ci: reset main to tag

* feat(tlsn): session type

* simpify example

* fmt

.github/workflows/releng.yml

@@ -6,7 +6,7 @@ on:
       tag:
         description: 'Tag to publish to NPM'
         required: true
-        default: 'v0.1.0-alpha.14-pre'
+        default: 'v0.1.0-alpha.14'
 
 jobs:
   release:

.github/workflows/updatemain.yml

@@ -1,4 +1,4 @@
-name: Fast-forward main branch to published release tag
+name: Reset main branch to published release tag
 
 on:
   workflow_dispatch:
@@ -6,7 +6,7 @@ on:
     types: [published]
 
 jobs:
-  ff-main-to-release:
+  reset-main-to-release:
     runs-on: ubuntu-latest
     permissions:
       contents: write
@@ -17,9 +17,9 @@ jobs:
         with:
           ref: main
 
-      - name: Fast-forward main to release tag
+      - name: Reset main to release tag
         run: |
           tag="${{ github.event.release.tag_name }}"
           git fetch origin "refs/tags/$tag:refs/tags/$tag"
-          git merge --ff-only "refs/tags/$tag"
+          git reset --hard "refs/tags/$tag"
-          git push origin main
+          git push --force origin main

Cargo.toml

@@ -53,6 +53,7 @@ tlsn-formats = { path = "crates/formats" }
 tlsn-hmac-sha256 = { path = "crates/components/hmac-sha256" }
 tlsn-key-exchange = { path = "crates/components/key-exchange" }
 tlsn-mpc-tls = { path = "crates/mpc-tls" }
+tlsn-mux = { git = "https://github.com/tlsnotary/tlsn-utils", rev = "d9facb6" }
 tlsn-server-fixture = { path = "crates/server-fixture/server" }
 tlsn-server-fixture-certs = { path = "crates/server-fixture/certs" }
 tlsn-tls-backend = { path = "crates/tls/backend" }
@@ -66,32 +67,32 @@ tlsn-harness-runner = { path = "crates/harness/runner" }
 tlsn-wasm = { path = "crates/wasm" }
 tlsn = { path = "crates/tlsn" }
 
-mpz-circuits = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-circuits = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
-mpz-circuits-data = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-circuits-data = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
-mpz-memory-core = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-memory-core = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
-mpz-common = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-common = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
-mpz-core = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-core = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
-mpz-vm-core = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-vm-core = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
-mpz-garble = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-garble = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
-mpz-garble-core = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-garble-core = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
-mpz-ole = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-ole = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
-mpz-ot = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-ot = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
-mpz-share-conversion = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-share-conversion = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
-mpz-fields = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-fields = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
-mpz-zk = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-zk = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
-mpz-hash = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-hash = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
-mpz-ideal-vm = { git = "https://github.com/privacy-ethereum/mpz", rev = "9c343f8" }
+mpz-ideal-vm = { git = "https://github.com/privacy-ethereum/mpz", tag = "v0.1.0-alpha.5" }
 
 rangeset = { version = "0.4" }
 serio = { version = "0.2" }
 spansy = { git = "https://github.com/tlsnotary/tlsn-utils", rev = "6f1a934" }
-uid-mux = { version = "0.2" }
 websocket-relay = { git = "https://github.com/tlsnotary/tlsn-utils", rev = "6f1a934" }
 
 aead = { version = "0.4" }
 aes = { version = "0.8" }
 aes-gcm = { version = "0.9" }
 anyhow = { version = "1.0" }
+async_io_stream = { version = "0.3" }
 async-trait = { version = "0.1" }
 axum = { version = "0.8" }
 bcs = { version = "0.1" }

crates/attestation/Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "tlsn-attestation"
-version = "0.1.0-alpha.14-pre"
+version = "0.1.0-alpha.14"
 edition = "2024"
 
 [features]
@@ -27,6 +27,7 @@ alloy-primitives = { version = "1.3.1", default-features = false }
 alloy-signer = { version = "1.0", default-features = false }
 alloy-signer-local = { version = "1.0", default-features = false }
 rand06-compat = { workspace = true }
+rangeset = { workspace = true }
 rstest = { workspace = true }
 tlsn-core = { workspace = true, features = ["fixtures"] }
 tlsn-data-fixtures = { workspace = true }

crates/attestation/src/builder.rs

@@ -5,7 +5,7 @@ use rand::{Rng, rng};
 use tlsn_core::{
     connection::{ConnectionInfo, ServerEphemKey},
     hash::HashAlgId,
-    transcript::{TranscriptCommitment, encoding::EncoderSecret},
+    transcript::TranscriptCommitment,
 };
 
 use crate::{
@@ -25,7 +25,6 @@ pub struct Sign {
     connection_info: Option<ConnectionInfo>,
     server_ephemeral_key: Option<ServerEphemKey>,
     cert_commitment: ServerCertCommitment,
-    encoder_secret: Option<EncoderSecret>,
     extensions: Vec<Extension>,
     transcript_commitments: Vec<TranscriptCommitment>,
 }
@@ -87,7 +86,6 @@ impl<'a> AttestationBuilder<'a, Accept> {
                 connection_info: None,
                 server_ephemeral_key: None,
                 cert_commitment,
-                encoder_secret: None,
                 transcript_commitments: Vec::new(),
                 extensions,
             },
@@ -108,12 +106,6 @@ impl AttestationBuilder<'_, Sign> {
         self
     }
 
-    /// Sets the secret for encoding commitments.
-    pub fn encoder_secret(&mut self, secret: EncoderSecret) -> &mut Self {
-        self.state.encoder_secret = Some(secret);
-        self
-    }
-
     /// Adds an extension to the attestation.
     pub fn extension(&mut self, extension: Extension) -> &mut Self {
         self.state.extensions.push(extension);
@@ -137,7 +129,6 @@ impl AttestationBuilder<'_, Sign> {
             connection_info,
             server_ephemeral_key,
             cert_commitment,
-            encoder_secret,
             extensions,
             transcript_commitments,
         } = self.state;
@@ -168,7 +159,6 @@ impl AttestationBuilder<'_, Sign> {
                 AttestationBuilderError::new(ErrorKind::Field, "handshake data was not set")
             })?),
             cert_commitment: field_id.next(cert_commitment),
-            encoder_secret: encoder_secret.map(|secret| field_id.next(secret)),
             extensions: extensions
                 .into_iter()
                 .map(|extension| field_id.next(extension))
@@ -253,8 +243,7 @@ mod test {
     use rstest::{fixture, rstest};
     use tlsn_core::{
         connection::{CertBinding, CertBindingV1_2},
-        fixtures::{ConnectionFixture, encoding_provider},
+        fixtures::ConnectionFixture,
-        hash::Blake3,
         transcript::Transcript,
     };
     use tlsn_data_fixtures::http::{request::GET_WITH_HEADER, response::OK_JSON};
@@ -285,13 +274,7 @@ mod test {
         let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
         let connection = ConnectionFixture::tlsnotary(transcript.length());
 
-        let RequestFixture { request, .. } = request_fixture(
+        let RequestFixture { request, .. } = request_fixture(transcript, connection, Vec::new());
-            transcript,
-            encoding_provider(GET_WITH_HEADER, OK_JSON),
-            connection,
-            Blake3::default(),
-            Vec::new(),
-        );
 
         let attestation_config = AttestationConfig::builder()
             .supported_signature_algs([SignatureAlgId::SECP256R1])
@@ -310,13 +293,7 @@ mod test {
         let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
         let connection = ConnectionFixture::tlsnotary(transcript.length());
 
-        let RequestFixture { request, .. } = request_fixture(
+        let RequestFixture { request, .. } = request_fixture(transcript, connection, Vec::new());
-            transcript,
-            encoding_provider(GET_WITH_HEADER, OK_JSON),
-            connection,
-            Blake3::default(),
-            Vec::new(),
-        );
 
         let attestation_config = AttestationConfig::builder()
             .supported_signature_algs([SignatureAlgId::SECP256K1])
@@ -336,13 +313,7 @@ mod test {
         let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
         let connection = ConnectionFixture::tlsnotary(transcript.length());
 
-        let RequestFixture { request, .. } = request_fixture(
+        let RequestFixture { request, .. } = request_fixture(transcript, connection, Vec::new());
-            transcript,
-            encoding_provider(GET_WITH_HEADER, OK_JSON),
-            connection,
-            Blake3::default(),
-            Vec::new(),
-        );
 
         let attestation_builder = Attestation::builder(attestation_config)
             .accept_request(request)
@@ -363,13 +334,8 @@ mod test {
         let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
         let connection = ConnectionFixture::tlsnotary(transcript.length());
 
-        let RequestFixture { request, .. } = request_fixture(
+        let RequestFixture { request, .. } =
-            transcript,
+            request_fixture(transcript, connection.clone(), Vec::new());
-            encoding_provider(GET_WITH_HEADER, OK_JSON),
-            connection.clone(),
-            Blake3::default(),
-            Vec::new(),
-        );
 
         let mut attestation_builder = Attestation::builder(attestation_config)
             .accept_request(request)
@@ -393,13 +359,8 @@ mod test {
         let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
         let connection = ConnectionFixture::tlsnotary(transcript.length());
 
-        let RequestFixture { request, .. } = request_fixture(
+        let RequestFixture { request, .. } =
-            transcript,
+            request_fixture(transcript, connection.clone(), Vec::new());
-            encoding_provider(GET_WITH_HEADER, OK_JSON),
-            connection.clone(),
-            Blake3::default(),
-            Vec::new(),
-        );
 
         let mut attestation_builder = Attestation::builder(attestation_config)
             .accept_request(request)
@@ -432,9 +393,7 @@ mod test {
 
         let RequestFixture { request, .. } = request_fixture(
             transcript,
-            encoding_provider(GET_WITH_HEADER, OK_JSON),
             connection.clone(),
-            Blake3::default(),
             vec![Extension {
                 id: b"foo".to_vec(),
                 value: b"bar".to_vec(),
@@ -461,9 +420,7 @@ mod test {
 
         let RequestFixture { request, .. } = request_fixture(
             transcript,
-            encoding_provider(GET_WITH_HEADER, OK_JSON),
             connection.clone(),
-            Blake3::default(),
             vec![Extension {
                 id: b"foo".to_vec(),
                 value: b"bar".to_vec(),

crates/attestation/src/fixtures.rs

@@ -2,11 +2,7 @@
 use tlsn_core::{
     connection::{CertBinding, CertBindingV1_2},
     fixtures::ConnectionFixture,
-    hash::HashAlgorithm,
+    transcript::{Transcript, TranscriptCommitConfigBuilder, TranscriptCommitment},
-    transcript::{
-        Transcript, TranscriptCommitConfigBuilder, TranscriptCommitment,
-        encoding::{EncodingProvider, EncodingTree},
-    },
 };
 
 use crate::{
@@ -21,16 +17,13 @@ use crate::{
 /// A Request fixture used for testing.
 #[allow(missing_docs)]
 pub struct RequestFixture {
-    pub encoding_tree: EncodingTree,
     pub request: Request,
 }
 
 /// Returns a request fixture for testing.
 pub fn request_fixture(
     transcript: Transcript,
-    encodings_provider: impl EncodingProvider,
     connection: ConnectionFixture,
-    encoding_hasher: impl HashAlgorithm,
     extensions: Vec<Extension>,
 ) -> RequestFixture {
     let provider = CryptoProvider::default();
@@ -50,16 +43,10 @@ pub fn request_fixture(
         .unwrap();
     let transcripts_commitment_config = transcript_commitment_builder.build().unwrap();
 
-    // Prover constructs encoding tree.
-    let encoding_tree = EncodingTree::new(
-        &encoding_hasher,
-        transcripts_commitment_config.iter_encoding(),
-        &encodings_provider,
-    )
-    .unwrap();
-
     let mut builder = RequestConfig::builder();
 
+    builder.transcript_commit(transcripts_commitment_config);
+
     for extension in extensions {
         builder.extension(extension);
     }
@@ -74,10 +61,7 @@ pub fn request_fixture(
 
     let (request, _) = request_builder.build(&provider).unwrap();
 
-    RequestFixture {
+    RequestFixture { request }
-        encoding_tree,
-        request,
-    }
 }
 
 /// Returns an attestation fixture for testing.

crates/attestation/src/lib.rs

@@ -79,8 +79,6 @@
 //!
 //! // Specify all the transcript commitments we want to make.
 //! builder
-//!     // Use BLAKE3 for encoding commitments.
-//!     .encoding_hash_alg(HashAlgId::BLAKE3)
 //!     // Commit to all sent data.
 //!     .commit_sent(&(0..sent_len))?
 //!     // Commit to the first 10 bytes of sent data.
@@ -129,7 +127,7 @@
 //!
 //! ```no_run
 //! # use tlsn_attestation::{Attestation, CryptoProvider, Secrets, presentation::Presentation};
-//! # use tlsn_core::transcript::{TranscriptCommitmentKind, Direction};
+//! # use tlsn_core::transcript::Direction;
 //! # fn main() -> Result<(), Box<dyn std::error::Error>> {
 //! # let attestation: Attestation = unimplemented!();
 //! # let secrets: Secrets = unimplemented!();
@@ -140,8 +138,6 @@
 //! let mut builder = secrets.transcript_proof_builder();
 //!
 //! builder
-//!     // Use transcript encoding commitments.
-//!     .commitment_kinds(&[TranscriptCommitmentKind::Encoding])
 //!     // Disclose the first 10 bytes of the sent data.
 //!     .reveal(&(0..10), Direction::Sent)?
 //!     // Disclose all of the received data.
@@ -219,7 +215,7 @@ use tlsn_core::{
     connection::{ConnectionInfo, ServerEphemKey},
     hash::{Hash, HashAlgorithm, TypedHash},
     merkle::MerkleTree,
-    transcript::{TranscriptCommitment, encoding::EncoderSecret},
+    transcript::TranscriptCommitment,
 };
 
 use crate::{
@@ -301,8 +297,6 @@ pub enum FieldKind {
     ServerEphemKey = 0x02,
     /// Server identity commitment.
     ServerIdentityCommitment = 0x03,
-    /// Encoding commitment.
-    EncodingCommitment = 0x04,
     /// Plaintext hash commitment.
     PlaintextHash = 0x05,
 }
@@ -327,7 +321,6 @@ pub struct Body {
     connection_info: Field<ConnectionInfo>,
     server_ephemeral_key: Field<ServerEphemKey>,
     cert_commitment: Field<ServerCertCommitment>,
-    encoder_secret: Option<Field<EncoderSecret>>,
     extensions: Vec<Field<Extension>>,
     transcript_commitments: Vec<Field<TranscriptCommitment>>,
 }
@@ -373,7 +366,6 @@ impl Body {
             connection_info: conn_info,
             server_ephemeral_key,
             cert_commitment,
-            encoder_secret,
             extensions,
             transcript_commitments,
         } = self;
@@ -391,13 +383,6 @@ impl Body {
             ),
         ];
 
-        if let Some(encoder_secret) = encoder_secret {
-            fields.push((
-                encoder_secret.id,
-                hasher.hash_separated(&encoder_secret.data),
-            ));
-        }
-
         for field in extensions.iter() {
             fields.push((field.id, hasher.hash_separated(&field.data)));
         }

crates/attestation/src/presentation.rs

@@ -91,11 +91,6 @@ impl Presentation {
                 transcript.verify_with_provider(
                     &provider.hash,
                     &attestation.body.connection_info().transcript_length,
-                    attestation
-                        .body
-                        .encoder_secret
-                        .as_ref()
-                        .map(|field| &field.data),
                     attestation.body.transcript_commitments(),
                 )
             })

crates/attestation/src/request.rs

@@ -144,9 +144,7 @@ impl std::fmt::Display for ErrorKind {
 #[cfg(test)]
 mod test {
     use tlsn_core::{
-        connection::TranscriptLength,
+        connection::TranscriptLength, fixtures::ConnectionFixture, hash::HashAlgId,
-        fixtures::{ConnectionFixture, encoding_provider},
-        hash::{Blake3, HashAlgId},
         transcript::Transcript,
     };
     use tlsn_data_fixtures::http::{request::GET_WITH_HEADER, response::OK_JSON};
@@ -164,13 +162,8 @@ mod test {
         let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
         let connection = ConnectionFixture::tlsnotary(transcript.length());
 
-        let RequestFixture { request, .. } = request_fixture(
+        let RequestFixture { request, .. } =
-            transcript,
+            request_fixture(transcript, connection.clone(), Vec::new());
-            encoding_provider(GET_WITH_HEADER, OK_JSON),
-            connection.clone(),
-            Blake3::default(),
-            Vec::new(),
-        );
 
         let attestation =
             attestation_fixture(request.clone(), connection, SignatureAlgId::SECP256K1, &[]);
@@ -185,13 +178,8 @@ mod test {
         let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
         let connection = ConnectionFixture::tlsnotary(transcript.length());
 
-        let RequestFixture { mut request, .. } = request_fixture(
+        let RequestFixture { mut request, .. } =
-            transcript,
+            request_fixture(transcript, connection.clone(), Vec::new());
-            encoding_provider(GET_WITH_HEADER, OK_JSON),
-            connection.clone(),
-            Blake3::default(),
-            Vec::new(),
-        );
 
         let attestation =
             attestation_fixture(request.clone(), connection, SignatureAlgId::SECP256K1, &[]);
@@ -209,13 +197,8 @@ mod test {
         let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
         let connection = ConnectionFixture::tlsnotary(transcript.length());
 
-        let RequestFixture { mut request, .. } = request_fixture(
+        let RequestFixture { mut request, .. } =
-            transcript,
+            request_fixture(transcript, connection.clone(), Vec::new());
-            encoding_provider(GET_WITH_HEADER, OK_JSON),
-            connection.clone(),
-            Blake3::default(),
-            Vec::new(),
-        );
 
         let attestation =
             attestation_fixture(request.clone(), connection, SignatureAlgId::SECP256K1, &[]);
@@ -233,13 +216,8 @@ mod test {
         let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
         let connection = ConnectionFixture::tlsnotary(transcript.length());
 
-        let RequestFixture { mut request, .. } = request_fixture(
+        let RequestFixture { mut request, .. } =
-            transcript,
+            request_fixture(transcript, connection.clone(), Vec::new());
-            encoding_provider(GET_WITH_HEADER, OK_JSON),
-            connection.clone(),
-            Blake3::default(),
-            Vec::new(),
-        );
 
         let attestation =
             attestation_fixture(request.clone(), connection, SignatureAlgId::SECP256K1, &[]);
@@ -265,13 +243,8 @@ mod test {
         let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
         let connection = ConnectionFixture::tlsnotary(transcript.length());
 
-        let RequestFixture { request, .. } = request_fixture(
+        let RequestFixture { request, .. } =
-            transcript,
+            request_fixture(transcript, connection.clone(), Vec::new());
-            encoding_provider(GET_WITH_HEADER, OK_JSON),
-            connection.clone(),
-            Blake3::default(),
-            Vec::new(),
-        );
 
         let mut attestation =
             attestation_fixture(request.clone(), connection, SignatureAlgId::SECP256K1, &[]);
@@ -289,13 +262,8 @@ mod test {
         let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
         let connection = ConnectionFixture::tlsnotary(transcript.length());
 
-        let RequestFixture { request, .. } = request_fixture(
+        let RequestFixture { request, .. } =
-            transcript,
+            request_fixture(transcript, connection.clone(), Vec::new());
-            encoding_provider(GET_WITH_HEADER, OK_JSON),
-            connection.clone(),
-            Blake3::default(),
-            Vec::new(),
-        );
 
         let attestation =
             attestation_fixture(request.clone(), connection, SignatureAlgId::SECP256K1, &[]);

crates/attestation/src/serialize.rs

@@ -49,6 +49,4 @@ impl_domain_separator!(tlsn_core::connection::ConnectionInfo);
 impl_domain_separator!(tlsn_core::connection::CertBinding);
 impl_domain_separator!(tlsn_core::transcript::TranscriptCommitment);
 impl_domain_separator!(tlsn_core::transcript::TranscriptSecret);
-impl_domain_separator!(tlsn_core::transcript::encoding::EncoderSecret);
-impl_domain_separator!(tlsn_core::transcript::encoding::EncodingCommitment);
 impl_domain_separator!(tlsn_core::transcript::hash::PlaintextHash);

crates/attestation/tests/api.rs

@@ -1,3 +1,5 @@
+use rand::{Rng, SeedableRng, rngs::StdRng};
+use rangeset::set::RangeSet;
 use tlsn_attestation::{
     Attestation, AttestationConfig, CryptoProvider,
     presentation::PresentationOutput,
@@ -6,12 +8,11 @@ use tlsn_attestation::{
 };
 use tlsn_core::{
     connection::{CertBinding, CertBindingV1_2},
-    fixtures::{self, ConnectionFixture, encoder_secret},
+    fixtures::ConnectionFixture,
-    hash::Blake3,
+    hash::{Blake3, Blinder, HashAlgId},
     transcript::{
-        Direction, Transcript, TranscriptCommitConfigBuilder, TranscriptCommitment,
+        Direction, Transcript, TranscriptCommitment, TranscriptSecret,
-        TranscriptSecret,
+        hash::{PlaintextHash, PlaintextHashSecret, hash_plaintext},
-        encoding::{EncodingCommitment, EncodingTree},
     },
 };
 use tlsn_data_fixtures::http::{request::GET_WITH_HEADER, response::OK_JSON};
@@ -19,6 +20,7 @@ use tlsn_data_fixtures::http::{request::GET_WITH_HEADER, response::OK_JSON};
 /// Tests that the attestation protocol and verification work end-to-end
 #[test]
 fn test_api() {
+    let mut rng = StdRng::seed_from_u64(0);
     let mut provider = CryptoProvider::default();
 
     // Configure signer for Notary
@@ -26,8 +28,6 @@ fn test_api() {
 
     let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
     let (sent_len, recv_len) = transcript.len();
-    // Plaintext encodings which the Prover obtained from GC evaluation
-    let encodings_provider = fixtures::encoding_provider(GET_WITH_HEADER, OK_JSON);
 
     // At the end of the TLS connection the Prover holds the:
     let ConnectionFixture {
@@ -44,26 +44,38 @@ fn test_api() {
         unreachable!()
     };
 
-    // Prover specifies the ranges it wants to commit to.
+    // Create hash commitments
-    let mut transcript_commitment_builder = TranscriptCommitConfigBuilder::new(&transcript);
+    let hasher = Blake3::default();
-    transcript_commitment_builder
+    let sent_blinder: Blinder = rng.random();
-        .commit_sent(&(0..sent_len))
+    let recv_blinder: Blinder = rng.random();
-        .unwrap()
-        .commit_recv(&(0..recv_len))
-        .unwrap();
 
-    let transcripts_commitment_config = transcript_commitment_builder.build().unwrap();
+    let sent_idx = RangeSet::from(0..sent_len);
+    let recv_idx = RangeSet::from(0..recv_len);
 
-    // Prover constructs encoding tree.
+    let sent_hash_commitment = PlaintextHash {
-    let encoding_tree = EncodingTree::new(
+        direction: Direction::Sent,
-        &Blake3::default(),
+        idx: sent_idx.clone(),
-        transcripts_commitment_config.iter_encoding(),
+        hash: hash_plaintext(&hasher, transcript.sent(), &sent_blinder),
-        &encodings_provider,
+    };
-    )
-    .unwrap();
 
-    let encoding_commitment = EncodingCommitment {
+    let recv_hash_commitment = PlaintextHash {
-        root: encoding_tree.root(),
+        direction: Direction::Received,
+        idx: recv_idx.clone(),
+        hash: hash_plaintext(&hasher, transcript.received(), &recv_blinder),
+    };
+
+    let sent_hash_secret = PlaintextHashSecret {
+        direction: Direction::Sent,
+        idx: sent_idx,
+        alg: HashAlgId::BLAKE3,
+        blinder: sent_blinder,
+    };
+
+    let recv_hash_secret = PlaintextHashSecret {
+        direction: Direction::Received,
+        idx: recv_idx,
+        alg: HashAlgId::BLAKE3,
+        blinder: recv_blinder,
     };
 
     let request_config = RequestConfig::default();
@@ -74,8 +86,14 @@ fn test_api() {
         .handshake_data(server_cert_data)
         .transcript(transcript)
         .transcript_commitments(
-            vec![TranscriptSecret::Encoding(encoding_tree)],
+            vec![
-            vec![TranscriptCommitment::Encoding(encoding_commitment.clone())],
+                TranscriptSecret::Hash(sent_hash_secret),
+                TranscriptSecret::Hash(recv_hash_secret),
+            ],
+            vec![
+                TranscriptCommitment::Hash(sent_hash_commitment.clone()),
+                TranscriptCommitment::Hash(recv_hash_commitment.clone()),
+            ],
         );
 
     let (request, secrets) = request_builder.build(&provider).unwrap();
@@ -95,8 +113,10 @@ fn test_api() {
         .connection_info(connection_info.clone())
         // Server key Notary received during handshake
         .server_ephemeral_key(server_ephemeral_key)
-        .encoder_secret(encoder_secret())
+        .transcript_commitments(vec![
-        .transcript_commitments(vec![TranscriptCommitment::Encoding(encoding_commitment)]);
+            TranscriptCommitment::Hash(sent_hash_commitment),
+            TranscriptCommitment::Hash(recv_hash_commitment),
+        ]);
 
     let attestation = attestation_builder.build(&provider).unwrap();
 

crates/components/cipher/Cargo.toml

@@ -5,7 +5,7 @@ description = "This crate provides implementations of ciphers for two parties"
 keywords = ["tls", "mpc", "2pc", "aes"]
 categories = ["cryptography"]
 license = "MIT OR Apache-2.0"
-version = "0.1.0-alpha.14-pre"
+version = "0.1.0-alpha.14"
 edition = "2021"
 
 [lints]

crates/components/deap/Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "tlsn-deap"
-version = "0.1.0-alpha.14-pre"
+version = "0.1.0-alpha.14"
 edition = "2021"
 
 [lints]

crates/components/hmac-sha256/Cargo.toml

@@ -5,7 +5,7 @@ description = "A 2PC implementation of TLS HMAC-SHA256 PRF"
 keywords = ["tls", "mpc", "2pc", "hmac", "sha256"]
 categories = ["cryptography"]
 license = "MIT OR Apache-2.0"
-version = "0.1.0-alpha.14-pre"
+version = "0.1.0-alpha.14"
 edition = "2021"
 
 [lints]

crates/components/hmac-sha256/benches/prf.rs

@@ -32,8 +32,8 @@ async fn prf(mode: Mode) {
     let server_random: [u8; 32] = [96u8; 32];
 
     let (mut leader_exec, mut follower_exec) = test_mt_context(8);
-    let mut leader_ctx = leader_exec.new_context().await.unwrap();
+    let mut leader_ctx = leader_exec.new_context().unwrap();
-    let mut follower_ctx = follower_exec.new_context().await.unwrap();
+    let mut follower_ctx = follower_exec.new_context().unwrap();
 
     let mut leader_vm = IdealVm::new();
     let mut follower_vm = IdealVm::new();

crates/components/key-exchange/Cargo.toml

@@ -5,7 +5,7 @@ description = "Implementation of the 3-party key-exchange protocol"
 keywords = ["tls", "mpc", "2pc", "pms", "key-exchange"]
 categories = ["cryptography"]
 license = "MIT OR Apache-2.0"
-version = "0.1.0-alpha.14-pre"
+version = "0.1.0-alpha.14"
 edition = "2021"
 
