{ "ANCILLARIES": { "hL": { "A": [ -146897.81533096946, 344.41400457664463, 0.1453259262301363, -0.002180442283885708, 7.993651920520039e-06, -1.5990604412244245e-08, 1.5996223830909462e-11, -6.467501453564422e-15 ], "B": [ 1, -0.001601636904637735 ], "Tmax": 616.79, "Tmin": 225.3, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 471.2176067210821, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "hLV": { "A": [ 35834.68484755282, 395.91925054275566, -4.823277167013627, 0.022935076468746162, -6.128991479248157e-05, 9.507838885634794e-08, -8.022562080947331e-11, 2.8664747813587667e-14 ], "B": [ 1, -0.0016008021938757782 ], "Tmax": 616.79, "Tmin": 225.3, "_note": "coefficients are in increasing order; input in K, output in J/mol; value is enthalpy minus hs_anchor enthalpy", "max_abs_error": 1091.2923614028264, "max_abs_error_units": "J/mol", "type": "rational_polynomial" }, "pS": { "T_r": 616.89, "Tmax": 616.889999999999, "Tmin": 225.3, "description": "p'' = pc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 0.011448642296418843, "n": [ 16.462027456851953, -23.613777199675944, 2.341442695879726, -2.172024345368255, -3.2181295708930437, -1.3831666730887018 ], "reducing_value": 3534600.0, "t": [ 0.932, 0.948, 1.792, 2.065, 3.546, 6.706 ], "type": "pV", "using_tau_r": true }, "rhoL": { "T_r": 616.89, "Tmax": 616.889999999999, "Tmin": 225.3, "description": "rho' = rhoc*(1+sum(n_i*theta^t_i))", "max_abserror_percentage": 0.020112847012532242, "n": [ 1.1684596769577356, -11.068326498191913, 239.3508126040545, -235.63804962721167, 9.613596620997477, -0.5483150812209723 ], "reducing_value": 2665.0, "t": [ 0.262, 0.821, 0.965, 0.987, 1.389, 2.441 ], "type": "rhoLnoexp", "using_tau_r": false }, "rhoV": { "T_r": 616.89, "Tmax": 616.889999999999, "Tmin": 225.3, "description": "rho'' = rhoc*exp(Tc/T*sum(n_i*theta^t_i))", "max_abserror_percentage": 1.2356743428769246, "n": [ -0.07808901638966609, -3.249336299391575, -5.108399766940012, 68.16749399679267, -70.92698933428645, 1.963032740598388 ], "reducing_value": 2665.0, "t": [ 0.054, 0.43, 1.276, 2.589, 2.714, 8.624 ], "type": "rhoV", "using_tau_r": true }, "sL": { "A": [ -557.9436198993125, 3.475322070919154, -0.013700250840800057, 4.033180528086598e-05, -7.760152386918995e-08, 8.980311823401099e-11, -5.688726478216235e-14, 1.4991126312261798e-17 ], "B": [ 1, -0.0015990474967822958 ], "Tmax": 616.79, "Tmin": 225.3, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 0.8109431102829916, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "sLV": { "A": [ 1179.5187555549012, -12.188475115677031, 0.061841933581330014, -0.00018762998416637917, 3.534095610924074e-07, -4.051936706067856e-10, 2.587351134182912e-13, -7.023298643882691e-17 ], "B": [ 1, -0.0015961421755147029 ], "Tmax": 616.79, "Tmin": 225.3, "_note": "coefficients are in increasing order; input in K, output in J/mol/K; value is entropy minus hs_anchor entropy", "max_abs_error": 1.951173757817851, "max_abs_error_units": "J/mol/K", "type": "rational_polynomial" }, "surface_tension": { "BibTeX": "Mulero-JPCRD-2014", "Tc": 616.89, "a": [ 0.06445 ], "description": "sigma = sum(a_i*(1-T/Tc)^n_i)", "n": [ 1.256 ] } }, "EOS": [ { "BibTeX_CP0": "", "BibTeX_EOS": "Zhou-JPCRD-2012", "STATES": { "hs_anchor": { "T": 678.5790000000001, "T_units": "K", "hmolar": 79685.48961089761, "hmolar_units": "J/mol", "p": 5967003.886387356, "p_units": "Pa", "rhomolar": 2398.5, "rhomolar_units": "mol/m^3", "smolar": 143.39618875716516, "smolar_units": "J/mol/K" }, "reducing": { "T": 616.89, "T_units": "K", "hmolar": 61578.15976998018, "hmolar_units": "J/mol", "p": 3534600, "p_units": "Pa", "rhomolar": 2665, "rhomolar_units": "mol/m^3", "smolar": 116.89438820518606, "smolar_units": "J/mol/K" }, "sat_min_liquid": { "T": 225.3, "T_units": "K", "hmolar": -35540.80751806576, "hmolar_units": "J/mol", "p": 3.123267555690047, "p_units": "Pa", "rhomolar": 8676.649495127216, "rhomolar_units": "mol/m^3", "smolar": -112.89125739493811, "smolar_units": "J/mol/K" }, "sat_min_vapor": { "T": 225.3, "T_units": "K", "hmolar": 11580.44946376125, "hmolar_units": "J/mol", "p": 