{ "ANCILLARIES": { "hL": { "A": [ -555923.7476496103, 1988.9004720441635, -3.8828697883380823, 0.006498066081282927, -2.6414286992849214e-06, -1.2406613051178509e-08, 1.9565050482247866e-11, -9.063466300165167e-15 ], "B": [ 1, -0.00157823626904387 ], "Tmax": 628.26, "Tmin": 192.0, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 740.2316236024562, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "hLV": { "A": [ 140300.37991557716, -645.8201782021122, 1.574057938908, -0.002291873734183295, 2.1237884989375074e-07, 5.557200139685212e-09, -8.876616427559064e-12, 4.695144071529041e-15 ], "B": [ 1, -0.0015658337738799302 ], "Tmax": 628.26, "Tmin": 192.0, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 2000.9862864786364, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "pS": { "T_r": 628, "Tmax": 628, "Tmin": 192.0, "description": "p' = pc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 0.025890264817562958, "n": [ -9.6774, 3.973, -3.701, -9.1232, -5.467 ], "reducing_value": 953950.0, "t": [ 1.0, 1.5, 1.8, 3.54, 11.9 ], "type": "pL", "using_tau_r": true }, "rhoL": { "T_r": 628, "Tmax": 628, "Tmin": 192.0, "description": "rho' = rhoc*(1+sum(n_i*theta^t_i))", "max_abserror_percentage": 0.9412402880123238, "n": [ 3.326, 3.889, -2.363, -2.709, 1.325 ], "reducing_value": 700, "t": [ 0.42, 1.46, 0.9, 2.15, 3.15 ], "type": "rhoLnoexp", "using_tau_r": false }, "rhoV": { "T_r": 628, "Tmax": 628, "Tmin": 192.0, "description": "rho'' = rhoc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 1.090311933515531, "n": [ -4.0084, -7.913, -79.392, -28.572, -211.86, -1800.0 ], "reducing_value": 700, "t": [ 0.441, 1.244, 5.88, 3.03, 12.7, 32.0 ], "type": "rhoV", "using_tau_r": false }, "sL": { "A": [ -2459.182489808673, 19.697211510832297, -0.09433254633460193, 0.0003023751794837206, -6.167494570001515e-07, 7.666422783869779e-10, -5.32752780977053e-13, 1.5896595444321927e-16 ], "B": [ 1, -0.0015432674555708556 ], "Tmax": 628.26, "Tmin": 192.0, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 1.8821285898452516, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "sLV": { "A": [ 2630.834730596504, -31.024030584058558, 0.17897791513749084, -0.0006158690760177458, 1.3168272889454566e-06, -1.7172295950411074e-09, 1.2515740377093138e-12, -3.908001064860451e-16 ], "B": [ 1, -0.0015200094399678064 ], "Tmax": 628.26, "Tmin": 192.0, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 4.385165352979042, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "surface_tension": { "BibTeX": "Mulero-JPCRD-2014", "Tc": 628.36, "a": [ 0.03972 ], "description": "sigma = sum(a_i*(1-T/Tc)^n_i)", "n": [ 1.254 ] } }, "EOS": [ { "BibTeX_CP0": "", "BibTeX_EOS": "Thol-FPE-2019-siloxanes", "STATES": { "hs_anchor": { "T": 690.8000000000001, "T_units": "K", "hmolar": 175646.61431745678, "hmolar_units": "J/mol", "p": 1764748.432669481, "p_units": "Pa", "rhomolar": 630.0, "rhomolar_units": "mol/m^3", "smolar": 292.4912447184694, "smolar_units": "J/mol/K" }, "reducing": { "T": 628.0, "T_units": "K", "hmolar": 118489.75283773654, "hmolar_units": "J/mol", "p": 953950.3102368781, "p_units": "Pa", "rhomolar": 700, "rhomolar_units": "mol/m^3", "smolar": 207.60793862370883, "smolar_units": "J/mol/K" }, "sat_min_liquid": { "T": 