 [lints]

crates/core/Cargo.toml

@@ -5,7 +5,7 @@ description = "Core types for TLSNotary"
 keywords = ["tls", "mpc", "2pc", "types"]
 categories = ["cryptography"]
 license = "MIT OR Apache-2.0"
-version = "0.1.0-alpha.14-pre"
+version = "0.1.0-alpha.14"
 edition = "2021"
 
 [lints]

crates/core/src/fixtures.rs

@@ -1,10 +1,7 @@
 //! Fixtures for testing
 
-mod provider;
 pub mod transcript;
 
-pub use provider::FixtureEncodingProvider;
-
 use hex::FromHex;
 
 use crate::{
@@ -13,10 +10,6 @@ use crate::{
         ServerEphemKey, ServerName, ServerSignature, SignatureAlgorithm, TlsVersion,
         TranscriptLength,
     },
-    transcript::{
-        encoding::{EncoderSecret, EncodingProvider},
-        Transcript,
-    },
     webpki::CertificateDer,
 };
 
@@ -129,27 +122,3 @@ impl ConnectionFixture {
         server_ephemeral_key
     }
 }
-
-/// Returns an encoding provider fixture.
-pub fn encoding_provider(tx: &[u8], rx: &[u8]) -> impl EncodingProvider {
-    let secret = encoder_secret();
-    FixtureEncodingProvider::new(&secret, Transcript::new(tx, rx))
-}
-
-/// Seed fixture.
-const SEED: [u8; 32] = [0; 32];
-
-/// Delta fixture.
-const DELTA: [u8; 16] = [1; 16];
-
-/// Returns an encoder secret fixture.
-pub fn encoder_secret() -> EncoderSecret {
-    EncoderSecret::new(SEED, DELTA)
-}
-
-/// Returns a tampered encoder secret fixture.
-pub fn encoder_secret_tampered_seed() -> EncoderSecret {
-    let mut seed = SEED;
-    seed[0] += 1;
-    EncoderSecret::new(seed, DELTA)
-}

crates/core/src/fixtures/provider.rs

@@ -1,41 +0,0 @@
-use std::ops::Range;
-
-use crate::transcript::{
-    encoding::{new_encoder, Encoder, EncoderSecret, EncodingProvider, EncodingProviderError},
-    Direction, Transcript,
-};
-
-/// A encoding provider fixture.
-pub struct FixtureEncodingProvider {
-    encoder: Box<dyn Encoder>,
-    transcript: Transcript,
-}
-
-impl FixtureEncodingProvider {
-    /// Creates a new encoding provider fixture.
-    pub(crate) fn new(secret: &EncoderSecret, transcript: Transcript) -> Self {
-        Self {
-            encoder: Box::new(new_encoder(secret)),
-            transcript,
-        }
-    }
-}
-
-impl EncodingProvider for FixtureEncodingProvider {
-    fn provide_encoding(
-        &self,
-        direction: Direction,
-        range: Range<usize>,
-        dest: &mut Vec<u8>,
-    ) -> Result<(), EncodingProviderError> {
-        let transcript = match direction {
-            Direction::Sent => &self.transcript.sent(),
-            Direction::Received => &self.transcript.received(),
-        };
-
-        let data = transcript.get(range.clone()).ok_or(EncodingProviderError)?;
-        self.encoder.encode_data(direction, range, data, dest);
-
-        Ok(())
-    }
-}

crates/core/src/lib.rs

@@ -19,9 +19,7 @@ use serde::{Deserialize, Serialize};
 
 use crate::{
     connection::ServerName,
-    transcript::{
+    transcript::{PartialTranscript, TranscriptCommitment, TranscriptSecret},
-        encoding::EncoderSecret, PartialTranscript, TranscriptCommitment, TranscriptSecret,
-    },
 };
 
 /// Prover output.
@@ -42,8 +40,6 @@ pub struct VerifierOutput {
     pub server_name: Option<ServerName>,
     /// Transcript data.
     pub transcript: Option<PartialTranscript>,
-    /// Encoding commitment secret.
-    pub encoder_secret: Option<EncoderSecret>,
     /// Transcript commitments.
     pub transcript_commitments: Vec<TranscriptCommitment>,
 }

crates/core/src/merkle.rs

@@ -63,11 +63,6 @@ impl MerkleProof {
 
         Ok(())
     }
-
-    /// Returns the leaf count of the Merkle tree associated with the proof.
-    pub(crate) fn leaf_count(&self) -> usize {
-        self.leaf_count
-    }
 }
 
 #[derive(Clone)]

crates/core/src/transcript.rs

@@ -19,7 +19,6 @@
 //! withheld.
 
 mod commit;
-pub mod encoding;
 pub mod hash;
 mod proof;
 mod tls;

crates/core/src/transcript/commit.rs

@@ -8,27 +8,15 @@ use serde::{Deserialize, Serialize};
 use crate::{
     hash::HashAlgId,
     transcript::{
-        encoding::{EncodingCommitment, EncodingTree},
         hash::{PlaintextHash, PlaintextHashSecret},
         Direction, RangeSet, Transcript,
     },
 };
 
-/// The maximum allowed total bytelength of committed data for a single
-/// commitment kind. Used to prevent DoS during verification. (May cause the
-/// verifier to hash up to a max of 1GB * 128 = 128GB of data for certain kinds
-/// of encoding commitments.)
-///
-/// This value must not exceed bcs's MAX_SEQUENCE_LENGTH limit (which is (1 <<
-/// 31) - 1 by default)
-pub(crate) const MAX_TOTAL_COMMITTED_DATA: usize = 1_000_000_000;
-
 /// Kind of transcript commitment.
 #[derive(Debug, Clone, Copy, PartialEq, Eq, Hash, Serialize, Deserialize)]
 #[non_exhaustive]
 pub enum TranscriptCommitmentKind {
-    /// A commitment to encodings of the transcript.
-    Encoding,
     /// A hash commitment to plaintext in the transcript.
     Hash {
         /// The hash algorithm used.
@@ -39,7 +27,6 @@ pub enum TranscriptCommitmentKind {
 impl fmt::Display for TranscriptCommitmentKind {
     fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         match self {
-            Self::Encoding => f.write_str("encoding"),
             Self::Hash { alg } => write!(f, "hash ({alg})"),
         }
     }
@@ -49,8 +36,6 @@ impl fmt::Display for TranscriptCommitmentKind {
 #[derive(Debug, Clone, Serialize, Deserialize)]
 #[non_exhaustive]
 pub enum TranscriptCommitment {
-    /// Encoding commitment.
-    Encoding(EncodingCommitment),
     /// Plaintext hash commitment.
     Hash(PlaintextHash),
 }
@@ -59,8 +44,6 @@ pub enum TranscriptCommitment {
 #[derive(Debug, Clone, Serialize, Deserialize)]
 #[non_exhaustive]
 pub enum TranscriptSecret {
-    /// Encoding tree.
-    Encoding(EncodingTree),
     /// Plaintext hash secret.
     Hash(PlaintextHashSecret),
 }
@@ -68,9 +51,6 @@ pub enum TranscriptSecret {
 /// Configuration for transcript commitments.
 #[derive(Debug, Clone, Serialize, Deserialize)]
 pub struct TranscriptCommitConfig {
-    encoding_hash_alg: HashAlgId,
-    has_encoding: bool,
-    has_hash: bool,
     commits: Vec<((Direction, RangeSet<usize>), TranscriptCommitmentKind)>,
 }
 
@@ -80,53 +60,23 @@ impl TranscriptCommitConfig {
         TranscriptCommitConfigBuilder::new(transcript)
     }
 
-    /// Returns the hash algorithm to use for encoding commitments.
-    pub fn encoding_hash_alg(&self) -> &HashAlgId {
-        &self.encoding_hash_alg
-    }
-
-    /// Returns `true` if the configuration has any encoding commitments.
-    pub fn has_encoding(&self) -> bool {
-        self.has_encoding
-    }
-
     /// Returns `true` if the configuration has any hash commitments.
     pub fn has_hash(&self) -> bool {
-        self.has_hash
+        self.commits
-    }
+            .iter()
-
+            .any(|(_, kind)| matches!(kind, TranscriptCommitmentKind::Hash { .. }))
-    /// Returns an iterator over the encoding commitment indices.
-    pub fn iter_encoding(&self) -> impl Iterator<Item = &(Direction, RangeSet<usize>)> {
-        self.commits.iter().filter_map(|(idx, kind)| match kind {
-            TranscriptCommitmentKind::Encoding => Some(idx),
-            _ => None,
-        })
     }
 
     /// Returns an iterator over the hash commitment indices.
     pub fn iter_hash(&self) -> impl Iterator<Item = (&(Direction, RangeSet<usize>), &HashAlgId)> {
-        self.commits.iter().filter_map(|(idx, kind)| match kind {
+        self.commits.iter().map(|(idx, kind)| match kind {
-            TranscriptCommitmentKind::Hash { alg } => Some((idx, alg)),
+            TranscriptCommitmentKind::Hash { alg } => (idx, alg),
-            _ => None,
         })
     }
 
     /// Returns a request for the transcript commitments.
     pub fn to_request(&self) -> TranscriptCommitRequest {
         TranscriptCommitRequest {
-            encoding: self.has_encoding.then(|| {
-                let mut sent = RangeSet::default();
-                let mut recv = RangeSet::default();
-
-                for (dir, idx) in self.iter_encoding() {
-                    match dir {
-                        Direction::Sent => sent.union_mut(idx),
-                        Direction::Received => recv.union_mut(idx),
-                    }
-                }
-
-                (sent, recv)
-            }),
             hash: self
                 .iter_hash()
                 .map(|((dir, idx), alg)| (*dir, idx.clone(), *alg))
@@ -136,15 +86,9 @@ impl TranscriptCommitConfig {
 }
 
 /// A builder for [`TranscriptCommitConfig`].
-///
-/// The default hash algorithm is [`HashAlgId::BLAKE3`] and the default kind
-/// is [`TranscriptCommitmentKind::Encoding`].
 #[derive(Debug)]
 pub struct TranscriptCommitConfigBuilder<'a> {
     transcript: &'a Transcript,
-    encoding_hash_alg: HashAlgId,
-    has_encoding: bool,
-    has_hash: bool,
     default_kind: TranscriptCommitmentKind,
     commits: HashSet<((Direction, RangeSet<usize>), TranscriptCommitmentKind)>,
 }
@@ -154,20 +98,13 @@ impl<'a> TranscriptCommitConfigBuilder<'a> {
     pub fn new(transcript: &'a Transcript) -> Self {
         Self {
             transcript,
-            encoding_hash_alg: HashAlgId::BLAKE3,
+            default_kind: TranscriptCommitmentKind::Hash {
-            has_encoding: false,
+                alg: HashAlgId::BLAKE3,
-            has_hash: false,
+            },
-            default_kind: TranscriptCommitmentKind::Encoding,
             commits: HashSet::default(),
         }
     }
 
-    /// Sets the hash algorithm to use for encoding commitments.
-    pub fn encoding_hash_alg(&mut self, alg: HashAlgId) -> &mut Self {
-        self.encoding_hash_alg = alg;
-        self
-    }
-
     /// Sets the default kind of commitment to use.
     pub fn default_kind(&mut self, default_kind: TranscriptCommitmentKind) -> &mut Self {
         self.default_kind = default_kind;
@@ -201,11 +138,6 @@ impl<'a> TranscriptCommitConfigBuilder<'a> {
             ));
         }
 
-        match kind {
-            TranscriptCommitmentKind::Encoding => self.has_encoding = true,
-            TranscriptCommitmentKind::Hash { .. } => self.has_hash = true,
-        }
-
         self.commits.insert(((direction, idx), kind));
 
         Ok(self)
@@ -252,9 +184,6 @@ impl<'a> TranscriptCommitConfigBuilder<'a> {
     /// Builds the configuration.
     pub fn build(self) -> Result<TranscriptCommitConfig, TranscriptCommitConfigBuilderError> {
         Ok(TranscriptCommitConfig {
-            encoding_hash_alg: self.encoding_hash_alg,
-            has_encoding: self.has_encoding,
-            has_hash: self.has_hash,
             commits: Vec::from_iter(self.commits),
         })
     }
@@ -301,16 +230,10 @@ impl fmt::Display for TranscriptCommitConfigBuilderError {
 /// Request to compute transcript commitments.
 #[derive(Debug, Clone, Serialize, Deserialize)]
 pub struct TranscriptCommitRequest {
-    encoding: Option<(RangeSet<usize>, RangeSet<usize>)>,
     hash: Vec<(Direction, RangeSet<usize>, HashAlgId)>,
 }
 
 impl TranscriptCommitRequest {
-    /// Returns `true` if an encoding commitment is requested.
-    pub fn has_encoding(&self) -> bool {
-        self.encoding.is_some()
-    }
-
     /// Returns `true` if a hash commitment is requested.
     pub fn has_hash(&self) -> bool {
         !self.hash.is_empty()
@@ -320,11 +243,6 @@ impl TranscriptCommitRequest {
     pub fn iter_hash(&self) -> impl Iterator<Item = &(Direction, RangeSet<usize>, HashAlgId)> {
         self.hash.iter()
     }
-
-    /// Returns the ranges of the encoding commitments.
-    pub fn encoding(&self) -> Option<&(RangeSet<usize>, RangeSet<usize>)> {
-        self.encoding.as_ref()
-    }
 }
 
 #[cfg(test)]

crates/core/src/transcript/encoding.rs

@@ -1,22 +0,0 @@
-//! Transcript encoding commitments and proofs.
-
-mod encoder;
-mod proof;
-mod provider;
-mod tree;
-
-pub use encoder::{new_encoder, Encoder, EncoderSecret};
-pub use proof::{EncodingProof, EncodingProofError};
-pub use provider::{EncodingProvider, EncodingProviderError};
-pub use tree::{EncodingTree, EncodingTreeError};
-
-use serde::{Deserialize, Serialize};
-
-use crate::hash::TypedHash;
-
-/// Transcript encoding commitment.
-#[derive(Debug, Clone, PartialEq, Eq, Serialize, Deserialize)]
-pub struct EncodingCommitment {
-    /// Merkle root of the encoding commitments.
-    pub root: TypedHash,
-}

crates/core/src/transcript/encoding/encoder.rs

@@ -1,137 +0,0 @@
-use std::ops::Range;
-
-use crate::transcript::Direction;
-use itybity::ToBits;
-use rand::{RngCore, SeedableRng};
-use rand_chacha::ChaCha12Rng;
-use serde::{Deserialize, Serialize};
-
-/// The size of the encoding for 1 bit, in bytes.
-const BIT_ENCODING_SIZE: usize = 16;
-/// The size of the encoding for 1 byte, in bytes.
-const BYTE_ENCODING_SIZE: usize = 128;
-
-/// Secret used by an encoder to generate encodings.
-#[derive(Clone, PartialEq, Eq, Serialize, Deserialize)]
-pub struct EncoderSecret {
-    seed: [u8; 32],
-    delta: [u8; BIT_ENCODING_SIZE],
-}
-
-opaque_debug::implement!(EncoderSecret);
-
-impl EncoderSecret {
-    /// Creates a new secret.
-    ///
-    /// # Arguments
-    ///
-    /// * `seed` - The seed for the PRG.
-    /// * `delta` - Delta for deriving the one-encodings.
-    pub fn new(seed: [u8; 32], delta: [u8; 16]) -> Self {
-        Self { seed, delta }
-    }
-
-    /// Returns the seed.
-    pub fn seed(&self) -> &[u8; 32] {
-        &self.seed
-    }
-
-    /// Returns the delta.
-    pub fn delta(&self) -> &[u8; 16] {
-        &self.delta
-    }
-}
-
-/// Creates a new encoder.
-pub fn new_encoder(secret: &EncoderSecret) -> impl Encoder {
-    ChaChaEncoder::new(secret)
-}
-
-pub(crate) struct ChaChaEncoder {
-    seed: [u8; 32],
-    delta: [u8; 16],
-}
-
-impl ChaChaEncoder {
-    pub(crate) fn new(secret: &EncoderSecret) -> Self {
-        let seed = *secret.seed();
-        let delta = *secret.delta();
-
-        Self { seed, delta }
-    }
-
-    pub(crate) fn new_prg(&self, stream_id: u64) -> ChaCha12Rng {
-        let mut prg = ChaCha12Rng::from_seed(self.seed);
-        prg.set_stream(stream_id);
-        prg.set_word_pos(0);
-        prg
-    }
-}
-
-/// A transcript encoder.
-///
-/// This is an internal implementation detail that should not be exposed to the
-/// public API.
-pub trait Encoder {
-    /// Writes the zero encoding for the given range of the transcript into the
-    /// destination buffer.
-    fn encode_range(&self, direction: Direction, range: Range<usize>, dest: &mut Vec<u8>);
-
-    /// Writes the encoding for the given data into the destination buffer.
-    fn encode_data(
-        &self,
-        direction: Direction,
-        range: Range<usize>,
-        data: &[u8],
-        dest: &mut Vec<u8>,
-    );
-}
-
-impl Encoder for ChaChaEncoder {
-    fn encode_range(&self, direction: Direction, range: Range<usize>, dest: &mut Vec<u8>) {
-        // ChaCha encoder works with 32-bit words. Each encoded bit is 128 bits long.
-        const WORDS_PER_BYTE: u128 = 8 * 128 / 32;
-
-        let stream_id: u64 = match direction {
-            Direction::Sent => 0,
-            Direction::Received => 1,
-        };
-
-        let mut prg = self.new_prg(stream_id);
-        let len = range.len() * BYTE_ENCODING_SIZE;
-        let pos = dest.len();
-
-        // Write 0s to the destination buffer.
-        dest.resize(pos + len, 0);
-
-        // Fill the destination buffer with the PRG.
-        prg.set_word_pos(range.start as u128 * WORDS_PER_BYTE);
-        prg.fill_bytes(&mut dest[pos..pos + len]);
-    }
-
-    fn encode_data(
-        &self,
-        direction: Direction,
-        range: Range<usize>,
-        data: &[u8],
-        dest: &mut Vec<u8>,
-    ) {
-        const ZERO: [u8; 16] = [0; BIT_ENCODING_SIZE];
-
-        let pos = dest.len();
-
-        // Write the zero encoding for the given range.
-        self.encode_range(direction, range, dest);
-        let dest = &mut dest[pos..];
-
-        for (pos, bit) in data.iter_lsb0().enumerate() {
-            // Add the delta to the encoding whenever the encoded bit is 1,
-            // otherwise add a zero.
-            let summand = if bit { &self.delta } else { &ZERO };
-            dest[pos * BIT_ENCODING_SIZE..(pos + 1) * BIT_ENCODING_SIZE]
-                .iter_mut()
-                .zip(summand)
-                .for_each(|(a, b)| *a ^= *b);
-        }
-    }
-}

crates/core/src/transcript/encoding/proof.rs

@@ -1,361 +0,0 @@
-use std::{collections::HashMap, fmt};
-
-use rangeset::set::RangeSet;
-use serde::{Deserialize, Serialize};
-
-use crate::{
-    hash::{Blinder, HashProvider, HashProviderError},
-    merkle::{MerkleError, MerkleProof},
-    transcript::{
-        commit::MAX_TOTAL_COMMITTED_DATA,
-        encoding::{new_encoder, Encoder, EncoderSecret, EncodingCommitment},
-        Direction,
-    },
-};
-
-/// An opening of a leaf in the encoding tree.
-#[derive(Clone, Serialize, Deserialize)]
-pub(super) struct Opening {
-    pub(super) direction: Direction,
-    pub(super) idx: RangeSet<usize>,
-    pub(super) blinder: Blinder,
-}
-
-opaque_debug::implement!(Opening);
-
-/// An encoding commitment proof.
-#[derive(Debug, Clone, Serialize, Deserialize)]
-#[serde(try_from = "validation::EncodingProofUnchecked")]
-pub struct EncodingProof {
-    /// The proof of inclusion of the commitment(s) in the Merkle tree of
-    /// commitments.
-    pub(super) inclusion_proof: MerkleProof,
-    pub(super) openings: HashMap<usize, Opening>,
-}
-
-impl EncodingProof {
-    /// Verifies the proof against the commitment.
-    ///
-    /// Returns the authenticated indices of the sent and received data,
-    /// respectively.
-    ///
-    /// # Arguments
-    ///
-    /// * `provider` - Hash provider.
-    /// * `commitment` - Encoding commitment to verify against.
-    /// * `sent` - Sent data to authenticate.
-    /// * `recv` - Received data to authenticate.
-    pub fn verify_with_provider(
-        &self,
-        provider: &HashProvider,
-        secret: &EncoderSecret,
-        commitment: &EncodingCommitment,
-        sent: &[u8],
-        recv: &[u8],
-    ) -> Result<(RangeSet<usize>, RangeSet<usize>), EncodingProofError> {
-        let hasher = provider.get(&commitment.root.alg)?;
-
-        let encoder = new_encoder(secret);
-        let Self {
-            inclusion_proof,
-            openings,
-        } = self;
-
-        let mut leaves = Vec::with_capacity(openings.len());
-        let mut expected_leaf = Vec::default();
-        let mut total_opened = 0u128;
-        let mut auth_sent = RangeSet::default();
-        let mut auth_recv = RangeSet::default();
-        for (
-            id,
-            Opening {
-                direction,
-                idx,
-                blinder,
-            },
-        ) in openings
-        {
-            // Make sure the amount of data being proved is bounded.
-            total_opened += idx.len() as u128;
-            if total_opened > MAX_TOTAL_COMMITTED_DATA as u128 {
-                return Err(EncodingProofError::new(
-                    ErrorKind::Proof,
-                    "exceeded maximum allowed data",
-                ))?;
-            }
-
-            let (data, auth) = match direction {
-                Direction::Sent => (sent, &mut auth_sent),
-                Direction::Received => (recv, &mut auth_recv),
-            };
-
-            // Make sure the ranges are within the bounds of the transcript.
-            if idx.end().unwrap_or(0) > data.len() {
-                return Err(EncodingProofError::new(
-                    ErrorKind::Proof,
-                    format!(
-                        "index out of bounds of the transcript ({}): {} > {}",
-                        direction,
-                        idx.end().unwrap_or(0),
-                        data.len()
-                    ),
-                ));
-            }
-
-            expected_leaf.clear();
-            for range in idx.iter() {
-                encoder.encode_data(*direction, range.clone(), &data[range], &mut expected_leaf);
-            }
-            expected_leaf.extend_from_slice(blinder.as_bytes());
-
-            // Compute the expected hash of the commitment to make sure it is
-            // present in the merkle tree.
-            leaves.push((*id, hasher.hash(&expected_leaf)));
-
-            auth.union_mut(idx);
-        }
-
-        // Verify that the expected hashes are present in the merkle tree.
-        //
-        // This proves the Prover committed to the purported data prior to the encoder
-        // seed being revealed. Ergo, if the encodings are authentic then the purported
-        // data is authentic.
-        inclusion_proof.verify(hasher, &commitment.root, leaves)?;
-
-        Ok((auth_sent, auth_recv))
-    }
-}
-
-/// Error for [`EncodingProof`].
-#[derive(Debug, thiserror::Error)]
-pub struct EncodingProofError {
-    kind: ErrorKind,
-    source: Option<Box<dyn std::error::Error + Send + Sync>>,
-}
-
-impl EncodingProofError {
-    fn new<E>(kind: ErrorKind, source: E) -> Self
-    where
-        E: Into<Box<dyn std::error::Error + Send + Sync>>,
-    {
-        Self {
-            kind,
-            source: Some(source.into()),
-        }
-    }
-}
-
-#[derive(Debug)]
-enum ErrorKind {
-    Provider,
-    Proof,
-}
-
-impl fmt::Display for EncodingProofError {
-    fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
-        f.write_str("encoding proof error: ")?;
-
-        match self.kind {
-            ErrorKind::Provider => f.write_str("provider error")?,
-            ErrorKind::Proof => f.write_str("proof error")?,
-        }
-
-        if let Some(source) = &self.source {
-            write!(f, " caused by: {source}")?;
-        }
-
-        Ok(())
-    }
-}
-
-impl From<HashProviderError> for EncodingProofError {
-    fn from(error: HashProviderError) -> Self {
-        Self::new(ErrorKind::Provider, error)
-    }
-}
-
-impl From<MerkleError> for EncodingProofError {
-    fn from(error: MerkleError) -> Self {
-        Self::new(ErrorKind::Proof, error)
-    }
-}
-
-/// Invalid encoding proof error.
-#[derive(Debug, thiserror::Error)]
-#[error("invalid encoding proof: {0}")]
-pub struct InvalidEncodingProof(&'static str);
-
-mod validation {
-    use super::*;
-
-    /// The maximum allowed height of the Merkle tree of encoding commitments.
-    ///
-    /// The statistical security parameter (SSP) of the encoding commitment
-    /// protocol is calculated as "the number of uniformly random bits in a
-    /// single bit's encoding minus `MAX_HEIGHT`".
-    ///
-    /// For example, a bit encoding used in garbled circuits typically has 127
-    /// uniformly random bits, hence when using it in the encoding
-    /// commitment protocol, the SSP is 127 - 30 = 97 bits.
-    ///
-    /// Leaving this validation here as a fail-safe in case we ever start
-    /// using shorter encodings.
-    const MAX_HEIGHT: usize = 30;
-
-    #[derive(Debug, Deserialize)]
-    pub(super) struct EncodingProofUnchecked {
-        inclusion_proof: MerkleProof,
-        openings: HashMap<usize, Opening>,
-    }
-
-    impl TryFrom<EncodingProofUnchecked> for EncodingProof {
-        type Error = InvalidEncodingProof;
-
-        fn try_from(unchecked: EncodingProofUnchecked) -> Result<Self, Self::Error> {
-            if unchecked.inclusion_proof.leaf_count() > 1 << MAX_HEIGHT {
-                return Err(InvalidEncodingProof(
-                    "the height of the tree exceeds the maximum allowed",
-                ));
-            }
-
-            Ok(Self {
-                inclusion_proof: unchecked.inclusion_proof,
-                openings: unchecked.openings,
-            })
-        }
-    }
-}
-
-#[cfg(test)]
-mod test {
-    use tlsn_data_fixtures::http::{request::POST_JSON, response::OK_JSON};
-
-    use crate::{
-        fixtures::{encoder_secret, encoder_secret_tampered_seed, encoding_provider},
-        hash::Blake3,
-        transcript::{encoding::EncodingTree, Transcript},
-    };
-
-    use super::*;
-
-    struct EncodingFixture {
-        transcript: Transcript,
-        proof: EncodingProof,
-        commitment: EncodingCommitment,
-    }
-
-    fn new_encoding_fixture() -> EncodingFixture {
-        let transcript = Transcript::new(POST_JSON, OK_JSON);
-
-        let idx_0 = (Direction::Sent, RangeSet::from(0..POST_JSON.len()));
-        let idx_1 = (Direction::Received, RangeSet::from(0..OK_JSON.len()));
-
-        let provider = encoding_provider(transcript.sent(), transcript.received());
-        let tree = EncodingTree::new(&Blake3::default(), [&idx_0, &idx_1], &provider).unwrap();
-
-        let proof = tree.proof([&idx_0, &idx_1].into_iter()).unwrap();
-
-        let commitment = EncodingCommitment { root: tree.root() };
-
-        EncodingFixture {
-            transcript,
-            proof,
-            commitment,
-        }
-    }
-
-    #[test]
-    fn test_verify_encoding_proof_tampered_seed() {
-        let EncodingFixture {
-            transcript,
-            proof,
-            commitment,
-        } = new_encoding_fixture();
-
-        let err = proof
-            .verify_with_provider(
-                &HashProvider::default(),
-                &encoder_secret_tampered_seed(),
-                &commitment,
-                transcript.sent(),
-                transcript.received(),
-            )
-            .unwrap_err();
-
-        assert!(matches!(err.kind, ErrorKind::Proof));
-    }
-
-    #[test]
-    fn test_verify_encoding_proof_out_of_range() {
-        let EncodingFixture {
-            transcript,
-            proof,
-            commitment,
-        } = new_encoding_fixture();
-
-        let sent = &transcript.sent()[transcript.sent().len() - 1..];
-        let recv = &transcript.received()[transcript.received().len() - 2..];
-
-        let err = proof
-            .verify_with_provider(
-                &HashProvider::default(),
-                &encoder_secret(),
-                &commitment,
-                sent,
-                recv,
-            )
-            .unwrap_err();
-
-        assert!(matches!(err.kind, ErrorKind::Proof));
-    }
-
-    #[test]
-    fn test_verify_encoding_proof_tampered_idx() {
-        let EncodingFixture {
-            transcript,
-            mut proof,
-            commitment,
-        } = new_encoding_fixture();
-
-        let Opening { idx, .. } = proof.openings.values_mut().next().unwrap();
-
-        *idx = RangeSet::from([0..3, 13..15]);
-
-        let err = proof
-            .verify_with_provider(
-                &HashProvider::default(),
-                &encoder_secret(),
-                &commitment,
-                transcript.sent(),
-                transcript.received(),
-            )
-            .unwrap_err();
-
-        assert!(matches!(err.kind, ErrorKind::Proof));
-    }
-
-    #[test]
-    fn test_verify_encoding_proof_tampered_encoding_blinder() {
-        let EncodingFixture {
-            transcript,
-            mut proof,
-            commitment,
-        } = new_encoding_fixture();
-
-        let Opening { blinder, .. } = proof.openings.values_mut().next().unwrap();
-
-        *blinder = rand::random();
-
-        let err = proof
-            .verify_with_provider(
-                &HashProvider::default(),
-                &encoder_secret(),
-                &commitment,
-                transcript.sent(),
-                transcript.received(),
-            )
-            .unwrap_err();
-
-        assert!(matches!(err.kind, ErrorKind::Proof));
-    }
-}

