mirror of
https://github.com/CoolProp/CoolProp.git
synced 2026-01-20 19:37:58 -05:00
``` find . -regextype posix-extended -regex '.*\.(cpp|hpp|c|h|cxx|hxx|py)$' | xargs -I@ sed -i 's/[ \t]*$//' "@" ```
1747 lines
71 KiB
Python
1747 lines
71 KiB
Python
#!/usr/bin/env python
|
|
# -*- coding: utf8 -*-
|
|
from __future__ import division, print_function
|
|
import numpy as np
|
|
|
|
import matplotlib
|
|
import copy
|
|
matplotlib.use("agg")
|
|
|
|
import hashlib, os, json, sys
|
|
import matplotlib.pyplot as plt
|
|
import matplotlib.gridspec as gridspec
|
|
from CPIncomp.DataObjects import SolutionData
|
|
from CPIncomp.BaseObjects import IncompressibleData, IncompressibleFitter
|
|
from matplotlib.patches import Rectangle
|
|
from matplotlib.ticker import MaxNLocator
|
|
from matplotlib.backends.backend_pdf import PdfPages
|
|
import itertools
|
|
from CoolProp.BibtexParser import BibTeXerClass
|
|
from warnings import warn
|
|
|
|
# See: https://docs.python.org/2/library/csv.html#csv-examples
|
|
import csv, codecs, io
|
|
|
|
|
|
class UTF8Recoder:
|
|
"""
|
|
Iterator that reads an encoded stream and reencodes the input to UTF-8
|
|
"""
|
|
|
|
def __init__(self, f, encoding):
|
|
self.reader = codecs.getreader(encoding)(f)
|
|
|
|
def __iter__(self):
|
|
return self
|
|
|
|
def next(self):
|
|
return next(self.reader).encode("utf-8")
|
|
|
|
|
|
class UnicodeReader:
|
|
"""
|
|
A CSV reader which will iterate over lines in the CSV file "f",
|
|
which is encoded in the given encoding.
|
|
"""
|
|
|
|
def __init__(self, f, dialect=csv.excel, encoding="utf-8", **kwds):
|
|
f = UTF8Recoder(f, encoding)
|
|
self.reader = csv.reader(f, dialect=dialect, **kwds)
|
|
|
|
def next(self):
|
|
row = next(self.reader)
|
|
return [unicode(s, "utf-8") for s in row]
|
|
|
|
def __iter__(self):
|
|
return self
|
|
|
|
|
|
class UnicodeWriter:
|
|
"""
|
|
A CSV writer which will write rows to CSV file "f",
|
|
which is encoded in the given encoding.
|
|
"""
|
|
|
|
def __init__(self, f, dialect=csv.excel, encoding="utf-8", **kwds):
|
|
# Redirect output to a queue
|
|
self.queue = io.StringIO()
|
|
self.writer = csv.writer(self.queue, dialect=dialect, **kwds)
|
|
self.stream = f
|
|
self.encoder = codecs.getincrementalencoder(encoding)()
|
|
|
|
def writerow(self, row):
|
|
self.writer.writerow(row)
|
|
# Fetch UTF-8 output from the queue ...
|
|
data = self.queue.getvalue()
|
|
try: data = data.decode("utf-8")
|
|
except: pass
|
|
try: data = str(data, encoding ="utf-8")
|
|
except: pass
|
|
# ... and re-encode it into the target encoding
|
|
data = self.encoder.encode(data)
|
|
# write to the target stream
|
|
self.stream.write(data)
|
|
# empty queue
|
|
self.queue.truncate(0)
|
|
|
|
def writerows(self, rows):
|
|
for row in rows:
|
|
self.writerow(row)
|
|
|
|
|
|
class SolutionDataWriter(object):
|
|
"""
|
|
A base class that defines all the variables needed
|
|
in order to make a proper fit. You can copy this code
|
|
put in your data and add some documentation for where the
|
|
information came from.
|
|
"""
|
|
|
|
def __init__(self):
|
|
bibFile = os.path.join(os.path.dirname(__file__), '../../../CoolPropBibTeXLibrary.bib')
|
|
self.bibtexer = BibTeXerClass(bibFile)
|
|
|
|
matplotlib.rcParams['axes.formatter.useoffset'] = False
|
|
|
|
# For standard report generation
|
|
self.ext = "pdf"
|
|
self.usebp = False
|
|
self.ispage = True # Do you want a page or a figure?
|
|
self.isportrait = True
|
|
self.resolveRef = True # Resolve references and print text
|
|
|
|
# Latex document mode
|
|
#self.ext = "pgf"
|
|
#self.usebp = True
|
|
# self.ispage = False # Do you want a page or a figure?
|
|
#self.isportrait = True
|
|
# self.resolveRef = False # Resolve references and print text
|
|
|
|
if self.ext == "pgf" or matplotlib.rcParams['text.usetex']:
|
|
self.usetex = True
|
|
matplotlib.rcParams['text.usetex'] = True
|
|
# preamble = [r'\usepackage{hyperref}', r'\usepackage{siunitx}']#, r'\usepackage[style=alphabetic,natbib=true,backend=biber]{biblatex}']
|
|
preamble = [r'\usepackage{hyperref}', r'\usepackage{siunitx}']
|
|
#matplotlib.rcParams['text.latex.preamble'] = list(matplotlib.rcParams['text.latex.preamble']) + preamble
|
|
#matplotlib.rcParams["pgf.preamble"] = list(matplotlib.rcParams['pgf.preamble']) + preamble
|
|
matplotlib.rcParams['text.latex.preamble'] = preamble
|
|
matplotlib.rcParams["pgf.preamble"] = preamble
|
|
self.percent = r'\si{\percent}'
|
|
self.celsius = r'\si{\celsius}'
|
|
self.errLabel = r'rel. Error (' + self.percent + r')'
|
|
self.tempLabel = r'Temperature (' + self.celsius + r')'
|
|
self.densLabel = r'Density (\si{\kilo\gram\per\cubic\metre})'
|
|
self.heatLabel = r'Heat Capacity (\si{\joule\per\kilo\gram\per\kelvin})'
|
|
self.condLabel = r'Thermal Conductivity (\si{\watt\per\metre\per\kelvin})'
|
|
self.viscLabel = r'Dynamic Viscosity (\si{\pascal\second})'
|
|
self.satPLabel = r'Saturation Pressure (\si{\pascal})'
|
|
self.TfreLabel = r'Freezing Temperature (\si{\kelvin})'
|
|
f = 0.85
|
|
else:
|
|
self.usetex = False
|
|
matplotlib.rcParams['text.usetex'] = False
|
|
self.percent = r'%'
|
|
self.celsius = u'\u00B0C'
|
|
self.errLabel = r'rel. Error (' + self.percent + r')'
|
|
self.tempLabel = u'Temperature (' + self.celsius + u')'
|
|
self.densLabel = r'Density ($\mathdefault{kg/m^3\!}$)'
|
|
self.heatLabel = r'Heat Capacity ($\mathdefault{J/kg/K}$)'
|
|
self.condLabel = r'Thermal Conductivity ($\mathdefault{W/m/K}$)'
|
|
self.viscLabel = r'Dynamic Viscosity ($\mathdefault{Pa\/s}$)'
|
|
self.satPLabel = r'Saturation Pressure ($\mathdefault{Pa}$)'
|
|
self.TfreLabel = r'Freezing Temperature ($\mathdefault{K}$)'
|
|
f = 1.00
|
|
|
|
# self.percent = ur'pc'
|
|
# self.celsius = ur'degC'
|
|
# self.errLabel = ur'rel. Error ('+self.percent+ur')'
|
|
# self.tempLabel = ur'Temperature ('+self.celsius+ur')'
|
|
# self.densLabel = ur'Density (kg/m3)'
|
|
# self.heatLabel = ur'Heat Capacity (J/kg/K)'
|
|
# self.condLabel = ur'Thermal Conductivity (W/m/K)'
|
|
# self.viscLabel = ur'Dynamic Viscosity (Pa s)'
|
|
# self.satPLabel = ur'Saturation Pressure (Pa)'
|
|
# self.TfreLabel = ur'Freezing Temperature (K)'
|
|
|
|
if self.usebp:
|
|
from jopy.dataPlotters import BasePlotter
|
|
self.bp = BasePlotter()
|
|
ccycle = self.bp.getColourCycle(length=2)
|
|
# ccycle.next() # skip the first one
|
|
# ccycle.next() # skip the first one
|
|
self.secondaryColour = next(ccycle)
|
|
self.primaryColour = next(ccycle)
|
|
else:
|
|
self.primaryColour = 'blue'
|
|
self.secondaryColour = 'red'
|
|
|
|
baseSize = 297.0 * f # A4 in mm
|
|
ratio = 210.0 / 297.0 # A4 in mm
|
|
mm_to_inch = 3.93700787401575 / 100.0 # factor mm to inch
|
|
|
|
self.deta = 0.75 # factor for table
|
|
if self.ispage:
|
|
longSide = baseSize # Make A4
|
|
shortSide = baseSize * ratio
|
|
else:
|
|
# lofa = 1.0 - self.deta * 2.5/11.5 # Half of the original table
|
|
longSide = baseSize # * lofa #* 0.85 # Make smaller than A4
|
|
shortSide = baseSize * ratio # TODO: connect to gridspec and ylim
|
|
|
|
if self.isportrait: self.figsize = (shortSide * mm_to_inch, longSide * mm_to_inch)
|
|
else: self.figsize = (longSide * mm_to_inch, shortSide * mm_to_inch)
|
|
|
|
def fitAll(self, fluidObject=SolutionData()):
|
|
|
|
if fluidObject.Tbase is None:
|
|
fluidObject.Tbase = (fluidObject.Tmin + fluidObject.Tmax) / 2.0
|
|
|
|
if fluidObject.xbase is None:
|
|
fluidObject.xbase = (fluidObject.xmin + fluidObject.xmax) / 2.0
|
|
|
|
tData = fluidObject.temperature.data
|
|
xData = fluidObject.concentration.data
|
|
tBase = fluidObject.Tbase
|
|
xBase = fluidObject.xbase
|
|
|
|
# Set the standard order for polynomials
|
|
std_xorder = 3 + 1
|
|
std_yorder = 5 + 1
|
|
std_coeffs = np.zeros((std_xorder, std_yorder))
|
|
|
|
errList = (ValueError, AttributeError, TypeError, RuntimeError)
|
|
|
|
if fluidObject.density.coeffs is None:
|
|
try:
|
|
fluidObject.density.setxyData(tData, xData)
|
|
fluidObject.density.coeffs = np.copy(std_coeffs)
|
|
fluidObject.density.type = IncompressibleData.INCOMPRESSIBLE_POLYNOMIAL
|
|
fluidObject.density.fitCoeffs(tBase, xBase)
|
|
except errList as ve:
|
|
if fluidObject.density.DEBUG: print("{0}: Could not fit polynomial {1} coefficients: {2}".format(fluidObject.name, 'density', ve))
