{ "ANCILLARIES": { "hL": { "A": [ -107540.79803473793, -292.4566623763397, 4.538257444202257, -0.018797692747012335, 4.525355464110805e-05, -6.555616084744656e-08, 5.221761366188193e-11, -1.7681399637952474e-14 ], "B": [ 1, -0.0016046989166024369 ], "Tmax": 616.068, "Tmin": 286.40000000000003, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 387.799422821834, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "hLV": { "A": [ -44247.33836627066, 1738.0283004320615, -14.427055037714778, 0.06084819947056816, -0.0001503566059359697, 2.1942410075154895e-07, -1.7562408102729384e-10, 5.966237973623086e-14 ], "B": [ 1, -0.0016023396510306373 ], "Tmax": 616.068, "Tmin": 286.40000000000003, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 891.2862698051508, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "pS": { "T_r": 616.168, "Tmax": 616.1679999999988, "Tmin": 286.4, "description": "p'' = pc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 0.01797164382182359, "n": [ -6.922693475136246, -18.802630900264262, 19.915248950746882, -4.280178590137178, 2.8220366354716795, -4.222238595872705 ], "reducing_value": 3531500.0, "t": [ 1.005, 1.232, 1.271, 2.955, 4.359, 5.234 ], "type": "pV", "using_tau_r": true }, "rhoL": { "T_r": 616.168, "Tmax": 616.1679999999988, "Tmin": 286.4, "description": "rho' = rhoc*(1+sum(n_i*theta^t_i))", "max_abserror_percentage": 0.2129362347877306, "n": [ 0.056706544072533206, 2.34587948519851, 0.15533070291116807, 26.985091589824126, -1912.6053845039978, 2496.549996560909 ], "reducing_value": 2693.92, "t": [ 0.097, 0.41, 0.617, 6.974, 11.02, 11.7 ], "type": "rhoLnoexp", "using_tau_r": false }, "rhoV": { "T_r": 616.168, "Tmax": 616.1679999999988, "Tmin": 286.4, "description": "rho'' = rhoc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 0.36870096485427384, "n": [ -140.15017077353872, 166.06393987589922, -51.309204629695124, 20.70756142612646, -2.7902945630383784, -2.9836742600472896 ], "reducing_value": 2693.92, "t": [ 0.395, 0.408, 0.546, 0.651, 2.515, 3.948 ], "type": "rhoV", "using_tau_r": true }, "sL": { "A": [ -446.2078500391623, 1.6418781585786664, -0.0009157552225088569, -8.517903640464713e-06, 3.302875635689916e-08, -5.888986929730629e-11, 5.299117367169746e-14, -1.9452406301736498e-17 ], "B": [ 1, -0.0016049149755695132 ], "Tmax": 616.068, "Tmin": 286.40000000000003, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 0.6264204032539347, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "sLV": { "A": [ 922.1705922603377, -7.917699839949346, 0.031492938690717745, -6.849984318081641e-05, 7.486748655396947e-08, -1.7701545072209644e-11, -3.794283119001315e-14, 2.613751711120142e-17 ], "B": [ 1, -0.0016022189345725228 ], "Tmax": 616.068, "Tmin": 286.40000000000003, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 1.4528688802748215, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "surface_tension": { "BibTeX": "Mulero-JPCRD-2014", "Tc": 616.168, "a": [ 0.0619 ], "description": "sigma = sum(a_i*(1-T/Tc)^n_i)", "n": [ 1.21 ] } }, "EOS": [ { "BibTeX_CP0": "", "BibTeX_EOS": "Zhou-JPCRD-2012", "STATES": { "hs_anchor": { "T": 677.7848, "T_units": "K", "hmolar": 79390.53700947788, "hmolar_units": "J/mol", "p": 6002755.9044682635, "p_units": "Pa", "rhomolar": 2424.5280000000002, "rhomolar_units": "mol/m^3", "smolar": 142.9801151738155, "smolar_units": "J/mol/K" }, "reducing": { "T": 616.168, "T_units": "K", "hmolar": 60968.9572954206, "hmolar_units": "J/mol", "p": 3531500, "p_units": "Pa", "rhomolar": 2693.92, "rhomolar_units": "mol/m^3", "smolar": 115.96592591896388, "smolar_units": "J/mol/K" }, "sat_min_liquid": { "T": 286.40000000000003, "T_units": "K", "hmolar": -25111.0819148747, "hmolar_units": "J/mol", "p": 580.08500237559, "p_units": "Pa", "rhomolar": 8165.004739624553, "rhomolar_units": "mol/m^3", "smolar": -72.20997230967596, "smolar_units": "J/mol/K" }, "sat_min_vapor": { "T": 286.40000000000003, "T_units": "K", "hmolar": 17947.385399163548, "hmolar_units": "J/mol", "p": 