crates/core/src/transcript/encoding/provider.rs

@@ -1,19 +0,0 @@
-use std::ops::Range;
-
-use crate::transcript::Direction;
-
-/// A provider of plaintext encodings.
-pub trait EncodingProvider {
-    /// Writes the encoding of the given range into the destination buffer.
-    fn provide_encoding(
-        &self,
-        direction: Direction,
-        range: Range<usize>,
-        dest: &mut Vec<u8>,
-    ) -> Result<(), EncodingProviderError>;
-}
-
-/// Error for [`EncodingProvider`].
-#[derive(Debug, thiserror::Error)]
-#[error("failed to provide encoding")]
-pub struct EncodingProviderError;

crates/core/src/transcript/encoding/tree.rs

@@ -1,327 +0,0 @@
-use std::collections::HashMap;
-
-use bimap::BiMap;
-use rangeset::set::RangeSet;
-use serde::{Deserialize, Serialize};
-
-use crate::{
-    hash::{Blinder, HashAlgId, HashAlgorithm, TypedHash},
-    merkle::MerkleTree,
-    transcript::{
-        encoding::{
-            proof::{EncodingProof, Opening},
-            EncodingProvider,
-        },
-        Direction,
-    },
-};
-
-/// Encoding tree builder error.
-#[derive(Debug, thiserror::Error)]
-pub enum EncodingTreeError {
-    /// Index is out of bounds of the transcript.
-    #[error("index is out of bounds of the transcript")]
-    OutOfBounds {
-        /// The index.
-        index: RangeSet<usize>,
-        /// The transcript length.
-        transcript_length: usize,
-    },
-    /// Encoding provider is missing an encoding for an index.
-    #[error("encoding provider is missing an encoding for an index")]
-    MissingEncoding {
-        /// The index which is missing.
-        index: RangeSet<usize>,
-    },
-    /// Index is missing from the tree.
-    #[error("index is missing from the tree")]
-    MissingLeaf {
-        /// The index which is missing.
-        index: RangeSet<usize>,
-    },
-}
-
-/// A merkle tree of transcript encodings.
-#[derive(Clone, Serialize, Deserialize)]
-pub struct EncodingTree {
-    /// Merkle tree of the commitments.
-    tree: MerkleTree,
-    /// Nonces used to blind the hashes.
-    blinders: Vec<Blinder>,
-    /// Mapping between the index of a leaf and the transcript index it
-    /// corresponds to.
-    idxs: BiMap<usize, (Direction, RangeSet<usize>)>,
-    /// Union of all transcript indices in the sent direction.
-    sent_idx: RangeSet<usize>,
-    /// Union of all transcript indices in the received direction.
-    received_idx: RangeSet<usize>,
-}
-
-opaque_debug::implement!(EncodingTree);
-
-impl EncodingTree {
-    /// Creates a new encoding tree.
-    ///
-    /// # Arguments
-    ///
-    /// * `hasher` - The hash algorithm to use.
-    /// * `idxs` - The subsequence indices to commit to.
-    /// * `provider` - The encoding provider.
-    pub fn new<'idx>(
-        hasher: &dyn HashAlgorithm,
-        idxs: impl IntoIterator<Item = &'idx (Direction, RangeSet<usize>)>,
-        provider: &dyn EncodingProvider,
-    ) -> Result<Self, EncodingTreeError> {
-        let mut this = Self {
-            tree: MerkleTree::new(hasher.id()),
-            blinders: Vec::new(),
-            idxs: BiMap::new(),
-            sent_idx: RangeSet::default(),
-            received_idx: RangeSet::default(),
-        };
-
-        let mut leaves = Vec::new();
-        let mut encoding = Vec::new();
-        for dir_idx in idxs {
-            let direction = dir_idx.0;
-            let idx = &dir_idx.1;
-
-            // Ignore empty indices.
-            if idx.is_empty() {
-                continue;
-            }
-
-            if this.idxs.contains_right(dir_idx) {
-                // The subsequence is already in the tree.
-                continue;
-            }
-
-            let blinder: Blinder = rand::random();
-
-            encoding.clear();
-            for range in idx.iter() {
-                provider
-                    .provide_encoding(direction, range, &mut encoding)
-                    .map_err(|_| EncodingTreeError::MissingEncoding { index: idx.clone() })?;
-            }
-            encoding.extend_from_slice(blinder.as_bytes());
-
-            let leaf = hasher.hash(&encoding);
-
-            leaves.push(leaf);
-            this.blinders.push(blinder);
-            this.idxs.insert(this.idxs.len(), dir_idx.clone());
-            match direction {
-                Direction::Sent => this.sent_idx.union_mut(idx),
-                Direction::Received => this.received_idx.union_mut(idx),
-            }
-        }
-
-        this.tree.insert(hasher, leaves);
-
-        Ok(this)
-    }
-
-    /// Returns the root of the tree.
-    pub fn root(&self) -> TypedHash {
-        self.tree.root()
-    }
-
-    /// Returns the hash algorithm of the tree.
-    pub fn algorithm(&self) -> HashAlgId {
-        self.tree.algorithm()
-    }
-
-    /// Generates a proof for the given indices.
-    ///
-    /// # Arguments
-    ///
-    /// * `idxs` - The transcript indices to prove.
-    pub fn proof<'idx>(
-        &self,
-        idxs: impl Iterator<Item = &'idx (Direction, RangeSet<usize>)>,
-    ) -> Result<EncodingProof, EncodingTreeError> {
-        let mut openings = HashMap::new();
-        for dir_idx in idxs {
-            let direction = dir_idx.0;
-            let idx = &dir_idx.1;
-
-            let leaf_idx = *self
-                .idxs
-                .get_by_right(dir_idx)
-                .ok_or_else(|| EncodingTreeError::MissingLeaf { index: idx.clone() })?;
-            let blinder = self.blinders[leaf_idx].clone();
-
-            openings.insert(
-                leaf_idx,
-                Opening {
-                    direction,
-                    idx: idx.clone(),
-                    blinder,
-                },
-            );
-        }
-
-        let mut indices = openings.keys().copied().collect::<Vec<_>>();
-        indices.sort();
-
-        Ok(EncodingProof {
-            inclusion_proof: self.tree.proof(&indices),
-            openings,
-        })
-    }
-
-    /// Returns whether the tree contains the given transcript index.
-    pub fn contains(&self, idx: &(Direction, RangeSet<usize>)) -> bool {
-        self.idxs.contains_right(idx)
-    }
-
-    pub(crate) fn idx(&self, direction: Direction) -> &RangeSet<usize> {
-        match direction {
-            Direction::Sent => &self.sent_idx,
-            Direction::Received => &self.received_idx,
-        }
-    }
-
-    /// Returns the committed transcript indices.
-    pub(crate) fn transcript_indices(&self) -> impl Iterator<Item = &(Direction, RangeSet<usize>)> {
-        self.idxs.right_values()
-    }
-}
-
-#[cfg(test)]
-mod tests {
-    use super::*;
-    use crate::{
-        fixtures::{encoder_secret, encoding_provider},
-        hash::{Blake3, HashProvider},
-        transcript::{encoding::EncodingCommitment, Transcript},
-    };
-    use tlsn_data_fixtures::http::{request::POST_JSON, response::OK_JSON};
-
-    fn new_tree<'seq>(
-        transcript: &Transcript,
-        idxs: impl Iterator<Item = &'seq (Direction, RangeSet<usize>)>,
-    ) -> Result<EncodingTree, EncodingTreeError> {
-        let provider = encoding_provider(transcript.sent(), transcript.received());
-
-        EncodingTree::new(&Blake3::default(), idxs, &provider)
-    }
-
-    #[test]
-    fn test_encoding_tree() {
-        let transcript = Transcript::new(POST_JSON, OK_JSON);
-
-        let idx_0 = (Direction::Sent, RangeSet::from(0..POST_JSON.len()));
-        let idx_1 = (Direction::Received, RangeSet::from(0..OK_JSON.len()));
-
-        let tree = new_tree(&transcript, [&idx_0, &idx_1].into_iter()).unwrap();
-
-        assert!(tree.contains(&idx_0));
-        assert!(tree.contains(&idx_1));
-
-        let proof = tree.proof([&idx_0, &idx_1].into_iter()).unwrap();
-
-        let commitment = EncodingCommitment { root: tree.root() };
-
-        let (auth_sent, auth_recv) = proof
-            .verify_with_provider(
-                &HashProvider::default(),
-                &encoder_secret(),
-                &commitment,
-                transcript.sent(),
-                transcript.received(),
-            )
-            .unwrap();
-
-        assert_eq!(auth_sent, idx_0.1);
-        assert_eq!(auth_recv, idx_1.1);
-    }
-
-    #[test]
-    fn test_encoding_tree_multiple_ranges() {
-        let transcript = Transcript::new(POST_JSON, OK_JSON);
-
-        let idx_0 = (Direction::Sent, RangeSet::from(0..1));
-        let idx_1 = (Direction::Sent, RangeSet::from(1..POST_JSON.len()));
-        let idx_2 = (Direction::Received, RangeSet::from(0..1));
-        let idx_3 = (Direction::Received, RangeSet::from(1..OK_JSON.len()));
-
-        let tree = new_tree(&transcript, [&idx_0, &idx_1, &idx_2, &idx_3].into_iter()).unwrap();
-
-        assert!(tree.contains(&idx_0));
-        assert!(tree.contains(&idx_1));
-        assert!(tree.contains(&idx_2));
-        assert!(tree.contains(&idx_3));
-
-        let proof = tree
-            .proof([&idx_0, &idx_1, &idx_2, &idx_3].into_iter())
-            .unwrap();
-
-        let commitment = EncodingCommitment { root: tree.root() };
-
-        let (auth_sent, auth_recv) = proof
-            .verify_with_provider(
-                &HashProvider::default(),
-                &encoder_secret(),
-                &commitment,
-                transcript.sent(),
-                transcript.received(),
-            )
-            .unwrap();
-
-        let mut expected_auth_sent = RangeSet::default();
-        expected_auth_sent.union_mut(&idx_0.1);
-        expected_auth_sent.union_mut(&idx_1.1);
-
-        let mut expected_auth_recv = RangeSet::default();
-        expected_auth_recv.union_mut(&idx_2.1);
-        expected_auth_recv.union_mut(&idx_3.1);
-
-        assert_eq!(auth_sent, expected_auth_sent);
-        assert_eq!(auth_recv, expected_auth_recv);
-    }
-
-    #[test]
-    fn test_encoding_tree_proof_missing_leaf() {
-        let transcript = Transcript::new(POST_JSON, OK_JSON);
-
-        let idx_0 = (Direction::Sent, RangeSet::from(0..POST_JSON.len()));
-        let idx_1 = (Direction::Received, RangeSet::from(0..4));
-        let idx_2 = (Direction::Received, RangeSet::from(4..OK_JSON.len()));
-
-        let tree = new_tree(&transcript, [&idx_0, &idx_1].into_iter()).unwrap();
-
-        let result = tree
-            .proof([&idx_0, &idx_1, &idx_2].into_iter())
-            .unwrap_err();
-        assert!(matches!(result, EncodingTreeError::MissingLeaf { .. }));
-    }
-
-    #[test]
-    fn test_encoding_tree_out_of_bounds() {
-        let transcript = Transcript::new(POST_JSON, OK_JSON);
-
-        let idx_0 = (Direction::Sent, RangeSet::from(0..POST_JSON.len() + 1));
-        let idx_1 = (Direction::Received, RangeSet::from(0..OK_JSON.len() + 1));
-
-        let result = new_tree(&transcript, [&idx_0].into_iter()).unwrap_err();
-        assert!(matches!(result, EncodingTreeError::MissingEncoding { .. }));
-
-        let result = new_tree(&transcript, [&idx_1].into_iter()).unwrap_err();
-        assert!(matches!(result, EncodingTreeError::MissingEncoding { .. }));
-    }
-
-    #[test]
-    fn test_encoding_tree_missing_encoding() {
-        let provider = encoding_provider(&[], &[]);
-
-        let result = EncodingTree::new(
-            &Blake3::default(),
-            [(Direction::Sent, RangeSet::from(0..8))].iter(),
-            &provider,
-        )
-        .unwrap_err();
-        assert!(matches!(result, EncodingTreeError::MissingEncoding { .. }));
-    }
-}

crates/core/src/transcript/proof.rs

@@ -14,7 +14,6 @@ use crate::{
     hash::{HashAlgId, HashProvider},
     transcript::{
         commit::{TranscriptCommitment, TranscriptCommitmentKind},
-        encoding::{EncoderSecret, EncodingProof, EncodingProofError, EncodingTree},
         hash::{hash_plaintext, PlaintextHash, PlaintextHashSecret},
         Direction, PartialTranscript, RangeSet, Transcript, TranscriptSecret,
     },
@@ -32,14 +31,12 @@ const DEFAULT_COMMITMENT_KINDS: &[TranscriptCommitmentKind] = &[
     TranscriptCommitmentKind::Hash {
         alg: HashAlgId::KECCAK256,
     },
-    TranscriptCommitmentKind::Encoding,
 ];
 
 /// Proof of the contents of a transcript.
 #[derive(Clone, Serialize, Deserialize)]
 pub struct TranscriptProof {
     transcript: PartialTranscript,
-    encoding_proof: Option<EncodingProof>,
     hash_secrets: Vec<PlaintextHashSecret>,
 }
 
@@ -53,27 +50,18 @@ impl TranscriptProof {
     /// # Arguments
     ///
     /// * `provider` - The hash provider to use for verification.
-    /// * `attestation_body` - The attestation body to verify against.
+    /// * `length` - The transcript length.
+    /// * `commitments` - The commitments to verify against.
     pub fn verify_with_provider<'a>(
         self,
         provider: &HashProvider,
         length: &TranscriptLength,
-        encoder_secret: Option<&EncoderSecret>,
         commitments: impl IntoIterator<Item = &'a TranscriptCommitment>,
     ) -> Result<PartialTranscript, TranscriptProofError> {
-        let mut encoding_commitment = None;
         let mut hash_commitments = HashSet::new();
         // Index commitments.
         for commitment in commitments {
             match commitment {
-                TranscriptCommitment::Encoding(commitment) => {
-                    if encoding_commitment.replace(commitment).is_some() {
-                        return Err(TranscriptProofError::new(
-                            ErrorKind::Encoding,
-                            "multiple encoding commitments are present.",
-                        ));
-                    }
-                }
                 TranscriptCommitment::Hash(plaintext_hash) => {
                     hash_commitments.insert(plaintext_hash);
                 }
@@ -92,34 +80,6 @@ impl TranscriptProof {
         let mut total_auth_sent = RangeSet::default();
         let mut total_auth_recv = RangeSet::default();
 
-        // Verify encoding proof.
-        if let Some(proof) = self.encoding_proof {
-            let secret = encoder_secret.ok_or_else(|| {
-                TranscriptProofError::new(
-                    ErrorKind::Encoding,
-                    "contains an encoding proof but missing encoder secret",
-                )
-            })?;
-
-            let commitment = encoding_commitment.ok_or_else(|| {
-                TranscriptProofError::new(
-                    ErrorKind::Encoding,
-                    "contains an encoding proof but missing encoding commitment",
-                )
-            })?;
-
-            let (auth_sent, auth_recv) = proof.verify_with_provider(
-                provider,
-                secret,
-                commitment,
-                self.transcript.sent_unsafe(),
-                self.transcript.received_unsafe(),
-            )?;
-
-            total_auth_sent.union_mut(&auth_sent);
-            total_auth_recv.union_mut(&auth_recv);
-        }
-
         let mut buffer = Vec::new();
         for PlaintextHashSecret {
             direction,
@@ -203,7 +163,6 @@ impl TranscriptProofError {
 
 #[derive(Debug)]
 enum ErrorKind {
-    Encoding,
     Hash,
     Proof,
 }
@@ -213,7 +172,6 @@ impl fmt::Display for TranscriptProofError {
         f.write_str("transcript proof error: ")?;
 
         match self.kind {
-            ErrorKind::Encoding => f.write_str("encoding error")?,
             ErrorKind::Hash => f.write_str("hash error")?,
             ErrorKind::Proof => f.write_str("proof error")?,
         }
@@ -226,12 +184,6 @@ impl fmt::Display for TranscriptProofError {
     }
 }
 
-impl From<EncodingProofError> for TranscriptProofError {
-    fn from(e: EncodingProofError) -> Self {
-        TranscriptProofError::new(ErrorKind::Encoding, e)
-    }
-}
-
 /// Union of ranges to reveal.
 #[derive(Clone, Debug, PartialEq)]
 struct QueryIdx {
@@ -276,7 +228,6 @@ pub struct TranscriptProofBuilder<'a> {
     /// Commitment kinds in order of preference for building transcript proofs.
     commitment_kinds: Vec<TranscriptCommitmentKind>,
     transcript: &'a Transcript,
-    encoding_tree: Option<&'a EncodingTree>,
     hash_secrets: Vec<&'a PlaintextHashSecret>,
     committed_sent: RangeSet<usize>,
     committed_recv: RangeSet<usize>,
@@ -292,15 +243,9 @@ impl<'a> TranscriptProofBuilder<'a> {
         let mut committed_sent = RangeSet::default();
         let mut committed_recv = RangeSet::default();
 
-        let mut encoding_tree = None;
         let mut hash_secrets = Vec::new();
         for secret in secrets {
             match secret {
-                TranscriptSecret::Encoding(tree) => {
-                    committed_sent.union_mut(tree.idx(Direction::Sent));
-                    committed_recv.union_mut(tree.idx(Direction::Received));
-                    encoding_tree = Some(tree);
-                }
                 TranscriptSecret::Hash(hash) => {
                     match hash.direction {
                         Direction::Sent => committed_sent.union_mut(&hash.idx),
@@ -314,7 +259,6 @@ impl<'a> TranscriptProofBuilder<'a> {
         Self {
             commitment_kinds: DEFAULT_COMMITMENT_KINDS.to_vec(),
             transcript,
-            encoding_tree,
             hash_secrets,
             committed_sent,
             committed_recv,
@@ -412,7 +356,6 @@ impl<'a> TranscriptProofBuilder<'a> {
             transcript: self
                 .transcript
                 .to_partial(self.query_idx.sent.clone(), self.query_idx.recv.clone()),
-            encoding_proof: None,
             hash_secrets: Vec::new(),
         };
         let mut uncovered_query_idx = self.query_idx.clone();
@@ -424,46 +367,6 @@ impl<'a> TranscriptProofBuilder<'a> {
             // self.commitment_kinds.
             if let Some(kind) = commitment_kinds_iter.next() {
                 match kind {
-                    TranscriptCommitmentKind::Encoding => {
-                        let Some(encoding_tree) = self.encoding_tree else {
-                            // Proceeds to the next preferred commitment kind if encoding tree is
-                            // not available.
-                            continue;
-                        };
-
-                        let (sent_dir_idxs, sent_uncovered) = uncovered_query_idx.sent.cover_by(
-                            encoding_tree
-                                .transcript_indices()
-                                .filter(|(dir, _)| *dir == Direction::Sent),
-                            |(_, idx)| idx,
-                        );
-                        // Uncovered ranges will be checked with ranges of the next
-                        // preferred commitment kind.
-                        uncovered_query_idx.sent = sent_uncovered;
-
-                        let (recv_dir_idxs, recv_uncovered) = uncovered_query_idx.recv.cover_by(
-                            encoding_tree
-                                .transcript_indices()
-                                .filter(|(dir, _)| *dir == Direction::Received),
-                            |(_, idx)| idx,
-                        );
-                        uncovered_query_idx.recv = recv_uncovered;
-
-                        let dir_idxs = sent_dir_idxs
-                            .into_iter()
-                            .chain(recv_dir_idxs)
-                            .collect::<Vec<_>>();
-
-                        // Skip proof generation if there are no committed ranges that can cover the
-                        // query ranges.
-                        if !dir_idxs.is_empty() {
-                            transcript_proof.encoding_proof = Some(
-                                encoding_tree
-                                    .proof(dir_idxs.into_iter())
-                                    .expect("subsequences were checked to be in tree"),
-                            );
-                        }
-                    }
                     TranscriptCommitmentKind::Hash { alg } => {
                         let (sent_hashes, sent_uncovered) = uncovered_query_idx.sent.cover_by(
                             self.hash_secrets.iter().filter(|hash| {
@@ -590,46 +493,10 @@ mod tests {
     use rstest::rstest;
     use tlsn_data_fixtures::http::{request::GET_WITH_HEADER, response::OK_JSON};
 
-    use crate::{
+    use crate::hash::{Blinder, HashAlgId};
-        fixtures::{encoder_secret, encoding_provider},
-        hash::{Blake3, Blinder, HashAlgId},
-        transcript::TranscriptCommitConfigBuilder,
-    };
 
     use super::*;
 
-    #[rstest]
-    fn test_verify_missing_encoding_commitment_root() {
-        let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
-        let idxs = vec![(Direction::Received, RangeSet::from(0..transcript.len().1))];
-        let encoding_tree = EncodingTree::new(
-            &Blake3::default(),
-            &idxs,
-            &encoding_provider(transcript.sent(), transcript.received()),
-        )
-        .unwrap();
-
-        let secrets = vec![TranscriptSecret::Encoding(encoding_tree)];
-        let mut builder = TranscriptProofBuilder::new(&transcript, &secrets);
-
-        builder.reveal_recv(&(0..transcript.len().1)).unwrap();
-
-        let transcript_proof = builder.build().unwrap();
-
-        let provider = HashProvider::default();
-        let err = transcript_proof
-            .verify_with_provider(
-                &provider,
-                &transcript.length(),
-                Some(&encoder_secret()),
-                &[],
-            )
-            .err()
-            .unwrap();
-
-        assert!(matches!(err.kind, ErrorKind::Encoding));
-    }
-
     #[rstest]
     fn test_reveal_range_out_of_bounds() {
         let transcript = Transcript::new(
@@ -649,7 +516,7 @@ mod tests {
     }
 
     #[rstest]
-    fn test_reveal_missing_encoding_tree() {
+    fn test_reveal_missing_commitment() {
         let transcript = Transcript::new(
             [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11],
             [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11],
@@ -698,7 +565,6 @@ mod tests {
             .verify_with_provider(
                 &provider,
                 &transcript.length(),
-                None,
                 &[TranscriptCommitment::Hash(commitment)],
             )
             .unwrap();
@@ -748,7 +614,6 @@ mod tests {
             .verify_with_provider(
                 &provider,
                 &transcript.length(),
-                None,
                 &[TranscriptCommitment::Hash(commitment)],
             )
             .unwrap_err();
@@ -764,24 +629,19 @@ mod tests {
             TranscriptCommitmentKind::Hash {
                 alg: HashAlgId::SHA256,
             },
-            TranscriptCommitmentKind::Encoding,
             TranscriptCommitmentKind::Hash {
                 alg: HashAlgId::SHA256,
             },
             TranscriptCommitmentKind::Hash {
                 alg: HashAlgId::SHA256,
             },
-            TranscriptCommitmentKind::Encoding,
         ]);
 
         assert_eq!(
             builder.commitment_kinds,
-            vec![
+            vec![TranscriptCommitmentKind::Hash {
-                TranscriptCommitmentKind::Hash {
                 alg: HashAlgId::SHA256
-                },
+            },]
-                TranscriptCommitmentKind::Encoding
-            ]
         );
     }
 
@@ -791,7 +651,7 @@ mod tests {
         RangeSet::from([0..10, 12..30]),
         true,
     )]
-    #[case::reveal_all_rangesets_with_superset_ranges(
+    #[case::reveal_all_rangesets_with_single_superset_range(
         vec![RangeSet::from([0..1]), RangeSet::from([1..2, 8..9]), RangeSet::from([2..4, 6..8]), RangeSet::from([2..3, 6..7]), RangeSet::from([9..12])],
         RangeSet::from([0..4, 6..9]),
         true,
@@ -822,29 +682,30 @@ mod tests {
         false,
     )]
     #[allow(clippy::single_range_in_vec_init)]
-    fn test_reveal_mutliple_rangesets_with_one_rangeset(
+    fn test_reveal_multiple_rangesets_with_one_rangeset(
         #[case] commit_recv_rangesets: Vec<RangeSet<usize>>,
         #[case] reveal_recv_rangeset: RangeSet<usize>,
         #[case] success: bool,
     ) {
+        use rand::{Rng, SeedableRng};
+
+        let mut rng = rand::rngs::StdRng::seed_from_u64(0);
         let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
 
-        // Encoding commitment kind
+        // Create hash commitments for each rangeset
-        let mut transcript_commitment_builder = TranscriptCommitConfigBuilder::new(&transcript);
+        let mut secrets = Vec::new();
         for rangeset in commit_recv_rangesets.iter() {
-            transcript_commitment_builder.commit_recv(rangeset).unwrap();
+            let blinder: crate::hash::Blinder = rng.random();
+
+            let secret = PlaintextHashSecret {
+                direction: Direction::Received,
+                idx: rangeset.clone(),
+                alg: HashAlgId::BLAKE3,
+                blinder,
+            };
+            secrets.push(TranscriptSecret::Hash(secret));
         }
 
-        let transcripts_commitment_config = transcript_commitment_builder.build().unwrap();
-
-        let encoding_tree = EncodingTree::new(
-            &Blake3::default(),
-            transcripts_commitment_config.iter_encoding(),
-            &encoding_provider(GET_WITH_HEADER, OK_JSON),
-        )
-        .unwrap();
-
-        let secrets = vec![TranscriptSecret::Encoding(encoding_tree)];
         let mut builder = TranscriptProofBuilder::new(&transcript, &secrets);
 
         if success {
@@ -897,27 +758,34 @@ mod tests {
         #[case] uncovered_sent_rangeset: RangeSet<usize>,
         #[case] uncovered_recv_rangeset: RangeSet<usize>,
     ) {
+        use rand::{Rng, SeedableRng};
+
+        let mut rng = rand::rngs::StdRng::seed_from_u64(0);
         let transcript = Transcript::new(GET_WITH_HEADER, OK_JSON);
 
-        // Encoding commitment kind
+        // Create hash commitments for each rangeset
-        let mut transcript_commitment_builder = TranscriptCommitConfigBuilder::new(&transcript);
+        let mut secrets = Vec::new();
         for rangeset in commit_sent_rangesets.iter() {
-            transcript_commitment_builder.commit_sent(rangeset).unwrap();
+            let blinder: crate::hash::Blinder = rng.random();
+            let secret = PlaintextHashSecret {
+                direction: Direction::Sent,
+                idx: rangeset.clone(),
+                alg: HashAlgId::BLAKE3,
+                blinder,
+            };
+            secrets.push(TranscriptSecret::Hash(secret));
         }
         for rangeset in commit_recv_rangesets.iter() {
-            transcript_commitment_builder.commit_recv(rangeset).unwrap();
+            let blinder: crate::hash::Blinder = rng.random();
+            let secret = PlaintextHashSecret {
+                direction: Direction::Received,
+                idx: rangeset.clone(),
+                alg: HashAlgId::BLAKE3,
+                blinder,
+            };
+            secrets.push(TranscriptSecret::Hash(secret));
         }
 
-        let transcripts_commitment_config = transcript_commitment_builder.build().unwrap();
-
-        let encoding_tree = EncodingTree::new(
-            &Blake3::default(),
-            transcripts_commitment_config.iter_encoding(),
-            &encoding_provider(GET_WITH_HEADER, OK_JSON),
-        )
-        .unwrap();
-
-        let secrets = vec![TranscriptSecret::Encoding(encoding_tree)];
         let mut builder = TranscriptProofBuilder::new(&transcript, &secrets);
         builder.reveal_sent(&reveal_sent_rangeset).unwrap();
         builder.reveal_recv(&reveal_recv_rangeset).unwrap();

crates/examples/Cargo.toml

@@ -43,12 +43,12 @@ noir = { git = "https://github.com/zkmopro/noir-rs", tag = "v1.0.0-beta.8", feat
 ] }
 
 [[example]]
-name = "interactive"
+name = "basic"
-path = "interactive/interactive.rs"
+path = "basic/basic.rs"
 
 [[example]]
-name = "interactive_zk"
+name = "basic_zk"
-path = "interactive_zk/interactive_zk.rs"
+path = "basic_zk/basic_zk.rs"
 
 [[example]]
 name = "attestation_prove"

crates/examples/README.md

@@ -2,9 +2,9 @@
 
 This folder contains examples demonstrating how to use the TLSNotary protocol.
 