|
|
pass
|
|
|
|
if fluidObject.specific_heat.coeffs is None:
|
|
try:
|
|
fluidObject.specific_heat.setxyData(tData, xData)
|
|
fluidObject.specific_heat.coeffs = np.copy(std_coeffs)
|
|
fluidObject.specific_heat.type = IncompressibleData.INCOMPRESSIBLE_POLYNOMIAL
|
|
fluidObject.specific_heat.fitCoeffs(tBase, xBase)
|
|
except errList as ve:
|
|
if fluidObject.specific_heat.DEBUG: print("{0}: Could not fit polynomial {1} coefficients: {2}".format(fluidObject.name, 'specific heat', ve))
|
|
pass
|
|
|
|
if fluidObject.conductivity.coeffs is None:
|
|
try:
|
|
fluidObject.conductivity.setxyData(tData, xData)
|
|
fluidObject.conductivity.coeffs = np.copy(std_coeffs)
|
|
fluidObject.conductivity.type = IncompressibleData.INCOMPRESSIBLE_POLYNOMIAL
|
|
fluidObject.conductivity.fitCoeffs(tBase, xBase)
|
|
except errList as ve:
|
|
if fluidObject.conductivity.DEBUG: print("{0}: Could not fit polynomial {1} coefficients: {2}".format(fluidObject.name, 'conductivity', ve))
|
|
pass
|
|
|
|
if fluidObject.viscosity.coeffs is None:
|
|
try:
|
|
fluidObject.viscosity.setxyData(tData, xData)
|
|
tried = False
|
|
if len(fluidObject.viscosity.yData) == 1: # and np.isfinite(fluidObject.viscosity.data).sum()<10:
|
|
fluidObject.viscosity.coeffs = np.array([+5e+2, -6e+1, +1e+1])
|
|
fluidObject.viscosity.type = IncompressibleData.INCOMPRESSIBLE_EXPONENTIAL
|
|
fluidObject.viscosity.fitCoeffs(tBase, xBase)
|
|
if fluidObject.viscosity.coeffs is None or IncompressibleFitter.allClose(fluidObject.viscosity.coeffs, np.array([+5e+2, -6e+1, +1e+1])): # Fit failed
|
|
tried = True
|
|
if len(fluidObject.viscosity.yData) > 1 or tried:
|
|
#fluidObject.viscosity.coeffs = np.zeros(np.round(np.array(std_coeffs.shape) * 1.5))
|
|
fluidObject.viscosity.coeffs = np.copy(std_coeffs)
|
|
fluidObject.viscosity.type = IncompressibleData.INCOMPRESSIBLE_EXPPOLYNOMIAL
|
|
fluidObject.viscosity.fitCoeffs(tBase, xBase)
|
|
except errList as ve:
|
|
if fluidObject.viscosity.DEBUG: print("{0}: Could not fit polynomial {1} coefficients: {2}".format(fluidObject.name, 'viscosity', ve))
|
|
pass
|
|
|
|
if fluidObject.saturation_pressure.coeffs is None:
|
|
try:
|
|
fluidObject.saturation_pressure.setxyData(tData, xData)
|
|
tried = False
|
|
if len(fluidObject.saturation_pressure.yData) == 1: # and np.isfinite(fluidObject.saturation_pressure.data).sum()<10:
|
|
fluidObject.saturation_pressure.coeffs = np.array([-5e+3, +6e+1, -1e+1])
|
|
fluidObject.saturation_pressure.type = IncompressibleData.INCOMPRESSIBLE_EXPONENTIAL
|
|
fluidObject.saturation_pressure.fitCoeffs(tBase, xBase)
|
|
if fluidObject.saturation_pressure.coeffs is None or IncompressibleFitter.allClose(fluidObject.saturation_pressure.coeffs, np.array([-5e+3, +6e+1, -1e+1])): # Fit failed
|
|
tried = True
|
|
if len(fluidObject.saturation_pressure.yData) > 1 or tried:
|
|
#fluidObject.saturation_pressure.coeffs = np.zeros(np.round(np.array(std_coeffs.shape) * 1.5))
|
|
fluidObject.saturation_pressure.coeffs = np.copy(std_coeffs)
|
|
fluidObject.saturation_pressure.type = IncompressibleData.INCOMPRESSIBLE_EXPPOLYNOMIAL
|
|
fluidObject.saturation_pressure.fitCoeffs(tBase, xBase)
|
|
except errList as ve:
|
|
if fluidObject.saturation_pressure.DEBUG: print("{0}: Could not fit polynomial {1} coefficients: {2}".format(fluidObject.name, 'saturation pressure', ve))
|
|
pass
|
|
|
|
# reset data for getArray and read special files
|
|
if fluidObject.xid != fluidObject.ifrac_pure and fluidObject.xid != fluidObject.ifrac_undefined:
|
|
if fluidObject.T_freeze.coeffs is None:
|
|
fluidObject.T_freeze.setxyData([0.0], xData)
|
|
try:
|
|
if len(fluidObject.T_freeze.xData) == 1: # and np.isfinite(fluidObject.T_freeze.data).sum()<10:
|
|
fluidObject.T_freeze.coeffs = np.array([+7e+2, -6e+1, +1e+1])
|
|
fluidObject.T_freeze.type = IncompressibleData.INCOMPRESSIBLE_EXPONENTIAL
|
|
else:
|
|
fluidObject.T_freeze.coeffs = np.copy(std_coeffs)
|
|
fluidObject.T_freeze.type = IncompressibleData.INCOMPRESSIBLE_EXPPOLYNOMIAL
|
|
fluidObject.T_freeze.fitCoeffs(tBase, xBase)
|
|
except errList as ve:
|
|
if fluidObject.T_freeze.DEBUG: print("{0}: Could not fit {1} coefficients: {2}".format(fluidObject.name, "T_freeze", ve))
|
|
pass
|
|
#
|
|
# # reset data for getArray again
|
|
# if fluidObject.xid==fluidObject.ifrac_volume:
|
|
# try:
|
|
# fluidObject.mass2input.coeffs = np.copy(std_coeffs)
|
|
# fluidObject.mass2input.type = fluidObject.mass2input.INCOMPRESSIBLE_POLYNOMIAL
|
|
# fluidObject.mass2input.fitCoeffs([fluidObject.Tbase],massData,fluidObject.Tbase,fluidObject.xbase)
|
|
# except errList as ve:
|
|
# if fluidObject.mass2input.DEBUG: print("{0}: Could not fit {1} coefficients: {2}".format(fluidObject.name,"mass2input",ve))
|
|
# pass
|
|
# elif fluidObject.xid==fluidObject.ifrac_mass:
|
|
# _,_,fluidObject.volume2input.data = IncompressibleData.shfluidObject.ray(massData,axs=1)
|
|
# #_,_,volData = IncompressibleData.shapeArray(volData,axs=1)
|
|
# try:
|
|
# fluidObject.volume2input.coeffs = np.copy(std_coeffs)
|
|
# fluidObject.volume2input.type = fluidObject.volume2input.INCOMPRESSIBLE_POLYNOMIAL
|
|
# fluidObject.volume2input.fitCoeffs([fluidObject.Tbase],volData,fluidObject.Tbase,fluidObject.xbase)
|
|
# except errList as ve:
|
|
# if fluidObject.volume2input.DEBUG: print("{0}: Could not fit {1} coefficients: {2}".format(fluidObject.name,"volume2input",ve))
|
|
# pass
|
|
# else:
|
|
# raise ValueError("Unknown xid specified.")
|
|
|
|
def get_hash(self, data):
|
|
return hashlib.sha224(data.encode()).hexdigest()
|
|
|
|
def get_hash_file(self):
|
|
return os.path.join(os.path.dirname(__file__), 'data', "hashes.json")
|
|
|
|
def load_hashes(self):
|
|
hashes_fname = self.get_hash_file()
|
|
if os.path.exists(hashes_fname):
|
|
hashes = json.load(open(hashes_fname, 'r'))
|
|
else:
|
|
hashes = dict()
|
|
return hashes
|
|
|
|
def write_hashes(self, hashes):
|
|
hashes_fname = self.get_hash_file()
|
|
fp = open(hashes_fname, 'w')
|
|
fp.write(json.dumps(hashes))
|
|
fp.close()
|
|
return True
|
|
|
|
def get_json_file(self, name):
|
|
return os.path.join("json", "{0}.json".format(name))
|
|
|
|
def get_report_file(self, name):
|
|
return os.path.join("report", "{0}_fitreport.{1}".format(name, self.ext))
|
|
|
|
def toJSON(self, data, quiet=False):
|
|
jobj = {}
|
|
|
|
jobj['name'] = data.name # Name of the current fluid
|
|
jobj['description'] = data.description # Description of the current fluid
|
|
jobj['reference'] = data.reference # Reference data for the current fluid
|
|
|
|
jobj['Tmax'] = data.Tmax # Maximum temperature in K
|
|
jobj['Tmin'] = data.Tmin # Minimum temperature in K
|
|
jobj['xmax'] = data.xmax # Maximum concentration
|
|
jobj['xmin'] = data.xmin # Minimum concentration
|
|
jobj['xid'] = data.xid # Concentration is mole, mass or volume-based
|
|
jobj['TminPsat'] = data.TminPsat # Minimum saturation temperature in K
|
|
jobj['Tbase'] = data.Tbase # Base value for temperature fits
|
|
jobj['xbase'] = data.xbase # Base value for concentration fits
|
|
|
|
# data.temperature # Temperature for data points in K
|
|
# data.concentration # Concentration data points in weight fraction
|
|
jobj['density'] = data.density.toJSON() # Density in kg/m3
|
|
jobj['specific_heat'] = data.specific_heat.toJSON() # Heat capacity in J/(kg.K)
|
|
jobj['viscosity'] = data.viscosity.toJSON() # Dynamic viscosity in Pa.s
|
|
jobj['conductivity'] = data.conductivity.toJSON() # Thermal conductivity in W/(m.K)
|
|
jobj['saturation_pressure'] = data.saturation_pressure.toJSON() # Saturation pressure in Pa
|
|
jobj['T_freeze'] = data.T_freeze.toJSON() # Freezing temperature in K
|
|
jobj['mass2input'] = data.mass2input.toJSON() # dd
|
|
jobj['volume2input'] = data.volume2input.toJSON() # dd
|
|
jobj['mole2input'] = data.mole2input.toJSON() # dd
|
|
|
|
# Quickfix to allow building the docs with Python 3, see #1786
|
|
try:
|
|
original_float_repr = json.encoder.FLOAT_REPR
|
|
# print json.dumps(1.0001)
|
|
stdFmt = "1.{0}e".format(int(data.significantDigits - 1))
|
|
#pr = np.finfo(float64).eps * 10.0
|
|
# pr = np.finfo(float64).precision - 2 # stay away from numerical precision
|
|
