{ "ANCILLARIES": { "hL": { "A": [ 97108.00777536437, -4167.031039503142, 47.44081772402304, -0.2789970803615067, 0.0009751338143115229, -2.0391767778269797e-06, 2.3584227819664906e-09, -1.1640351439756232e-12 ], "B": [ 1, -0.0025587270690500164 ], "Tmax": 388.28, "Tmin": 233.35, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 209.80633134013078, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "hLV": { "A": [ -591505.8327839759, 15168.13419763823, -158.85428133647085, 0.9127745782236029, -0.003130733790315338, 6.41541353970224e-06, -7.274991487312669e-09, 3.5245148421487234e-12 ], "B": [ 1, -0.002557104062343887 ], "Tmax": 388.28, "Tmin": 233.35, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 449.9345433735564, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "pS": { "T_r": 388.38, "Tmax": 388.37999999999914, "Tmin": 233.35, "description": "p' = pc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 0.019138662643680693, "n": [ -15.102617412971505, 8.53184439256971, -1.3014556054852215, -3.286800573693744, -8.150652838303959, 0.020748299859318566 ], "reducing_value": 2777500.0, "t": [ 1.017, 1.071, 2.454, 3.687, 9.48, 0.506 ], "type": "pL", "using_tau_r": true }, "rhoL": { "T_r": 388.38, "Tmax": 388.37999999999914, "Tmin": 233.35, "description": "rho' = rhoc*(1+sum(n_i*theta^t_i))", "max_abserror_percentage": 0.5464670263682914, "n": [ 6.172092166054074, -13.109692547967464, 382.2970506693918, -475.82711917828664, 190.84639492080177, -142.60801162239488 ], "reducing_value": 3099.38, "t": [ 0.52, 0.979, 2.105, 2.269, 3.362, 4.954 ], "type": "rhoLnoexp", "using_tau_r": false }, "rhoV": { "T_r": 388.38, "Tmax": 388.37999999999914, "Tmin": 233.35, "description": "rho'' = rhoc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 0.2883096383379913, "n": [ 0.06881363274511793, -4.9709012896577605, 3.1335807931630963, -4.8498027190461865, -3405.1114368231356, 4685.608624866425 ], "reducing_value": 3099.38, "t": [ 0.117, 0.455, 0.746, 1.132, 8.848, 9.296 ], "type": "rhoV", "using_tau_r": true }, "sL": { "A": [ -224.89393682750583, -2.62584115379871, 0.055091607442938076, -0.00038307686953836307, 1.4628864227106823e-06, -3.2569547059529292e-09, 3.958840339199141e-12, -2.036192981950933e-15 ], "B": [ 1, -0.0025587526016840204 ], "Tmax": 388.28, "Tmin": 233.35, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 0.5402880405253079, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "sLV": { "A": [ -399.0753403774678, 19.605275995057834, -0.25120550112786844, 0.0015938651700138993, -5.805980223002076e-06, 1.2401116774437711e-08, -1.4502826328173382e-11, 7.19691776460456e-15 ], "B": [ 1, -0.0025572789472560593 ], "Tmax": 388.28, "Tmin": 233.35, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 1.1510941178453304, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "surface_tension": { "BibTeX": "Mulero-JPCRD-2012", "Tc": 388.38, "a": [ 0.0507 ], "description": "sigma = sum(a_i*(1-T/Tc)^n_i)", "n": [ 1.25 ] } }, "EOS": [ { "BibTeX_CP0": "Platzer-BOOK-1990", "BibTeX_EOS": "Platzer-BOOK-1990", "STATES": { "hs_anchor": { "T": 427.218, "T_units": "K", "hmolar": 80910.32651491373, "hmolar_units": "J/mol", "p": 4688214.666190826, "p_units": "Pa", "rhomolar": 2789.442, "rhomolar_units": "mol/m^3", "smolar": 314.20614745923746, "smolar_units": "J/mol/K" }, "reducing": { "T": 388.38, "T_units": "K", "hmolar": 71730.94762603201, "hmolar_units": "J/mol", "p": 2777500, "p_units": "Pa", "rhomolar": 3099.38, "rhomolar_units": "mol/m^3", "smolar": 293.2686676934833, "smolar_units": "J/mol/K" }, "sat_min_liquid": { "T": 233.35, "T_units": "K", "hmolar": 31957.19563750956, "hmolar_units": "J/mol", "p": 19461.056081372997, "p_units": "Pa", "rhomolar": 8645.18328651729, "rhomolar_units": "mol/m^3", "smolar": 168.26971481332566, "smolar_units": "J/mol/K" }, "sat_min_vapor": { "T": 233.35, "T_units": "K", "hmolar": 57605.81616033167, "hmolar_units": "J/mol", "p": 19461.056081372997, "p_units": "Pa", "rhomolar": 10.156986147247, "rhomolar_units": "mol/m^3", "smolar": 278.18445707047107, "smolar_units": "J/mol/K" } }, "T_max": 