-* [Interactive](./interactive/README.md): Interactive Prover and Verifier session without a trusted notary.
+* [Basic](./basic/README.md): Basic Prover and Verifier session.
-* [Attestation](./attestation/README.md): Performing a simple notarization with a trusted notary.
+* [Attestation](./attestation/README.md): Issuing an attestation where a Verifier acts as a Notary.
-* [Interactive_zk](./interactive_zk/README.md): Interactive Prover and Verifier session demonstrating zero-knowledge age verification using Noir.
+* [Basic_zk](./basic_zk/README.md): Basic Prover and Verifier session demonstrating zero-knowledge age verification using Noir.
 
 
 Refer to <https://tlsnotary.org/docs/quick_start> for a quick start guide to using TLSNotary with these examples.

crates/examples/attestation/README.md

@@ -1,21 +1,20 @@
 # Attestation Example
 
-
+This example demonstrates an **attestation workflow**: notarizing data from a server with a trusted third party (Notary), then creating verifiable presentations with selective disclosure of sensitive information to a Verifier.
-This example demonstrates a **TLSNotary attestation workflow**: notarizing data from a server with a trusted third party (Notary), then creating verifiable presentations with selective disclosure of sensitive information to a Verifier.
 
 ## 🔍 How It Works
 
 ```mermaid
 sequenceDiagram
     participant P as Prover
-    participant N as MPC-TLS<br/>Verifier
+    participant N as TLS<br/>Verifier
     participant S as Server<br/>Fixture
     participant V as Attestation<br/>Verifier
 
     Note over P,S: 1. Notarization Phase
-    P->>N: Establish MPC-TLS connection
+    P->>N: Establish TLS connection
-    P->>S: Request (MPC-TLS)
+    P->>S: Request (TLS)
-    S->>P: Response (MPC-TLS)
+    S->>P: Response (TLS)
     N->>P: Issue signed attestation
 
     Note over P: 2. Presentation Phase

crates/examples/attestation/prove.rs

@@ -33,8 +33,9 @@ use tlsn::{
     connection::{ConnectionInfo, HandshakeData, ServerName, TranscriptLength},
     prover::{state::Committed, Prover, ProverOutput},
     transcript::{ContentType, TranscriptCommitConfig},
-    verifier::{Verifier, VerifierOutput},
+    verifier::VerifierOutput,
     webpki::{CertificateDer, PrivateKeyDer, RootCertStore},
+    Session,
 };
 use tlsn_examples::ExampleType;
 use tlsn_formats::http::{DefaultHttpCommitter, HttpCommit, HttpTranscript};
@@ -99,8 +100,16 @@ async fn prover<S: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>(
         .map(|port| port.parse().expect("port should be valid integer"))
         .unwrap_or(DEFAULT_FIXTURE_PORT);
 
+    // Create a session with the notary.
+    let session = Session::new(socket.compat());
+    let (driver, mut handle) = session.split();
+
+    // Spawn the session driver to run in the background.
+    let driver_task = tokio::spawn(driver);
+
     // Create a new prover and perform necessary setup.
-    let prover = Prover::new(ProverConfig::builder().build()?)
+    let prover = handle
+        .new_prover(ProverConfig::builder().build()?)?
         .commit(
             TlsCommitConfig::builder()
                 // Select the TLS commitment protocol.
@@ -115,7 +124,6 @@ async fn prover<S: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>(
                         .build()?,
                 )
                 .build()?,
-            socket.compat(),
         )
         .await?;
 
@@ -224,6 +232,10 @@ async fn prover<S: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>(
 
     let (attestation, secrets) = notarize(prover, &request_config, req_tx, resp_rx).await?;
 
+    // Close the session and wait for the driver to complete.
+    handle.close();
+    driver_task.await??;
+
     // Write the attestation to disk.
     let attestation_path = tlsn_examples::get_file_path(example_type, "attestation");
     let secrets_path = tlsn_examples::get_file_path(example_type, "secrets");
@@ -311,6 +323,13 @@ async fn notary<S: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>(
     request_rx: Receiver<AttestationRequest>,
     attestation_tx: Sender<Attestation>,
 ) -> Result<()> {
+    // Create a session with the prover.
+    let session = Session::new(socket.compat());
+    let (driver, mut handle) = session.split();
+
+    // Spawn the session driver to run in the background.
+    let driver_task = tokio::spawn(driver);
+
     // Create a root certificate store with the server-fixture's self-signed
     // certificate. This is only required for offline testing with the
     // server-fixture.
@@ -321,8 +340,9 @@ async fn notary<S: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>(
         .build()
         .unwrap();
 
-    let verifier = Verifier::new(verifier_config)
+    let verifier = handle
-        .commit(socket.compat())
+        .new_verifier(verifier_config)?
+        .commit()
         .await?
         .accept()
         .await?
@@ -332,7 +352,6 @@ async fn notary<S: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>(
     let (
         VerifierOutput {
             transcript_commitments,
-            encoder_secret,
             ..
         },
         verifier,
@@ -393,10 +412,6 @@ async fn notary<S: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>(
         .server_ephemeral_key(tls_transcript.server_ephemeral_key().clone())
         .transcript_commitments(transcript_commitments);
 
-    if let Some(encoder_secret) = encoder_secret {
-        builder.encoder_secret(encoder_secret);
-    }
-
     let attestation = builder.build(&provider)?;
 
     // Send attestation to prover.
@@ -404,5 +419,9 @@ async fn notary<S: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>(
         .send(attestation)
         .map_err(|_| anyhow!("prover is not receiving attestation"))?;
 
+    // Close the session and wait for the driver to complete.
+    handle.close();
+    driver_task.await??;
+
     Ok(())
 }

crates/examples/basic/README.md

@@ -1,18 +1,18 @@
-## Simple Interactive Verifier: Verifying Data from an API in Rust
+## Simple Basic Verifier: Verifying Data from an API in Rust
 
-This example demonstrates how to use TLSNotary in a simple interactive session between a Prover and a Verifier. It involves the Verifier first verifying the MPC-TLS session and then confirming the correctness of the data.
+This example demonstrates how to use TLSNotary in a simple session between a Prover and a Verifier.
 
 This example fetches data from a local test server. To start the server, run the following command from the root of this repository (not from this example's folder):
 ```shell
 RUST_LOG=info PORT=4000 cargo run --bin tlsn-server-fixture
 ```
-Next, run the interactive example with:
+Next, run the basic example with:
 ```shell
-SERVER_PORT=4000 cargo run --release --example interactive
+SERVER_PORT=4000 cargo run --release --example basic
 ```
 To view more detailed debug information, use the following command:
 ```
-RUST_LOG=debug,yamux=info,uid_mux=info SERVER_PORT=4000 cargo run --release --example interactive
+RUST_LOG=debug,yamux=info,uid_mux=info SERVER_PORT=4000 cargo run --release --example basic
 ```
 
 > ℹ️ Note: In this example, the Prover and Verifier run on the same machine. In real-world scenarios, the Prover and Verifier would typically operate on separate machines.

crates/examples/basic/basic.rs

@@ -20,10 +20,10 @@ use tlsn::{
         verifier::VerifierConfig,
     },
     connection::ServerName,
-    prover::Prover,
     transcript::PartialTranscript,
-    verifier::{Verifier, VerifierOutput},
+    verifier::VerifierOutput,
     webpki::{CertificateDer, RootCertStore},
+    Session,
 };
 use tlsn_server_fixture::DEFAULT_FIXTURE_PORT;
 use tlsn_server_fixture_certs::{CA_CERT_DER, SERVER_DOMAIN};
@@ -77,8 +77,16 @@ async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
     assert_eq!(uri.scheme().unwrap().as_str(), "https");
     let server_domain = uri.authority().unwrap().host();
 
+    // Create a session with the verifier.
+    let session = Session::new(verifier_socket.compat());
+    let (driver, mut handle) = session.split();
+
+    // Spawn the session driver to run in the background.
+    let driver_task = tokio::spawn(driver);
+
     // Create a new prover and perform necessary setup.
-    let prover = Prover::new(ProverConfig::builder().build()?)
+    let prover = handle
+        .new_prover(ProverConfig::builder().build()?)?
         .commit(
             TlsCommitConfig::builder()
                 // Select the TLS commitment protocol.
@@ -93,7 +101,6 @@ async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
                         .build()?,
                 )
                 .build()?,
-            verifier_socket.compat(),
         )
         .await?;
 
@@ -120,14 +127,13 @@ async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
     // Spawn the Prover to run in the background.
     let prover_task = tokio::spawn(prover_fut);
 
-    // MPC-TLS Handshake.
     let (mut request_sender, connection) =
         hyper::client::conn::http1::handshake(tls_connection).await?;
 
     // Spawn the connection to run in the background.
     tokio::spawn(connection);
 
-    // MPC-TLS: Send Request and wait for Response.
+    // Send Request and wait for Response.
     let request = Request::builder()
         .uri(uri.clone())
         .header("Host", server_domain)
@@ -176,6 +182,10 @@ async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
     prover.prove(&config).await?;
     prover.close().await?;
 
+    // Close the session and wait for the driver to complete.
+    handle.close();
+    driver_task.await??;
+
     Ok(())
 }
 
@@ -183,6 +193,13 @@ async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
 async fn verifier<T: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>(
     socket: T,
 ) -> Result<PartialTranscript> {
+    // Create a session with the prover.
+    let session = Session::new(socket.compat());
+    let (driver, mut handle) = session.split();
+
+    // Spawn the session driver to run in the background.
+    let driver_task = tokio::spawn(driver);
+
     // Create a root certificate store with the server-fixture's self-signed
     // certificate. This is only required for offline testing with the
     // server-fixture.
@@ -191,10 +208,10 @@ async fn verifier<T: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>(
             roots: vec![CertificateDer(CA_CERT_DER.to_vec())],
         })
         .build()?;
-    let verifier = Verifier::new(verifier_config);
+    let verifier = handle.new_verifier(verifier_config)?;
 
     // Validate the proposed configuration and then run the TLS commitment protocol.
-    let verifier = verifier.commit(socket.compat()).await?;
+    let verifier = verifier.commit().await?;
 
     // This is the opportunity to ensure the prover does not attempt to overload the
     // verifier.
@@ -241,6 +258,10 @@ async fn verifier<T: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>(
 
     verifier.close().await?;
 
+    // Close the session and wait for the driver to complete.
+    handle.close();
+    driver_task.await??;
+
     let server_name = server_name.expect("prover should have revealed server name");
     let transcript = transcript.expect("prover should have revealed transcript data");
 

crates/examples/basic_zk/README.md

@@ -1,4 +1,4 @@
-# Interactive Zero-Knowledge Age Verification with TLSNotary
+# Basic Zero-Knowledge Age Verification with TLSNotary
 
 This example demonstrates **privacy-preserving age verification** using TLSNotary and zero-knowledge proofs. It allows a prover to demonstrate they are 18+ years old without revealing their actual birth date or any other personal information.
 
@@ -10,8 +10,8 @@ sequenceDiagram
     participant P as Prover
     participant V as Verifier
 
-    P->>S: Request tax data (with auth token) (MPC-TLS)
+    P->>S: Request tax data (with auth token) (TLS)
-    S->>P: Tax data including `date_of_birth` (MPC-TLS)
+    S->>P: Tax data including `date_of_birth` (TLS)
     P->>V: Share transcript with redactions
     P->>V: Commit to blinded hash of birth date
     P->>P: Generate ZK proof of age ≥ 18
@@ -22,7 +22,7 @@ sequenceDiagram
 
 ### The Process
 
-1. **MPC-TLS Session**: The Prover fetches tax information containing their birth date, while the Verifier jointly verifies the TLS session to ensure the data comes from the authentic server.
+1. **TLS Commitment**: The Prover fetches tax information containing their birth date, while the Verifier jointly verifies the TLS session to ensure the data comes from the authentic server.
 2. **Selective Disclosure**:
    * The authorization token is **redacted**: the Verifier sees the plaintext request but not the token.
    * The birth date is **committed** as a blinded hash: the Verifier cannot see the date, but the Prover is cryptographically bound to it.  
@@ -61,7 +61,7 @@ The ZK circuit proves: **"I know a birth date that hashes to the committed value
 
 **What the Verifier Learns:**
 - ✅ The prover is 18+ years old
-- ✅ The birth date is authentic (from the MPC-TLS session)
+- ✅ The birth date is authentic (from the TLS session)
 
 Everything else remains private.
 
@@ -74,12 +74,12 @@ Everything else remains private.
 
 2. **Run the age verification** (in a new terminal):
    ```bash
-   SERVER_PORT=4000 cargo run --release --example interactive_zk
+   SERVER_PORT=4000 cargo run --release --example basic_zk
    ```
 
 3. **For detailed logs**:
    ```bash
-   RUST_LOG=debug,yamux=info,uid_mux=info SERVER_PORT=4000 cargo run --release --example interactive_zk
+   RUST_LOG=debug,yamux=info,uid_mux=info SERVER_PORT=4000 cargo run --release --example basic_zk
    ```
 
 ### Expected Output
@@ -106,11 +106,11 @@ Verified received data:
 ### Project Structure
 
 ```
-interactive_zk/
+basic_zk/
 ├── prover.rs                   # Prover implementation
 ├── verifier.rs                 # Verifier implementation
 ├── types.rs                    # Shared types
-└── interactive_zk.rs           # Main example runner
+└── basic_zk.rs                 # Main example runner
 ├── noir/                       # Zero-knowledge circuit
 │   ├── src/main.n              # Noir circuit code
 │   ├── target/                 # Compiled circuit artifacts

crates/examples/basic_zk/basic_zk.rs

@@ -31,11 +31,10 @@ async fn main() -> Result<()> {
 
     // Connect prover and verifier.
     let (prover_socket, verifier_socket) = tokio::io::duplex(1 << 23);
-    let (prover_extra_socket, verifier_extra_socket) = tokio::io::duplex(1 << 23);
 
     let (_, transcript) = tokio::try_join!(
-        prover(prover_socket, prover_extra_socket, &server_addr, &uri),
+        prover(prover_socket, &server_addr, &uri),
-        verifier(verifier_socket, verifier_extra_socket)
+        verifier(verifier_socket)
     )?;
 
     println!("---");

crates/examples/basic_zk/prover.rs

@@ -32,24 +32,24 @@ use tlsn::{
     },
     connection::ServerName,
     hash::HashAlgId,
-    prover::Prover,
     transcript::{
         hash::{PlaintextHash, PlaintextHashSecret},
         Direction, TranscriptCommitConfig, TranscriptCommitConfigBuilder, TranscriptCommitmentKind,
         TranscriptSecret,
     },
     webpki::{CertificateDer, RootCertStore},
+    Session,
 };
 
+use futures::io::AsyncWriteExt as _;
 use tlsn_examples::{MAX_RECV_DATA, MAX_SENT_DATA};
-use tokio::io::{AsyncRead, AsyncWrite, AsyncWriteExt};
+use tokio::io::{AsyncRead, AsyncWrite};
 use tokio_util::compat::{FuturesAsyncReadCompatExt, TokioAsyncReadCompatExt};
 use tracing::instrument;
 
-#[instrument(skip(verifier_socket, verifier_extra_socket))]
+#[instrument(skip(verifier_socket))]
 pub async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
     verifier_socket: T,
-    mut verifier_extra_socket: T,
     server_addr: &SocketAddr,
     uri: &str,
 ) -> Result<()> {
@@ -64,8 +64,16 @@ pub async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
         .ok_or_else(|| anyhow::anyhow!("URI must have authority"))?
         .host();
 
+    // Create a session with the verifier.
+    let session = Session::new(verifier_socket.compat());
+    let (driver, mut handle) = session.split();
+
+    // Spawn the session driver to run in the background.
+    let driver_task = tokio::spawn(driver);
+
     // Create a new prover and perform necessary setup.
-    let prover = Prover::new(ProverConfig::builder().build()?)
+    let prover = handle
+        .new_prover(ProverConfig::builder().build()?)?
         .commit(
             TlsCommitConfig::builder()
                 // Select the TLS commitment protocol.
@@ -80,7 +88,6 @@ pub async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
                         .build()?,
                 )
                 .build()?,
-            verifier_socket.compat(),
         )
         .await?;
 
@@ -107,14 +114,13 @@ pub async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
     // Spawn the Prover to run in the background.
     let prover_task = tokio::spawn(prover_fut);
 
-    // MPC-TLS Handshake.
     let (mut request_sender, connection) =
         hyper::client::conn::http1::handshake(tls_connection).await?;
 
     // Spawn the connection to run in the background.
     tokio::spawn(connection);
 
-    // MPC-TLS: Send Request and wait for Response.
+    // Send Request and wait for Response.
     let request = Request::builder()
         .uri(uri.clone())
         .header("Host", server_domain)
@@ -127,7 +133,7 @@ pub async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
 
     if response.status() != StatusCode::OK {
         return Err(anyhow::anyhow!(
-            "MPC-TLS request failed with status {}",
+            "request failed with status {}",
             response.status()
         ));
     }
@@ -166,10 +172,13 @@ pub async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
 
     let prove_config = prove_config_builder.build()?;
 
-    // MPC-TLS prove
     let prover_output = prover.prove(&prove_config).await?;
     prover.close().await?;
 
+    // Close the session and wait for the driver to complete, reclaiming the socket.
+    handle.close();
+    let mut socket = driver_task.await??;
+
     // Prove birthdate is more than 18 years ago.
     let received_commitments = received_commitments(&prover_output.transcript_commitments);
     let received_commitment = received_commitments
@@ -184,8 +193,8 @@ pub async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
 
     // Sent zk proof bundle to verifier
     let serialized_proof = bincode::serialize(&proof_bundle)?;
-    verifier_extra_socket.write_all(&serialized_proof).await?;
+    socket.write_all(&serialized_proof).await?;
-    verifier_extra_socket.shutdown().await?;
+    socket.close().await?;
 
     Ok(())
 }

crates/examples/basic_zk/verifier.rs

@@ -3,6 +3,7 @@ use crate::types::received_commitments;
 use super::types::ZKProofBundle;
 use anyhow::Result;
 use chrono::{Local, NaiveDate};
+use futures::io::AsyncReadExt as _;
 use noir::barretenberg::verify::{get_ultra_honk_verification_key, verify_ultra_honk};
 use serde_json::Value;
 use tls_server_fixture::CA_CERT_DER;
@@ -11,33 +12,39 @@ use tlsn::{
     connection::ServerName,
     hash::HashAlgId,
     transcript::{Direction, PartialTranscript},
-    verifier::{Verifier, VerifierOutput},
+    verifier::VerifierOutput,
     webpki::{CertificateDer, RootCertStore},
+    Session,
 };
 use tlsn_examples::{MAX_RECV_DATA, MAX_SENT_DATA};
 use tlsn_server_fixture_certs::SERVER_DOMAIN;
-use tokio::io::{AsyncRead, AsyncReadExt, AsyncWrite};
+use tokio::io::{AsyncRead, AsyncWrite};
 use tokio_util::compat::TokioAsyncReadCompatExt;
 use tracing::instrument;
 
-#[instrument(skip(socket, extra_socket))]
+#[instrument(skip(socket))]
 pub async fn verifier<T: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>(
     socket: T,
-    mut extra_socket: T,
 ) -> Result<PartialTranscript> {
-    let verifier = Verifier::new(
+    // Create a session with the prover.
-        VerifierConfig::builder()
+    let session = Session::new(socket.compat());
+    let (driver, mut handle) = session.split();
+
+    // Spawn the session driver to run in the background.
+    let driver_task = tokio::spawn(driver);
+
     // Create a root certificate store with the server-fixture's self-signed
     // certificate. This is only required for offline testing with the
     // server-fixture.
+    let verifier_config = VerifierConfig::builder()
         .root_store(RootCertStore {
             roots: vec![CertificateDer(CA_CERT_DER.to_vec())],
         })
-            .build()?,
+        .build()?;
-    );
+    let verifier = handle.new_verifier(verifier_config)?;
 
     // Validate the proposed configuration and then run the TLS commitment protocol.
-    let verifier = verifier.commit(socket.compat()).await?;
+    let verifier = verifier.commit().await?;
 
     // This is the opportunity to ensure the prover does not attempt to overload the
     // verifier.
@@ -90,6 +97,10 @@ pub async fn verifier<T: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>
 
     verifier.close().await?;
 
+    // Close the session and wait for the driver to complete, reclaiming the socket.
+    handle.close();
+    let mut socket = driver_task.await??;
+
     let server_name = server_name.expect("server name should be present");
     let transcript = transcript.expect("transcript should be present");
 
@@ -126,7 +137,7 @@ pub async fn verifier<T: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>
 
     // Receive ZKProof information from prover
     let mut buf = Vec::new();
-    extra_socket.read_to_end(&mut buf).await?;
+    socket.read_to_end(&mut buf).await?;
 
     if buf.is_empty() {
         return Err(anyhow::anyhow!("No ZK proof data received from prover"));
@@ -193,16 +204,16 @@ pub async fn verifier<T: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>
     let expected_hash = committed_hash.value.as_bytes().to_vec();
     if committed_hash_in_proof != expected_hash {
         tracing::error!(
-            "❌ The hash in the proof does not match the committed hash in MPC-TLS: {} != {}",
+            "❌ The hash in the proof does not match the committed hash: {} != {}",
             hex::encode(&committed_hash_in_proof),
             hex::encode(&expected_hash)
         );
         return Err(anyhow::anyhow!(
-            "Hash in proof does not match committed hash in MPC-TLS"
+            "Hash in proof does not match committed hash"
         ));
     }
     tracing::info!(
-        "✅ The hash in the proof matches the committed hash in MPC-TLS ({})",
+        "✅ The hash in the proof matches the committed hash ({})",
         hex::encode(&expected_hash)
     );
 

crates/formats/Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "tlsn-formats"
-version = "0.1.0-alpha.14-pre"
+version = "0.1.0-alpha.14"
 edition = "2021"
 
 [lints]

crates/harness/bench.toml

@@ -1,51 +1,59 @@
-#### Latency ####
+#### Default Representative Benchmarks ####
+#
+# This benchmark measures TLSNotary performance on three representative network scenarios.
+# Each scenario is run multiple times to produce statistical metrics (median, std dev, etc.)
+# rather than plots. Use this for quick performance checks and CI regression testing.
+#
+# Payload sizes:
+#   - upload-size: 1KB (typical HTTP request)
+#   - download-size: 2KB (typical HTTP response/API data)
+#
+# Network scenarios are chosen to represent real-world user conditions where
+# TLSNotary is primarily bottlenecked by upload bandwidth.
+
+#### Cable/DSL Home Internet ####
+# Most common residential internet connection
+# - Asymmetric: high download, limited upload (typical bottleneck)
+# - Upload bandwidth: 20 Mbps (realistic cable/DSL upload speed)
+# - Latency: 20ms (typical ISP latency)
 
 [[group]]
-name = "latency"
+name = "cable"
-bandwidth = 1000
+bandwidth = 20
+protocol_latency = 20
+upload-size = 1024
+download-size = 2048
 
 [[bench]]
-group = "latency"
+group = "cable"
-protocol_latency = 10
 
-[[bench]]
+#### Mobile 5G ####
-group = "latency"
+# Modern mobile connection with good coverage
-protocol_latency = 25
+# - Upload bandwidth: 30 Mbps (typical 5G upload in good conditions)
-
+# - Latency: 30ms (higher than wired due to mobile tower hops)
-[[bench]]
-group = "latency"
-protocol_latency = 50
-
-[[bench]]
-group = "latency"
-protocol_latency = 100
-
-[[bench]]
-group = "latency"
-protocol_latency = 200
-
-#### Bandwidth ####
 
 [[group]]
-name = "bandwidth"
+name = "mobile_5g"
-protocol_latency = 25
+bandwidth = 30
+protocol_latency = 30
+upload-size = 1024
+download-size = 2048
 