#json.encoder.FLOAT_REPR = lambda o: format(np.around(o,decimals=pr), stdFmt)
|
|
json.encoder.FLOAT_REPR = lambda o: format(o, stdFmt)
|
|
dump = json.dumps(jobj, indent=2, sort_keys=True)
|
|
json.encoder.FLOAT_REPR = original_float_repr
|
|
except:
|
|
# Assume Python3
|
|
stdFmt = "1.{0}e".format(int(data.significantDigits - 1))
|
|
class RoundingEncoder(json.JSONEncoder):
|
|
def default(self, obj):
|
|
if isinstance(obj, float):
|
|
return format(o, stdFmt)
|
|
# Let the base class default method raise the TypeError
|
|
return json.JSONEncoder.default(self, obj)
|
|
dump = json.dumps(jobj, indent=2, sort_keys=True, cls=RoundingEncoder)
|
|
|
|
|
|
# print dump
|
|
hashes = self.load_hashes()
|
|
hash = self.get_hash(dump)
|
|
|
|
name = jobj['name']
|
|
|
|
if name not in hashes or \
|
|
hashes[name] != hash or \
|
|
not os.path.isfile(self.get_json_file(name)): # update hashes and write file
|
|
|
|
hashes[name] = hash
|
|
self.write_hashes(hashes)
|
|
path = self.get_json_file(name)
|
|
if not os.path.exists(os.path.dirname(path)):
|
|
os.makedirs(os.path.dirname(path))
|
|
with open(path, 'w') as fp:
|
|
fp.write(dump)
|
|
|
|
if not quiet: print(" ({0})".format("w"), end="")
|
|
else:
|
|
if not quiet: print(" ({0})".format("i"), end="")
|
|
|
|
# Update the object:
|
|
self.fromJSON(data=data)
|
|
|
|
def fromJSON(self, data=SolutionData()):
|
|
|
|
path = os.path.join("json", data.name + '.json')
|
|
|
|
if not os.path.isfile(path):
|
|
return None
|
|
|
|
with open(path) as json_file:
|
|
jobj = json.load(json_file)
|
|
|
|
data.name = jobj['name'] # Name of the current fluid
|
|
data.description = jobj['description'] # Description of the current fluid
|
|
data.reference = jobj['reference'] # Reference data for the current fluid
|
|
|
|
data.Tmax = jobj['Tmax'] # Maximum temperature in K
|
|
data.Tmin = jobj['Tmin'] # Minimum temperature in K
|
|
data.xmax = jobj['xmax'] # Maximum concentration
|
|
data.xmin = jobj['xmin'] # Minimum concentration
|
|
data.xid = jobj['xid'] # Concentration is mole, mass or volume-based
|
|
data.TminPsat = jobj['TminPsat'] # Minimum saturation temperature in K
|
|
data.Tbase = jobj['Tbase'] # Base value for temperature fits
|
|
data.xbase = jobj['xbase'] # Base value for concentration fits
|
|
|
|
# data.temperature # Temperature for data points in K
|
|
# data.concentration # Concentration data points in weight fraction
|
|
data.density.fromJSON(jobj['density']) # Density in kg/m3
|
|
data.specific_heat.fromJSON(jobj['specific_heat']) # Heat capacity in J/(kg.K)
|
|
data.viscosity.fromJSON(jobj['viscosity']) # Dynamic viscosity in Pa.s
|
|
data.conductivity.fromJSON(jobj['conductivity']) # Thermal conductivity in W/(m.K)
|
|
data.saturation_pressure.fromJSON(jobj['saturation_pressure']) # Saturation pressure in Pa
|
|
data.T_freeze.fromJSON(jobj['T_freeze']) # Freezing temperature in K
|
|
data.mass2input.fromJSON(jobj['mass2input']) # dd
|
|
data.volume2input.fromJSON(jobj['volume2input']) # dd
|
|
data.mole2input.fromJSON(jobj['mole2input']) # dd
|
|
|
|
return data
|
|
|
|
def printStatusID(self, fluidObjs, obj):
|
|
#obj = fluidObjs[num]
|
|
if obj == fluidObjs[0]:
|
|
print(" {0}".format(obj.name), end="")
|
|
elif obj == fluidObjs[-1]:
|
|
print(", {0}".format(obj.name), end="")
|
|
else:
|
|
print(", {0}".format(obj.name), end="")
|
|
|
|
sys.stdout.flush()
|
|
return
|
|
|
|
def fitFluidList(self, fluidObjs):
|
|
print("Fitting normal fluids:", end="")
|
|
for obj in fluidObjs:
|
|
self.printStatusID(fluidObjs, obj)
|
|
try:
|
|
self.fitAll(obj)
|
|
except (TypeError, ValueError) as e:
|
|
print("An error occurred for fluid: {0}".format(obj.name))
|
|
print(obj)
|
|
print(e)
|
|
pass
|
|
print(" ... done")
|
|
return
|
|
|
|
def readFluidList(self, fluidObjs):
|
|
print("Reading fluids:", end="")
|
|
for obj in fluidObjs:
|
|
self.printStatusID(fluidObjs, obj)
|
|
try:
|
|
self.fromJSON(obj)
|
|
except (TypeError, ValueError) as e:
|
|
print("An error occurred for fluid: {0}".format(obj.name))
|
|
print(obj)
|
|
print(e)
|
|
pass
|
|
print(" ... done")
|
|
return
|
|
|
|
def fitSecCoolList(self, fluidObjs):
|
|
print("Fitting SecCool fluids:", end="")
|
|
for obj in fluidObjs:
|
|
self.printStatusID(fluidObjs, obj)
|
|
try:
|
|
obj.fitFluid()
|
|
except (TypeError, ValueError) as e:
|
|
print("An error occurred for fluid: {0}".format(obj.name))
|
|
print(obj)
|
|
print(e)
|
|
pass
|
|
print(" ... done")
|
|
return
|
|
|
|
def writeFluidList(self, fluidObjs):
|
|
print("Writing fluids to JSON:", end="")
|
|
for obj in fluidObjs:
|
|
self.printStatusID(fluidObjs, obj)
|
|
try:
|
|
self.toJSON(obj)
|
|
except (TypeError, ValueError) as e:
|
|
print("An error occurred for fluid: {0}".format(obj.name))
|
|
print(obj)
|
|
print(str(e))
|
|
pass
|
|
print(" ... done")
|
|
return
|
|
|
|
def writeReportList(self, fluidObjs, pdfFile=None):
|
|
print("Writing fitting reports:", end="")
|
|
|
|
if self.usetex and pdfFile is not None:
|
|
warn("Unsetting PDF object, LaTeX output requested.")
|
|
pdfFile = None
|
|
|
|
if not pdfFile is None:
|
|
if not os.path.exists(os.path.dirname(pdfFile)):
|
|
os.makedirs(os.path.dirname(pdfFile))
|
|
with PdfPages(pdfFile) as pdfObj:
|
|
for obj in fluidObjs:
|
|
matplotlib.pyplot.close("all")
|
|
self.printStatusID(fluidObjs, obj)
|
|
try:
|
|
self.makeFitReportPage(obj, pdfObj=pdfObj)
|
|
except (TypeError, ValueError) as e:
|
|
print("An error occurred for fluid: {0}".format(obj.name))
|
|
print(obj)
|
|
print(e)
|
|
pass
|
|
else:
|
|
for obj in fluidObjs:
|
|
matplotlib.pyplot.close("all")
|
|
self.printStatusID(fluidObjs, obj)
|
|
self.makeFitReportPage(obj)
|
|
# TODO: Fix Python errors
|
|
# try:
|
|
# self.makeFitReportPage(obj)
|
|
# except (TypeError, ValueError) as e:
|
|
# print("An error occurred for fluid: {0}".format(obj.name))
|
|
# print(obj)
|
|
# print(e)
|
|
# pass
|
|
|
|
print(" ... done")
|
|
return
|
|
|
|
#####################################
|
|
# Plotting routines
|
|
#####################################
|
|
def relError(self, A=[], B=[], PCT=False):
|
|
"""
|
|
Returns the absolute relative Error from either
|
|
(B-A)/B or (A-B)/A for abs(B)>abs(A) and abs(A)>abs(B),
|
|
respectively. If PCT is True, it returns it in percent.
|
|
"""
|
|
A_a = np.array(A)
|
|
B_a = np.array(B)
|
|
|
|
abl = np.absolute(B_a)
|
|
eps = np.ones_like(abl) * np.finfo(float).eps
|
|
#div = np.amax(np.hstack((abl,eps)), axis=1)*np.sign(B_a)
|
|
|
|
pos = np.isfinite(B_a)
|
|
pos2 = (B_a > eps)
|
|
result = np.ones_like(A_a) * np.NAN
|
|
|
|
result[pos & pos2] = (A_a[pos & pos2] - B_a[pos & pos2]) / B_a[pos & pos2]
|
|
|
|
if PCT:
|
|
return result * 100.
|
|
else:
|
|
return result
|
|
|
|
############################################################
|
|
# Define the general purpose routines for plotting
|
|
############################################################
|
|
def wireFrame2D(self, xz, yz, linesX=5, linesY=None, color='black', ax=None, plot=False):
|
|
"""
|
|
xz is a 2D array that holds x-values for constant z1 and z2.
|
|
yz is a 2D array that holds y-values for the same z1 and z2.
|
|
xz and yz have to have the same size.
|
|
The first dimension of xz should be greater than
|
|
or equal to the lines input.
|
|
"""
|
|
if xz.ndim != 2:
|
|
raise ValueError("xz has to be a 2D array.")
|
|
if yz.ndim != 2:
|
|
raise ValueError("yz has to be a 2D array.")
|
|
if xz.shape != yz.shape:
|
|
raise ValueError("xz and yz have to have the same shape: {0} != {1}".format(xz.shape, yz.shape))
|
|
if linesY is None and not linesX is None:
|
|
linesY = linesX
|
|
if linesX is None and not linesY is None:
|
|
linesX = linesY
|
|
if linesY is None and linesX is None:
|
|
raise ValueError("You have to provide linesX or linesY")
|
|
|
|
xl, yl = xz.shape
|
|
x_index = np.round(np.linspace(0, xl - 1, linesX))
|
|
y_index = np.round(np.linspace(0, yl - 1, linesY))
|
|
x_toPlot = []
|
|
y_toPlot = []
|
|
for i in x_index:
|
|
x_toPlot += [xz.T[i]]
|
|
y_toPlot += [yz.T[i]]
|
|
for i in y_index:
|
|
x_toPlot += [xz[i]]
|
|
y_toPlot += [yz[i]]
|
|
if plot == False:
|
|
return x_toPlot, y_toPlot
|
|
if ax is None:
|
|
raise ValueError("You have to give an axis to plot.")