3.1232675232328466, "p_units": "Pa", "rhomolar": 0.0016673174152434798, "rhomolar_units": "mol/m^3", "smolar": 96.25768607417126, "smolar_units": "J/mol/K" } }, "T_max": 700, "T_max_units": "K", "Ttriple": 225.3, "Ttriple_units": "K", "acentric": 0.326, "acentric_units": "-", "alpha0": [ { "a1": 12.652887, "a2": 0.45975624, "type": "IdealGasHelmholtzLead" }, { "a": 1.169909, "type": "IdealGasHelmholtzLogTau" }, { "n": [ 4.44312, 2.862794, 24.83298, 16.26077 ], "t": [ 0.259365527079382, 0.3079965634067662, 2.160839047480102, 5.667136766684498 ], "type": "IdealGasHelmholtzPlanckEinstein" }, { "a1": -7.79365691983003e-08, "a2": -0.919512475110122, "reference": "NBP", "type": "IdealGasHelmholtzEnthalpyEntropyOffset" } ], "alphar": [ { "d": [ 8, 4, 1, 1, 2, 3, 1, 3, 2, 2, 7 ], "l": [ 0, 0, 0, 0, 0, 0, 2, 2, 1, 2, 1 ], "n": [ 1.2791017e-05, 0.041063111, 1.505996, -2.3095875, -0.46969, 0.171031, -1.001728, -0.3945766, 0.6970578, -0.3002876, -0.024311 ], "t": [ 1, 0.91, 0.231, 0.772, 1.205, 0.323, 2.7, 3.11, 0.768, 4.1, 0.818 ], "type": "ResidualHelmholtzPower" }, { "beta": [ 1.66, 1.9354, 1.0323, 78 ], "d": [ 1, 1, 3, 3 ], "epsilon": [ 0.713, 0.9169, 0.6897, 0.7245 ], "eta": [ 1.0244, 1.3788, 0.9806, 6.3563 ], "gamma": [ 1.1013, 0.6515, 0.4975, 1.26 ], "n": [ 0.815488, -0.330647, -0.123393, -0.54661 ], "t": [ 2, 2.9, 3.83, 0.5 ], "type": "ResidualHelmholtzGaussian" } ], "critical_region_splines": { "T_max": 616.89, "T_min": 616.8899937003947, "_note": "Coefficients for the critical cubic spline. T = c[0]*rho^3 + c[1]*rho^2 + c[2]*rho + c[3] with rho in mol/m^3 and T in K", "cL": [ 0.0, 0.0, -2.3188404050194553e-07, 616.8906179709679 ], "cV": [ 0.0, 0.0, 2.1811620743863226e-07, 616.8894187203072 ], "rhomolar_max": 2692.1670497921914, "rhomolar_min": 2636.1181240342576 }, "gas_constant": 8.314472, "gas_constant_units": "J/mol/K", "molar_mass": 0.106165, "molar_mass_units": "kg/mol", "p_max": 200000000, "p_max_units": "Pa", "pseudo_pure": false } ], "INFO": { "2DPNG_URL": "http://www.chemspider.com/ImagesHandler.ashx?id=7641", "ALIASES": [ "mXylene", "m-xylene", "M-XYLENE" ], "CAS": "108-38-3", "CHEMSPIDER_ID": 7641, "FORMULA": "C_{8}H_{10}", "INCHI_KEY": "IVSZLXZYQVIEFR-UHFFFAOYAX", "INCHI_STRING": "InChI=1/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3", "NAME": "m-Xylene", "REFPROP_NAME": "MXYLENE", "SMILES": "Cc1cccc(c1)C" }, "STATES": { "critical": { "T": 616.89, "T_units": "K", "hmolar": 61561.23399713627, "hmolar_units": "J/mol", "p": 3534600.0, "p_units": "Pa", "rhomolar": 2665.0, "rhomolar_units": "mol/m^3", "smolar": 116.86857876019602, "smolar_units": "J/mol/K" }, "triple_liquid": { "T": 225.3, "T_units": "K", "hmolar": -35540.80751806576, "hmolar_units": "J/mol", "p": 3.123267555690047, "p_units": "Pa", "rhomolar": 8676.649495127216, "rhomolar_units": "mol/m^3", "smolar": -112.89125739493811, "smolar_units": "J/mol/K" }, "triple_vapor": { "T": 225.3, "T_units": "K", "hmolar": 11580.44946376125, "hmolar_units": "J/mol", "p": 3.1232675232328466, "p_units": "Pa", "rhomolar": 0.0016673174152434798, "rhomolar_units": "mol/m^3", "smolar": 96.25768607417126, "smolar_units": "J/mol/K" } }, "TRANSPORT": { "conductivity": { "BibTeX": "Mylona-JPCRD-2014-xylenes", "critical": { "GAMMA": 0.057, "R0": 1.03, "gamma": 1.239, "qD": 1402524544.179523, "type": "simplified_Olchowy_Sengers", "zeta0": 2.35e-10 }, "dilute": { "A": [ 0.00024210699999999998, 0.013522000000000001, -0.123168, 0.296882, -0.107973, 0.018686, -0.0012916700000000002 ], "B": [ -0.850118, 3.11646, 0.0001 ], "T_reducing": 616.89, "T_reducing_units": "K", "m": [ 0, 1, 2 ], "n": [ 0, 1, 2, 3, 4, 5, 6 ], "type": "ratio_of_polynomials" }, "residual": { "B": [ -0.0679314, 0.0592537, 0.22577799999999998, -0.162626, -0.18569300000000002, 0.133036, 0.0619006, -0.044905099999999996, -0.0071166400000000005, 0.0056186 ], "T_reducing": 616.89, "T_reducing_units": "K", "d": [ 1, 1, 2, 2, 3, 3, 4, 4, 5, 5 ], "rhomass_reducing": 282.9297, "rhomass_reducing_units": "kg/m^3", "t": [ 0, -1, 0, -1, 0, -1, 0, -1, 0, -1 ], "type": "polynomial" } }, "viscosity": { "BibTeX": "Cao-JPCRD-2016-mxylene", "hardcoded": "m-Xylene" } } }