 [[bench]]
-group = "bandwidth"
+group = "mobile_5g"
-bandwidth = 10
 
-[[bench]]
+#### Fiber Home Internet ####
-group = "bandwidth"
+# High-end residential connection (best case scenario)
-bandwidth = 50
+# - Symmetric: equal upload/download bandwidth
+# - Upload bandwidth: 100 Mbps (typical fiber upload)
+# - Latency: 15ms (lower latency than cable)
 
-[[bench]]
+[[group]]
-group = "bandwidth"
+name = "fiber"
 bandwidth = 100
+protocol_latency = 15
+upload-size = 1024
+download-size = 2048
 
 [[bench]]
-group = "bandwidth"
+group = "fiber"
-bandwidth = 250
-
-[[bench]]
-group = "bandwidth"
-bandwidth = 1000

crates/harness/bench_bandwidth_sweep.toml

@@ -0,0 +1,52 @@
+#### Bandwidth Sweep Benchmark ####
+#
+# Measures how network bandwidth affects TLSNotary runtime.
+# Keeps latency and payload sizes fixed while varying upload bandwidth.
+#
+# Fixed parameters:
+#   - Latency: 25ms (typical internet latency)
+#   - Upload: 1KB (typical request)
+#   - Download: 2KB (typical response)
+#
+# Variable: Bandwidth from 5 Mbps to 1000 Mbps
+#
+# Use this to plot "Bandwidth vs Runtime" and understand bandwidth sensitivity.
+# Focus on upload bandwidth as TLSNotary is primarily upload-bottlenecked
+
+[[group]]
+name = "bandwidth_sweep"
+protocol_latency = 25
+upload-size = 1024
+download-size = 2048
+
+[[bench]]
+group = "bandwidth_sweep"
+bandwidth = 5
+
+[[bench]]
+group = "bandwidth_sweep"
+bandwidth = 10
+
+[[bench]]
+group = "bandwidth_sweep"
+bandwidth = 20
+
+[[bench]]
+group = "bandwidth_sweep"
+bandwidth = 50
+
+[[bench]]
+group = "bandwidth_sweep"
+bandwidth = 100
+
+[[bench]]
+group = "bandwidth_sweep"
+bandwidth = 250
+
+[[bench]]
+group = "bandwidth_sweep"
+bandwidth = 500
+
+[[bench]]
+group = "bandwidth_sweep"
+bandwidth = 1000

crates/harness/bench_download_sweep.toml

@@ -0,0 +1,53 @@
+#### Download Size Sweep Benchmark ####
+#
+# Measures how download payload size affects TLSNotary runtime.
+# Keeps network conditions fixed while varying the response size.
+#
+# Fixed parameters:
+#   - Bandwidth: 100 Mbps (typical good connection)
+#   - Latency: 25ms (typical internet latency)
+#   - Upload: 1KB (typical request size)
+#
+# Variable: Download size from 1KB to 100KB
+#
+# Use this to plot "Download Size vs Runtime" and understand how much data
+# TLSNotary can efficiently notarize. Useful for determining optimal
+# chunking strategies for large responses.
+
+[[group]]
+name = "download_sweep"
+bandwidth = 100
+protocol_latency = 25
+upload-size = 1024
+
+[[bench]]
+group = "download_sweep"
+download-size = 1024
+
+[[bench]]
+group = "download_sweep"
+download-size = 2048
+
+[[bench]]
+group = "download_sweep"
+download-size = 5120
+
+[[bench]]
+group = "download_sweep"
+download-size = 10240
+
+[[bench]]
+group = "download_sweep"
+download-size = 20480
+
+[[bench]]
+group = "download_sweep"
+download-size = 30720
+
+[[bench]]
+group = "download_sweep"
+download-size = 40960
+
+[[bench]]
+group = "download_sweep"
+download-size = 51200

crates/harness/bench_latency_sweep.toml

@@ -0,0 +1,47 @@
+#### Latency Sweep Benchmark ####
+#
+# Measures how network latency affects TLSNotary runtime.
+# Keeps bandwidth and payload sizes fixed while varying protocol latency.
+#
+# Fixed parameters:
+#   - Bandwidth: 100 Mbps (typical good connection)
+#   - Upload: 1KB (typical request)
+#   - Download: 2KB (typical response)
+#
+# Variable: Protocol latency from 10ms to 200ms
+#
+# Use this to plot "Latency vs Runtime" and understand latency sensitivity.
+
+[[group]]
+name = "latency_sweep"
+bandwidth = 100
+upload-size = 1024
+download-size = 2048
+
+[[bench]]
+group = "latency_sweep"
+protocol_latency = 10
+
+[[bench]]
+group = "latency_sweep"
+protocol_latency = 25
+
+[[bench]]
+group = "latency_sweep"
+protocol_latency = 50
+
+[[bench]]
+group = "latency_sweep"
+protocol_latency = 75
+
+[[bench]]
+group = "latency_sweep"
+protocol_latency = 100
+
+[[bench]]
+group = "latency_sweep"
+protocol_latency = 150
+
+[[bench]]
+group = "latency_sweep"
+protocol_latency = 200

crates/harness/executor/src/bench/prover.rs

@@ -5,6 +5,7 @@ use futures::{AsyncReadExt, AsyncWriteExt, TryFutureExt};
 
 use harness_core::bench::{Bench, ProverMetrics};
 use tlsn::{
+    Session,
     config::{
         prove::ProveConfig,
         prover::ProverConfig,
@@ -12,7 +13,6 @@ use tlsn::{
         tls_commit::{TlsCommitConfig, mpc::MpcTlsConfig},
     },
     connection::ServerName,
-    prover::Prover,
     webpki::{CertificateDer, RootCertStore},
 };
 use tlsn_server_fixture_certs::{CA_CERT_DER, SERVER_DOMAIN};
@@ -20,6 +20,7 @@ use tlsn_server_fixture_certs::{CA_CERT_DER, SERVER_DOMAIN};
 use crate::{
     IoProvider,
     bench::{Meter, RECV_PADDING},
+    spawn,
 };
 
 pub async fn bench_prover(provider: &IoProvider, config: &Bench) -> Result<ProverMetrics> {
@@ -28,7 +29,12 @@ pub async fn bench_prover(provider: &IoProvider, config: &Bench) -> Result<Prove
     let sent = verifier_io.sent();
     let recv = verifier_io.recv();
 
-    let prover = Prover::new(ProverConfig::builder().build()?);
+    let mut session = Session::new(verifier_io);
+
+    let prover = session.new_prover(ProverConfig::builder().build()?)?;
+    let (session, handle) = session.split();
+
+    _ = spawn(session);
 
     let time_start = web_time::Instant::now();
 
@@ -49,7 +55,6 @@ pub async fn bench_prover(provider: &IoProvider, config: &Bench) -> Result<Prove
                         .build()
                 }?)
                 .build()?,
-            verifier_io,
         )
         .await?;
 
@@ -120,6 +125,7 @@ pub async fn bench_prover(provider: &IoProvider, config: &Bench) -> Result<Prove
 
     prover.prove(&prove_config).await?;
     prover.close().await?;
+    handle.close();
 
     let time_total = time_start.elapsed().as_millis();
 

crates/harness/executor/src/bench/verifier.rs

@@ -2,32 +2,34 @@ use anyhow::Result;
 
 use harness_core::bench::Bench;
 use tlsn::{
+    Session,
     config::verifier::VerifierConfig,
-    verifier::Verifier,
     webpki::{CertificateDer, RootCertStore},
 };
 use tlsn_server_fixture_certs::CA_CERT_DER;
 
-use crate::IoProvider;
+use crate::{IoProvider, spawn};
 
 pub async fn bench_verifier(provider: &IoProvider, _config: &Bench) -> Result<()> {
-    let verifier = Verifier::new(
+    let io = provider.provide_proto_io().await?;
+    let mut session = Session::new(io);
+
+    let verifier = session.new_verifier(
         VerifierConfig::builder()
             .root_store(RootCertStore {
                 roots: vec![CertificateDer(CA_CERT_DER.to_vec())],
             })
             .build()?,
-    );
+    )?;
 
-    let verifier = verifier
+    let (session, handle) = session.split();
-        .commit(provider.provide_proto_io().await?)
+
-        .await?
+    _ = spawn(session);
-        .accept()
+
-        .await?
+    let verifier = verifier.commit().await?.accept().await?.run().await?;
-        .run()
-        .await?;
     let (_, verifier) = verifier.verify().await?.accept().await?;
     verifier.close().await?;
+    handle.close();
 
     Ok(())
 }

crates/harness/executor/test_plugins/basic.rs

@@ -1,4 +1,5 @@
 use tlsn::{
+    Session,
     config::{
         prove::ProveConfig,
         prover::ProverConfig,
@@ -8,9 +9,8 @@ use tlsn::{
     },
     connection::ServerName,
     hash::HashAlgId,
-    prover::Prover,
     transcript::{TranscriptCommitConfig, TranscriptCommitment, TranscriptCommitmentKind},
-    verifier::{Verifier, VerifierOutput},
+    verifier::VerifierOutput,
     webpki::{CertificateDer, RootCertStore},
 };
 use tlsn_server_fixture_certs::{CA_CERT_DER, SERVER_DOMAIN};
@@ -28,7 +28,17 @@ const MAX_RECV_DATA: usize = 1 << 11;
 crate::test!("basic", prover, verifier);
 
 async fn prover(provider: &IoProvider) {
-    let prover = Prover::new(ProverConfig::builder().build().unwrap())
+    let io = provider.provide_proto_io().await.unwrap();
+    let mut session = Session::new(io);
+    let prover = session
+        .new_prover(ProverConfig::builder().build().unwrap())
+        .unwrap();
+
+    let (session, handle) = session.split();
+
+    _ = spawn(session);
+
+    let prover = prover
         .commit(
             TlsCommitConfig::builder()
                 .protocol(
@@ -41,7 +51,6 @@ async fn prover(provider: &IoProvider) {
                 )
                 .build()
                 .unwrap(),
-            provider.provide_proto_io().await.unwrap(),
         )
         .await
         .unwrap();
@@ -116,18 +125,27 @@ async fn prover(provider: &IoProvider) {
 
     prover.prove(&config).await.unwrap();
     prover.close().await.unwrap();
+    handle.close();
 }
 
 async fn verifier(provider: &IoProvider) {
+    let io = provider.provide_proto_io().await.unwrap();
+    let mut session = Session::new(io);
+
     let config = VerifierConfig::builder()
         .root_store(RootCertStore {
             roots: vec![CertificateDer(CA_CERT_DER.to_vec())],
         })
         .build()
         .unwrap();
+    let verifier = session.new_verifier(config).unwrap();
 
-    let verifier = Verifier::new(config)
+    let (session, handle) = session.split();
-        .commit(provider.provide_proto_io().await.unwrap())
+
+    _ = spawn(session);
+
+    let verifier = verifier
+        .commit()
         .await
         .unwrap()
         .accept()
@@ -147,6 +165,7 @@ async fn verifier(provider: &IoProvider) {
     ) = verifier.verify().await.unwrap().accept().await.unwrap();
 
     verifier.close().await.unwrap();
+    handle.close();
 
     let ServerName::Dns(server_name) = server_name.unwrap();
 

crates/harness/runner/Cargo.toml

@@ -22,6 +22,7 @@ clap = { workspace = true, features = ["derive", "env"] }
 csv = { version = "1.3" }
 duct = { version = "1" }
 futures = { workspace = true }
+indicatif = { version = "0.17" }
 ipnet = { workspace = true }
 serio = { workspace = true }
 serde_json = { workspace = true }

crates/harness/runner/src/cli.rs

@@ -16,6 +16,10 @@ pub struct Cli {
     /// Subnet to assign harness network interfaces.
     #[arg(long, default_value = "10.250.0.0/24", env = "SUBNET")]
     pub subnet: Ipv4Net,
+    /// Run browser in headed mode (visible window) for debugging.
+    /// Works with both X11 and Wayland.
+    #[arg(long)]
+    pub headed: bool,
 }
 
 #[derive(Subcommand)]
@@ -31,10 +35,13 @@ pub enum Command {
     },
     /// runs benchmarks.
     Bench {
-        /// Configuration path.
+        /// Configuration path. Defaults to bench.toml which contains
+        /// representative scenarios (cable, 5G, fiber) for quick performance
+        /// checks. Use bench_*_sweep.toml files for parametric
+        /// analysis.
         #[arg(short, long, default_value = "bench.toml")]
         config: PathBuf,
-        /// Output file path.
+        /// Output CSV file path for detailed metrics and post-processing.
         #[arg(short, long, default_value = "metrics.csv")]
         output: PathBuf,
         /// Number of samples to measure per benchmark. This is overridden by

crates/harness/runner/src/executor.rs

@@ -28,6 +28,9 @@ pub struct Executor {
     ns: Namespace,
     config: ExecutorConfig,
     target: Target,
+    /// Display environment variables for headed mode (X11/Wayland).
+    /// Empty means headless mode.
+    display_env: Vec<String>,
     state: State,
 }
 
@@ -49,11 +52,17 @@ impl State {
 }
 
 impl Executor {
-    pub fn new(ns: Namespace, config: ExecutorConfig, target: Target) -> Self {
+    pub fn new(
+        ns: Namespace,
+        config: ExecutorConfig,
+        target: Target,
+        display_env: Vec<String>,
+    ) -> Self {
         Self {
             ns,
             config,
             target,
+            display_env,
             state: State::Init,
         }
     }
@@ -120,23 +129,49 @@ impl Executor {
                 let tmp = duct::cmd!("mktemp", "-d").read()?;
                 let tmp = tmp.trim();
 
-                let process = duct::cmd!(
+                let headed = !self.display_env.is_empty();
-                    "sudo",
+
-                    "ip",
+                // Build command args based on headed/headless mode
-                    "netns",
+                let mut args: Vec<String> = vec![
-                    "exec",
+                    "ip".into(),
-                    self.ns.name(),
+                    "netns".into(),
-                    chrome_path,
+                    "exec".into(),
-                    format!("--remote-debugging-port={PORT_BROWSER}"),
+                    self.ns.name().into(),
-                    "--headless",
+                ];
-                    "--disable-dev-shm-usage",
+
-                    "--disable-gpu",
+                if headed {
-                    "--disable-cache",
+                    // For headed mode: drop back to the current user and pass display env vars
-                    "--disable-application-cache",
+                    // This allows the browser to connect to X11/Wayland while in the namespace
-                    "--no-sandbox",
+                    let user =
+                        std::env::var("USER").context("USER environment variable not set")?;
+                    args.extend(["sudo".into(), "-E".into(), "-u".into(), user, "env".into()]);
+                    args.extend(self.display_env.clone());
+                }
+
+                args.push(chrome_path.to_string_lossy().into());
+                args.push(format!("--remote-debugging-port={PORT_BROWSER}"));
+
+                if headed {
+                    // Headed mode: no headless, add flags to suppress first-run dialogs
+                    args.extend(["--no-first-run".into(), "--no-default-browser-check".into()]);
+                } else {
+                    // Headless mode: original flags
+                    args.extend([
+                        "--headless".into(),
+                        "--disable-dev-shm-usage".into(),
+                        "--disable-gpu".into(),
+                        "--disable-cache".into(),
+                        "--disable-application-cache".into(),
+                    ]);
+                }
+
+                args.extend([
+                    "--no-sandbox".into(),
                     format!("--user-data-dir={tmp}"),
-                    format!("--allowed-ips=10.250.0.1"),
+                    "--allowed-ips=10.250.0.1".into(),
-                );
+                ]);
+
+                let process = duct::cmd("sudo", &args);
 
                 let process = if !cfg!(feature = "debug") {
                     process.stderr_capture().stdout_capture().start()?

crates/harness/runner/src/lib.rs

@@ -9,7 +9,7 @@ mod ws_proxy;
 #[cfg(feature = "debug")]
 mod debug_prelude;
 
-use std::time::Duration;
+use std::{collections::HashMap, time::Duration};
 
 use anyhow::Result;
 use clap::Parser;
@@ -22,6 +22,7 @@ use harness_core::{
     rpc::{BenchCmd, TestCmd},
     test::TestStatus,
 };
+use indicatif::{ProgressBar, ProgressStyle};
 
 use cli::{Cli, Command};
 use executor::Executor;
@@ -32,6 +33,60 @@ use crate::debug_prelude::*;
 
 use crate::{cli::Route, network::Network, wasm_server::WasmServer, ws_proxy::WsProxy};
 
+/// Statistics for a benchmark configuration
+#[derive(Debug, Clone)]
+struct BenchStats {
+    group: Option<String>,
+    bandwidth: usize,
+    latency: usize,
+    upload_size: usize,
+    download_size: usize,
+    times: Vec<u64>,
+}
+
+impl BenchStats {
+    fn median(&self) -> f64 {
+        let mut sorted = self.times.clone();
+        sorted.sort();
+        let len = sorted.len();
+        if len == 0 {
+            return 0.0;
+        }
+        if len.is_multiple_of(2) {
+            (sorted[len / 2 - 1] + sorted[len / 2]) as f64 / 2.0
+        } else {
+            sorted[len / 2] as f64
+        }
+    }
+}
+
+/// Print summary table of benchmark results
+fn print_bench_summary(stats: &[BenchStats]) {
+    if stats.is_empty() {
+        println!("\nNo benchmark results to display (only warmup was run).");
+        return;
+    }
+
+    println!("\n{}", "=".repeat(80));
+    println!("TLSNotary Benchmark Results");
+    println!("{}", "=".repeat(80));
+    println!();
+
+    for stat in stats {
+        let group_name = stat.group.as_deref().unwrap_or("unnamed");
+        println!(
+            "{} ({} Mbps, {}ms latency, {}KB↑ {}KB↓):",
+            group_name,
+            stat.bandwidth,
+            stat.latency,
+            stat.upload_size / 1024,
+            stat.download_size / 1024
+        );
+        println!("  Median:  {:.2}s", stat.median() / 1000.0);
+        println!();
+    }
+}
+
 #[derive(Debug, Clone, Copy, PartialEq, Eq, clap::ValueEnum, Default)]
 pub enum Target {
     #[default]
@@ -50,14 +105,46 @@ struct Runner {
     started: bool,
 }
 
+/// Collects display-related environment variables for headed browser mode.
+/// Works with both X11 and Wayland by collecting whichever vars are present.
+fn collect_display_env_vars() -> Vec<String> {
+    const DISPLAY_VARS: &[&str] = &[
+        "DISPLAY",         // X11
+        "XAUTHORITY",      // X11 auth
+        "WAYLAND_DISPLAY", // Wayland
+        "XDG_RUNTIME_DIR", // Wayland runtime dir
+    ];
+
+    DISPLAY_VARS
+        .iter()
+        .filter_map(|&var| {
+            std::env::var(var)
+                .ok()
+                .map(|val| format!("{}={}", var, val))
+        })
+        .collect()
+}
+
 impl Runner {
     fn new(cli: &Cli) -> Result<Self> {
-        let Cli { target, subnet, .. } = cli;
+        let Cli {
+            target,
+            subnet,
+            headed,
+            ..
+        } = cli;
         let current_path = std::env::current_exe().unwrap();
         let fixture_path = current_path.parent().unwrap().join("server-fixture");
         let network_config = NetworkConfig::new(*subnet);
         let network = Network::new(network_config.clone())?;
 
+        // Collect display env vars once if headed mode is enabled
+        let display_env = if *headed {
+            collect_display_env_vars()
+        } else {
+            Vec::new()
+        };
+
         let server_fixture =
             ServerFixture::new(fixture_path, network.ns_app().clone(), network_config.app);
         let wasm_server = WasmServer::new(
@@ -75,6 +162,7 @@ impl Runner {
                 .network_config(network_config.clone())
                 .build(),
             *target,
+            display_env.clone(),
         );
         let exec_v = Executor::new(
             network.ns_1().clone(),
@@ -84,6 +172,7 @@ impl Runner {
                 .network_config(network_config.clone())
                 .build(),
             Target::Native,
+            Vec::new(), // Verifier doesn't need display env
         );
 
         Ok(Self {
@@ -118,6 +207,12 @@ pub async fn main() -> Result<()> {
     tracing_subscriber::fmt::init();
 
     let cli = Cli::parse();
+
+    // Validate --headed requires --target browser
+    if cli.headed && cli.target != Target::Browser {
+        anyhow::bail!("--headed can only be used with --target browser");
+    }
+
     let mut runner = Runner::new(&cli)?;
 
     let mut exit_code = 0;
@@ -206,6 +301,12 @@ pub async fn main() -> Result<()> {
             samples_override,
             skip_warmup,
         } => {
+            // Print configuration info
+            println!("TLSNotary Benchmark Harness");
+            println!("Running benchmarks from: {}", config.display());
+            println!("Output will be written to: {}", output.display());
+            println!();
+
             let items: BenchItems = toml::from_str(&std::fs::read_to_string(config)?)?;
             let output_file = std::fs::File::create(output)?;
             let mut writer = WriterBuilder::new().from_writer(output_file);
@@ -220,7 +321,34 @@ pub async fn main() -> Result<()> {
             runner.exec_p.start().await?;
             runner.exec_v.start().await?;
 
-            for config in benches {
+            // Create progress bar
+            let pb = ProgressBar::new(benches.len() as u64);
+            pb.set_style(
+                ProgressStyle::default_bar()
+                    .template("[{elapsed_precise}] {bar:40.cyan/blue} {pos}/{len} {msg}")
+                    .expect("valid template")
+                    .progress_chars("█▓▒░ "),
+            );
+
+            // Collect measurements for stats
+            let mut measurements_by_config: HashMap<String, Vec<u64>> = HashMap::new();
+
+            let warmup_count = if skip_warmup { 0 } else { 3 };
+
+            for (idx, config) in benches.iter().enumerate() {
+                let is_warmup = idx < warmup_count;
+
+                let group_name = if is_warmup {
+                    format!("Warmup {}/{}", idx + 1, warmup_count)
+                } else {
+                    config.group.as_deref().unwrap_or("unnamed").to_string()
+                };
+
+                pb.set_message(format!(
+                    "{} ({} Mbps, {}ms)",
+                    group_name, config.bandwidth, config.protocol_latency
+                ));
+
                 runner
                     .network
                     .set_proto_config(config.bandwidth, config.protocol_latency.div_ceil(2))?;
@@ -249,11 +377,73 @@ pub async fn main() -> Result<()> {
                     panic!("expected prover output");
                 };
 
-                let measurement = Measurement::new(config, metrics);
+                // Collect metrics for stats (skip warmup benches)
+                if !is_warmup {
+                    let config_key = format!(
+                        "{:?}|{}|{}|{}|{}",
+                        config.group,
+                        config.bandwidth,
+                        config.protocol_latency,
+                        config.upload_size,
+                        config.download_size
+                    );
+                    measurements_by_config
+                        .entry(config_key)
+                        .or_default()
+                        .push(metrics.time_total);
+                }
+
+                let measurement = Measurement::new(config.clone(), metrics);
 
                 writer.serialize(measurement)?;
                 writer.flush()?;
+
+                pb.inc(1);
             }
+
+            pb.finish_with_message("Benchmarks complete");
+
+            // Compute and print statistics
+            let mut all_stats: Vec<BenchStats> = Vec::new();
+            for (key, times) in measurements_by_config {
+                // Parse back the config from the key
+                let parts: Vec<&str> = key.split('|').collect();
+                if parts.len() >= 5 {
+                    let group = if parts[0] == "None" {
+                        None
+                    } else {
+                        Some(
+                            parts[0]
+                                .trim_start_matches("Some(\"")
+                                .trim_end_matches("\")")
+                                .to_string(),
+                        )
+                    };
+                    let bandwidth: usize = parts[1].parse().unwrap_or(0);
+                    let latency: usize = parts[2].parse().unwrap_or(0);
+                    let upload_size: usize = parts[3].parse().unwrap_or(0);
+                    let download_size: usize = parts[4].parse().unwrap_or(0);
+
+                    all_stats.push(BenchStats {
+                        group,
+                        bandwidth,
+                        latency,
+                        upload_size,
+                        download_size,
+                        times,
+                    });
+                }
+            }
+
+            // Sort stats by group name for consistent output
+            all_stats.sort_by(|a, b| {
+                a.group
+                    .cmp(&b.group)
+                    .then(a.latency.cmp(&b.latency))
+                    .then(a.bandwidth.cmp(&b.bandwidth))
+            });
+
+            print_bench_summary(&all_stats);
         }
         Command::Serve {} => {
             runner.start_services().await?;

crates/mpc-tls/Cargo.toml

@@ -5,7 +5,7 @@ description = "TLSNotary MPC-TLS protocol"
 keywords = ["tls", "mpc", "2pc"]
 categories = ["cryptography"]
 license = "MIT OR Apache-2.0"
-version = "0.1.0-alpha.14-pre"
+version = "0.1.0-alpha.14"
 edition = "2021"
 
 [lints]
@@ -60,6 +60,8 @@ mpz-common = { workspace = true, features = ["test-utils"] }
 mpz-ot = { workspace = true, features = ["ideal"] }
 mpz-ideal-vm = { workspace = true }
 
+tlsn-mux = { workspace = true }
+
 cipher-crate = { package = "cipher", version = "0.4" }
 generic-array = { workspace = true }
 rand_chacha = { workspace = true }
@@ -70,6 +72,5 @@ tlsn-tls-client-async = { workspace = true }
 tokio = { workspace = true, features = ["macros", "rt", "rt-multi-thread"] }
 tokio-util = { workspace = true, features = ["compat"] }
 tracing-subscriber = { workspace = true }
-uid-mux = { workspace = true, features = ["serio", "test-utils"] }
 rustls-pki-types = { workspace = true }
 rustls-webpki = { workspace = true }

crates/mpc-tls/tests/test.rs

@@ -123,8 +123,8 @@ fn build_pair(config: Config) -> (MpcTlsLeader, MpcTlsFollower) {
 
     let (mut mt_a, mut mt_b) = test_mt_context(8);
 
-    let ctx_a = futures::executor::block_on(mt_a.new_context()).unwrap();
+    let ctx_a = mt_a.new_context().unwrap();
-    let ctx_b = futures::executor::block_on(mt_b.new_context()).unwrap();
+    let ctx_b = mt_b.new_context().unwrap();
 
     let delta_a = Delta::new(Block::random(&mut rng));
     let delta_b = Delta::new(Block::random(&mut rng));

crates/tls/backend/Cargo.toml

@@ -5,7 +5,7 @@ description = "A TLS backend trait for TLSNotary"
 keywords = ["tls", "mpc", "2pc"]
 categories = ["cryptography"]
 license = "MIT OR Apache-2.0"
-version = "0.1.0-alpha.14-pre"
+version = "0.1.0-alpha.14"
 edition = "2021"
 
 [lints]

crates/tls/client-async/Cargo.toml

@@ -5,7 +5,7 @@ description = "An async TLS client for TLSNotary"
 keywords = ["tls", "mpc", "2pc", "client", "async"]
 categories = ["cryptography"]
 license = "MIT OR Apache-2.0"
-version = "0.1.0-alpha.14-pre"
+version = "0.1.0-alpha.14"
 edition = "2021"
 
 [lints]

crates/tls/client/Cargo.toml

@@ -5,7 +5,7 @@ description = "A TLS client for TLSNotary"
 keywords = ["tls", "mpc", "2pc", "client", "sync"]
 categories = ["cryptography"]
 license = "Apache-2.0 OR ISC OR MIT"
-version = "0.1.0-alpha.14-pre"
+version = "0.1.0-alpha.14"
 edition = "2021"
 autobenches = false
 

crates/tls/core/Cargo.toml

@@ -5,7 +5,7 @@ description = "Cryptographic operations for the TLSNotary TLS client"
 keywords = ["tls", "mpc", "2pc"]
 categories = ["cryptography"]
 license = "Apache-2.0 OR ISC OR MIT"
-version = "0.1.0-alpha.14-pre"
+version = "0.1.0-alpha.14"
 edition = "2021"
 