|
|
for i in range(len(x_toPlot)):
|
|
ax.plot(x_toPlot[i], y_toPlot[i], color=color)
|
|
return x_toPlot, y_toPlot
|
|
|
|
def plotValues(self, axVal, axErr, solObj=SolutionData(), dataObj=IncompressibleData(), func=None, old=None):
|
|
"""
|
|
Plots two data series using the same axis. You can
|
|
choose if you prefer points or a line for the reference
|
|
data. This can be used to show that we have experimental
|
|
data or a reference equation.
|
|
You can use the old input to call CoolProp with this ID.
|
|
You can use this feature to visualise changes for new
|
|
data fits. Primarily intended to highlight changes from
|
|
v4 to v5 of CoolProp.
|
|
"""
|
|
|
|
if dataObj.type == dataObj.INCOMPRESSIBLE_NOT_SET \
|
|
or dataObj.source == dataObj.SOURCE_NOT_SET:
|
|
return
|
|
|
|
# TODO: Improve this work-around
|
|
xFunction = False
|
|
try:
|
|
if solObj.T_freeze.coeffs.shape == dataObj.coeffs.shape:
|
|
if np.all(solObj.T_freeze.coeffs == dataObj.coeffs):
|
|
xFunction = True
|
|
except AttributeError as ae:
|
|
if False: print(ae)
|
|
pass
|
|
|
|
points = 30
|
|
|
|
dataFormatter = {}
|
|
tData = None
|
|
xData = None
|
|
pData = None
|
|
zData = None
|
|
zError = None
|
|
|
|
if dataObj.source == dataObj.SOURCE_DATA or dataObj.source == dataObj.SOURCE_EQUATION:
|
|
|
|
dataFormatter['color'] = self.primaryColour
|
|
dataFormatter['marker'] = 'o'
|
|
dataFormatter['ls'] = 'none'
|
|
|
|
dataObj.setxyData(solObj.temperature.data, solObj.concentration.data)
|
|
|
|
tData = dataObj.xData
|
|
xData = dataObj.yData
|
|
pData = 1e7 # 100 bar
|
|
zData = dataObj.data
|
|
|
|
if not func is None and not zData is None:
|
|
r, c = zData.shape
|
|
zError = np.zeros((r, c))
|
|
for i in range(r):
|
|
for j in range(c):
|
|
zError[i, j] = func(tData[i], pData, xData[j])
|
|
|
|
zError = self.relError(zData, zError) * 1e2
|
|
|
|
# Find the column with the largest single error
|
|
# maxVal = np.amax(zError, axis=0) # largest error per column
|
|
# col2plot = np.argmax(maxVal) # largest error in row
|
|
# Find the column with the largest total error
|
|
# totVal = np.sum(zError, axis=0) # summed error per column
|
|
# col2plot = np.argmax(totVal) # largest error in row
|
|
# Find the column with the largest average error
|
|
if xFunction:
|
|
# avgVal = np.average(zError, axis=1) # summed error per column
|
|
# set2plot = np.argmax(avgVal) # largest error in row
|
|
set2plot = int(np.round(r / 2.0))
|
|
tData = np.array([tData[set2plot]])
|
|
zData = zData[set2plot]
|
|
zError = zError[set2plot]
|
|
else:
|
|
# avgVal = np.average(zError, axis=0) # summed error per column
|
|
# set2plot = np.argmax(avgVal) # largest error in row
|
|
set2plot = int(np.round(c / 2.0))
|
|
xData = np.array([xData[set2plot]])
|
|
zData = zData.T[set2plot]
|
|
zError = zError.T[set2plot]
|
|
else:
|
|
raise ValueError("You have to provide data and a fitted function.")
|
|
|
|
elif dataObj.source == dataObj.SOURCE_COEFFS:
|
|
dataFormatter['color'] = self.primaryColour
|
|
#dataFormatter['marker'] = 'o'
|
|
dataFormatter['ls'] = 'solid'
|
|
|
|
if xFunction:
|
|
xData = np.linspace(solObj.xmin, solObj.xmax, num=points)
|
|
if solObj.xid == solObj.ifrac_pure: tData = np.array([0.0])
|
|
else: tData = np.array([solObj.Tmin + solObj.Tmax]) / 2.0
|
|
else:
|
|
tData = np.linspace(solObj.Tmin, solObj.Tmax, num=points)
|
|
if solObj.xid == solObj.ifrac_pure: xData = np.array([0.0])
|
|
else: xData = np.array([solObj.xmin + solObj.xmax]) / 2.0
|
|
|
|
pData = 1e7 # 100 bar
|
|
|
|
#zData= np.zeros((len(tData),len(xData)))
|
|
# for i in range(len(tData)):
|
|
# for j in range(len(xData)):
|
|
# zData[i,j] = func(tData[i],pData,xData[j])
|
|
#r,c = zData.shape
|
|
# if r==1 or c==1:
|
|
# zData = np.array(zData.flat)
|
|
# else:
|
|
# raise ValueError("Cannot plot non-flat arrays!")
|
|
|
|
# Copy the arrays
|
|
tFunc = tData
|
|
xFunc = xData
|
|
pFunc = pData
|
|
zFunc = None
|
|
zMiMa = None
|
|
xFree = xData
|
|
tFree = tData
|
|
zFree = None
|
|
|
|
if not func is None:
|
|
if len(tFunc) < points and len(tFunc) > 1:
|
|
tFunc = np.linspace(solObj.Tmin, solObj.Tmax, num=points)
|
|
if len(xFunc) < points and len(xFunc) > 1:
|
|
xFunc = np.linspace(solObj.xmin, solObj.xmax, num=points)
|
|
|
|
zFunc = np.zeros((len(tFunc), len(xFunc)))
|
|
for i in range(len(tFunc)):
|
|
for j in range(len(xFunc)):
|
|
zFunc[i, j] = func(tFunc[i], pFunc, xFunc[j])
|
|
r, c = zFunc.shape
|
|
if r == 1 or c == 1:
|
|
zFunc = np.array(zFunc.flat)
|
|
else:
|
|
raise ValueError("Cannot plot non-flat arrays!")
|
|
|
|
if xFunction:
|
|
tMiMa = np.array([solObj.Tmin, solObj.Tmax])
|
|
xMiMa = xFunc
|
|
else:
|
|
tMiMa = tFunc
|
|
xMiMa = np.array([solObj.xmin, solObj.xmax])
|
|
|
|
zMiMa = np.zeros((len(tMiMa), len(xMiMa)))
|
|
for i in range(len(tMiMa)):
|
|
for j in range(len(xMiMa)):
|
|
zMiMa[i, j] = func(tMiMa[i], pFunc, xMiMa[j])
|
|
|
|
if not xFunction: # add the freezing front
|
|
if solObj.T_freeze.type != IncompressibleData.INCOMPRESSIBLE_NOT_SET:
|
|
cols = len(tMiMa)
|
|
conc = np.linspace(solObj.xmin, solObj.xmax, num=cols)
|
|
tFree = np.zeros_like(conc)
|
|
zFree = np.zeros_like(conc)
|
|
for i in range(cols):
|
|
tFree[i] = solObj.Tfreeze(10.0, p=pFunc, x=conc[i])
|
|
zFree[i] = func(tFree[i], pFunc, conc[i])
|
|
#zMiMa = np.hstack((zMiMa,temp.reshape((len(conc),1))))
|
|
|
|
fitFormatter = {}
|
|
fitFormatter['color'] = self.secondaryColour
|
|
fitFormatter['ls'] = 'solid'
|
|
|
|
errorFormatter = {}
|
|
errorFormatter['color'] = dataFormatter['color']
|
|
errorFormatter['marker'] = 'o'
|
|
errorFormatter['ls'] = 'none'
|
|
errorFormatter['alpha'] = 0.5
|
|
|
|
boundsFormatter = fitFormatter.copy()
|
|
boundsFormatter['ls'] = ':'
|
|
boundsFormatter['alpha'] = 0.75
|
|
|
|
pData = None
|
|
pFree = None
|
|
if xFunction:
|
|
pData = xData
|
|
pFunc = xFunc
|
|
pMiMa = xMiMa
|
|
zMiMa = zMiMa.T
|
|
#pFree = xFree
|
|
#zFree = zFree.T
|
|
else:
|
|
pData = tData - 273.15
|
|
pFunc = tFunc - 273.15
|
|
pMiMa = tMiMa - 273.15
|
|
#zMiMa = zMiMa
|
|
pFree = tFree - 273.15
|
|
|
|
if not zData is None and not axVal is None:
|
|
axVal.plot(pData, zData, label='data', **dataFormatter)
|
|
|
|
if not zFunc is None and not axVal is None:
|
|
axVal.plot(pFunc, zFunc, label='function', **fitFormatter)
|
|
if solObj.xid != solObj.ifrac_pure and not xFunction:
|
|
axVal.set_title("showing x={0:3.2f}".format(xFunc[0]), fontsize='small')
|
|
else:
|
|
axVal.set_title(" ", fontsize='small')
|
|
|
|
if not zMiMa is None and not axVal is None:
|
|
axVal.plot(pMiMa, zMiMa, label='bounds', **boundsFormatter)
|
|
|
|
if not zFree is None and not axVal is None:
|
|
axVal.plot(pFree, zFree, label='bounds', **boundsFormatter)
|
|
|
|
if not zError is None and not axErr is None:
|
|
#formatter = matplotlib.ticker.ScalarFormatter(useOffset=False)
|
|
# axErr.yaxis.set_major_formatter(formatter)
|
|
# axErr.yaxis.get_major_formatter().useOffset=False
|
|
axErr.plot(pData, zError, label='error', **errorFormatter)
|
|
|
|
elif not axErr is None:
|
|
errorFormatter['alpha'] = 0.00
|
|
axErr.plot([pData[0], pData[-1]], [0, 0], **errorFormatter)
|
|
# axErr.xaxis.set_visible(False)
|
|
# axErr.yaxis.set_visible(False)
|
|
#axErr.plot(pData, zFunc, label='function' , **fitFormatter)
|
|
|
|
# else:
|
|
# plt.setp(axErr.get_yticklabels(), visible=False)
|
|
# plt.setp(axErr.yaxis.get_label(), visible=False)
|
|
|
|
def printFluidInfo(self, ax, solObj=SolutionData()):
|
|
"""
|
|
Prints some fluid information on top of the fitting report.