192.0, "T_units": "K", "hmolar": -215635.74256096038, "hmolar_units": "J/mol", "p": 6.144036026149336e-07, "p_units": "Pa", "rhomolar": 2532.810980780669, "rhomolar_units": "mol/m^3", "smolar": -644.6242957770428, "smolar_units": "J/mol/K" }, "sat_min_vapor": { "T": 192.0, "T_units": "K", "hmolar": -131327.43076670656, "hmolar_units": "J/mol", "p": 6.144036026149336e-07, "p_units": "Pa", "rhomolar": 1.3761360340617266e-10, "rhomolar_units": "mol/m^3", "smolar": -205.51850518196872, "smolar_units": "J/mol/K" } }, "T_max": 673, "T_max_units": "K", "Ttriple": 192, "Ttriple_units": "K", "acentric": 0.7296270902014383, "acentric_units": "-", "alpha0": [ { "a1": 68.11672041661723, "a2": -29.80919654255515, "type": "IdealGasHelmholtzLead" }, { "a": 3.0, "type": "IdealGasHelmholtzLogTau" }, { "n": [ 81.2386, 61.191, 51.1798 ], "t": [ 0.9713375796178344, 3.9808917197452227, 11.94267515923567 ], "type": "IdealGasHelmholtzPlanckEinstein" } ], "alphar": [ { "d": [ 4, 1, 1, 2, 3, 1, 3, 2, 2, 7 ], "l": [ 0, 0, 0, 0, 0, 2, 2, 1, 2, 1 ], "n": [ 0.040674325, 4.4936509, -6.0327468, -1.0842396, 0.65985153, -2.3011802, -1.5022099, 0.5051725, -2.2363839, -0.071582853 ], "t": [ 1.0, 0.37, 0.718, 0.79, 0.59, 2.38, 3.14, 0.62, 2.08, 1.042 ], "type": "ResidualHelmholtzPower" }, { "beta": [ 0.86, 1099.0, 0.95, 0.1, 1.85 ], "d": [ 1, 1, 3, 2, 2 ], "epsilon": [ 0.725, 0.94, 0.546, 0.68, 0.495 ], "eta": [ 1.043, 20.0, 1.08, 0.47, 1.085 ], "gamma": [ 1.357, 1.097, 1.03, 1.02, 0.8 ], "n": [ 4.7053488, -0.774783117, -0.68302991, 0.41657104, -1.1441135 ], "t": [ 0.9, 0.86, 2.06, 0.55, 0.69 ], "type": "ResidualHelmholtzGaussian" } ], "critical_region_splines": { "T_max": 628.36, "T_min": 628.3569917799531, "_note": "Coefficients for the critical cubic spline. T = c[0]*rho^3 + c[1]*rho^2 + c[2]*rho + c[3] with rho in mol/m^3 and T in K", "cL": [ 3.306215390839023e-07, -0.0007009970408251223, 0.49499207140405216, 511.9476683657978 ], "cV": [ -3.977392516737338e-07, 0.0007943503177039177, -0.528334852377581, 745.381333245749 ], "rhomolar_max": 699.3896862967481, "rhomolar_min": 673.1968167336198 }, "gas_constant": 8.3144598, "gas_constant_units": "J/mol/K", "molar_mass": 0.384839, "molar_mass_units": "kg/mol", "p_max": 125000000, "p_max_units": "Pa", "pseudo_pure": false }, { "BibTeX_CP0": "", "BibTeX_EOS": "Colonna-FPE-2008", "STATES": { "hs_anchor": { "T": 691.196, "T_units": "K", "hmolar": 176878.41034321528, "hmolar_units": "J/mol", "p": 1729604.878920523, "p_units": "Pa", "rhomolar": 617.2183464299993, "rhomolar_units": "mol/m^3", "smolar": 294.5855544751468, "smolar_units": "J/mol/K" }, "reducing": { "T": 628.36, "T_units": "K", "hmolar": 119621.6599953922, "hmolar_units": "J/mol", "p": 945000, "p_units": "Pa", "rhomolar": 685.7981626999992, "rhomolar_units": "mol/m^3", "smolar": 209.58322302452075, "smolar_units": "J/mol/K" }, "sat_min_liquid": { "T": 192.0, "T_units": "K", "hmolar": -220741.96966016272, "hmolar_units": "J/mol", "p": 5.923973188262137e-07, "p_units": "Pa", "rhomolar": 2541.798960773629, "rhomolar_units": "mol/m^3", "smolar": -668.7840897655553, "smolar_units": "J/mol/K" }, "sat_min_vapor": { "T": 192.0, "T_units": "K", "hmolar": -135731.9040701164, "hmolar_units": "J/mol", "p": 