{ "ANCILLARIES": { "hL": { "A": [ -41857.97972679445, 141.51816109881761, 0.6931578673650347, -0.006888785224971558, 2.8878465435715204e-05, -7.004419976873312e-08, 9.341103311671954e-11, -5.445775954182144e-14 ], "B": [ 1, -0.0026681328507758765 ], "Tmax": 369.195, "Tmin": 115.78069806980699, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 286.05700095637803, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "hLV": { "A": [ 25944.824336149803, 98.60594668315983, -3.4186210532309906, 0.027797695968511744, -0.00012340567080756899, 3.163174301636938e-07, -4.4161912008633985e-10, 2.633224160837037e-13 ], "B": [ 1, -0.0026723196618635954 ], "Tmax": 369.195, "Tmin": 115.78069806980699, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 631.5726476637724, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "pS": { "T_r": 369.295, "Tmax": 369.2949999999993, "Tmin": 115.73000000000002, "description": "p'' = pc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 0.01948277890697625, "n": [ -7.2670371701641265, 1.2860929616388512, -0.10790119794275199, -0.989473291657183, -2.9393096353041623, 0.488431917326884 ], "reducing_value": 4990000.0, "t": [ 0.999, 1.272, 1.692, 2.74, 4.539, 15.876 ], "type": "pV", "using_tau_r": true }, "rhoL": { "T_r": 369.295, "Tmax": 369.2949999999993, "Tmin": 115.73000000000002, "description": "rho' = rhoc*(1+sum(n_i*theta^t_i))", "max_abserror_percentage": 0.3314470249190071, "n": [ 1.854194439375902, 0.5825631843499427, 3.174073656022523, -10.117473443656856, 12.021023952475513, -39.819978547168276 ], "reducing_value": 6058.220000000001, "t": [ 0.351, 0.588, 3.365, 5.022, 6.849, 16.221 ], "type": "rhoLnoexp", "using_tau_r": false }, "rhoV": { "T_r": 369.295, "Tmax": 369.2949999999993, "Tmin": 115.73000000000002, "description": "rho'' = rhoc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 0.6907353964608065, "n": [ -1.7899191799956613, -1.332183889152018, -2.5626654031276335, -5.6750215901718954, 0.6059879695747222, 3.499235901423112 ], "reducing_value": 6058.220000000001, "t": [ 0.343, 0.528, 1.104, 4.839, 7.214, 11.11 ], "type": "rhoV", "using_tau_r": true }, "sL": { "A": [ -304.79685263410215, 3.462158342815594, -0.022355773437643323, 0.00010187313921197813, -3.1635225765977416e-07, 6.299115847668061e-10, -7.253278756017329e-13, 3.643150044447599e-16 ], "B": [ 1, -0.0026604613500051714 ], "Tmax": 369.195, "Tmin": 115.78069806980699, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 0.8420345957661883, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "sLV": { "A": [ 1112.5110853131198, -20.350375820965425, 0.18597468829028563, -0.0010274725676266167, 3.5553872767248907e-06, -7.551168482973773e-09, 9.011861778384509e-12, -4.625458080751607e-15 ], "B": [ 1, -0.0026482483141540255 ], "Tmax": 369.195, "Tmin": 115.78069806980699, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 2.1747460996629213, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "surface_tension": { "BibTeX": "Mulero-JPCRD-2012", "Tc": 