|
|
"""
|
|
#ax = subplot(111, frame_on=False)
|
|
ax.xaxis.set_visible(False)
|
|
ax.yaxis.set_visible(False)
|
|
|
|
#cellText = [["1","2"],["3","4"]]
|
|
#rowLabels = ["Name","Source"]
|
|
# Add a table at the bottom of the axes
|
|
#the_table = ax.table(cellText=cellText)
|
|
|
|
annotateSettingsTitle = {}
|
|
#annotateSettingsLabel['xycoords']=('figure fraction', 'figure fraction')
|
|
annotateSettingsTitle['ha'] = 'center'
|
|
annotateSettingsTitle['va'] = 'baseline'
|
|
annotateSettingsTitle['fontsize'] = 'large'
|
|
annotateSettingsTitle['fontweight'] = 'bold'
|
|
|
|
annotateSettingsLabel = {}
|
|
#annotateSettingsLabel['xycoords']=('figure fraction', 'figure fraction')
|
|
annotateSettingsLabel['ha'] = 'right'
|
|
annotateSettingsLabel['va'] = 'baseline'
|
|
annotateSettingsLabel['fontsize'] = 'small'
|
|
annotateSettingsLabel['fontweight'] = 'semibold'
|
|
|
|
annotateSettingsText = {}
|
|
#annotateSettingsText['xycoords']=('figure fraction', 'figure fraction')
|
|
annotateSettingsText['ha'] = 'left'
|
|
annotateSettingsText['va'] = 'baseline'
|
|
annotateSettingsText['fontsize'] = 'small'
|
|
annotateSettingsText['fontweight'] = 'medium'
|
|
|
|
#ax.set_title('Fitting Report for {0}'.format(solObj.name))
|
|
yHead = 0.0
|
|
if self.ispage:
|
|
yHead = 0.8
|
|
ax.text(0.5, yHead, 'Fitting Report for {0}'.format(solObj.name), **annotateSettingsTitle)
|
|
yHead += 0.2
|
|
|
|
def myAnnotate(label, text, x=0.0, y=0.0):
|
|
dx = 0.005
|
|
ax.text(x - dx, y, label, **annotateSettingsLabel)
|
|
ax.text(x + dx, y, text, **annotateSettingsText)
|
|
|
|
#ax.annotate(r'Enthalpy [$\mathdefault{10^5\!J/kg}$]', xy=(0.25, 0.03), **annotateSettings)
|
|
#ax.annotate(r'Enthalpy [$\mathdefault{10^5\!J/kg}$]', xy=(0.25, 0.03), **annotateSettings)
|
|
|
|
dx = 0.50
|
|
dy = 0.10
|
|
|
|
xStart = 0.175; x = xStart
|
|
yStart = 0.575; y = yStart
|
|
|
|
#myAnnotate('Name: ',solObj.name,x=x,y=y); x += .0; y -= dy
|
|
if self.usetex:
|
|
myAnnotate('Description: ', solObj.description.encode("latex"), x=x, y=y); x += .0; y -= dy
|
|
else:
|
|
myAnnotate('Description: ', solObj.description, x=x, y=y); x += .0; y -= dy
|
|
|
|
# TODO: Debug bibtexer
|
|
refs = solObj.reference.split(",")
|
|
maxLength = 75
|
|
for i in range(len(refs)):
|
|
refs[i] = refs[i].strip()
|
|
|
|
if self.resolveRef:
|
|
try:
|
|
if self.usetex:
|
|
refs[i] = self.bibtexer.getEntry(key=refs[i], fmt='latex').strip()
|
|
else:
|
|
refs[i] = self.bibtexer.getEntry(key=refs[i], fmt='plaintext').strip()
|
|
except Exception as e:
|
|
warn("Your string \"{0}\" was not a valid Bibtex key, I will use it directly: {1}".format(refs[i], e))
|
|
pass
|
|
else:
|
|
if self.usetex:
|
|
refs[i] = r'\cite{' + str(refs[i]) + r'}'
|
|
else:
|
|
refs[i] = str(refs[i])
|
|
|
|
if len(refs[i]) > maxLength and not self.usetex:
|
|
refs[i] = refs[i][0:maxLength - 3] + u'...'
|
|
# elif self.usetex:
|
|
# refs[i] = r'\truncate{'+str(maxLength)+r'pt}{'+str(refs[i])+r'}'
|
|
# elif i>0 and (len(refs[i])+len(refs[i-1]))<maxLength:
|
|
# refs[i-1] = refs[i-1]+r", "+refs[i]
|
|
# refs[i] = ""
|
|
|
|
for i in range(len(refs)):
|
|
if i == 0:
|
|
myAnnotate('Source: ', refs[i], x=x, y=y); x += .0 # ; y -= 2*dy
|
|
elif i == 1:
|
|
myAnnotate(' ', refs[i], x=x, y=y - dy); x += .0 # ; y -= 2*dy
|
|
else:
|
|
warn("Discarding all reference after the second line")
|
|
|
|
y -= 2 * dy
|
|
yRestart = y
|
|
myAnnotate('Temperature: ', u'{0} {2} to {1} {2}'.format(solObj.Tmin - 273.15, solObj.Tmax - 273.15, self.celsius), x=x, y=y); x += .0; y -= dy
|
|
conc = False
|
|
if solObj.xid == solObj.ifrac_mass: conc = True
|
|
if solObj.xid == solObj.ifrac_volume: conc = True
|
|
if solObj.xid == solObj.ifrac_mole: conc = True
|
|
if conc == True:
|
|
myAnnotate('Composition: ', u'{0} {3} to {1} {3}, {2}'.format(solObj.xmin * 100., solObj.xmax * 100., solObj.xid, self.percent), x=x, y=y)
|
|
else:
|
|
myAnnotate('Composition: ', 'pure fluid', x=x, y=y)
|
|
x += .0; y -= dy
|
|
|
|
if solObj.density.source != solObj.density.SOURCE_NOT_SET:
|
|
myAnnotate('Density: ', u'{0} to {1} {2}'.format(solObj.density.source, solObj.density.type, solObj.density.coeffs.shape), x=x, y=y)
|
|
else:
|
|
myAnnotate('Density: ', 'no information', x=x, y=y)
|
|
x += .0; y -= dy
|
|
if solObj.specific_heat.source != solObj.specific_heat.SOURCE_NOT_SET:
|
|
myAnnotate('Spec. Heat: ', u'{0} to {1} {2}'.format(solObj.specific_heat.source, solObj.specific_heat.type, solObj.specific_heat.coeffs.shape), x=x, y=y)
|
|
else:
|
|
myAnnotate('Spec. Heat: ', 'no information', x=x, y=y)
|
|
x += .0; y -= dy
|
|
|
|
x = xStart + dx; y = yRestart
|
|
if solObj.conductivity.source != solObj.conductivity.SOURCE_NOT_SET:
|
|
myAnnotate('Th. Cond.: ', u'{0} to {1} {2}'.format(solObj.conductivity.source, solObj.conductivity.type, solObj.conductivity.coeffs.shape), x=x, y=y)
|
|
else:
|
|
myAnnotate('Th. Cond.: ', 'no information', x=x, y=y)
|
|
x += .0; y -= dy
|
|
if solObj.viscosity.source != solObj.viscosity.SOURCE_NOT_SET:
|
|
myAnnotate('Viscosity: ', u'{0} to {1} {2}'.format(solObj.viscosity.source, solObj.viscosity.type, solObj.viscosity.coeffs.shape), x=x, y=y)
|
|
else:
|
|
myAnnotate('Viscosity: ', 'no information', x=x, y=y)
|
|
x += .0; y -= dy
|
|
if solObj.saturation_pressure.source != solObj.saturation_pressure.SOURCE_NOT_SET:
|
|
myAnnotate('Psat: ', u'{0} to {1} {2}'.format(solObj.saturation_pressure.source, solObj.saturation_pressure.type, solObj.saturation_pressure.coeffs.shape), x=x, y=y)
|
|
else:
|
|
myAnnotate('Psat: ', 'no information', x=x, y=y)
|
|
x += .0; y -= dy
|
|
if solObj.T_freeze.source != solObj.T_freeze.SOURCE_NOT_SET:
|
|
myAnnotate('Tfreeze: ', u'{0} to {1} {2}'.format(solObj.T_freeze.source, solObj.T_freeze.type, solObj.T_freeze.coeffs.shape), x=x, y=y)
|
|
else:
|
|
myAnnotate('Tfreeze: ', 'no information', x=x, y=y)
|
|
x += .0; y -= dy
|
|
|
|
# ax5.set_xlabel(ur'$\mathregular{Temperature\/(\u00B0C)}$')
|
|
|
|
#x += dx; y = yStart
|
|
#myAnnotate('Name: ',solObj.name,x=x,y=y); x += .0; y -= dy
|
|
|
|
xmin = 0
|
|
xmax = 1
|
|
|
|
ymin = y + 1 * dy
|
|
ymax = max(yStart, yHead)
|
|
|
|
ax.set_xlim((xmin, xmax))
|
|
ax.set_ylim((ymin, ymax))
|
|
|
|
#xpos,ypos = ax.transAxes.inverted().transform(ax.transData.transform((0,y)))
|
|
return [xmin, y + 0.5 * dy, xmax, y + 0.5 * dy]
|
|
|
|
def printFitDetails(self):
|
|
pass
|
|
|
|
def makeFitReportPage(self, solObj=SolutionData(), pdfObj=None, quiet=False):
|
|
"""
|
|
Creates a whole page with some plots and basic information
|
|
for both fit quality, reference data, data sources and
|
|
more.
|
|
"""
|
|
|
|
# First we determine some basic settings and check the JSON file
|
|
|
|
json_path = self.get_json_file(solObj.name)
|
|
report_path = self.get_report_file(solObj.name)
|
|
|
|
if os.path.isfile(json_path):
|
|
json_time = os.path.getctime(json_path)
|
|
else:
|
|
json_time = 0
|
|
|
|
if os.path.isfile(report_path):
|
|
report_time = os.path.getctime(report_path)
|
|
else:
|
|
report_time = 0
|
|
|
|
if json_time < report_time and pdfObj is None:
|
|
#print("The JSON file {0} has not been updated, skipping.".format(self.get_json_file(solObj.name)))
|
|
if not quiet: print(" ({0})".format("i"), end="")
|
|
return 1
|
|
|
|
# from os import path
|
|
# from time import ctime
|
|
# from datetime import datetime, timedelta
|
|
#
|
|
# two_days_ago = datetime.now() - timedelta(days=2)
|
|
# filetime = datetime.fromtimestamp(path.getctime(file))
|
|
#
|
|
# if filetime < two_days_ago:
|
|
# print "File is more than two days old"
|
|
|
|
if self.ispage:
|
|
gs = gridspec.GridSpec(4, 2, wspace=None, hspace=None, height_ratios=[2.50, 3, 3, 3])
|
|
else: # Reduce height of upper graph by two fifth, TODO: connect to ylim
|
|
gs = gridspec.GridSpec(4, 2, wspace=None, hspace=None, height_ratios=[2.50 * self.deta, 3, 3, 3])
|
|
|
|
#gs.update(top=0.75, hspace=0.05)
|
|
fig = plt.figure(figsize=self.figsize)
|
|
|
|
table_axis = plt.subplot(gs[0, :], frame_on=False)
|
|
|
|
# Info text settings
|
|
infoText = {}
|
|
infoText['ha'] = 'center'
|
|
infoText['va'] = 'baseline'
|
|
infoText['fontsize'] = 'smaller'
|
|
infoText['xycoords'] = ('axes fraction', 'axes fraction')
|
|
|
|
density_axis = plt.subplot(gs[1, 0])
|
|
density_error = density_axis.twinx()
|
|
density_axis.set_ylabel(self.densLabel)
|
|
density_axis.set_xlabel(self.tempLabel)
|
|
density_error.set_ylabel(self.errLabel)
|
|
if solObj.density.source != solObj.density.SOURCE_NOT_SET:
|
|
self.plotValues(density_axis, density_error, solObj=solObj, dataObj=solObj.density, func=solObj.rho)
|
|
else:
|
|
raise ValueError("Density data has to be provided!")