2.0577476435306466e-07, "p_units": "Pa", "rhomolar": 1.2890097703756486e-10, "rhomolar_units": "mol/m^3", "smolar": -226.02333148406316, "smolar_units": "J/mol/K" } }, "T_max": 673, "T_max_units": "K", "Ttriple": 192, "Ttriple_units": "K", "acentric": 0.722, "acentric_units": "-", "alpha0": [ { "a1": -7.835183629103501, "a2": 8.367692358068204, "type": "IdealGasHelmholtzLead" }, { "a": -1, "type": "IdealGasHelmholtzLogTau" }, { "T0": 503.022623775204, "Tc": 628.36, "c": [ 55.71009199381512, 115.1245683430048, 2117.1, 88.79697953159261, 908.5 ], "type": "IdealGasHelmholtzCP0AlyLee" }, { "a1": 10.9232086184983, "a2": -6.79248521719259, "reference": "NBP", "type": "IdealGasHelmholtzEnthalpyEntropyOffset" } ], "alphar": [ { "d": [ 1, 1, 1, 2, 3, 7, 2, 5, 1, 4, 3, 4 ], "l": [ 0, 0, 0, 0, 0, 0, 1, 1, 2, 2, 3, 3 ], "n": [ 1.20540386, -2.42914797, 0.69016432, -0.69268041, 0.18506046, 0.00031161436, 0.99862519, 0.074229034, -0.80259136, -0.20865337, -0.036461791, 0.019174051 ], "t": [ 0.25, 1.125, 1.5, 1.375, 0.25, 0.875, 0.625, 1.75, 3.625, 3.625, 14.5, 12 ], "type": "ResidualHelmholtzPower" } ], "critical_region_splines": { "T_max": 628.36, "T_min": 628.3569917799531, "_note": "Coefficients for the critical cubic spline. T = c[0]*rho^3 + c[1]*rho^2 + c[2]*rho + c[3] with rho in mol/m^3 and T in K", "cL": [ 3.306215390839023e-07, -0.0007009970408251223, 0.49499207140405216, 511.9476683657978 ], "cV": [ -3.977392516737338e-07, 0.0007943503177039177, -0.528334852377581, 745.381333245749 ], "rhomolar_max": 699.3896862967481, "rhomolar_min": 673.1968167336198 }, "gas_constant": 8.314472, "gas_constant_units": "J/mol/K", "molar_mass": 0.384839, "molar_mass_units": "kg/mol", "p_max": 30000000, "p_max_units": "Pa", "pseudo_pure": false } ], "INFO": { "2DPNG_URL": "http://www.chemspider.com/ImagesHandler.ashx?id=8521", "ALIASES": [ "Dodecamethylpentasiloxane", "DODECAMETHYLPENTASILOXANE" ], "CAS": "141-63-9", "CHEMSPIDER_ID": 8521, "ENVIRONMENTAL": { "ASHRAE34": "UNKNOWN", "FH": 2, "GWP100": -1.0, "GWP20": -1.0, "GWP500": -1.0, "HH": 1, "Name": "MD3M", "ODP": -1.0, "PH": 0 }, "FORMULA": "C_{12}H_{36}O_{4}Si_{5}", "INCHI_KEY": "FBZANXDWQAVSTQ-UHFFFAOYSA-N", "INCHI_STRING": "InChI=1S/C12H36O4Si5/c1-17(2,3)13-19(7,8)15-21(11,12)16-20(9,10)14-18(4,5)6/h1-12H3", "NAME": "MD3M", "REFPROP_NAME": "MD3M", "SMILES": "C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C" }, "STATES": { "critical": { "T": 628.0, "T_units": "K", "hmolar": 118489.75283773654, "hmolar_units": "J/mol", "p": 953950.3102368781, "p_units": "Pa", "rhomolar": 700, "rhomolar_units": "mol/m^3", "smolar": 207.60793862370883, "smolar_units": "J/mol/K" }, "triple_liquid": { "T": 192.0, "T_units": "K", "hmolar": -215635.74256096038, "hmolar_units": "J/mol", "p": 6.144036026149336e-07, "p_units": "Pa", "rhomolar": 2532.810980780669, "rhomolar_units": "mol/m^3", "smolar": -644.6242957770428, "smolar_units": "J/mol/K" }, "triple_vapor": { "T": 192.0, "T_units": "K", "hmolar": -131327.43076670656, "hmolar_units": "J/mol", "p": 6.144036026149336e-07, "p_units": "Pa", "rhomolar": 1.3761360340617266e-10, "rhomolar_units": "mol/m^3", "smolar": -205.51850518196872, "smolar_units": "J/mol/K" } } }