.488, 19.277 ], "type": "rhoLnoexp", "using_tau_r": false }, "rhoV": { "T_r": 345.02, "Tmax": 345.01999999999936, "Tmin": 125.45000000000002, "description": "rho'' = rhoc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 0.09201959542241012, "n": [ 3.329585797093735, -6.844734619770494, -1.1111833788437069, -2.0711985469576675, -4.658013576000995, 0.29142793495095165 ], "reducing_value": 3340.0000000000005, "t": [ 0.372, 0.41, 0.775, 1.882, 4.237, 8.879 ], "type": "rhoV", "using_tau_r": true }, "sL": { "A": [ -497.6803411076713, 5.825135042249743, -0.04097562230204031, 0.00020990056727661447, -7.156817080254555e-07, 1.5015561745790405e-09, -1.754684267168894e-12, 8.671175087568152e-16 ], "B": [ 1, -0.002867626250576254 ], "Tmax": 344.91999999999996, "Tmin": 125.45, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 0.7519344810011042, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "sLV": { "A": [ 1255.6429439326298, -24.13984058721065, 0.22883011227001343, -0.001299324463336886, 4.5877482226187245e-06, -9.883015568222353e-09, 1.1902023201051958e-11, -6.134129307797647e-15 ], "B": [ 1, -0.002855758696388894 ], "Tmax": 344.91999999999996, "Tmin": 125.45, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 1.7631265870209125, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "surface_tension": { "BibTeX": "Mulero-JPCRD-2012", "Tc": 345.02, "a": [ 0.04322 ], "description": "sigma = sum(a_i*(1-T/Tc)^n_i)", "n": [ 1.224 ] } }, "EOS": [ { "BibTeX_CP0": "", "BibTeX_EOS": "Lemmon-JCED-2006", "STATES": { "hs_anchor": { "T": 379.522, "T_units": "K", "hmolar": 64418.41576334056, "hmolar_units": "J/mol", "p": 4431361.108447598, "p_units": "Pa", "rhomolar": 3006.000000000001, "rhomolar_units": "mol/m^3", "smolar": 267.64678100020603, "smolar_units": "J/mol/K" }, "reducing": { "T": 345.02, "T_units": "K", "hmolar": 57048.44073891886, "hmolar_units": "J/mol", "p": 2640000, "p_units": "Pa", "rhomolar": 3340.000000000001, "rhomolar_units": "mol/m^3", "smolar": 248.84276210530032, "smolar_units": "J/mol/K" }, "sat_min_liquid": { "T": 125.45, "T_units": "K", "hmolar": 12346.066680427975, "hmolar_units": "J/mol", "p": 2.018573582236092, "p_units": "Pa", "rhomolar": 10687.00507449543, "rhomolar_units": "mol/m^3", "smolar": 57.735566827185586, "smolar_units": "J/mol/K" }, "sat_min_vapor": { "T": 125.45, "T_units": "K", "hmolar": 38916.72500440882, "hmolar_units": "J/mol", "p": 2.01857482644654, "p_units": "Pa", "rhomolar": 0.0019353038719978387, "rhomolar_units": "mol/m^3", "smolar": 269.53833819929, "smolar_units": "J/mol/K" } }, "T_max": 440, "T_max_units": "K", "Ttriple": 125.45, "Ttriple_units": "K", "acentric": 0.3172, "acentric_units": "-", "alpha0": [ { "a1": -15.6587335175, "a2": 11.4531412796, "type": "IdealGasHelmholtzLead" }, { "a": 3, "type": "IdealGasHelmholtzLogTau" }, { "n": [ 7.2198, 7.2692, 11.599 ], "t": [ 0.9448727609993625, 1.724537707958959, 4.315691843951075 ], "type": "IdealGasHelmholtzPlanckEinstein" } ], "alphar": [ { "d": [ 1, 1, 1, 3, 7, 1, 2, 5, 1, 1, 4, 2 ], "l": [ 0, 0, 0, 0, 0, 1, 1, 1, 2, 2, 2, 3 ], "n": [ 1.327, -3.8433, 0.922, 0.1136, 0.00036195, 1.1001, 1.1896, -0.025147, -0.65923, -0.027969, -0.1833, -0.02163 ], "t": [ 0.25, 1.25, 1.5, 0.25, 0.875, 2.375, 2, 2.125, 3.5, 6.5, 4.75, 12.5 ], "type": "ResidualHelmholtzPower" } ], "critical_region_splines": { "T_max": 345.02, "T_min": 345.01867131966134, "_note": "Coefficients for the critical cubic spline. T = c[0]*rho^3 + c[1]*rho^2 + c[2]*rho + c[3] with rho in mol/m^3 and T in K", "cL": [ 2.115849844779737e-09, -2.2622652824384362e-05, 0.08030859728161308, 250.32261200217556 ], "cV": [ -1.5113366978895236e-09, 1.3734866737761167e-05, -0.04116930680731554, 385.6167633643665 ], "rhomolar_max": 3371.3072650243957, "rhomolar_min": 3308.7608519066903 }, "gas_constant": 8.314472, "gas_constant_units": "J/mol/K", "molar_mass": 0.18801933, "molar_mass_units": "kg/mol", "p_max": 20000000, "p_max_units": "Pa", "pseudo_pure": false } ], "INFO": { "2DPNG_URL": "http://www.chemspider.com/ImagesHandler.ashx?id=6192", "ALIASES": [], "CAS": "76-19-7", "CHEMSPIDER_ID": 6192, "ENVIRONMENTAL": { "ASHRAE34": "A1", "FH": 1, "GWP100": 8830.0, "GWP20": 6310.0, "GWP500": 12500.0, "HH": 2, "Name": "R218", "ODP": -1.0, "PH": 1 }, "FORMULA": "C_{3}F_{8}", "INCHI_KEY": "QYSGYZVSCZSLHT-UHFFFAOYSA-N", "INCHI_STRING": "InChI=1S/C3F8/c4-1(5,2(6,7)8)3(9,10)11", "NAME": "R218", "REFPROP_NAME": "R218", "SMILES": "C(C(F)(F)F)(C(F)(F)F)(F)F" }, "STATES": { "critical": { "T": 345.02, "T_units": "K", "hmolar": 57042.182437460724, "hmolar_units": "J/mol", "p": 2640000.0, "p_units": "Pa", "rhomolar": 3340.0000000000005, "rhomolar_units": "mol/m^3", "smolar": 248.82637544333176, "smolar_units": "J/mol/K" }, "triple_liquid": { "T": 125.45, "T_units": "K", "hmolar": 12346.066680427975, "hmolar_units": "J/mol", "p": 2.018573582236092, "p_units": "Pa", "rhomolar": 10687.00507449543, "rhomolar_units": "mol/m^3", "smolar": 57.735566827185586, "smolar_units": "J/mol/K" }, "triple_vapor": { "T": 125.45, "T_units": "K", "hmolar": 38916.72500440882, "hmolar_units": "J/mol", "p": 2.01857482644654, "p_units": "Pa", "rhomolar": 0.0019353038719978387, "rhomolar_units": "mol/m^3", "smolar": 269.53833819929, "smolar_units": "J/mol/K" } }, "TRANSPORT": { "conductivity": { "BibTeX": "Huber-IECR-2003", "f_int": { "T_reducing": 1.0, "T_reducing_units": "K", "a": [ 0.000892659, 1.14912e-06 ], "t": [ 0, 1 ] }, "psi": { "a": [ 1.2877, -0.0758811 ], "rhomolar_reducing": 3340.0, "rhomolar_reducing_units": "mol/m^3", "t": [ 0, 1 ] }, "q_D": 917069412.9838686, "q_D_units": "m", "reference_fluid": "Propane", "type": "ECS" }, "viscosity": { "BibTeX": "Huber-IECR-2003", "epsilon_over_k": 266.35, "epsilon_over_k_units": "K", "psi": { "a": [ 1.10225, -0.00550442, 0.0 ], "rhomolar_reducing": 3340.0, "rhomolar_reducing_units": "mol/m^3", "t": [ 0, 1, 2 ] }, "reference_fluid": "Propane", "sigma_eta": 5.8e-10, "sigma_eta_units": "m", "type": "ECS" } } }