|
|
|
|
capacity_axis = plt.subplot(gs[1, 1])
|
|
capacity_error = capacity_axis.twinx()
|
|
capacity_axis.set_ylabel(self.heatLabel)
|
|
capacity_axis.set_xlabel(self.tempLabel)
|
|
capacity_error.set_ylabel(self.errLabel)
|
|
if solObj.specific_heat.source != solObj.specific_heat.SOURCE_NOT_SET:
|
|
self.plotValues(capacity_axis, capacity_error, solObj=solObj, dataObj=solObj.specific_heat, func=solObj.c)
|
|
else:
|
|
raise ValueError("Specific heat data has to be provided!")
|
|
|
|
# Optional plots, might not all be shown
|
|
conductivity_axis = plt.subplot(gs[2, 0]) # , sharex=density_axis)
|
|
conductivity_error = conductivity_axis.twinx()
|
|
conductivity_axis.set_ylabel(self.condLabel)
|
|
conductivity_axis.set_xlabel(self.tempLabel)
|
|
conductivity_error.set_ylabel(self.errLabel)
|
|
if solObj.conductivity.source != solObj.conductivity.SOURCE_NOT_SET:
|
|
self.plotValues(conductivity_axis, conductivity_error, solObj=solObj, dataObj=solObj.conductivity, func=solObj.cond)
|
|
else:
|
|
# conductivity_axis.xaxis.set_visible(False)
|
|
# conductivity_axis.yaxis.set_visible(False)
|
|
# conductivity_error.xaxis.set_visible(False)
|
|
# conductivity_error.yaxis.set_visible(False)
|
|
conductivity_axis.annotate("No conductivity information", xy=(0.5, 0.5), **infoText)
|
|
|
|
viscosity_axis = plt.subplot(gs[2, 1]) # , sharex=capacity_axis)
|
|
viscosity_error = viscosity_axis.twinx()
|
|
viscosity_axis.set_yscale('log')
|
|
viscosity_axis.set_ylabel(self.viscLabel)
|
|
viscosity_axis.set_xlabel(self.tempLabel)
|
|
viscosity_error.set_ylabel(self.errLabel)
|
|
if solObj.viscosity.source != solObj.viscosity.SOURCE_NOT_SET:
|
|
self.plotValues(viscosity_axis, viscosity_error, solObj=solObj, dataObj=solObj.viscosity, func=solObj.visc)
|
|
else:
|
|
# viscosity_axis.xaxis.set_visible(False)
|
|
# viscosity_axis.yaxis.set_visible(False)
|
|
# viscosity_error.xaxis.set_visible(False)
|
|
# viscosity_error.yaxis.set_visible(False)
|
|
viscosity_axis.annotate("No viscosity information", xy=(0.5, 0.5), **infoText)
|
|
|
|
saturation_axis = plt.subplot(gs[3, 0]) # , sharex=density_axis)
|
|
saturation_error = saturation_axis.twinx()
|
|
saturation_axis.set_yscale('log')
|
|
saturation_axis.set_ylabel(self.satPLabel)
|
|
saturation_axis.set_xlabel(self.tempLabel)
|
|
saturation_error.set_ylabel(self.errLabel)
|
|
if solObj.saturation_pressure.source != solObj.saturation_pressure.SOURCE_NOT_SET: # exists
|
|
self.plotValues(saturation_axis, saturation_error, solObj=solObj, dataObj=solObj.saturation_pressure, func=solObj.psat)
|
|
else:
|
|
# saturation_axis.xaxis.set_visible(False)
|
|
# saturation_axis.yaxis.set_visible(False)
|
|
# saturation_error.xaxis.set_visible(False)
|
|
# saturation_error.yaxis.set_visible(False)
|
|
saturation_axis.annotate("No saturation state information", xy=(0.5, 0.5), **infoText)
|
|
|
|
Tfreeze_axis = plt.subplot(gs[3, 1]) # , sharex=capacity_axis)
|
|
Tfreeze_error = Tfreeze_axis.twinx()
|
|
Tfreeze_axis.set_ylabel(self.TfreLabel)
|
|
Tfreeze_axis.set_xlabel("{0} fraction".format(solObj.xid.title()))
|
|
Tfreeze_error.set_ylabel(self.errLabel)
|
|
if solObj.T_freeze.source != solObj.T_freeze.SOURCE_NOT_SET: # exists
|
|
self.plotValues(Tfreeze_axis, Tfreeze_error, solObj=solObj, dataObj=solObj.T_freeze, func=solObj.Tfreeze)
|
|
else:
|
|
# Tfreeze_axis.xaxis.set_visible(False)
|
|
# Tfreeze_axis.yaxis.set_visible(False)
|
|
# Tfreeze_error.xaxis.set_visible(False)
|
|
# Tfreeze_error.yaxis.set_visible(False)
|
|
Tfreeze_axis.annotate("No freezing point information", xy=(0.5, 0.5), **infoText)
|
|
Tfreeze_axis.set_xlabel("Fraction")
|
|
|
|
#saturation_axis = plt.subplot2grid((3,2), (2,0))
|
|
#Tfreeze_axis = plt.subplot2grid((3,2), (2,0))
|
|
#mass2input_axis = plt.subplot2grid((3,2), (2,0))
|
|
#volume2input_axis = plt.subplot2grid((3,2), (2,0))
|
|
|
|
# Set a minimum error level and do some more formatting
|
|
minAbsErrorScale = 0.05 # in per cent
|
|
for a in fig.axes:
|
|
if a.get_ylabel() == self.errLabel:
|
|
mi, ma = a.get_ylim()
|
|
if mi > -minAbsErrorScale: a.set_ylim(bottom=-minAbsErrorScale)
|
|
if ma < minAbsErrorScale: a.set_ylim(top=minAbsErrorScale)
|
|
a.xaxis.set_major_locator(MaxNLocator(5))
|
|
# a.yaxis.set_major_locator(MaxNLocator(7))
|
|
|
|
# print headlines etc.
|
|
lims = self.printFluidInfo(table_axis, solObj)
|
|
# Prepare the legend
|
|
legenddict = {}
|
|
for a in fig.axes:
|
|
handles, labels = a.get_legend_handles_labels()
|
|
for i in range(len(labels)):
|
|
legenddict[labels[i]] = handles[i]
|
|
|
|
legKey = ["Legend: "]
|
|
legVal = [Rectangle((0, 0), 1, 1, alpha=0.0)]
|
|
legKey += legenddict.keys()
|
|
legVal += legenddict.values()
|
|
if self.usetex: legKey += ["~"]
|
|
else: legKey += [" "]
|
|
legVal += [Rectangle((0, 0), 1, 1, alpha=0.0)]
|
|
|
|
# TODO: Fix this problem: ValueError: Can only output finite numbers in PDF
|
|
if self.ext == "pdf" and self.usetex:
|
|
warn("This is a dangerous combination, be prepared to experience problems with the PDF backend. It might help to manually change the number of columns.")
|
|
else:
|
|
table_axis.legend(
|
|
legVal, legKey,
|
|
bbox_to_anchor=tuple(lims),
|
|
bbox_transform=table_axis.transData,
|
|
ncol=len(legVal), loc=9,
|
|
mode="expand", borderaxespad=0.,
|
|
numpoints=1, fontsize='small')
|
|
#table_axis.legend(handles, labels, bbox_to_anchor=(0.0, -0.1), loc=2, ncol=3)
|
|
|
|
gs.tight_layout(fig) # , rect=[0, 0, 1, 0.75])
|
|
# Fine-tune figure; make subplots close to each other
|
|
# and hide x ticks for all but bottom plot.
|
|
# fig.subplots_adjust(wspace=0)
|
|
#plt.setp([a.get_xticklabels() for a in fig.axes[:-1]], visible=False)
|
|
|
|
if json_time < report_time:
|
|
if not quiet: print(" ({0})".format("i"), end="")
|
|
else:
|
|
if not os.path.exists(os.path.dirname(report_path)):
|
|
os.makedirs(os.path.dirname(report_path))
|
|
|
|
if self.usebp and self.ext == "pgf":
|
|
self.bp.savepgf(report_path, fig=fig, customReplace=["\\cite{", "\\citet{"])
|
|
else:
|
|
fig.savefig(report_path)
|
|
|
|
if not quiet: print(" ({0})".format("w"), end="")
|
|
|
|
if not pdfObj is None: pdfObj.savefig(fig)
|
|
|
|
plt.close(fig)
|
|
pass
|
|
|
|
def makeSolutionPlots(self, solObjs=[SolutionData()], pdfObj=None):
|
|
"""
|
|
Creates a whole page with some plots and basic information
|
|
for both fit quality, reference data, data sources and
|
|
more.
|
|
"""
|
|
# First we determine some basic settings
|
|
water = None
|
|
solutions = []
|
|
|
|
for i in range(len(solObjs) - 1):
|
|
if solObjs[i].xid == SolutionData.ifrac_mass or \
|
|
solObjs[i].xid == SolutionData.ifrac_mole or \
|
|
solObjs[i].xid == SolutionData.ifrac_volume:
|
|
solutions += [solObjs[i]]
|
|
# elif solObjs[i].xid==SolutionData.ifrac_pure:
|
|
# purefluids += [doneObjs[i]]
|
|
elif solObjs[i].name == "NBS":
|
|
water = solObjs[i]
|
|
solutions += [solObjs[i]]
|
|
|
|
if water is None: raise ValueError("No water found, reference values missing.")