369.295, "a": [ 3.0587, -2.99856 ], "description": "sigma = sum(a_i*(1-T/Tc)^n_i)", "n": [ 1.41809, 1.42291 ] } }, "EOS": [ { "BibTeX_CP0": "", "BibTeX_EOS": "Kamei-IJT-1995", "STATES": { "hs_anchor": { "T": 406.22450000000003, "T_units": "K", "hmolar": 35750.23312835588, "hmolar_units": "J/mol", "p": 8208023.276403122, "p_units": "Pa", "rhomolar": 5452.398000000001, "rhomolar_units": "mol/m^3", "smolar": 138.02512323622946, "smolar_units": "J/mol/K" }, "reducing": { "T": 369.295, "T_units": "K", "hmolar": 31727.891687101688, "hmolar_units": "J/mol", "p": 4990000, "p_units": "Pa", "rhomolar": 6058.220000000001, "rhomolar_units": "mol/m^3", "smolar": 129.0763411176551, "smolar_units": "J/mol/K" }, "sat_min_liquid": { "T": 115.73, "T_units": "K", "hmolar": 2559.4875614060247, "hmolar_units": "J/mol", "p": 0.3794747321972858, "p_units": "Pa", "rhomolar": 19906.534060848982, "rhomolar_units": "mol/m^3", "smolar": 6.581294309972051, "smolar_units": "J/mol/K" }, "sat_min_vapor": { "T": 115.73, "T_units": "K", "hmolar": 28768.747001737593, "hmolar_units": "J/mol", "p": 0.3794747321972858, "p_units": "Pa", "rhomolar": 0.00039436211244907326, "rhomolar_units": "mol/m^3", "smolar": 233.050312200087, "smolar_units": "J/mol/K" } }, "T_max": 550, "T_max_units": "K", "Ttriple": 115.73, "Ttriple_units": "K", "acentric": 0.22082, "acentric_units": "-", "alpha0": [ { "a1": -15.86079407387002, "a2": 11.68367319965483, "type": "IdealGasHelmholtzLead" }, { "a": -1, "type": "IdealGasHelmholtzLogTau" }, { "T0": 273.15, "Tc": 369.295, "cp_over_R": 4.00526140446, "type": "IdealGasHelmholtzCP0Constant" }, { "T0": 273.15, "Tc": 369.295, "c": [ 0.000120662553 ], "t": [ 1 ], "type": "IdealGasHelmholtzCP0PolyT" }, { "n": [ 1, 1, 1, 1, 1, 1, 1, 1, 1 ], "t": [ 11.78545471777306, 5.240144329059424, 5.111575732138263, 4.589509308276581, 4.34795618678834, 3.147982615524174, 2.322026780757931, 1.640223615266927, 1.437630674663887 ], "type": "IdealGasHelmholtzPlanckEinstein" }, { "a1": 1.17703822802506, "a2": -0.622087185111783, "reference": "IIR", "type": "IdealGasHelmholtzEnthalpyEntropyOffset" } ], "alphar": [ { "d": [ 1, 1, 1, 1, 1, 1, 1, 2, 2, 2, 3, 3, 4, 5, 6, 7, 7, 7, 8, 8, 2, 2, 2, 2, 3, 4, 4, 4, 4, 6, 6, 6, 8, 8, 8 ], "l": [ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 2, 2, 2, 2, 3, 2, 2, 2, 4, 2, 2, 4, 2, 2, 4 ], "n": [ 0.0695645445236, 25.2275419999, -202.351148311, 350.063090302, -223.134648863, 48.8345904592, 0.0108874958556, 0.590315073614, -0.689043767432, 0.284224445844, 0.125436457897, -0.0113338666416, -0.063138895917, 0.00974021015232, -0.000408406844722, 0.00074194877357, 0.000315912525922, 8.76009723338e-06, -0.000110343340301, -7.05323356879e-05, 0.23585073151, -0.192640494729, 0.00375218008557, -4.48926036678e-05, 0.0198120520635, -0.0356958425255, 0.0319594161562, 2.60284291078e-06, -0.00897629021967, 0.0345482791645, -0.00411831711251, 0.00567428536529, -0.00563368989908, 0.00191384919423, -0.00178930036389 ], "t": [ -1, 1.75, 2.25, 2.5, 2.75, 3, 5.5, 1.5, 1.75, 3.5, 1, 4.5, 1.5, 0.5, 4.5, 1, 4, 5, -0.5, 3.5, 5, 7, 12, 15, 3.5, 3.5, 8, 15, 25, 3, 9, 19, 2, 7, 13 ], "type": "ResidualHelmholtzPower" } ], "critical_region_splines": { "T_max": 369.295, "T_min": 369.2949627574784, "_note": "Coefficients for the critical cubic spline. T = c[0]*rho^3 + c[1]*rho^2 + c[2]*rho + c[3] with rho in mol/m^3 and T in K", "cL": [ 0.0, 0.0, -2.3424000852304404e-06, 369.3091907750444 ], "cV": [ 0.0, 0.0, 2.2501789373208953e-06, 369.28136792095836 ], "rhomolar_max": 6074.119299984461, "rhomolar_min": 6041.669084436526 }, "gas_constant": 8.31451, "gas_constant_units": "J/mol/K", "molar_mass": 0.086468, "molar_mass_units": "kg/mol", "p_max": 60000000, "p_max_units": "Pa", "pseudo_pure": false } ], "INFO": { "2DPNG_URL": "http://www.chemspider.com/ImagesHandler.ashx?id=6132", "ALIASES": [], "CAS": "75-45-6", "CHEMSPIDER_ID": 6132, "ENVIRONMENTAL": { "ASHRAE34": "A1", "FH": 1, "GWP100": 1810.0, "GWP20": 5160.0, "GWP500": 549.0, "HH": 1, "Name": "R22", "ODP": 0.05, "PH": 0 }, "FORMULA": "C_{1}Cl_{1}F_{2}H_{1}", "INCHI_KEY": "VOPWNXZWBYDODV-UHFFFAOYAQ", "INCHI_STRING": "InChI=1/CHClF2/c2-1(3)4/h1H", "NAME": "R22", "REFPROP_NAME": "R22", "SMILES": "C(F)(F)Cl" }, "STATES": { "critical": { "T": 369.295, "T_units": "K", "hmolar": 31724.726286601024, "hmolar_units": "J/mol", "p": 4990000.0, "p_units": "Pa", "rhomolar": 6058.220000000001, "rhomolar_units": "mol/m^3", "smolar": 129.06936248168947, "smolar_units": "J/mol/K" }, "triple_liquid": { "T": 115.73, "T_units": "K", "hmolar": 2559.4875614060247, "hmolar_units": "J/mol", "p": 0.3794747321972858, "p_units": "Pa", "rhomolar": 19906.534060848982, "rhomolar_units": "mol/m^3", "smolar": 6.581294309972051, "smolar_units": "J/mol/K" }, "triple_vapor": { "T": 115.73, "T_units": "K", "hmolar": 28768.747001737593, "hmolar_units": "J/mol", "p": 0.3794747321972858, "p_units": "Pa", "rhomolar": 0.00039436211244907326, "rhomolar_units": "mol/m^3", "smolar": 233.050312200087, "smolar_units": "J/mol/K" } }, "TRANSPORT": { "conductivity": { "BibTeX": "McLinden-IJR-2000", "f_int": { "T_reducing": 1.0, "T_reducing_units": "K", "a": [ 0.00077817, 1.2536e-06 ], "t": [ 0, 1 ] }, "psi": { "a": [ 1.075, -0.038574 ], "rhomolar_reducing": 6058.220000000001, "rhomolar_reducing_units": "mol/m^3", "t": [ 0, 1 ] }, "q_D": 1999999999.9999998, "q_D_units": "m", "reference_fluid": "R134a", "type": "ECS" }, "viscosity": [ { "BibTeX": "Bell-PURDUE-2016-ETA", "C": 0.6682, "c_liq": [ 0.6100913843, 0.4508958312, -0.017063, 0.000564 ], "c_vap": [ 0.0, 1.2, -0.308598, 0.035317 ], "rhosr_critical": -72911.40129607519, "type": "rhosr-CS", "x_crossover": 2 }, { "BibTeX": "Klein-IJR-1997", "epsilon_over_k": 284.72, "epsilon_over_k_units": "K", "psi": { "a": [ 1.106, -0.0491 ], "rhomolar_reducing": 6058.220000000001, "rhomolar_reducing_units": "mol/m^3", "t": [ 0, 1 ] }, "reference_fluid": "R134a", "sigma_eta": 4.666e-10, "sigma_eta_units": "m", "type": "ECS" } ] } }