580.08500237559, "p_units": "Pa", "rhomolar": 0.24384856357118545, "rhomolar_units": "mol/m^3", "smolar": 78.13377271225741, "smolar_units": "J/mol/K" } }, "T_max": 700, "T_max_units": "K", "Ttriple": 286.4, "Ttriple_units": "K", "acentric": 0.324, "acentric_units": "-", "alpha0": [ { "a1": 5.9815241, "a2": -0.52477835, "type": "IdealGasHelmholtzLead" }, { "a": 4.2430504, "type": "IdealGasHelmholtzLogTau" }, { "n": [ 5.2291378, 19.549862, 16.656178, 5.9390291 ], "t": [ 0.6718946780748107, 2.038405110294595, 4.299152179275782, 10.84282208748263 ], "type": "IdealGasHelmholtzPlanckEinstein" } ], "alphar": [ { "d": [ 5, 1, 4, 1, 1, 2, 3, 1, 3, 2, 2, 7 ], "l": [ 0, 0, 0, 0, 0, 0, 0, 2, 2, 1, 2, 1 ], "n": [ 0.0010786811, -0.103161822, 0.0421544125, 1.47865376, -2.4266, -0.46575193, 0.190290995, -1.06376565, -0.209934069, 1.25159879, -0.951328356, -0.0269980032 ], "t": [ 1, 0.83, 0.83, 0.281, 0.932, 1.1, 0.443, 2.62, 2.5, 1.2, 3, 0.778 ], "type": "ResidualHelmholtzPower" }, { "beta": [ 2.445, 1.483, 4.971, 413 ], "d": [ 1, 1, 3, 3 ], "epsilon": [ 0.54944, 0.7234, 0.4926, 0.8459 ], "eta": [ 1.179, 1.065, 1.764, 13.675 ], "gamma": [ 1.267, 0.4242, 0.864, 1.1465 ], "n": [ 1.3710318, -0.494160616, -0.0724317468, -3.69464746 ], "t": [ 1.13, 4.5, 2.2, 2 ], "type": "ResidualHelmholtzGaussian" } ], "critical_region_splines": { "T_max": 616.168, "T_min": 616.1676135546516, "_note": "Coefficients for the critical cubic spline. T = c[0]*rho^3 + c[1]*rho^2 + c[2]*rho + c[3] with rho in mol/m^3 and T in K", "cL": [ 0.0, 0.0, -1.1132572209863086e-05, 616.1979902589276 ], "cV": [ 0.0, 0.0, 8.534367674093475e-06, 616.1450090962354 ], "rhomolar_max": 2728.633033173596, "rhomolar_min": 2648.6389243240715 }, "gas_constant": 8.314472, "gas_constant_units": "J/mol/K", "molar_mass": 0.106165, "molar_mass_units": "kg/mol", "p_max": 200000000, "p_max_units": "Pa", "pseudo_pure": false } ], "INFO": { "2DPNG_URL": "http://www.chemspider.com/ImagesHandler.ashx?id=7521", "ALIASES": [ "pXylene", "p-xylene", "P-XYLENE", "PC8H10" ], "CAS": "106-42-3", "CHEMSPIDER_ID": 7521, "FORMULA": "C_{8}H_{10}", "INCHI_KEY": "URLKBWYHVLBVBO-UHFFFAOYSA-N", "INCHI_STRING": "InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3", "NAME": "p-Xylene", "REFPROP_NAME": "PXYLENE", "SMILES": "Cc1ccc(cc1)C" }, "STATES": { "critical": { "T": 616.168, "T_units": "K", "hmolar": 60950.0992383199, "hmolar_units": "J/mol", "p": 3531500.0, "p_units": "Pa", "rhomolar": 2693.92, "rhomolar_units": "mol/m^3", "smolar": 115.93691839044982, "smolar_units": "J/mol/K" }, "triple_liquid": { "T": 286.40000000000003, "T_units": "K", "hmolar": -25111.0819148747, "hmolar_units": "J/mol", "p": 580.08500237559, "p_units": "Pa", "rhomolar": 8165.004739624553, "rhomolar_units": "mol/m^3", "smolar": -72.20997230967596, "smolar_units": "J/mol/K" }, "triple_vapor": { "T": 286.40000000000003, "T_units": "K", "hmolar": 17947.385399163548, "hmolar_units": "J/mol", "p": 580.08500237559, "p_units": "Pa", "rhomolar": 0.24384856357118545, "rhomolar_units": "mol/m^3", "smolar": 78.13377271225741, "smolar_units": "J/mol/K" } }, "TRANSPORT": { "conductivity": { "BibTeX": "Mylona-JPCRD-2014-xylenes", "critical": { "GAMMA": 0.056, "R0": 1.03, "gamma": 1.239, "qD": 1408450704.225352, "type": "simplified_Olchowy_Sengers", "zeta0": 2.35e-10 }, "dilute": { "A": [ -0.00388568, 0.0294648, -0.0815299, 0.07715340000000001, 0.00755487, -0.0038897, 0.00040689199999999995 ], "B": [ 0.00404188, -0.424893, 1 ], "T_reducing": 616.168, "T_reducing_units": "K", "m": [ 0, 1, 2 ], "n": [ 0, 1, 2, 3, 4, 5, 6 ], "type": "ratio_of_polynomials" }, "residual": { "B": [ -0.101022, 0.107531, 0.224828, -0.205499, -0.1591, 0.150348, 0.049949, -0.0502584, -0.00562422, 0.00644051 ], "T_reducing": 616.168, "T_reducing_units": "K", "d": [ 1, 1, 2, 2, 3, 3, 4, 4, 5, 5 ], "rhomass_reducing": 286.0, "rhomass_reducing_units": "kg/m^3", "t": [ 0, -1, 0, -1, 0, -1, 0, -1, 0, -1 ], "type": "polynomial" } }, "viscosity": { "BibTeX": "Balogun-JPCRD-2015-pxylene", "hardcoded": "p-Xylene" } } }