 [lints]

crates/tlsn/Cargo.toml

@@ -4,7 +4,7 @@ authors = ["TLSNotary Team"]
 keywords = ["tls", "mpc", "2pc", "prover"]
 categories = ["cryptography"]
 license = "MIT OR Apache-2.0"
-version = "0.1.0-alpha.14-pre"
+version = "0.1.0-alpha.14"
 edition = "2024"
 
 [lints]
@@ -20,6 +20,7 @@ web = ["dep:web-spawn"]
 tlsn-attestation = { workspace = true }
 tlsn-core = { workspace = true }
 tlsn-deap = { workspace = true }
+tlsn-mux = { workspace = true }
 tlsn-tls-client = { workspace = true }
 tlsn-tls-client-async = { workspace = true }
 tlsn-tls-core = { workspace = true }
@@ -27,7 +28,6 @@ tlsn-mpc-tls = { workspace = true }
 tlsn-cipher = { workspace = true }
 
 serio = { workspace = true, features = ["compat"] }
-uid-mux = { workspace = true, features = ["serio"] }
 web-spawn = { workspace = true, optional = true }
 
 mpz-circuits = { workspace = true, features = ["aes"] }

crates/tlsn/src/context.rs

@@ -1,21 +0,0 @@
-//! Execution context.
-
-use mpz_common::context::Multithread;
-
-use crate::mux::MuxControl;
-
-/// Maximum concurrency for multi-threaded context.
-pub(crate) const MAX_CONCURRENCY: usize = 8;
-
-/// Builds a multi-threaded context with the given muxer.
-pub(crate) fn build_mt_context(mux: MuxControl) -> Multithread {
-    let builder = Multithread::builder().mux(mux).concurrency(MAX_CONCURRENCY);
-
-    #[cfg(all(feature = "web", target_arch = "wasm32"))]
-    let builder = builder.spawn_handler(|f| {
-        let _ = web_spawn::spawn(f);
-        Ok(())
-    });
-
-    builder.build().unwrap()
-}

crates/tlsn/src/error.rs

@@ -0,0 +1,170 @@
+use std::fmt::Display;
+
+/// TLSNotary error.
+///
+/// Errors are categorized by kind:
+///
+/// - **User** ([`is_user`](Self::is_user)): e.g. rejected by the remote party.
+/// - **IO** ([`is_io`](Self::is_io)): network or communication failure.
+/// - **Internal** ([`is_internal`](Self::is_internal)): an unknown internal
+///   error in the library.
+/// - **Config** ([`is_config`](Self::is_config)): invalid configuration
+///   provided by the user.
+///
+/// The [`msg`](Self::msg) method returns additional context if available, such
+/// as a rejection message provided by a verifier.
+#[derive(Debug, thiserror::Error)]
+pub struct Error {
+    kind: ErrorKind,
+    msg: Option<String>,
+    source: Option<Box<dyn std::error::Error + Send + Sync>>,
+}
+
+impl Error {
+    pub(crate) fn io() -> Self {
+        Self {
+            kind: ErrorKind::Io,
+            msg: None,
+            source: None,
+        }
+    }
+
+    pub(crate) fn internal() -> Self {
+        Self {
+            kind: ErrorKind::Internal,
+            msg: None,
+            source: None,
+        }
+    }
+
+    pub(crate) fn user() -> Self {
+        Self {
+            kind: ErrorKind::User,
+            msg: None,
+            source: None,
+        }
+    }
+
+    pub(crate) fn config() -> Self {
+        Self {
+            kind: ErrorKind::Config,
+            msg: None,
+            source: None,
+        }
+    }
+
+    pub(crate) fn with_msg(mut self, msg: impl Into<String>) -> Self {
+        self.msg = Some(msg.into());
+        self
+    }
+
+    pub(crate) fn with_source<T>(mut self, source: T) -> Self
+    where
+        T: Into<Box<dyn std::error::Error + Send + Sync>>,
+    {
+        self.source = Some(source.into());
+        self
+    }
+
+    /// Returns `true` if the error was user created.
+    pub fn is_user(&self) -> bool {
+        self.kind.is_user()
+    }
+
+    /// Returns `true` if the error originated from an IO error.
+    pub fn is_io(&self) -> bool {
+        self.kind.is_io()
+    }
+
+    /// Returns `true` if the error originated from an internal bug.
+    pub fn is_internal(&self) -> bool {
+        self.kind.is_internal()
+    }
+
+    /// Returns `true` if the error originated from invalid configuration.
+    pub fn is_config(&self) -> bool {
+        self.kind.is_config()
+    }
+
+    /// Returns the error message if available.
+    pub fn msg(&self) -> Option<&str> {
+        self.msg.as_deref()
+    }
+}
+
+impl Display for Error {
+    fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
+        match self.kind {
+            ErrorKind::User => write!(f, "user error")?,
+            ErrorKind::Io => write!(f, "io error")?,
+            ErrorKind::Internal => write!(f, "internal error")?,
+            ErrorKind::Config => write!(f, "config error")?,
+        }
+
+        if let Some(msg) = &self.msg {
+            write!(f, ": {msg}")?;
+        }
+
+        if let Some(source) = &self.source {
+            write!(f, " caused by: {source}")?;
+        }
+
+        Ok(())
+    }
+}
+
+impl From<std::io::Error> for Error {
+    fn from(e: std::io::Error) -> Self {
+        Self::io().with_source(e)
+    }
+}
+
+impl From<mpz_common::ContextError> for Error {
+    fn from(e: mpz_common::ContextError) -> Self {
+        Self::internal().with_msg("context error").with_source(e)
+    }
+}
+
+impl From<mpc_tls::MpcTlsError> for Error {
+    fn from(e: mpc_tls::MpcTlsError) -> Self {
+        Self::internal().with_msg("mpc-tls error").with_source(e)
+    }
+}
+
+impl From<tls_client_async::ConnectionError> for Error {
+    fn from(e: tls_client_async::ConnectionError) -> Self {
+        Self::io().with_msg("tls connection error").with_source(e)
+    }
+}
+
+impl From<tlsn_mux::ConnectionError> for Error {
+    fn from(e: tlsn_mux::ConnectionError) -> Self {
+        Self::io().with_msg("mux connection error").with_source(e)
+    }
+}
+
+#[derive(Debug)]
+enum ErrorKind {
+    User,
+    Io,
+    Internal,
+    Config,
+}
+
+impl ErrorKind {
+    fn is_user(&self) -> bool {
+        matches!(self, ErrorKind::User)
+    }
+
+    fn is_io(&self) -> bool {
+        matches!(self, ErrorKind::Io)
+    }
+
+    fn is_internal(&self) -> bool {
+        matches!(self, ErrorKind::Internal)
+    }
+
+    fn is_config(&self) -> bool {
+        matches!(self, ErrorKind::Config)
+    }
+}

crates/tlsn/src/lib.rs

@@ -1,23 +1,66 @@
-//! TLSNotary library.
+//! TLSNotary protocol implementation.
+//!
+//! This crate provides the core protocol for generating and verifying proofs
+//! of TLS sessions. A prover can demonstrate to a verifier that specific data
+//! was exchanged with a TLS server, without revealing the full transcript.
+//!
+//! # Overview
+//!
+//! The protocol involves two parties:
+//!
+//! - **Prover** ([`Prover`](prover::Prover)): connects to a TLS server and
+//!   generates proofs about the session.
+//! - **Verifier** ([`Verifier`](verifier::Verifier)): collaborates with the
+//!   prover during the TLS session and verifies the resulting proofs.
+//!
+//! Both parties communicate through an established [`Session`].
+//!
+//! # Workflow
+//!
+//! The protocol has two main phases:
+//!
+//! **Commitment**: The prover and verifier collaborate to construct a TLS
+//! transcript commitment from the prover's communication with a TLS server.
+//! This authenticates the transcript for the verifier, without the verifier
+//! learning the contents.
+//!
+//! **Selective Disclosure**: The prover selectively reveals portions of the
+//! committed transcript to the verifier, proving statements about the data
+//! exchanged with the server.
+//!
+//! ## Steps
+//!
+//! 1. Establish a communication channel between prover and verifier.
+//! 2. Create a [`Session`] on each side from the channel.
+//! 3. Create a [`Prover`](prover::Prover) or [`Verifier`](verifier::Verifier).
+//! 4. Run the commitment phase: the prover connects to the TLS server and
+//!    exchanges data to obtain a commitment to the TLS transcript.
+//! 5. (Optional) Perform selective disclosure: the prover provably reveals
+//!    selected data to the verifier.
 
 #![deny(missing_docs, unreachable_pub, unused_must_use)]
 #![deny(clippy::all)]
 #![forbid(unsafe_code)]
 
-pub(crate) mod context;
+mod error;
 pub(crate) mod ghash;
 pub(crate) mod map;
 pub(crate) mod mpz;
 pub(crate) mod msg;
-pub(crate) mod mux;
 pub mod prover;
+mod session;
 pub(crate) mod tag;
 pub(crate) mod transcript_internal;
 pub mod verifier;
 
+pub use error::Error;
+pub use session::{Session, SessionDriver, SessionHandle};
 pub use tlsn_attestation as attestation;
 pub use tlsn_core::{config, connection, hash, transcript, webpki};
 
+/// Result type.
+pub type Result<T, E = Error> = core::result::Result<T, E>;
+
 use std::sync::LazyLock;
 
 use semver::Version;

crates/tlsn/src/map.rs

@@ -21,20 +21,6 @@ impl<T> RangeMap<T>
 where
     T: Item,
 {
-    pub(crate) fn new(map: Vec<(usize, T)>) -> Self {
-        let mut pos = 0;
-        for (idx, item) in &map {
-            assert!(
-                *idx >= pos,
-                "items must be sorted by index and non-overlapping"
-            );
-
-            pos = *idx + item.length();
-        }
-
-        Self { map }
-    }
-
     /// Returns `true` if the map is empty.
     pub(crate) fn is_empty(&self) -> bool {
         self.map.is_empty()
@@ -47,11 +33,6 @@ where
             .map(|(idx, item)| *idx..*idx + item.length())
     }
 
-    /// Returns the length of the map.
-    pub(crate) fn len(&self) -> usize {
-        self.map.iter().map(|(_, item)| item.length()).sum()
-    }
-
     pub(crate) fn iter(&self) -> impl Iterator<Item = (Range<usize>, &T)> {
         self.map
             .iter()

crates/tlsn/src/mpz.rs

@@ -6,11 +6,6 @@ use mpz_core::Block;
 #[cfg(not(tlsn_insecure))]
 use mpz_garble::protocol::semihonest::{Evaluator, Garbler};
 use mpz_garble_core::Delta;
-use mpz_memory_core::{
-    Vector,
-    binary::U8,
-    correlated::{Key, Mac},
-};
 #[cfg(not(tlsn_insecure))]
 use mpz_ot::cot::{DerandCOTReceiver, DerandCOTSender};
 use mpz_ot::{
@@ -24,8 +19,6 @@ use tlsn_core::config::tls_commit::mpc::{MpcTlsConfig, NetworkSetting};
 use tlsn_deap::Deap;
 use tokio::sync::Mutex;
 
-use crate::transcript_internal::commit::encoding::{KeyStore, MacStore};
-
 #[cfg(not(tlsn_insecure))]
 pub(crate) type ProverMpc =
     Garbler<DerandCOTSender<SharedRCOTSender<kos::Sender<co::Receiver>, Block>>>;
@@ -193,41 +186,3 @@ pub(crate) fn translate_keys<Mpc, Zk>(keys: &mut SessionKeys, vm: &Deap<Mpc, Zk>
         .translate(keys.server_write_mac_key)
         .expect("VM memory should be consistent");
 }
-
-impl<T> KeyStore for Verifier<T> {
-    fn delta(&self) -> &Delta {
-        self.delta()
-    }
-
-    fn get_keys(&self, data: Vector<U8>) -> Option<&[Key]> {
-        self.get_keys(data).ok()
-    }
-}
-
-impl<T> MacStore for Prover<T> {
-    fn get_macs(&self, data: Vector<U8>) -> Option<&[Mac]> {
-        self.get_macs(data).ok()
-    }
-}
-
-#[cfg(tlsn_insecure)]
-mod insecure {
-    use super::*;
-    use mpz_ideal_vm::IdealVm;
-
-    impl KeyStore for IdealVm {
-        fn delta(&self) -> &Delta {
-            unimplemented!("encodings not supported in insecure mode")
-        }
-
-        fn get_keys(&self, _data: Vector<U8>) -> Option<&[Key]> {
-            unimplemented!("encodings not supported in insecure mode")
-        }
-    }
-
-    impl MacStore for IdealVm {
-        fn get_macs(&self, _data: Vector<U8>) -> Option<&[Mac]> {
-            unimplemented!("encodings not supported in insecure mode")
-        }
-    }
-}

crates/tlsn/src/msg.rs

@@ -1,3 +1,5 @@
+use std::fmt;
+
 use semver::Version;
 use serde::{Deserialize, Serialize};
 
@@ -40,12 +42,14 @@ impl Response {
 #[derive(Debug, Serialize, Deserialize)]
 pub(crate) struct RejectionReason(Option<String>);
 
-impl From<RejectionReason> for crate::prover::ProverError {
+impl fmt::Display for RejectionReason {
-    fn from(value: RejectionReason) -> Self {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
-        if let Some(msg) = value.0 {
+        if let Some(msg) = &self.0 {
-            crate::prover::ProverError::config(format!("verifier rejected with reason: {msg}"))
+            write!(f, "{msg}")
         } else {
-            crate::prover::ProverError::config("verifier rejected without providing a reason")
+            write!(f, "no reason provided")
         }
     }
 }
+
+impl std::error::Error for RejectionReason {}

crates/tlsn/src/mux.rs

@@ -1,90 +0,0 @@
-//! Multiplexer used in the TLSNotary protocol.
-
-use std::future::IntoFuture;
-
-use futures::{
-    AsyncRead, AsyncWrite, Future,
-    future::{FusedFuture, FutureExt},
-};
-use tracing::error;
-use uid_mux::yamux;
-
-use crate::Role;
-
-/// Multiplexer supporting unique deterministic stream IDs.
-pub(crate) type Mux<Io> = yamux::Yamux<Io>;
-/// Multiplexer controller providing streams.
-pub(crate) type MuxControl = yamux::YamuxCtrl;
-
-/// Multiplexer future which must be polled for the muxer to make progress.
-pub(crate) struct MuxFuture(
-    Box<dyn FusedFuture<Output = Result<(), yamux::ConnectionError>> + Send + Unpin>,
-);
-
-impl MuxFuture {
-    /// Returns true if the muxer is complete.
-    pub(crate) fn is_complete(&self) -> bool {
-        self.0.is_terminated()
-    }
-
-    /// Awaits a future, polling the muxer future concurrently.
-    pub(crate) async fn poll_with<F, R>(&mut self, fut: F) -> R
-    where
-        F: Future<Output = R>,
-    {
-        let mut fut = Box::pin(fut.fuse());
-        // Poll the future concurrently with the muxer future.
-        // If the muxer returns an error, continue polling the future
-        // until it completes.
-        loop {
-            futures::select! {
-                res = fut => return res,
-                res = &mut self.0 => if let Err(e) = res {
-                    error!("mux error: {:?}", e);
-                },
-            }
-        }
-    }
-}
-
-impl Future for MuxFuture {
-    type Output = Result<(), yamux::ConnectionError>;
-
-    fn poll(
-        mut self: std::pin::Pin<&mut Self>,
-        cx: &mut std::task::Context<'_>,
-    ) -> std::task::Poll<Self::Output> {
-        self.0.as_mut().poll_unpin(cx)
-    }
-}
-
-/// Attaches a multiplexer to the provided socket.
-///
-/// Returns the multiplexer and a controller for creating streams with a codec
-/// attached.
-///
-/// # Arguments
-///
-/// * `socket` - The socket to attach the multiplexer to.
-/// * `role` - The role of the party using the multiplexer.
-pub(crate) fn attach_mux<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
-    socket: T,
-    role: Role,
-) -> (MuxFuture, MuxControl) {
-    let mut mux_config = yamux::Config::default();
-    mux_config.set_max_num_streams(36);
-
-    let mux_role = match role {
-        Role::Prover => yamux::Mode::Client,
-        Role::Verifier => yamux::Mode::Server,
-    };
-
-    let mux = Mux::new(socket, mux_config, mux_role);
-    let ctrl = mux.control();
-
-    if let Role::Prover = role {
-        ctrl.alloc(32);
-    }
-
-    (MuxFuture(Box::new(mux.into_future().fuse())), ctrl)
-}

crates/tlsn/src/prover.rs

@@ -1,20 +1,17 @@
 //! Prover.
 
-mod error;
 mod future;
 mod prove;
 pub mod state;
 
-pub use error::ProverError;
 pub use future::ProverFuture;
+use mpz_common::Context;
 pub use tlsn_core::ProverOutput;
 
 use crate::{
-    Role,
+    Error, Result,
-    context::build_mt_context,
     mpz::{ProverDeps, build_prover_deps, translate_keys},
     msg::{ProveRequestMsg, Response, TlsCommitRequestMsg},
-    mux::attach_mux,
     tag::verify_tags,
 };
 
@@ -45,6 +42,7 @@ use tracing::{Instrument, Span, debug, info, info_span, instrument};
 pub struct Prover<T: state::ProverState = state::Initialized> {
     config: ProverConfig,
     span: Span,
+    ctx: Option<Context>,
     state: T,
 }
 
@@ -53,12 +51,14 @@ impl Prover<state::Initialized> {
     ///
     /// # Arguments
     ///
+    /// * `ctx` - A thread context.
     /// * `config` - The configuration for the prover.
-    pub fn new(config: ProverConfig) -> Self {
+    pub(crate) fn new(ctx: Context, config: ProverConfig) -> Self {
         let span = info_span!("prover");
         Self {
             config,
             span,
+            ctx: Some(ctx),
             state: state::Initialized,
         }
     }
@@ -71,34 +71,43 @@ impl Prover<state::Initialized> {
     /// # Arguments
     ///
     /// * `config` - The TLS commitment configuration.
-    /// * `socket` - The socket to the TLS verifier.
     #[instrument(parent = &self.span, level = "debug", skip_all, err)]
-    pub async fn commit<S: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
+    pub async fn commit(
-        self,
+        mut self,
         config: TlsCommitConfig,
-        socket: S,
+    ) -> Result<Prover<state::CommitAccepted>> {
-    ) -> Result<Prover<state::CommitAccepted>, ProverError> {
+        let mut ctx = self
-        let (mut mux_fut, mux_ctrl) = attach_mux(socket, Role::Prover);
+            .ctx
-        let mut mt = build_mt_context(mux_ctrl.clone());
+            .take()
-        let mut ctx = mux_fut.poll_with(mt.new_context()).await?;
+            .ok_or_else(|| Error::internal().with_msg("commitment protocol context was dropped"))?;
 
         // Sends protocol configuration to verifier for compatibility check.
-        mux_fut
-            .poll_with(async {
         ctx.io_mut()
             .send(TlsCommitRequestMsg {
                 request: config.to_request(),
                 version: crate::VERSION.clone(),
             })
-                    .await?;
+            .await
+            .map_err(|e| {
+                Error::io()
+                    .with_msg("commitment protocol failed to send request")
+                    .with_source(e)
+            })?;
 
         ctx.io_mut()
             .expect_next::<Response>()
-                    .await?
+            .await
+            .map_err(|e| {
+                Error::io()
+                    .with_msg("commitment protocol failed to receive response")
+                    .with_source(e)
+            })?
             .result
-                    .map_err(ProverError::from)
+            .map_err(|e| {
-            })
+                Error::user()
-            .await?;
+                    .with_msg("commitment protocol rejected by verifier")
+                    .with_source(e)
+            })?;
 
         let TlsCommitProtocolConfig::Mpc(mpc_tls_config) = config.protocol().clone() else {
             unreachable!("only MPC TLS is supported");
@@ -107,27 +116,30 @@ impl Prover<state::Initialized> {
         let ProverDeps { vm, mut mpc_tls } = build_prover_deps(mpc_tls_config, ctx);
 
         // Allocate resources for MPC-TLS in the VM.
-        let mut keys = mpc_tls.alloc()?;
+        let mut keys = mpc_tls.alloc().map_err(|e| {
+            Error::internal()
+                .with_msg("commitment protocol failed to allocate mpc-tls resources")
+                .with_source(e)
+        })?;
         let vm_lock = vm.try_lock().expect("VM is not locked");
         translate_keys(&mut keys, &vm_lock);
         drop(vm_lock);
 
         debug!("setting up mpc-tls");
 
-        mux_fut.poll_with(mpc_tls.preprocess()).await?;
+        mpc_tls.preprocess().await.map_err(|e| {
+            Error::internal()
+                .with_msg("commitment protocol failed during mpc-tls preprocessing")
+                .with_source(e)
+        })?;
 
         debug!("mpc-tls setup complete");
 
         Ok(Prover {
             config: self.config,
             span: self.span,
-            state: state::CommitAccepted {
+            ctx: None,
-                mux_ctrl,
+            state: state::CommitAccepted { mpc_tls, keys, vm },
-                mux_fut,
-                mpc_tls,
-                keys,
-                vm,
-            },
         })
     }
 }
@@ -148,14 +160,9 @@ impl Prover<state::CommitAccepted> {
         self,
         config: TlsClientConfig,
         socket: S,
-    ) -> Result<(TlsConnection, ProverFuture), ProverError> {
+    ) -> Result<(TlsConnection, ProverFuture)> {
         let state::CommitAccepted {
-            mux_ctrl,
+            mpc_tls, keys, vm, ..
-            mut mux_fut,
-            mpc_tls,
-            keys,
-            vm,
-            ..
         } = self.state;
 
         let (mpc_ctrl, mpc_fut) = mpc_tls.run();
@@ -173,7 +180,11 @@ impl Prover<state::CommitAccepted> {
                     let der = CertificateDer::from_slice(&cert.0);
                     anchor_from_trusted_cert(&der)
                         .map(|anchor| anchor.to_owned())
-                        .map_err(ProverError::config)
+                        .map_err(|e| {
+                            Error::config()
+                                .with_msg("failed to parse root certificate")
+                                .with_source(e)
+                        })
                 })
                 .collect::<Result<Vec<_>, _>>()?,
         };
@@ -190,7 +201,11 @@ impl Prover<state::CommitAccepted> {
                         .collect(),
                     tls_client::PrivateKey(key.0.clone()),
                 )
-                .map_err(ProverError::config)?
+                .map_err(|e| {
+                    Error::config()
+                        .with_msg("failed to configure client authentication")
+                        .with_source(e)
+                })?
         } else {
             rustls_config.with_no_client_auth()
         };
@@ -200,7 +215,11 @@ impl Prover<state::CommitAccepted> {
             Box::new(mpc_ctrl.clone()),
             server_name,
         )
-        .map_err(ProverError::config)?;
+        .map_err(|e| {
+            Error::config()
+                .with_msg("failed to create tls client connection")
+                .with_source(e)
+        })?;
 
         let (conn, conn_fut) = bind_client(socket, client);
 
@@ -209,20 +228,27 @@ impl Prover<state::CommitAccepted> {
             let mpc_ctrl = mpc_ctrl.clone();
             async move {
                 let conn_fut = async {
-                    mux_fut
+                    conn_fut.await.map_err(|e| {
-                        .poll_with(conn_fut.map_err(ProverError::from))
+                        Error::io().with_msg("tls connection failed").with_source(e)
-                        .await?;
+                    })?;
+                    mpc_ctrl.stop().await.map_err(|e| {
+                        Error::internal()
+                            .with_msg("mpc-tls failed to stop")
+                            .with_source(e)
+                    })?;
 
-                    mpc_ctrl.stop().await?;
+                    Ok::<_, crate::Error>(())
-
-                    Ok::<_, ProverError>(())
                 };
 
                 info!("starting MPC-TLS");
 
                 let (_, (mut ctx, tls_transcript)) = futures::try_join!(
                     conn_fut,
-                    mpc_fut.in_current_span().map_err(ProverError::from)
+                    mpc_fut.in_current_span().map_err(|e| {
+                        Error::internal()
+                            .with_msg("mpc-tls execution failed")
+                            .with_source(e)
+                    })
                 )?;
 
                 info!("finished MPC-TLS");
@@ -233,10 +259,11 @@ impl Prover<state::CommitAccepted> {
                     debug!("finalizing mpc");
 
                     // Finalize DEAP.
-                    mux_fut
+                    vm.finalize(&mut ctx).await.map_err(|e| {
-                        .poll_with(vm.finalize(&mut ctx))
+                        Error::internal()
-                        .await
+                            .with_msg("mpc finalization failed")
-                        .map_err(ProverError::mpc)?;
+                            .with_source(e)
+                    })?;
 
                     debug!("mpc finalized");
                 }
@@ -256,11 +283,17 @@ impl Prover<state::CommitAccepted> {
                     *tls_transcript.version(),
                     tls_transcript.recv().to_vec(),
                 )
-                .map_err(ProverError::zk)?;
+                .map_err(|e| {
+                    Error::internal()
+                        .with_msg("tag verification setup failed")
+                        .with_source(e)
+                })?;
 
-                mux_fut
+                vm.execute_all(&mut ctx).await.map_err(|e| {
-                    .poll_with(vm.execute_all(&mut ctx).map_err(ProverError::zk))
+                    Error::internal()
-                    .await?;
+                        .with_msg("executing the zkVM failed during tag verification")
+                        .with_source(e)
+                })?;
 
                 let transcript = tls_transcript
                     .to_transcript()
@@ -269,10 +302,8 @@ impl Prover<state::CommitAccepted> {
                 Ok(Prover {
                     config: self.config,
                     span: self.span,
+                    ctx: Some(ctx),
                     state: state::Committed {
-                        mux_ctrl,
-                        mux_fut,
-                        ctx,
                         vm,
                         server_name: config.server_name().clone(),
                         keys,
@@ -311,10 +342,12 @@ impl Prover<state::Committed> {
     ///
     /// * `config` - The disclosure configuration.
     #[instrument(parent = &self.span, level = "info", skip_all, err)]
-    pub async fn prove(&mut self, config: &ProveConfig) -> Result<ProverOutput, ProverError> {
+    pub async fn prove(&mut self, config: &ProveConfig) -> Result<ProverOutput> {
+        let ctx = self
+            .ctx
+            .as_mut()
+            .ok_or_else(|| Error::internal().with_msg("proving context was dropped"))?;
         let state::Committed {
-            mux_fut,
-            ctx,
             vm,
             keys,
             server_name,
@@ -350,32 +383,34 @@ impl Prover<state::Committed> {
             transcript: partial_transcript,
         };
 
-        let output = mux_fut
+        ctx.io_mut().send(msg).await.map_err(|e| {
-            .poll_with(async {
+            Error::io()
-                ctx.io_mut().send(msg).await.map_err(ProverError::from)?;
+                .with_msg("failed to send prove configuration")
+                .with_source(e)
+        })?;
+        ctx.io_mut()
+            .expect_next::<Response>()
+            .await
+            .map_err(|e| {
+                Error::io()
+                    .with_msg("failed to receive prove response from verifier")
+                    .with_source(e)
+            })?
+            .result
+            .map_err(|e| {
+                Error::user()
+                    .with_msg("proving rejected by verifier")
+                    .with_source(e)
+            })?;
 
