{ "ANCILLARIES": { "hL": { "A": [ -664123.7175636584, 1459.3497016115132, -1.013533748533916, 0.0008915617841225812, -2.80010650328904e-07, -1.900870453538187e-09, 2.3311682127061718e-12, -8.737317322833411e-16 ], "B": [ 1, -0.0012747493319714008 ], "Tmax": 774.9, "Tmin": 311.84000000000003, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 858.3096618553973, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "hLV": { "A": [ 196534.11284032452, -678.561902572562, 0.710835652950705, 0.0016674073628908375, -7.4927358680234445e-06, 1.2094714581473265e-08, -9.565806678297681e-12, 3.0998238582699342e-15 ], "B": [ 1, -0.0012708464938223974 ], "Tmax": 774.9, "Tmin": 311.84000000000003, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 1815.0019798295857, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "pS": { "T_r": 775.0, "Tmax": 774.9999999999982, "Tmin": 311.84, "description": "p'' = pc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 0.1336364373609178, "n": [ 2.1826956545780285, -12.589076401149699, 36.04270465112389, -42.212867821373706, -6.8647834615185905, -3.7675034486843777 ], "reducing_value": 1239000.0, "t": [ 0.748, 0.895, 1.963, 2.132, 6.214, 17.278 ], "type": "pV", "using_tau_r": true }, "rhoL": { "T_r": 775.0, "Tmax": 774.9999999999982, "Tmin": 311.84, "description": "rho' = rhoc*(1+sum(n_i*theta^t_i))", "max_abserror_percentage": 0.5178991761328189, "n": [ 13.378627444826547, -39.36472953109966, 31.2494017978262, -2.5577833084230965, 1973.9623113227108, -8032.142511402829 ], "reducing_value": 794.3, "t": [ 0.623, 0.963, 1.129, 2.549, 16.434, 19.506 ], "type": "rhoLnoexp", "using_tau_r": false }, "rhoV": { "T_r": 775.0, "Tmax": 774.9999999999982, "Tmin": 311.84, "description": "rho'' = rhoc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 1.3802020091006062, "n": [ -10.55735551534245, 7.1258533777053925, -17.33588775317371, 16.369396695687463, -63.311014763601946, 2762.728336814682 ], "reducing_value": 794.3, "t": [ 0.619, 1.153, 2.581, 5.272, 8.552, 19.512 ], "type": "rhoV", "using_tau_r": true }, "sL": { "A": [ -2053.4756735890214, 10.106112309714057, -0.029890752437873543, 6.638619507953338e-05, -9.98367976224863e-08, 9.311156966640383e-11, -4.896461197168943e-14, 1.110466465222388e-17 ], "B": [ 1, -0.001273559922892243 ], "Tmax": 774.9, "Tmin": 311.84000000000003, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 1.1715904230384808, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "sLV": { "A": [ 2558.993133882165, -22.301220276170284, 0.09388318473479099, -0.0002353894029576272, 3.6785674449971657e-07, -3.5226336775346333e-10, 1.8941258099025638e-13, -4.378890371167356e-17 ], "B": [ 1, -0.001268414217889463 ], "Tmax": 774.9, "Tmin": 311.84000000000003, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 2.5310009085741028, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "surface_tension": { "BibTeX": "Mulero-JPCRD-2014", "Tc": 775.0, "a": [ 0.02313, 0.04567 ], "description": "sigma = sum(a_i*(1-T/Tc)^n_i)", "n": [ 3.242, 1.163 ] } }, "EOS": [ { "BibTeX_CP0": "", "BibTeX_EOS": "Huber-EF-2009", "STATES": { "hs_anchor": { "T": 852.5000000000001, "T_units": "K", "hmolar": 231444.7131075797, "hmolar_units": "J/mol", "p": 2648682.036707185, "p_units": "Pa", "rhomolar": 714.87, "rhomolar_units": "mol/m^3", "smolar": 309.9667537153969, "smolar_units": "J/mol/K" }, "reducing": { "T": 775, "T_units": "K", "hmolar": 154672.1806411243, "hmolar_units": "J/mol", "p": 1239000, "p_units": "Pa", "rhomolar": 794.3, "rhomolar_units": "mol/m^3", "smolar": 217.87002734062258, "smolar_units": "J/mol/K" }, "sat_min_liquid": { "T": 311.84000000000003, "T_units": "K", "hmolar": -244795.27791798153, "hmolar_units": "J/mol", "p": 