623, "T_max_units": "K", "Ttriple": 233.35, "Ttriple_units": "K", "acentric": 0.355345, "acentric_units": "-", "alpha0": [ { "a1": 0, "a2": 0, "type": "IdealGasHelmholtzLead" }, { "a": -1, "type": "IdealGasHelmholtzLogTau" }, { "T0": 298.15, "Tc": 388.38, "c": [ 2.911028455074322, 0.06984062483537816, -6.093191543939451e-05, 1.857067747732578e-08 ], "t": [ 0, 1, 2, 3 ], "type": "IdealGasHelmholtzCP0PolyT" }, { "a1": -32.5172232538152, "a2": 20.7826742209953, "reference": "IIR", "type": "IdealGasHelmholtzEnthalpyEntropyOffset" } ], "alphar": [ { "d": [ 1, 1, 1, 1, 1, 2, 2, 2, 3, 3, 4, 4, 5, 0, 0, 0 ], "l": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ], "n": [ 1.09415573664603, -2.68265247887176, 1.73403070801418, -1.63611253452478, 0.304834511239559, 0.102771559991302, -0.023236791408773, 0.166151971110653, -0.0250103944487447, 0.0935681090149423, 0.043192919662493, -0.133439867188959, 0.025541668325497, -1.04729119771286, 1.38034128674154, -0.333625770182218 ], "t": [ 0, 1, 2, 3, 4, 0, 1, 2, 0, 1, 0, 1, 1, 3, 4, 5 ], "type": "ResidualHelmholtzPower" }, { "d": [ 2, 2, 2, 0, 0, 0 ], "g": [ 0.99944, 0.99944, 0.99944, 0.99944, 0.99944, 0.99944 ], "l": [ 2, 2, 2, 2, 2, 2 ], "n": [ -0.510485822124397, 1.81840742529488, -1.38530904967474, 1.04729119771286, -1.38034128674154, 0.333625770182218 ], "t": [ 3, 4, 5, 3, 4, 5 ], "type": "ResidualHelmholtzExponential" } ], "critical_region_splines": { "T_max": 388.38, "T_min": 388.29054792405356, "_note": "Coefficients for the critical cubic spline. T = c[0]*rho^3 + c[1]*rho^2 + c[2]*rho + c[3] with rho in mol/m^3 and T in K", "cL": [ 1.1298449787658047e-09, -1.2403349555998569e-05, 0.04432498442528143, 336.509525023081 ], "cV": [ -1.04204053156705e-09, 7.774300413950925e-06, -0.018161009518633232, 401.01153126933485 ], "rhomolar_max": 3333.3908947283726, "rhomolar_min": 2868.2068492030176 }, "gas_constant": 8.31451, "gas_constant_units": "J/mol/K", "molar_mass": 0.2000312, "molar_mass_units": "kg/mol", "p_max": 60000000, "p_max_units": "Pa", "pseudo_pure": false } ], "INFO": { "2DPNG_URL": "http://www.chemspider.com/ImagesHandler.ashx?id=13846040", "ALIASES": [], "CAS": "115-25-3", "CHEMSPIDER_ID": 13846040, "ENVIRONMENTAL": { "ASHRAE34": "A1", "FH": 0, "GWP100": 10300.0, "GWP20": 7310.0, "GWP500": 14700.0, "HH": 1, "Name": "RC318", "ODP": -1.0, "PH": 2 }, "FORMULA": "C_{4}F_{8}", "INCHI_KEY": "BCCOBQSFUDVTJQ-UHFFFAOYSA-N", "INCHI_STRING": "InChI=1S/C4F8/c5-1(6)2(7,8)4(11,12)3(1,9)10", "NAME": "RC318", "REFPROP_NAME": "RC318", "SMILES": "C1(C(C(C1(F)F)(F)F)(F)F)(F)F" }, "STATES": { "critical": { "T": 388.38, "T_units": "K", "hmolar": 71723.09920314865, "hmolar_units": "J/mol", "p": 2777500.0, "p_units": "Pa", "rhomolar": 3099.38, "rhomolar_units": "mol/m^3", "smolar": 293.25026117992604, "smolar_units": "J/mol/K" }, "triple_liquid": { "T": 233.35, "T_units": "K", "hmolar": 31957.19563750956, "hmolar_units": "J/mol", "p": 19461.056081372997, "p_units": "Pa", "rhomolar": 8645.18328651729, "rhomolar_units": "mol/m^3", "smolar": 168.26971481332566, "smolar_units": "J/mol/K" }, "triple_vapor": { "T": 233.35, "T_units": "K", "hmolar": 57605.81616033167, "hmolar_units": "J/mol", "p": 19461.056081372997, "p_units": "Pa", "rhomolar": 10.156986147247, "rhomolar_units": "mol/m^3", "smolar": 278.18445707047107, "smolar_units": "J/mol/K" } }, "TRANSPORT": { "conductivity": { "BibTeX": "Huber-IECR-2003", "f_int": { "T_reducing": 1.0, "T_reducing_units": "K", "a": [ 0.00135697, -1.11635e-07 ], "t": [ 0, 1 ] }, "psi": { "a": [ 1.5249, -0.147564 ], "rhomolar_reducing": 3099.0, "rhomolar_reducing_units": "mol/m^3", "t": [ 0, 1 ] }, "q_D": 2808318238.622801, "q_D_units": "m", "reference_fluid": "Propane", "type": "ECS" }, "viscosity": { "BibTeX": "Huber-IECR-2003", "epsilon_over_k": 299.76, "epsilon_over_k_units": "K", "psi": { "a": [ 1.21141, -0.0337573, 0.0 ], "rhomolar_reducing": 3099.0, "rhomolar_reducing_units": "mol/m^3", "t": [ 0, 1, 2 ] }, "reference_fluid": "Propane", "sigma_eta": 5.947e-10, "sigma_eta_units": "m", "type": "ECS" } } }