-                ctx.io_mut().expect_next::<Response>().await?.result?;
+        let output = prove::prove(ctx, vm, keys, transcript, tls_transcript, config).await?;
-
-                prove::prove(ctx, vm, keys, transcript, tls_transcript, config).await
-            })
-            .await?;
 
         Ok(output)
     }
 
     /// Closes the connection with the verifier.
     #[instrument(parent = &self.span, level = "info", skip_all, err)]
-    pub async fn close(self) -> Result<(), ProverError> {
+    pub async fn close(self) -> Result<()> {
-        let state::Committed {
-            mux_ctrl, mux_fut, ..
-        } = self.state;
-
-        // Wait for the verifier to correctly close the connection.
-        if !mux_fut.is_complete() {
-            mux_ctrl.close();
-            mux_fut.await?;
-        }
-
         Ok(())
     }
 }
@@ -398,10 +433,11 @@ impl ProverControl {
     /// * The prover may need to close the connection to the server in order for
     ///   it to close the connection on its end. If neither the prover or server
     ///   close the connection this will cause a deadlock.
-    pub async fn defer_decryption(&self) -> Result<(), ProverError> {
+    pub async fn defer_decryption(&self) -> Result<()> {
-        self.mpc_ctrl
+        self.mpc_ctrl.defer_decryption().await.map_err(|e| {
-            .defer_decryption()
+            Error::internal()
-            .await
+                .with_msg("failed to defer decryption")
-            .map_err(ProverError::from)
+                .with_source(e)
+        })
     }
 }

crates/tlsn/src/prover/error.rs

@@ -1,117 +0,0 @@
-use std::{error::Error, fmt};
-
-use mpc_tls::MpcTlsError;
-
-use crate::transcript_internal::commit::encoding::EncodingError;
-
-/// Error for [`Prover`](crate::prover::Prover).
-#[derive(Debug, thiserror::Error)]
-pub struct ProverError {
-    kind: ErrorKind,
-    source: Option<Box<dyn Error + Send + Sync + 'static>>,
-}
-
-impl ProverError {
-    fn new<E>(kind: ErrorKind, source: E) -> Self
-    where
-        E: Into<Box<dyn Error + Send + Sync + 'static>>,
-    {
-        Self {
-            kind,
-            source: Some(source.into()),
-        }
-    }
-
-    pub(crate) fn config<E>(source: E) -> Self
-    where
-        E: Into<Box<dyn Error + Send + Sync + 'static>>,
-    {
-        Self::new(ErrorKind::Config, source)
-    }
-
-    pub(crate) fn mpc<E>(source: E) -> Self
-    where
-        E: Into<Box<dyn Error + Send + Sync + 'static>>,
-    {
-        Self::new(ErrorKind::Mpc, source)
-    }
-
-    pub(crate) fn zk<E>(source: E) -> Self
-    where
-        E: Into<Box<dyn Error + Send + Sync + 'static>>,
-    {
-        Self::new(ErrorKind::Zk, source)
-    }
-
-    pub(crate) fn commit<E>(source: E) -> Self
-    where
-        E: Into<Box<dyn Error + Send + Sync + 'static>>,
-    {
-        Self::new(ErrorKind::Commit, source)
-    }
-}
-
-#[derive(Debug)]
-enum ErrorKind {
-    Io,
-    Mpc,
-    Zk,
-    Config,
-    Commit,
-}
-
-impl fmt::Display for ProverError {
-    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
-        f.write_str("prover error: ")?;
-
-        match self.kind {
-            ErrorKind::Io => f.write_str("io error")?,
-            ErrorKind::Mpc => f.write_str("mpc error")?,
-            ErrorKind::Zk => f.write_str("zk error")?,
-            ErrorKind::Config => f.write_str("config error")?,
-            ErrorKind::Commit => f.write_str("commit error")?,
-        }
-
-        if let Some(source) = &self.source {
-            write!(f, " caused by: {source}")?;
-        }
-
-        Ok(())
-    }
-}
-
-impl From<std::io::Error> for ProverError {
-    fn from(e: std::io::Error) -> Self {
-        Self::new(ErrorKind::Io, e)
-    }
-}
-
-impl From<tls_client_async::ConnectionError> for ProverError {
-    fn from(e: tls_client_async::ConnectionError) -> Self {
-        Self::new(ErrorKind::Io, e)
-    }
-}
-
-impl From<uid_mux::yamux::ConnectionError> for ProverError {
-    fn from(e: uid_mux::yamux::ConnectionError) -> Self {
-        Self::new(ErrorKind::Io, e)
-    }
-}
-
-impl From<mpz_common::ContextError> for ProverError {
-    fn from(e: mpz_common::ContextError) -> Self {
-        Self::new(ErrorKind::Mpc, e)
-    }
-}
-
-impl From<MpcTlsError> for ProverError {
-    fn from(e: MpcTlsError) -> Self {
-        Self::new(ErrorKind::Mpc, e)
-    }
-}
-
-impl From<EncodingError> for ProverError {
-    fn from(e: EncodingError) -> Self {
-        Self::new(ErrorKind::Commit, e)
-    }
-}

crates/tlsn/src/prover/future.rs

@@ -1,15 +1,17 @@
 //! This module collects futures which are used by the [Prover].
 
-use super::{Prover, ProverControl, ProverError, state};
-use futures::Future;
 use std::pin::Pin;
 
+use futures::Future;
+
+use super::{Prover, ProverControl, state};
+use crate::Result;
+
 /// Prover future which must be polled for the TLS connection to make progress.
 pub struct ProverFuture {
     #[allow(clippy::type_complexity)]
-    pub(crate) fut: Pin<
+    pub(crate) fut:
-        Box<dyn Future<Output = Result<Prover<state::Committed>, ProverError>> + Send + 'static>,
+        Pin<Box<dyn Future<Output = Result<Prover<state::Committed>>> + Send + 'static>>,
-    >,
     pub(crate) ctrl: ProverControl,
 }
 
@@ -21,7 +23,7 @@ impl ProverFuture {
 }
 
 impl Future for ProverFuture {
-    type Output = Result<Prover<state::Committed>, ProverError>;
+    type Output = Result<Prover<state::Committed>>;
 
     fn poll(
         mut self: Pin<&mut Self>,

crates/tlsn/src/prover/prove.rs

@@ -12,25 +12,18 @@ use tlsn_core::{
 };
 
 use crate::{
-    prover::ProverError,
+    Error, Result,
-    transcript_internal::{
+    transcript_internal::{TranscriptRefs, auth::prove_plaintext, commit::hash::prove_hash},
-        TranscriptRefs,
-        auth::prove_plaintext,
-        commit::{
-            encoding::{self, MacStore},
-            hash::prove_hash,
-        },
-    },
 };
 
-pub(crate) async fn prove<T: Vm<Binary> + MacStore + Send + Sync>(
+pub(crate) async fn prove<T: Vm<Binary> + Send + Sync>(
     ctx: &mut Context,
     vm: &mut T,
     keys: &SessionKeys,
     transcript: &Transcript,
     tls_transcript: &TlsTranscript,
     config: &ProveConfig,
-) -> Result<ProverOutput, ProverError> {
+) -> Result<ProverOutput> {
     let mut output = ProverOutput {
         transcript_commitments: Vec::default(),
         transcript_secrets: Vec::default(),
@@ -45,13 +38,6 @@ pub(crate) async fn prove<T: Vm<Binary> + MacStore + Send + Sync>(
                 Direction::Sent => commit_sent.union_mut(idx),
                 Direction::Received => commit_recv.union_mut(idx),
             });
-
-        commit_config
-            .iter_encoding()
-            .for_each(|(direction, idx)| match direction {
-                Direction::Sent => commit_sent.union_mut(idx),
-                Direction::Received => commit_recv.union_mut(idx),
-            });
     }
 
     let transcript_refs = TranscriptRefs {
@@ -67,7 +53,11 @@ pub(crate) async fn prove<T: Vm<Binary> + MacStore + Send + Sync>(
             &reveal_sent,
             &commit_sent,
         )
-        .map_err(ProverError::commit)?,
+        .map_err(|e| {
+            Error::internal()
+                .with_msg("proving failed during sent plaintext commitment")
+                .with_source(e)
+        })?,
         recv: prove_plaintext(
             vm,
             keys.server_write_key,
@@ -80,7 +70,11 @@ pub(crate) async fn prove<T: Vm<Binary> + MacStore + Send + Sync>(
             &reveal_recv,
             &commit_recv,
         )
-        .map_err(ProverError::commit)?,
+        .map_err(|e| {
+            Error::internal()
+                .with_msg("proving failed during received plaintext commitment")
+                .with_source(e)
+        })?,
     };
 
     let hash_commitments = if let Some(commit_config) = config.transcript_commit()
@@ -94,55 +88,28 @@ pub(crate) async fn prove<T: Vm<Binary> + MacStore + Send + Sync>(
                     .iter_hash()
                     .map(|((dir, idx), alg)| (*dir, idx.clone(), *alg)),
             )
-            .map_err(ProverError::commit)?,
+            .map_err(|e| {
+                Error::internal()
+                    .with_msg("proving failed during hash commitment setup")
+                    .with_source(e)
+            })?,
         )
     } else {
         None
     };
 
-    vm.execute_all(ctx).await.map_err(ProverError::zk)?;
+    vm.execute_all(ctx).await.map_err(|e| {
-
+        Error::internal()
-    if let Some(commit_config) = config.transcript_commit()
+            .with_msg("proving failed during zk execution")
-        && commit_config.has_encoding()
+            .with_source(e)
-    {
+    })?;
-        let mut sent_ranges = RangeSet::default();
-        let mut recv_ranges = RangeSet::default();
-        for (dir, idx) in commit_config.iter_encoding() {
-            match dir {
-                Direction::Sent => sent_ranges.union_mut(idx),
-                Direction::Received => recv_ranges.union_mut(idx),
-            }
-        }
-
-        let sent_map = transcript_refs
-            .sent
-            .index(&sent_ranges)
-            .expect("indices are valid");
-        let recv_map = transcript_refs
-            .recv
-            .index(&recv_ranges)
-            .expect("indices are valid");
-
-        let (commitment, tree) = encoding::receive(
-            ctx,
-            vm,
-            *commit_config.encoding_hash_alg(),
-            &sent_map,
-            &recv_map,
-            commit_config.iter_encoding(),
-        )
-        .await?;
-
-        output
-            .transcript_commitments
-            .push(TranscriptCommitment::Encoding(commitment));
-        output
-            .transcript_secrets
-            .push(TranscriptSecret::Encoding(tree));
-    }
 
     if let Some((hash_fut, hash_secrets)) = hash_commitments {
-        let hash_commitments = hash_fut.try_recv().map_err(ProverError::commit)?;
+        let hash_commitments = hash_fut.try_recv().map_err(|e| {
+            Error::internal()
+                .with_msg("proving failed during hash commitment finalization")
+                .with_source(e)
+        })?;
         for (commitment, secret) in hash_commitments.into_iter().zip(hash_secrets) {
             output
                 .transcript_commitments

crates/tlsn/src/prover/state.rs

@@ -3,7 +3,6 @@
 use std::sync::Arc;
 
 use mpc_tls::{MpcTlsLeader, SessionKeys};
-use mpz_common::Context;
 use tlsn_core::{
     connection::ServerName,
     transcript::{TlsTranscript, Transcript},
@@ -11,10 +10,7 @@ use tlsn_core::{
 use tlsn_deap::Deap;
 use tokio::sync::Mutex;
 
-use crate::{
+use crate::mpz::{ProverMpc, ProverZk};
-    mpz::{ProverMpc, ProverZk},
-    mux::{MuxControl, MuxFuture},
-};
 
 /// Entry state
 pub struct Initialized;
@@ -24,8 +20,6 @@ opaque_debug::implement!(Initialized);
 /// State after the verifier has accepted the proposed TLS commitment protocol
 /// configuration and preprocessing has completed.
 pub struct CommitAccepted {
-    pub(crate) mux_ctrl: MuxControl,
-    pub(crate) mux_fut: MuxFuture,
     pub(crate) mpc_tls: MpcTlsLeader,
     pub(crate) keys: SessionKeys,
     pub(crate) vm: Arc<Mutex<Deap<ProverMpc, ProverZk>>>,
@@ -35,9 +29,6 @@ opaque_debug::implement!(CommitAccepted);
 
 /// State after the TLS transcript has been committed.
 pub struct Committed {
-    pub(crate) mux_ctrl: MuxControl,
-    pub(crate) mux_fut: MuxFuture,
-    pub(crate) ctx: Context,
     pub(crate) vm: ProverZk,
     pub(crate) server_name: ServerName,
     pub(crate) keys: SessionKeys,

crates/tlsn/src/session.rs

@@ -0,0 +1,326 @@
+use std::{
+    future::Future,
+    pin::Pin,
+    sync::{
+        Arc, Mutex,
+        atomic::{AtomicBool, Ordering},
+    },
+    task::{Context, Poll, Waker},
+};
+
+use futures::{AsyncRead, AsyncWrite};
+use mpz_common::{ThreadId, context::Multithread, io::Io, mux::Mux};
+use tlsn_core::config::{prover::ProverConfig, verifier::VerifierConfig};
+use tlsn_mux::{Connection, Handle};
+
+use crate::{
+    Error, Result,
+    prover::{Prover, state as prover_state},
+    verifier::{Verifier, state as verifier_state},
+};
+
+/// Maximum concurrency for multi-threaded context.
+const MAX_CONCURRENCY: usize = 8;
+
+/// A TLSNotary session over a communication channel.
+///
+/// Wraps an async IO stream and provides multiplexing for the protocol. Use
+/// [`new_prover`](Self::new_prover) or [`new_verifier`](Self::new_verifier) to
+/// create protocol participants.
+///
+/// The session must be polled continuously (either directly or via
+/// [`split`](Self::split)) to drive the underlying connection. After the
+/// session closes, the underlying IO can be reclaimed with
+/// [`try_take`](Self::try_take).
+///
+/// **Important**: The order in which provers and verifiers are created must
+/// match on both sides. For example, if the prover side calls `new_prover`
+/// then `new_verifier`, the verifier side must call `new_verifier` then
+/// `new_prover`.
+#[must_use = "session must be polled continuously to make progress, including during closing."]
+pub struct Session<Io> {
+    conn: Option<Connection<Io>>,
+    mt: Multithread,
+}
+
+impl<Io> Session<Io>
+where
+    Io: AsyncRead + AsyncWrite + Unpin,
+{
+    /// Creates a new session.
+    pub fn new(io: Io) -> Self {
+        let mut mux_config = tlsn_mux::Config::default();
+
+        mux_config.set_max_num_streams(36);
+        mux_config.set_keep_alive(true);
+        mux_config.set_close_sync(true);
+
+        let conn = tlsn_mux::Connection::new(io, mux_config);
+        let handle = conn.handle().expect("handle should be available");
+        let mt = build_mt_context(MuxHandle { handle });
+
+        Self {
+            conn: Some(conn),
+            mt,
+        }
+    }
+
+    /// Creates a new prover.
+    pub fn new_prover(
+        &mut self,
+        config: ProverConfig,
+    ) -> Result<Prover<prover_state::Initialized>> {
+        let ctx = self.mt.new_context().map_err(|e| {
+            Error::internal()
+                .with_msg("failed to create new prover")
+                .with_source(e)
+        })?;
+
+        Ok(Prover::new(ctx, config))
+    }
+
+    /// Creates a new verifier.
+    pub fn new_verifier(
+        &mut self,
+        config: VerifierConfig,
+    ) -> Result<Verifier<verifier_state::Initialized>> {
+        let ctx = self.mt.new_context().map_err(|e| {
+            Error::internal()
+                .with_msg("failed to create new verifier")
+                .with_source(e)
+        })?;
+
+        Ok(Verifier::new(ctx, config))
+    }
+
+    /// Returns `true` if the session is closed.
+    pub fn is_closed(&self) -> bool {
+        self.conn
+            .as_ref()
+            .map(|mux| mux.is_complete())
+            .unwrap_or_default()
+    }
+
+    /// Closes the session.
+    ///
+    /// This will cause the session to begin closing. Session must continue to
+    /// be polled until completion.
+    pub fn close(&mut self) {
+        if let Some(conn) = self.conn.as_mut() {
+            conn.close()
+        }
+    }
+
+    /// Attempts to take the IO, returning an error if it is not available.
+    pub fn try_take(&mut self) -> Result<Io> {
+        let conn = self.conn.take().ok_or_else(|| {
+            Error::io().with_msg("failed to take the session io, it was already taken")
+        })?;
+
+        match conn.try_into_io() {
+            Err(conn) => {
+                self.conn = Some(conn);
+                Err(Error::io()
+                    .with_msg("failed to take the session io, session was not completed yet"))
+            }
+            Ok(conn) => Ok(conn),
+        }
+    }
+
+    /// Polls the session.
+    pub fn poll(&mut self, cx: &mut Context<'_>) -> Poll<Result<()>> {
+        self.conn
+            .as_mut()
+            .ok_or_else(|| {
+                Error::io()
+                    .with_msg("failed to poll the session connection because it has been taken")
+            })?
+            .poll(cx)
+            .map_err(|e| {
+                Error::io()
+                    .with_msg("error occurred while polling the session connection")
+                    .with_source(e)
+            })
+    }
+
+    /// Splits the session into a driver and handle.
+    ///
+    /// The driver must be polled to make progress. The handle is used
+    /// for creating provers/verifiers and closing the session.
+    pub fn split(self) -> (SessionDriver<Io>, SessionHandle) {
+        let should_close = Arc::new(AtomicBool::new(false));
+        let waker = Arc::new(Mutex::new(None::<Waker>));
+
+        (
+            SessionDriver {
+                conn: self.conn,
+                should_close: should_close.clone(),
+                waker: waker.clone(),
+            },
+            SessionHandle {
+                mt: self.mt,
+                should_close,
+                waker,
+            },
+        )
+    }
+}
+
+impl<Io> Future for Session<Io>
+where
+    Io: AsyncRead + AsyncWrite + Unpin,
+{
+    type Output = Result<()>;
+
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        Session::poll(&mut (*self), cx)
+    }
+}
+
+/// The polling half of a split session.
+///
+/// Must be polled continuously to drive the session. Returns the underlying
+/// IO when the session closes.
+#[must_use = "driver must be polled to make progress"]
+pub struct SessionDriver<Io> {
+    conn: Option<Connection<Io>>,
+    should_close: Arc<AtomicBool>,
+    waker: Arc<Mutex<Option<Waker>>>,
+}
+
+impl<Io> SessionDriver<Io>
+where
+    Io: AsyncRead + AsyncWrite + Unpin,
+{
+    /// Polls the driver.
+    pub fn poll(&mut self, cx: &mut Context<'_>) -> Poll<Result<Io>> {
+        // Store the waker so the handle can wake us when close() is called.
+        {
+            let mut waker_guard = self.waker.lock().unwrap();
+            *waker_guard = Some(cx.waker().clone());
+        }
+
+        let conn = self
+            .conn
+            .as_mut()
+            .ok_or_else(|| Error::io().with_msg("session driver already completed"))?;
+
+        if self.should_close.load(Ordering::Acquire) {
+            conn.close();
+        }
+
+        match conn.poll(cx) {
+            Poll::Ready(Ok(())) => {}
+            Poll::Ready(Err(e)) => {
+                return Poll::Ready(Err(Error::io()
+                    .with_msg("error polling session connection")
+                    .with_source(e)));
+            }
+            Poll::Pending => return Poll::Pending,
+        }
+
+        let conn = self.conn.take().unwrap();
+        Poll::Ready(
+            conn.try_into_io()
+                .map_err(|_| Error::io().with_msg("failed to take session io")),
+        )
+    }
+}
+
+impl<Io> Future for SessionDriver<Io>
+where
+    Io: AsyncRead + AsyncWrite + Unpin,
+{
+    type Output = Result<Io>;
+
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        SessionDriver::poll(&mut *self, cx)
+    }
+}
+
+/// The control half of a split session.
+///
+/// Used to create provers/verifiers and control the session lifecycle.
+pub struct SessionHandle {
+    mt: Multithread,
+    should_close: Arc<AtomicBool>,
+    waker: Arc<Mutex<Option<Waker>>>,
+}
+
+impl SessionHandle {
+    /// Creates a new prover.
+    pub fn new_prover(
+        &mut self,
+        config: ProverConfig,
+    ) -> Result<Prover<prover_state::Initialized>> {
+        let ctx = self.mt.new_context().map_err(|e| {
+            Error::internal()
+                .with_msg("failed to create new prover")
+                .with_source(e)
+        })?;
+
+        Ok(Prover::new(ctx, config))
+    }
+
+    /// Creates a new verifier.
+    pub fn new_verifier(
+        &mut self,
+        config: VerifierConfig,
+    ) -> Result<Verifier<verifier_state::Initialized>> {
+        let ctx = self.mt.new_context().map_err(|e| {
+            Error::internal()
+                .with_msg("failed to create new verifier")
+                .with_source(e)
+        })?;
+
+        Ok(Verifier::new(ctx, config))
+    }
+
+    /// Signals the session to close.
+    ///
+    /// The driver must continue to be polled until it completes.
+    pub fn close(&self) {
+        self.should_close.store(true, Ordering::Release);
+        if let Some(waker) = self.waker.lock().unwrap().take() {
+            waker.wake();
+        }
+    }
+}
+
+/// Multiplexer controller providing streams.
+struct MuxHandle {
+    handle: Handle,
+}
+
+impl std::fmt::Debug for MuxHandle {
+    fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
+        f.debug_struct("MuxHandle").finish_non_exhaustive()
+    }
+}
+
+impl Mux for MuxHandle {
+    fn open(&self, id: ThreadId) -> Result<Io, std::io::Error> {
+        let stream = self
+            .handle
+            .new_stream(id.as_ref())
+            .map_err(std::io::Error::other)?;
+        let io = Io::from_io(stream);
+
+        Ok(io)
+    }
+}
+
+/// Builds a multi-threaded context with the given muxer.
+fn build_mt_context(mux: MuxHandle) -> Multithread {
+    let builder = Multithread::builder()
+        .mux(Box::new(mux) as Box<_>)
+        .concurrency(MAX_CONCURRENCY);
+
+    #[cfg(all(feature = "web", target_arch = "wasm32"))]
+    let builder = builder.spawn_handler(|f| {
+        let _ = web_spawn::spawn(f);
+        Ok(())
+    });
+
+    builder.build().unwrap()
+}

crates/tlsn/src/transcript_internal/commit.rs

@@ -1,4 +1,3 @@
 //! Plaintext commitment and proof of encryption.
 
-pub(crate) mod encoding;
 pub(crate) mod hash;

crates/tlsn/src/transcript_internal/commit/encoding.rs

@@ -1,267 +0,0 @@
-//! Encoding commitment protocol.
-
-use std::ops::Range;
-
-use mpz_common::Context;
-use mpz_memory_core::{
-    Vector,
-    binary::U8,
-    correlated::{Delta, Key, Mac},
-};
-use rand::Rng;
-use rangeset::set::RangeSet;
-use serde::{Deserialize, Serialize};
-use serio::{SinkExt, stream::IoStreamExt};
-use tlsn_core::{
-    hash::{Blake3, HashAlgId, HashAlgorithm, Keccak256, Sha256},
-    transcript::{
-        Direction,
-        encoding::{
-            Encoder, EncoderSecret, EncodingCommitment, EncodingProvider, EncodingProviderError,
-            EncodingTree, EncodingTreeError, new_encoder,
-        },
-    },
-};
-
-use crate::{
-    map::{Item, RangeMap},
-    transcript_internal::ReferenceMap,
-};
-
-/// Bytes of encoding, per byte.
-const ENCODING_SIZE: usize = 128;
-
-#[derive(Debug, Serialize, Deserialize)]
-struct Encodings {
-    sent: Vec<u8>,
-    recv: Vec<u8>,
-}
-
-/// Transfers encodings for the provided plaintext ranges.
-pub(crate) async fn transfer<K: KeyStore>(
-    ctx: &mut Context,
-    store: &K,
-    sent: &ReferenceMap,
-    recv: &ReferenceMap,
-) -> Result<(EncoderSecret, EncodingCommitment), EncodingError> {
-    let secret = EncoderSecret::new(rand::rng().random(), store.delta().as_block().to_bytes());
-    let encoder = new_encoder(&secret);
-
-    // Collects the encodings for the provided plaintext ranges.
-    fn collect_encodings(
-        encoder: &impl Encoder,
-        store: &impl KeyStore,
-        direction: Direction,
-        map: &ReferenceMap,
-    ) -> Vec<u8> {
-        let mut encodings = Vec::with_capacity(map.len() * ENCODING_SIZE);
-        for (range, chunk) in map.iter() {
-            let start = encodings.len();
-            encoder.encode_range(direction, range, &mut encodings);
-            let keys = store
-                .get_keys(*chunk)
-                .expect("keys are present for provided plaintext ranges");
-            encodings[start..]
-                .iter_mut()
-                .zip(keys.iter().flat_map(|key| key.as_block().as_bytes()))
-                .for_each(|(encoding, key)| {
-                    *encoding ^= *key;
-                });
-        }
-        encodings
-    }
-
-    let encodings = Encodings {
-        sent: collect_encodings(&encoder, store, Direction::Sent, sent),
-        recv: collect_encodings(&encoder, store, Direction::Received, recv),
-    };
-
-    let frame_limit = ctx
-        .io()
-        .limit()
-        .saturating_add(encodings.sent.len() + encodings.recv.len());
-    ctx.io_mut().with_limit(frame_limit).send(encodings).await?;
-
-    let root = ctx.io_mut().expect_next().await?;
-
-    Ok((secret, EncodingCommitment { root }))
-}
-
-/// Receives and commits to the encodings for the provided plaintext ranges.
-pub(crate) async fn receive<M: MacStore>(
-    ctx: &mut Context,
-    store: &M,
-    hash_alg: HashAlgId,
-    sent: &ReferenceMap,
-    recv: &ReferenceMap,
-    idxs: impl IntoIterator<Item = &(Direction, RangeSet<usize>)>,
-) -> Result<(EncodingCommitment, EncodingTree), EncodingError> {
-    let hasher: &(dyn HashAlgorithm + Send + Sync) = match hash_alg {
-        HashAlgId::SHA256 => &Sha256::default(),
-        HashAlgId::KECCAK256 => &Keccak256::default(),
-        HashAlgId::BLAKE3 => &Blake3::default(),
-        alg => {
-            return Err(ErrorRepr::UnsupportedHashAlgorithm(alg).into());
-        }
-    };
-
-    let (sent_len, recv_len) = (sent.len(), recv.len());
-    let frame_limit = ctx
-        .io()
-        .limit()
-        .saturating_add(ENCODING_SIZE * (sent_len + recv_len));
-    let encodings: Encodings = ctx.io_mut().with_limit(frame_limit).expect_next().await?;
-
-    if encodings.sent.len() != sent_len * ENCODING_SIZE {
-        return Err(ErrorRepr::IncorrectMacCount {
-            direction: Direction::Sent,
-            expected: sent_len,
-            got: encodings.sent.len() / ENCODING_SIZE,
-        }
-        .into());
-    }
-
-    if encodings.recv.len() != recv_len * ENCODING_SIZE {
-        return Err(ErrorRepr::IncorrectMacCount {
-            direction: Direction::Received,
-            expected: recv_len,
-            got: encodings.recv.len() / ENCODING_SIZE,
-        }
-        .into());
-    }
-
-    // Collects a map of plaintext ranges to their encodings.
-    fn collect_map(
-        store: &impl MacStore,
-        mut encodings: Vec<u8>,
-        map: &ReferenceMap,
-    ) -> RangeMap<EncodingSlice> {
-        let mut encoding_map = Vec::new();
-        let mut pos = 0;
-        for (range, chunk) in map.iter() {
-            let macs = store
-                .get_macs(*chunk)
-                .expect("MACs are present for provided plaintext ranges");
-            let encoding = &mut encodings[pos..pos + range.len() * ENCODING_SIZE];
-            encoding
-                .iter_mut()
-                .zip(macs.iter().flat_map(|mac| mac.as_bytes()))
-                .for_each(|(encoding, mac)| {
-                    *encoding ^= *mac;
-                });
-
-            encoding_map.push((range.start, EncodingSlice::from(&(*encoding))));
-            pos += range.len() * ENCODING_SIZE;
-        }
-        RangeMap::new(encoding_map)
-    }
-
-    let provider = Provider {
-        sent: collect_map(store, encodings.sent, sent),
-        recv: collect_map(store, encodings.recv, recv),
-    };
-
-    let tree = EncodingTree::new(hasher, idxs, &provider)?;
-    let root = tree.root();
-
-    ctx.io_mut().send(root.clone()).await?;
-
-    let commitment = EncodingCommitment { root };
-
-    Ok((commitment, tree))
-}
-
-pub(crate) trait KeyStore {
-    fn delta(&self) -> &Delta;
-
-    fn get_keys(&self, data: Vector<U8>) -> Option<&[Key]>;
-}
-
-pub(crate) trait MacStore {
-    fn get_macs(&self, data: Vector<U8>) -> Option<&[Mac]>;
-}
-
-#[derive(Debug)]
-struct Provider {
-    sent: RangeMap<EncodingSlice>,
-    recv: RangeMap<EncodingSlice>,
-}
-
-impl EncodingProvider for Provider {
-    fn provide_encoding(
-        &self,
-        direction: Direction,
-        range: Range<usize>,
-        dest: &mut Vec<u8>,
-    ) -> Result<(), EncodingProviderError> {
-        let encodings = match direction {
-            Direction::Sent => &self.sent,
-            Direction::Received => &self.recv,
-        };
-
-        let encoding = encodings.get(range).ok_or(EncodingProviderError)?;
-
-        dest.extend_from_slice(encoding);
-
-        Ok(())
-    }
-}
-
-#[derive(Debug)]
-struct EncodingSlice(Vec<u8>);
-
-impl From<&[u8]> for EncodingSlice {
-    fn from(value: &[u8]) -> Self {
-        Self(value.to_vec())
-    }
-}
-
-impl Item for EncodingSlice {
-    type Slice<'a>
-        = &'a [u8]
-    where
-        Self: 'a;
-
-    fn length(&self) -> usize {
-        self.0.len() / ENCODING_SIZE
-    }
-
-    fn slice<'a>(&'a self, range: Range<usize>) -> Option<Self::Slice<'a>> {
-        self.0
-            .get(range.start * ENCODING_SIZE..range.end * ENCODING_SIZE)
-    }
-}
-
-/// Encoding protocol error.
-#[derive(Debug, thiserror::Error)]
-#[error(transparent)]
-pub struct EncodingError(#[from] ErrorRepr);
-
-#[derive(Debug, thiserror::Error)]
-#[error("encoding protocol error: {0}")]
-enum ErrorRepr {
-    #[error("I/O error: {0}")]
-    Io(std::io::Error),
-    #[error("incorrect MAC count for {direction}: expected {expected}, got {got}")]
-    IncorrectMacCount {
-        direction: Direction,
-        expected: usize,
-        got: usize,
-    },
-    #[error("encoding tree error: {0}")]
-    EncodingTree(EncodingTreeError),
-    #[error("unsupported hash algorithm: {0}")]
-    UnsupportedHashAlgorithm(HashAlgId),
-}
-
-impl From<std::io::Error> for EncodingError {
-    fn from(value: std::io::Error) -> Self {
-        Self(ErrorRepr::Io(value))
-    }
-}
-
-impl From<EncodingTreeError> for EncodingError {
-    fn from(value: EncodingTreeError) -> Self {
-        Self(ErrorRepr::EncodingTree(value))
-    }
-}