0.006010956044723015, "p_units": "Pa", "rhomolar": 2851.43273206703, "rhomolar_units": "mol/m^3", "smolar": -530.9090477320352, "smolar_units": "J/mol/K" }, "sat_min_vapor": { "T": 311.84000000000003, "T_units": "K", "hmolar": -142879.13675678018, "hmolar_units": "J/mol", "p": 0.006010956044723015, "p_units": "Pa", "rhomolar": 2.3187518826646438e-06, "rhomolar_units": "mol/m^3", "smolar": -204.08863814146196, "smolar_units": "J/mol/K" } }, "T_max": 1000, "T_max_units": "K", "Ttriple": 311.84, "Ttriple_units": "K", "acentric": 1.01756, "acentric_units": "-", "alpha0": [ { "a1": -1, "a2": 0, "type": "IdealGasHelmholtzLead" }, { "a": -1, "type": "IdealGasHelmholtzLogTau" }, { "T0": 298, "Tc": 775, "c": [ 29.72106947981784 ], "t": [ -0.0916606 ], "type": "IdealGasHelmholtzCP0PolyT" }, { "n": [ 33.30818842134534, 49.19097688945251, 56.85291862189204 ], "t": [ 0.7176387096774193, 1.692709677419355, 3.646077419354839 ], "type": "IdealGasHelmholtzPlanckEinstein" }, { "a1": 67.9678895651248, "a2": -28.5988132374956, "reference": "NBP", "type": "IdealGasHelmholtzEnthalpyEntropyOffset" } ], "alphar": [ { "d": [ 4, 1, 1, 2, 3, 1, 3, 2, 2, 7 ], "l": [ 0, 0, 0, 0, 0, 2, 2, 1, 2, 1 ], "n": [ 0.03959635, 2.466654, -3.89595, -0.1167375, 0.04127229, -1.403734, -0.6465264, 1.934675, -1.608124, -0.01113813 ], "t": [ 1, 0.3, 1.25, 1.65, 0.8, 3.1, 3.4, 2.3, 3.8, 1.2 ], "type": "ResidualHelmholtzPower" }, { "beta": [ 0.9, 0.65, 0.75 ], "d": [ 1, 1, 3 ], "epsilon": [ 0.79, 0.9, 0.76 ], "eta": [ 1.1, 1.6, 1.1 ], "gamma": [ 1.14, 0.65, 0.77 ], "n": [ 2.125325, -0.7772671, -0.4183684 ], "t": [ 3.2, 3.8, 3.8 ], "type": "ResidualHelmholtzGaussian" } ], "critical_region_splines": { "T_max": 775.0, "T_min": 774.9998288233945, "_note": "Coefficients for the critical cubic spline. T = c[0]*rho^3 + c[1]*rho^2 + c[2]*rho + c[3] with rho in mol/m^3 and T in K", "cL": [ 0.0, 0.0, -0.00010980425210695775, 775.0872175174486 ], "cV": [ 0.0, 0.0, 0.00010988357503613521, 774.9127194763488 ], "rhomolar_max": 795.8589251075718, "rhomolar_min": 792.7422002522696 }, "gas_constant": 8.314472, "gas_constant_units": "J/mol/K", "molar_mass": 0.29850382, "molar_mass_units": "kg/mol", "p_max": 50000000, "p_max_units": "Pa", "pseudo_pure": false } ], "INFO": { "2DPNG_URL": "http://www.chemspider.com/ImagesHandler.ashx?id=7909", "ALIASES": [ "METHYLSTEARATE", "MSTEARAT" ], "CAS": "112-61-8", "CHEMSPIDER_ID": 7909, "ENVIRONMENTAL": { "ASHRAE34": "UNKNOWN", "FH": 1, "GWP100": -1.0, "GWP20": -1.0, "GWP500": -1.0, "HH": 0, "Name": "MethylStearate", "ODP": -1.0, "PH": 0 }, "FORMULA": "C_{19}H_{38}O_{2}", "INCHI_KEY": "HPEUJPJOZXNMSJ-UHFFFAOYSA-N", "INCHI_STRING": "InChI=1S/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3", "NAME": "MethylStearate", "REFPROP_NAME": "MSTEARAT", "SMILES": "CCCCCCCCCCCCCCCCCC(=O)OC" }, "STATES": { "critical": { "T": 775.0, "T_units": "K", "hmolar": 154600.52639625745, "hmolar_units": "J/mol", "p": 1239000.0, "p_units": "Pa", "rhomolar": 794.3000000000001, "rhomolar_units": "mol/m^3", "smolar": 217.7802653573089, "smolar_units": "J/mol/K" }, "triple_liquid": { "T": 311.84000000000003, "T_units": "K", "hmolar": -244795.27791798153, "hmolar_units": "J/mol", "p": 0.006010956044723015, "p_units": "Pa", "rhomolar": 2851.43273206703, "rhomolar_units": "mol/m^3", "smolar": -530.9090477320352, "smolar_units": "J/mol/K" }, "triple_vapor": { "T": 311.84000000000003, "T_units": "K", "hmolar": -142879.13675678018, "hmolar_units": "J/mol", "p": 0.006010956044723015, "p_units": "Pa", "rhomolar": 2.3187518826646438e-06, "rhomolar_units": "mol/m^3", "smolar": -204.08863814146196, "smolar_units": "J/mol/K" } } }