|
|
|
|
# Set temperature data for all fluids
|
|
dataDict = {}
|
|
dataList = []
|
|
obj = SolutionData()
|
|
for i in range(len(solutions) - 1):
|
|
obj = solutions[i]
|
|
T = np.arange(np.max([275, np.round(obj.Tmin)]), np.min([300, np.round(obj.Tmax)]), 1)
|
|
P = 100e5
|
|
x = obj.xmin
|
|
dataDict["name"] = obj.name
|
|
dataDict["desc"] = obj.description
|
|
dataDict["T"] = T
|
|
dataDict["P"] = P
|
|
dataDict["x"] = x
|
|
if obj.density.type != IncompressibleData.INCOMPRESSIBLE_NOT_SET:
|
|
dataDict["D"] = np.array([obj.rho(Ti, P, x) for Ti in T])
|
|
else: dataDict["D"] = None
|
|
if obj.specific_heat.type != IncompressibleData.INCOMPRESSIBLE_NOT_SET:
|
|
dataDict["C"] = np.array([obj.c(Ti, P, x) for Ti in T])
|
|
else: dataDict["C"] = None
|
|
if obj.conductivity.type != IncompressibleData.INCOMPRESSIBLE_NOT_SET:
|
|
dataDict["L"] = np.array([obj.cond(Ti, P, x) for Ti in T])
|
|
else: dataDict["L"] = None
|
|
if obj.viscosity.type != IncompressibleData.INCOMPRESSIBLE_NOT_SET:
|
|
dataDict["V"] = np.array([obj.visc(Ti, P, x) for Ti in T])
|
|
else: dataDict["V"] = None
|
|
dataList.append(dataDict.copy())
|
|
|
|
rat = np.array([5.5, 3.05])
|
|
mul = 2.25
|
|
#fig = plt.figure(figsize=(297/div,210/div))
|
|
fig = plt.figure(figsize=rat * mul)
|
|
|
|
ax = fig.add_subplot(121)
|
|
ax.set_xlabel(self.tempLabel)
|
|
ax.set_ylabel(self.densLabel)
|
|
fig.suptitle(r'Aqueous solutions with a concentration of 0.0', fontsize='x-large', fontweight='bold')
|
|
|
|
#obj = water
|
|
#T = np.linspace(obj.Tmin, obj.Tmax, num=int(obj.Tmax-obj.Tmin))
|
|
# D =
|
|
|
|
#import matplotlib.pyplot as plt
|
|
#from itertools import cycle
|
|
lines = ["-", "--", "-.", ":"]
|
|
colours = ['r', 'g', 'b', 'c', 'm']
|
|
|
|
linecycler = itertools.cycle(lines)
|
|
colourcycler = itertools.cycle(colours)
|
|
|
|
for i in range(len(dataList) - 1):
|
|
obj = dataList[i]
|
|
if not obj["T"] is None and not obj["D"] is None:
|
|
if obj["x"] == 0.0 and np.any(np.isfinite(obj["D"])) and obj["name"] != "NBS":
|
|
lc = next(colourcycler)
|
|
if lc == colours[0]: ls = next(linecycler)
|
|
ax.plot(obj["T"], obj["D"], label="{0}: {1}".format(obj["name"], obj["desc"]), ls=ls, color=lc)
|
|
# if not np.any(np.isfinite(obj["D"])):
|
|
# print("Name: {0}, Dmin: {1}, Dmax: {1}".format(obj["name"],np.min(obj["D"]),np.max(obj["D"])))
|
|
|
|
# Skip pure water
|
|
#obj = (item for item in dataList if item["name"] == "NBS").next()
|
|
#ax.plot(obj["T"], obj["D"], label="{0}: {1}".format(obj["name"], obj["desc"]), ls='-', color='black')
|
|
|
|
ax.legend(bbox_to_anchor=(1.05, 1), loc=2, borderaxespad=0., ncol=1) # , prop={'size':'smaller'})
|
|
plt.tight_layout(rect=(0, 0, 1, 0.95))
|
|
plt.savefig("all_solutions_00.pdf")
|
|
return 0
|
|
|
|
#####################################
|
|
# Table generation routines
|
|
#####################################
|
|
# See http://stackoverflow.com/questions/11347505/what-are-some-approaches-to-outputting-a-python-data-structure-to-restructuredte
|
|
def make_table(self, grid):
|
|
max_cols = [max(out) for out in map(list, zip(*[[len(item) for item in row] for row in grid]))]
|
|
rst = self.table_div(max_cols, 1)
|
|
for i, row in enumerate(grid):
|
|
header_flag = False
|
|
if i == 0 or i == len(grid) - 1: header_flag = True
|
|
rst += self.normalize_row(row, max_cols)
|
|
rst += self.table_div(max_cols, header_flag)
|
|
return rst
|
|
|
|
def table_div(self, max_cols, header_flag=1, indent=2):
|
|
out = u""
|
|
for i in range(indent):
|
|
out += u" "
|
|
if header_flag == 1:
|
|
style = u"="
|
|
else:
|
|
style = u"-"
|
|
for max_col in max_cols:
|
|
out += max_col * style + u" "
|
|
out += u"\n"
|
|
return out
|
|
|
|
def normalize_row(self, row, max_cols, indent=2):
|
|
r = u""
|
|
for i in range(indent):
|
|
r += u" "
|
|
|
|
for i, max_col in enumerate(max_cols):
|
|
r += row[i] + (max_col - len(row[i]) + 1) * u" "
|
|
return r + u"\n"
|
|
|
|
def writeTextToFile(self, path, text):
|
|
#print("Writing to file: {0}".format(path))
|
|
if not os.path.exists(os.path.dirname(path)):
|
|
os.makedirs(os.path.dirname(path))
|
|
with open(path, 'w') as f:
|
|
f.write(text)
|
|
|
|
return True
|
|
|
|
def writeTxtTableToFile(self, path, table, head=u""):
|
|
if not head == u"":
|
|
return self.writeTextToFile(path + ".txt", head + u"\n\n" + self.make_table(table))
|
|
return self.writeTextToFile(path + ".txt", self.make_table(table))
|
|
|
|
def writeCsvTableToFile(self, path, table):
|
|
if not os.path.exists(os.path.dirname(path + ".csv")):
|
|
os.makedirs(os.path.dirname(path + ".csv"))
|
|
with codecs.open(path + ".csv", 'w', encoding='utf-8') as f:
|
|
writer = csv.writer(f)
|
|
# writer = UnicodeWriter(f)
|
|
writer.writerows(table)
|
|
return True
|
|
|
|
# Interface
|
|
def writeTableToFile(self, path, table):
|
|
self.writeCsvTableToFile(path, table)
|
|
# self.writeTxtTableToFile(path,table)
|
|
return True
|
|
|
|
def getReportLink(self, name):
|
|
reportFile = os.path.join("..", "_static", "fluid_properties", "Incompressibles_reports", "{0}_fitreport.{1}".format(name, self.ext))
|
|
return self.d(name, reportFile)
|
|
|
|
def getCitation(self, keys):
|
|
return u":cite:`{0}`".format(keys)
|
|
|
|
def checkForNumber(self, number):
|
|
try:
|
|
n = float(number)
|
|
except:
|
|
n = np.NAN
|
|
pass
|
|
return n
|
|
|
|
def d(self, text, target):
|
|
# try:
|
|
# if os.path.isfile(target):
|
|
# link = ":download:`{0}<{1}>`".format(text,target)
|
|
# else:
|
|
# link = "{0}".format(text)
|
|
# except:
|
|
# link = "{0}".format(text)
|
|
# pass
|
|
# TODO: Fix this!
|
|
link = u":download:`{0}<{1}>`".format(text, target)
|
|
return link
|
|
|
|
def m(self, math):
|
|
text = u":math:`{0}`".format(math)
|
|
return text
|
|
|
|
def c(self, number):
|
|
#text = "{0:5.2f} |degC|".format(self.checkForNumber(number)-273.15)
|
|
text = u"{0:5.2f}".format(self.checkForNumber(number) - 273.15)
|
|
return text
|
|
|
|
def x(self, number):
|
|
text = u"{0:3.2f}".format(self.checkForNumber(number))
|
|
return text
|
|
|
|
def generateTexTable(self, solObjs=[SolutionData()], path="table"):
|
|
|
|
solObjs = sorted(solObjs, key=lambda x: x.name)
|
|
xmin = np.array([x.xmin for x in solObjs])
|
|
xmax = np.array([x.xmax for x in solObjs])
|
|
|
|
# TODO: This is a dirty hack!
|
|
if np.any(xmin > 0.0) and np.any(xmax < 1.0): use_x = True
|
|
else: use_x = False
|
|
|
|
header = [r'Name', r'Description', r'Reference', r'{$T_\text{min}$ (\si{\celsius})}', r'{$T_\text{max}$ (\si{\celsius})}', r'{$T_\text{base}$ (\si{\kelvin})}']
|
|
if use_x: header.extend([r'{$x_\text{min}$}', r'{$x_\text{max}$}'])
|
|
|
|
testTable = []
|
|
testTable.append(header) # Headline
|
|
|
|
testSection = []
|
|
|
|
figPath = r"appendices/IncompressibleFluidsReports/"
|
|
|
|
# def getFigureText(fld):
|
|
# text = "\\begin{pgffigure} \n"
|
|
# text += "\\fbox{\\resizebox{\\textwidth}{!}{ \n"
|
|
# text += "\\subimport{"+str(figPath)+"}{"+str(fld)+"_fitreport.pgf} \n"
|
|
# text += "}} \n"
|
|
# text += "\\end{pgffigure} \n"
|
|
# return text
|
|
def getFigureText(fld):
|
|
text = "{\\centering"
|
|
text += "\\resizebox{\\textwidth}{!}{ \n"
|
|
text += "\\subimport{" + str(figPath) + "}{" + str(fld) + "_fitreport.pgf} \n"
|
|
text += "}} \\vfill \n"
|
|
return text
|
|
|
|
def getFigureLabel(fld):
|
|
return "subsec:fit" + str(fld)
|
|
|
|
for fluid in solObjs:
|
|
# \hyperref[label_name]{''link text''}
|
|
testTable.append([
|
|
fluid.name + ", p.~\\pageref{" + getFigureLabel(fluid.name) + "}",
|
|
fluid.description.encode("latex"),
|
|
r'\cite{' + str(fluid.reference) + '}',
|
|
self.c(fluid.Tmin),
|
|
self.c(fluid.Tmax),
|
|
self.c(fluid.Tbase + 273.15)
|
|
])
|
|
if use_x: testTable[-1].extend([self.x(fluid.xmin), self.x(fluid.xmax)])
|
|
|
|
testSection.append([
|
|
"\\subsection{Fitted functions for " + str(fluid.name) + "}",
|
|
"\\label{" + getFigureLabel(fluid.name) + "}",
|
|
getFigureText(fluid.name)
|
|
])
|
|
|
|
text = "\\cr \\topcrule \n"
|
|
i = -1
|
|
for row in testTable:
|
|
for i__ in range(len(row)):
|
|
try: row[i__] = str(row[i__], encoding ="utf-8")
|
|
except: pass
|
|
i += 1
|
|
if i < 1:
|
|
tmp = r"\headcol " + " & ".join(row)
|
|
elif i % 2 == 0:
|
|
tmp = r"\rowcol " + " & ".join(row)
|
|
else:
|
|
tmp = " & ".join(row)
|
|
text += tmp + " \\\\\n"
|
|
if i == 0: text += "\\midcrule \n"
|
|
|
|
if i % 2 == 0:
|
|
text += "\\bottomcrule \\cr \n"
|
|
else:
|
|
text += "\\bottomrule \\cr \n"
|
|
|
|
with open(path + ".tex", 'w') as f:
|
|
f.write(text)
|
|
|
|
|
|
text = "\n"
|
|
for i, row in enumerate(testSection):
|
|
for i__ in range(len(row)):
|
|
try: row[i__] = str(row[i__], encoding ="utf-8")
|
|
except: pass
|
|
tmp = "\n".join(row)
|
|
text += tmp + " \n\n"
|
|
|
|
with open(path + "-section.tex", 'w') as f:
|
|
f.write(text)
|
|
|
|
return True
|
|
|
|
def generateStatsTable(self, objLists=[[SolutionData()]], labelList=[]):
|
|
|
|
if len(objLists) != len(labelList):
|
|
raise ValueError("Wrong length")
|
|
|
|
header = [u'Property']
|
|
header.extend(labelList)
|
|
|
|
testTable = []
|
|
testTable.append(header) # Headline
|
|
|
|
def getEntries(solObj):
|
|
data = {}
|
|
data["name"] = dict(type=solObj.name, nrms=solObj.name)
|
|
|
|
kt = [("density", solObj.density),
|
|
("specific_heat", solObj.specific_heat),
|
|
("conductivity", solObj.conductivity),
|
|
("viscosity", solObj.viscosity),
|
|
("saturation_pressure", solObj.saturation_pressure),
|
|
("T_freeze", solObj.T_freeze)]
|
|
|
|
for k, _ in kt: data[k] = {}
|
|
|
|
for k, t in kt:
|
|
try:
|
|
data[k]["type"] = t.type
|
|
except:
|
|
data[k]["type"] = None
|
|
try:
|
|
data[k]["nrms"] = t.NRMS
|
|
except:
|
|
data[k]["nrms"] = None
|
|
|
|
return data
|
|
|
|
errcolumns = []
|
|
typcolumns = []
|
|
for group in objLists:
|
|
errcolumn = {}
|
|
typcolumn = {}
|
|
for obj in group:
|
|
dat = getEntries(obj)
|
|
for k in dat:
|
|
ent = errcolumn.get(k, [])
|
|
ent.append(dat[k]["nrms"])
|
|
errcolumn[k] = ent
|
|
ent = typcolumn.get(k, [])
|
|
ent.append(dat[k]["type"])
|
|
typcolumn[k] = ent
|
|
for k in errcolumn:
|
|
if k != "name":
|
|
for i, _ in enumerate(errcolumn[k]):
|
|
try:
|
|
errcolumn[k][i] = float(errcolumn[k][i])
|
|
except:
|
|
errcolumn[k][i] = np.NAN
|
|
# try:
|
|
# typcolumn[k][i] = float(typcolumn[k][i])
|
|
# except:
|
|
# typcolumn[k][i] = np.NAN
|
|
|
|
errcolumns.append(errcolumn)
|
|
typcolumns.append(typcolumn)
|
|
|
|
keys = errcolumns[0].keys()
|
|
|
|
errTable = copy.copy(testTable)
|
|
typTable = copy.copy(testTable)
|
|
|
|
for k in keys:
|
|
if k != "name":
|
|
# Error lines
|
|
maxLine = []
|
|
avgLine = []
|
|
minLine = []
|
|
|
|
minLine.append("{0:25s}".format(k))
|
|
avgLine.append("{0:25s}".format(""))
|
|
maxLine.append("{0:25s}".format(""))
|
|
|
|
# Function type lines
|
|
polyLine = []
|
|
expoLine = []
|
|
logeLine = []
|
|
expPLine = []
|
|
|
|
polyLine.append("{0:25s}".format(k))
|
|
expoLine.append("{0:25s}".format("exp"))
|
|
logeLine.append("{0:25s}".format("logexp"))
|
|
expPLine.append("{0:25s}".format("exppoly"))
|
|
|
|
#print(k+": ", end="")
|
|
for e, t in zip(errcolumns, typcolumns):
|
|
try: mi = np.nanargmin(e[k])
|
|
except: mi = 0
|
|
try: ma = np.nanargmax(e[k])
|
|
except: ma = 0
|
|
try: av = np.nanmean(e[k])
|
|
except: av = 0.0
|
|
#print("min: {0}({1}), avg: {2}, max: {3}({4})".format(c[k][mi],c["name"][mi],av,c[k][ma],c["name"][ma]),end="")
|
|
minLine.append("{0:5.3f} ({1:5s})".format(e[k][mi] * 100.0, e["name"][mi]))
|
|
avgLine.append("{0:5.3f} {1:5s} ".format(av * 100.0, ""))
|
|
maxLine.append("{0:5.3f} ({1:5s})".format(e[k][ma] * 100.0, e["name"][ma]))
|
|
|
|
polyLine.append("{0:3d}".format(t[k].count(IncompressibleData.INCOMPRESSIBLE_POLYNOMIAL)))
|
|
expoLine.append("{0:3d}".format(t[k].count(IncompressibleData.INCOMPRESSIBLE_EXPONENTIAL)))
|
|
logeLine.append("{0:3d}".format(t[k].count(IncompressibleData.INCOMPRESSIBLE_LOGEXPONENTIAL)))
|
|
expPLine.append("{0:3d}".format(t[k].count(IncompressibleData.INCOMPRESSIBLE_EXPPOLYNOMIAL)))
|
|
print(t[k])
|
|
|
|
#print(" ")
|
|
errTable.append(minLine)
|
|
errTable.append(avgLine)
|
|
errTable.append(maxLine)
|
|
errTable.append([r"\midrule"])
|
|
|
|
typTable.append(polyLine)
|
|
typTable.append(expoLine)
|
|
typTable.append(logeLine)
|
|
typTable.append(expPLine)
|
|
typTable.append([r"\midrule"])
|
|
|
|
errString = ""
|
|
for lin in errTable:
|
|
errString += " & ".join(lin) + "\\\\ \n"
|
|
print(errString)
|
|
|
|
typString = ""
|
|
for lin in typTable:
|
|
typString += " & ".join(lin) + "\\\\ \n"
|
|
print(typString)
|
|
|
|
return True
|
|
#
|
|
#
|
|
#
|
|
# figPath = r"appendices/IncompressibleFluidsReports/"
|
|
#
|
|
# # def getFigureText(fld):
|
|
# # text = "\\begin{pgffigure} \n"
|
|
# # text += "\\fbox{\\resizebox{\\textwidth}{!}{ \n"
|
|
# # text += "\\subimport{"+str(figPath)+"}{"+str(fld)+"_fitreport.pgf} \n"
|
|
# # text += "}} \n"
|
|
# # text += "\\end{pgffigure} \n"
|
|
# # return text
|
|
# def getFigureText(fld):
|
|
# text = "{\\centering"
|
|
# text += "\\resizebox{\\textwidth}{!}{ \n"
|
|
# text += "\\subimport{"+str(figPath)+"}{"+str(fld)+"_fitreport.pgf} \n"
|
|
# text += "}} \\vfill \n"
|
|
# return text
|
|
#
|
|
# def getFigureLabel(fld):
|
|
# return "subsec:fit"+str(fld)
|
|
#
|
|
# for fluid in solObjs:
|
|
# #\hyperref[label_name]{''link text''}
|
|
# testTable.append([
|
|
# fluid.name+", p.~\\pageref{"+getFigureLabel(fluid.name)+"}",
|
|
# fluid.description.encode("latex"),
|
|
# r'\cite{'+str(fluid.reference)+'}',
|
|
# self.c(fluid.Tmin),
|
|
# self.c(fluid.Tmax),
|
|
# self.c(fluid.Tbase+273.15)
|
|
# ])
|
|
# if use_x: testTable[-1].extend([self.x(fluid.xmin), self.x(fluid.xmax)])
|
|
#
|
|
# testSection.append([
|
|
# "\\subsection{Fitted functions for "+str(fluid.name)+"}",
|
|
# "\\label{"+getFigureLabel(fluid.name)+"}",
|
|
# getFigureText(fluid.name)
|
|
# ])
|
|
#
|
|
# text = "\\cr \\topcrule \n"
|
|
# i = -1
|
|
# for row in testTable:
|
|
# i += 1
|
|
# if i < 1:
|
|
# tmp = r"\headcol "+" & ".join(row)
|
|
# elif i % 2 == 0:
|
|
# tmp = r"\rowcol " +" & ".join(row)
|
|
# else:
|
|
# tmp = " & ".join(row)
|
|
# text += tmp + " \\\\\n"
|
|
# if i == 0: text += "\\midcrule \n"
|
|
#
|
|
# if i % 2 == 0:
|
|
# text += "\\bottomcrule \\cr \n"
|
|
# else:
|
|
# text += "\\bottomrule \\cr \n"
|
|
#
|
|
# with open(path+".tex", 'w') as f:
|
|
# f.write(text.encode('utf-8'))
|
|
#
|
|
# text = "\n"
|
|
# for i,row in enumerate(testSection):
|
|
# tmp = "\n".join(row)
|
|
# text += tmp + " \n\n"
|
|
#
|
|
# with open(path+"-section.tex", 'w') as f:
|
|
# f.write(text.encode('utf-8'))
|
|
#
|
|
# return True
|
|
|
|
def generateRstTable(self, solObjs=[SolutionData()], path="table"):
|
|
|
|
solObjs = sorted(solObjs, key=lambda x: x.name)
|
|
xmin = np.array([x.xmin for x in solObjs])
|
|
xmax = np.array([x.xmax for x in solObjs])
|
|
|
|
# TODO: This is a dirty hack!
|
|
if np.any(xmin > 0.0) and np.any(xmax < 1.0): use_x = True
|
|
else: use_x = False
|
|
|
|
header = [u'Name', u'Description', u'Reference', \
|
|
self.m(u'T_\\text{min}') + u" (°C)", self.m(u'T_\\text{max}') + u" (°C)", self.m(u'T_\\text{base}') + u" (K)"]
|
|
if use_x: header.extend([self.m(u'x_\\text{min}'), self.m(u'x_\\text{max}')])
|
|
|
|
testTable = []
|
|
testTable.append(header) # Headline
|
|
for fluid in solObjs:
|
|
testTable.append([
|
|
self.getReportLink(fluid.name),
|
|
fluid.description,
|
|
self.getCitation(fluid.reference),
|
|
self.c(fluid.Tmin),
|
|
self.c(fluid.Tmax),
|
|
self.c(fluid.Tbase + 273.15)
|
|
])
|
|
if use_x: testTable[-1].extend([self.x(fluid.xmin), self.x(fluid.xmax)])
|
|
|
|
self.writeTableToFile(path, testTable)
|
|
return True
|