crates/tlsn/src/verifier.rs

@@ -1,23 +1,19 @@
 //! Verifier.
 
-mod error;
 pub mod state;
 mod verify;
 
 use std::sync::Arc;
 
-pub use error::VerifierError;
+use mpz_common::Context;
 pub use tlsn_core::{VerifierOutput, webpki::ServerCertVerifier};
 
 use crate::{
-    Role,
+    Error, Result,
-    context::build_mt_context,
     mpz::{VerifierDeps, build_verifier_deps, translate_keys},
     msg::{ProveRequestMsg, Response, TlsCommitRequestMsg},
-    mux::attach_mux,
     tag::verify_tags,
 };
-use futures::{AsyncRead, AsyncWrite, TryFutureExt};
 use mpz_vm_core::prelude::*;
 use serio::{SinkExt, stream::IoStreamExt};
 use tlsn_core::{
@@ -45,16 +41,18 @@ pub struct SessionInfo {
 pub struct Verifier<T: state::VerifierState = state::Initialized> {
     config: VerifierConfig,
     span: Span,
+    ctx: Option<Context>,
     state: T,
 }
 
 impl Verifier<state::Initialized> {
     /// Creates a new verifier.
-    pub fn new(config: VerifierConfig) -> Self {
+    pub(crate) fn new(ctx: Context, config: VerifierConfig) -> Self {
         let span = info_span!("verifier");
         Self {
             config,
             span,
+            ctx: Some(ctx),
             state: state::Initialized,
         }
     }
@@ -63,50 +61,43 @@ impl Verifier<state::Initialized> {
     ///
     /// This initiates the TLS commitment protocol, receiving the prover's
     /// configuration and providing the opportunity to accept or reject it.
-    ///
-    /// # Arguments
-    ///
-    /// * `socket` - The socket to the prover.
     #[instrument(parent = &self.span, level = "info", skip_all, err)]
-    pub async fn commit<S: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
+    pub async fn commit(mut self) -> Result<Verifier<state::CommitStart>> {
-        self,
+        let mut ctx = self
-        socket: S,
+            .ctx
-    ) -> Result<Verifier<state::CommitStart>, VerifierError> {
+            .take()
-        let (mut mux_fut, mux_ctrl) = attach_mux(socket, Role::Verifier);
+            .ok_or_else(|| Error::internal().with_msg("commitment protocol context was dropped"))?;
-        let mut mt = build_mt_context(mux_ctrl.clone());
-        let mut ctx = mux_fut.poll_with(mt.new_context()).await?;
 
         // Receives protocol configuration from prover to perform compatibility check.
         let TlsCommitRequestMsg { request, version } =
-            mux_fut.poll_with(ctx.io_mut().expect_next()).await?;
+            ctx.io_mut().expect_next().await.map_err(|e| {
+                Error::io()
+                    .with_msg("commitment protocol failed to receive request")
+                    .with_source(e)
+            })?;
 
         if version != *crate::VERSION {
             let msg = format!(
                 "prover version does not match with verifier: {version} != {}",
                 *crate::VERSION
             );
-            mux_fut
+            ctx.io_mut()
-                .poll_with(ctx.io_mut().send(Response::err(Some(msg.clone()))))
+                .send(Response::err(Some(msg.clone())))
-                .await?;
+                .await
+                .map_err(|e| {
+                    Error::io()
+                        .with_msg("commitment protocol failed to send version mismatch response")
+                        .with_source(e)
+                })?;
 
-            // Wait for the prover to correctly close the connection.
+            return Err(Error::config().with_msg(msg));
-            if !mux_fut.is_complete() {
-                mux_ctrl.close();
-                mux_fut.await?;
-            }
-
-            return Err(VerifierError::config(msg));
         }
 
         Ok(Verifier {
             config: self.config,
             span: self.span,
-            state: state::CommitStart {
+            ctx: Some(ctx),
-                mux_ctrl,
+            state: state::CommitStart { request },
-                mux_fut,
-                ctx,
-                request,
-            },
         })
     }
 }
@@ -119,15 +110,18 @@ impl Verifier<state::CommitStart> {
 
     /// Accepts the proposed protocol configuration.
     #[instrument(parent = &self.span, level = "info", skip_all, err)]
-    pub async fn accept(self) -> Result<Verifier<state::CommitAccepted>, VerifierError> {
+    pub async fn accept(mut self) -> Result<Verifier<state::CommitAccepted>> {
-        let state::CommitStart {
+        let mut ctx = self
-            mux_ctrl,
+            .ctx
-            mut mux_fut,
+            .take()
-            mut ctx,
+            .ok_or_else(|| Error::internal().with_msg("commitment protocol context was dropped"))?;
-            request,
+        let state::CommitStart { request } = self.state;
-        } = self.state;
 
-        mux_fut.poll_with(ctx.io_mut().send(Response::ok())).await?;
+        ctx.io_mut().send(Response::ok()).await.map_err(|e| {
+            Error::io()
+                .with_msg("commitment protocol failed to send acceptance")
+                .with_source(e)
+        })?;
 
         let TlsCommitProtocolConfig::Mpc(mpc_tls_config) = request.protocol().clone() else {
             unreachable!("only MPC TLS is supported");
@@ -136,49 +130,46 @@ impl Verifier<state::CommitStart> {
         let VerifierDeps { vm, mut mpc_tls } = build_verifier_deps(mpc_tls_config, ctx);
 
         // Allocate resources for MPC-TLS in the VM.
-        let mut keys = mpc_tls.alloc()?;
+        let mut keys = mpc_tls.alloc().map_err(|e| {
+            Error::internal()
+                .with_msg("commitment protocol failed to allocate mpc-tls resources")
+                .with_source(e)
+        })?;
         let vm_lock = vm.try_lock().expect("VM is not locked");
         translate_keys(&mut keys, &vm_lock);
         drop(vm_lock);
 
         debug!("setting up mpc-tls");
 
-        mux_fut.poll_with(mpc_tls.preprocess()).await?;
+        mpc_tls.preprocess().await.map_err(|e| {
+            Error::internal()
+                .with_msg("commitment protocol failed during mpc-tls preprocessing")
+                .with_source(e)
+        })?;
 
         debug!("mpc-tls setup complete");
 
         Ok(Verifier {
             config: self.config,
             span: self.span,
-            state: state::CommitAccepted {
+            ctx: None,
-                mux_ctrl,
+            state: state::CommitAccepted { mpc_tls, keys, vm },
-                mux_fut,
-                mpc_tls,
-                keys,
-                vm,
-            },
         })
     }
 
     /// Rejects the proposed protocol configuration.
     #[instrument(parent = &self.span, level = "info", skip_all, err)]
-    pub async fn reject(self, msg: Option<&str>) -> Result<(), VerifierError> {
+    pub async fn reject(mut self, msg: Option<&str>) -> Result<()> {
-        let state::CommitStart {
+        let mut ctx = self
-            mux_ctrl,
+            .ctx
-            mut mux_fut,
+            .take()
-            mut ctx,
+            .ok_or_else(|| Error::internal().with_msg("commitment protocol context was dropped"))?;
-            ..
-        } = self.state;
 
-        mux_fut
+        ctx.io_mut().send(Response::err(msg)).await.map_err(|e| {
-            .poll_with(ctx.io_mut().send(Response::err(msg)))
+            Error::io()
-            .await?;
+                .with_msg("commitment protocol failed to send rejection")
-
+                .with_source(e)
-        // Wait for the prover to correctly close the connection.
+        })?;
-        if !mux_fut.is_complete() {
-            mux_ctrl.close();
-            mux_fut.await?;
-        }
 
         Ok(())
     }
@@ -187,18 +178,16 @@ impl Verifier<state::CommitStart> {
 impl Verifier<state::CommitAccepted> {
     /// Runs the verifier until the TLS connection is closed.
     #[instrument(parent = &self.span, level = "info", skip_all, err)]
-    pub async fn run(self) -> Result<Verifier<state::Committed>, VerifierError> {
+    pub async fn run(self) -> Result<Verifier<state::Committed>> {
-        let state::CommitAccepted {
+        let state::CommitAccepted { mpc_tls, vm, keys } = self.state;
-            mux_ctrl,
-            mut mux_fut,
-            mpc_tls,
-            vm,
-            keys,
-        } = self.state;
 
         info!("starting MPC-TLS");
 
-        let (mut ctx, tls_transcript) = mux_fut.poll_with(mpc_tls.run()).await?;
+        let (mut ctx, tls_transcript) = mpc_tls.run().await.map_err(|e| {
+            Error::internal()
+                .with_msg("mpc-tls execution failed")
+                .with_source(e)
+        })?;
 
         info!("finished MPC-TLS");
 
@@ -207,10 +196,11 @@ impl Verifier<state::CommitAccepted> {
 
             debug!("finalizing mpc");
 
-            mux_fut
+            vm.finalize(&mut ctx).await.map_err(|e| {
-                .poll_with(vm.finalize(&mut ctx))
+                Error::internal()
-                .await
+                    .with_msg("mpc finalization failed")
-                .map_err(VerifierError::mpc)?;
+                    .with_source(e)
+            })?;
 
             debug!("mpc finalized");
         }
@@ -230,24 +220,32 @@ impl Verifier<state::CommitAccepted> {
             *tls_transcript.version(),
             tls_transcript.recv().to_vec(),
         )
-        .map_err(VerifierError::zk)?;
+        .map_err(|e| {
+            Error::internal()
+                .with_msg("tag verification setup failed")
+                .with_source(e)
+        })?;
 
-        mux_fut
+        vm.execute_all(&mut ctx).await.map_err(|e| {
-            .poll_with(vm.execute_all(&mut ctx).map_err(VerifierError::zk))
+            Error::internal()
-            .await?;
+                .with_msg("tag verification zk execution failed")
+                .with_source(e)
+        })?;
 
         // Verify the tags.
         // After the verification, the entire TLS trancript becomes
         // authenticated from the verifier's perspective.
-        tag_proof.verify().map_err(VerifierError::zk)?;
+        tag_proof.verify().map_err(|e| {
+            Error::internal()
+                .with_msg("tag verification failed")
+                .with_source(e)
+        })?;
 
         Ok(Verifier {
             config: self.config,
             span: self.span,
+            ctx: Some(ctx),
             state: state::Committed {
-                mux_ctrl,
-                mux_fut,
-                ctx,
                 vm,
                 keys,
                 tls_transcript,
@@ -264,11 +262,12 @@ impl Verifier<state::Committed> {
 
     /// Begins verification of statements from the prover.
     #[instrument(parent = &self.span, level = "info", skip_all, err)]
-    pub async fn verify(self) -> Result<Verifier<state::Verify>, VerifierError> {
+    pub async fn verify(mut self) -> Result<Verifier<state::Verify>> {
+        let mut ctx = self
+            .ctx
+            .take()
+            .ok_or_else(|| Error::internal().with_msg("verification context was dropped"))?;
         let state::Committed {
-            mux_ctrl,
-            mut mux_fut,
-            mut ctx,
             vm,
             keys,
             tls_transcript,
@@ -278,17 +277,17 @@ impl Verifier<state::Committed> {
             request,
             handshake,
             transcript,
-        } = mux_fut
+        } = ctx.io_mut().expect_next().await.map_err(|e| {
-            .poll_with(ctx.io_mut().expect_next().map_err(VerifierError::from))
+            Error::io()
-            .await?;
+                .with_msg("verification failed to receive prove request")
+                .with_source(e)
+        })?;
 
         Ok(Verifier {
             config: self.config,
             span: self.span,
+            ctx: Some(ctx),
             state: state::Verify {
-                mux_ctrl,
-                mux_fut,
-                ctx,
                 vm,
                 keys,
                 tls_transcript,
@@ -301,17 +300,7 @@ impl Verifier<state::Committed> {
 
     /// Closes the connection with the prover.
     #[instrument(parent = &self.span, level = "info", skip_all, err)]
-    pub async fn close(self) -> Result<(), VerifierError> {
+    pub async fn close(self) -> Result<()> {
-        let state::Committed {
-            mux_ctrl, mux_fut, ..
-        } = self.state;
-
-        // Wait for the prover to correctly close the connection.
-        if !mux_fut.is_complete() {
-            mux_ctrl.close();
-            mux_fut.await?;
-        }
-
         Ok(())
     }
 }
@@ -323,13 +312,12 @@ impl Verifier<state::Verify> {
     }
 
     /// Accepts the proving request.
-    pub async fn accept(
+    pub async fn accept(mut self) -> Result<(VerifierOutput, Verifier<state::Committed>)> {
-        self,
+        let mut ctx = self
-    ) -> Result<(VerifierOutput, Verifier<state::Committed>), VerifierError> {
+            .ctx
+            .take()
+            .ok_or_else(|| Error::internal().with_msg("verification context was dropped"))?;
         let state::Verify {
-            mux_ctrl,
-            mut mux_fut,
-            mut ctx,
             mut vm,
             keys,
             tls_transcript,
@@ -338,13 +326,19 @@ impl Verifier<state::Verify> {
             transcript,
         } = self.state;
 
-        mux_fut.poll_with(ctx.io_mut().send(Response::ok())).await?;
+        ctx.io_mut().send(Response::ok()).await.map_err(|e| {
+            Error::io()
+                .with_msg("verification failed to send acceptance")
+                .with_source(e)
+        })?;
 
-        let cert_verifier =
+        let cert_verifier = ServerCertVerifier::new(self.config.root_store()).map_err(|e| {
-            ServerCertVerifier::new(self.config.root_store()).map_err(VerifierError::config)?;
+            Error::config()
+                .with_msg("failed to create certificate verifier")
+                .with_source(e)
+        })?;
 
-        let output = mux_fut
+        let output = verify::verify(
-            .poll_with(verify::verify(
             &mut ctx,
             &mut vm,
             &keys,
@@ -353,7 +347,7 @@ impl Verifier<state::Verify> {
             request,
             handshake,
             transcript,
-            ))
+        )
         .await?;
 
         Ok((
@@ -361,10 +355,8 @@ impl Verifier<state::Verify> {
             Verifier {
                 config: self.config,
                 span: self.span,
+                ctx: Some(ctx),
                 state: state::Committed {
-                    mux_ctrl,
-                    mux_fut,
-                    ctx,
                     vm,
                     keys,
                     tls_transcript,
@@ -374,31 +366,29 @@ impl Verifier<state::Verify> {
     }
 
     /// Rejects the proving request.
-    pub async fn reject(
+    pub async fn reject(mut self, msg: Option<&str>) -> Result<Verifier<state::Committed>> {
-        self,
+        let mut ctx = self
-        msg: Option<&str>,
+            .ctx
-    ) -> Result<Verifier<state::Committed>, VerifierError> {
+            .take()
+            .ok_or_else(|| Error::internal().with_msg("verification context was dropped"))?;
         let state::Verify {
-            mux_ctrl,
-            mut mux_fut,
-            mut ctx,
             vm,
             keys,
             tls_transcript,
             ..
         } = self.state;
 
-        mux_fut
+        ctx.io_mut().send(Response::err(msg)).await.map_err(|e| {
-            .poll_with(ctx.io_mut().send(Response::err(msg)))
+            Error::io()
-            .await?;
+                .with_msg("verification failed to send rejection")
+                .with_source(e)
+        })?;
 
         Ok(Verifier {
             config: self.config,
             span: self.span,
+            ctx: Some(ctx),
             state: state::Committed {
-                mux_ctrl,
-                mux_fut,
-                ctx,
                 vm,
                 keys,
                 tls_transcript,

crates/tlsn/src/verifier/error.rs

@@ -1,113 +0,0 @@
-use std::{error::Error, fmt};
-
-use mpc_tls::MpcTlsError;
-
-use crate::transcript_internal::commit::encoding::EncodingError;
-
-/// Error for [`Verifier`](crate::verifier::Verifier).
-#[derive(Debug, thiserror::Error)]
-pub struct VerifierError {
-    kind: ErrorKind,
-    source: Option<Box<dyn Error + Send + Sync + 'static>>,
-}
-
-impl VerifierError {
-    fn new<E>(kind: ErrorKind, source: E) -> Self
-    where
-        E: Into<Box<dyn Error + Send + Sync + 'static>>,
-    {
-        Self {
-            kind,
-            source: Some(source.into()),
-        }
-    }
-
-    pub(crate) fn config<E>(source: E) -> Self
-    where
-        E: Into<Box<dyn Error + Send + Sync + 'static>>,
-    {
-        Self::new(ErrorKind::Config, source)
-    }
-
-    pub(crate) fn mpc<E>(source: E) -> Self
-    where
-        E: Into<Box<dyn Error + Send + Sync + 'static>>,
-    {
-        Self::new(ErrorKind::Mpc, source)
-    }
-
-    pub(crate) fn zk<E>(source: E) -> Self
-    where
-        E: Into<Box<dyn Error + Send + Sync + 'static>>,
-    {
-        Self::new(ErrorKind::Zk, source)
-    }
-
-    pub(crate) fn verify<E>(source: E) -> Self
-    where
-        E: Into<Box<dyn Error + Send + Sync + 'static>>,
-    {
-        Self::new(ErrorKind::Verify, source)
-    }
-}
-
-#[derive(Debug)]
-enum ErrorKind {
-    Io,
-    Config,
-    Mpc,
-    Zk,
-    Commit,
-    Verify,
-}
-
-impl fmt::Display for VerifierError {
-    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
-        f.write_str("verifier error: ")?;
-
-        match self.kind {
-            ErrorKind::Io => f.write_str("io error")?,
-            ErrorKind::Config => f.write_str("config error")?,
-            ErrorKind::Mpc => f.write_str("mpc error")?,
-            ErrorKind::Zk => f.write_str("zk error")?,
-            ErrorKind::Commit => f.write_str("commit error")?,
-            ErrorKind::Verify => f.write_str("verification error")?,
-        }
-
-        if let Some(source) = &self.source {
-            write!(f, " caused by: {source}")?;
-        }
-
-        Ok(())
-    }
-}
-
-impl From<std::io::Error> for VerifierError {
-    fn from(e: std::io::Error) -> Self {
-        Self::new(ErrorKind::Io, e)
-    }
-}
-
-impl From<uid_mux::yamux::ConnectionError> for VerifierError {
-    fn from(e: uid_mux::yamux::ConnectionError) -> Self {
-        Self::new(ErrorKind::Io, e)
-    }
-}
-
-impl From<mpz_common::ContextError> for VerifierError {
-    fn from(e: mpz_common::ContextError) -> Self {
-        Self::new(ErrorKind::Mpc, e)
-    }
-}
-
-impl From<MpcTlsError> for VerifierError {
-    fn from(e: MpcTlsError) -> Self {
-        Self::new(ErrorKind::Mpc, e)
-    }
-}
-
-impl From<EncodingError> for VerifierError {
-    fn from(e: EncodingError) -> Self {
-        Self::new(ErrorKind::Commit, e)
-    }
-}

crates/tlsn/src/verifier/state.rs

@@ -2,9 +2,7 @@
 
 use std::sync::Arc;
 
-use crate::mux::{MuxControl, MuxFuture};
 use mpc_tls::{MpcTlsFollower, SessionKeys};
-use mpz_common::Context;
 use tlsn_core::{
     config::{prove::ProveRequest, tls_commit::TlsCommitRequest},
     connection::{HandshakeData, ServerName},
@@ -25,9 +23,6 @@ opaque_debug::implement!(Initialized);
 
 /// State after receiving protocol configuration from the prover.
 pub struct CommitStart {
-    pub(crate) mux_ctrl: MuxControl,
-    pub(crate) mux_fut: MuxFuture,
-    pub(crate) ctx: Context,
     pub(crate) request: TlsCommitRequest,
 }
 
@@ -36,8 +31,6 @@ opaque_debug::implement!(CommitStart);
 /// State after accepting the proposed TLS commitment protocol configuration and
 /// performing preprocessing.
 pub struct CommitAccepted {
-    pub(crate) mux_ctrl: MuxControl,
-    pub(crate) mux_fut: MuxFuture,
     pub(crate) mpc_tls: MpcTlsFollower,
     pub(crate) keys: SessionKeys,
     pub(crate) vm: Arc<Mutex<Deap<VerifierMpc, VerifierZk>>>,
@@ -47,9 +40,6 @@ opaque_debug::implement!(CommitAccepted);
 
 /// State after the TLS transcript has been committed.
 pub struct Committed {
-    pub(crate) mux_ctrl: MuxControl,
-    pub(crate) mux_fut: MuxFuture,
-    pub(crate) ctx: Context,
     pub(crate) vm: VerifierZk,
     pub(crate) keys: SessionKeys,
     pub(crate) tls_transcript: TlsTranscript,
@@ -59,9 +49,6 @@ opaque_debug::implement!(Committed);
 
 /// State after receiving a proving request.
 pub struct Verify {
-    pub(crate) mux_ctrl: MuxControl,
-    pub(crate) mux_fut: MuxFuture,
-    pub(crate) ctx: Context,
     pub(crate) vm: VerifierZk,
     pub(crate) keys: SessionKeys,
     pub(crate) tls_transcript: TlsTranscript,

crates/tlsn/src/verifier/verify.rs

@@ -14,19 +14,12 @@ use tlsn_core::{
 };
 
 use crate::{
-    transcript_internal::{
+    Error, Result,
-        TranscriptRefs,
+    transcript_internal::{TranscriptRefs, auth::verify_plaintext, commit::hash::verify_hash},
-        auth::verify_plaintext,
-        commit::{
-            encoding::{self, KeyStore},
-            hash::verify_hash,
-        },
-    },
-    verifier::VerifierError,
 };
 
 #[allow(clippy::too_many_arguments)]
-pub(crate) async fn verify<T: Vm<Binary> + KeyStore + Send + Sync>(
+pub(crate) async fn verify<T: Vm<Binary> + Send + Sync>(
     ctx: &mut Context,
     vm: &mut T,
     keys: &SessionKeys,
@@ -35,35 +28,33 @@ pub(crate) async fn verify<T: Vm<Binary> + KeyStore + Send + Sync>(
     request: ProveRequest,
     handshake: Option<(ServerName, HandshakeData)>,
     transcript: Option<PartialTranscript>,
-) -> Result<VerifierOutput, VerifierError> {
+) -> Result<VerifierOutput> {
     let ciphertext_sent = collect_ciphertext(tls_transcript.sent());
     let ciphertext_recv = collect_ciphertext(tls_transcript.recv());
 
     let transcript = if let Some((auth_sent, auth_recv)) = request.reveal() {
         let Some(transcript) = transcript else {
-            return Err(VerifierError::verify(
+            return Err(Error::internal().with_msg(
-                "prover requested to reveal data but did not send transcript",
+                "verification failed: prover requested to reveal data but did not send transcript",
             ));
         };
 
         if transcript.len_sent() != ciphertext_sent.len()
             || transcript.len_received() != ciphertext_recv.len()
         {
-            return Err(VerifierError::verify(
+            return Err(
-                "prover sent transcript with incorrect length",
+                Error::internal().with_msg("verification failed: transcript length mismatch")
-            ));
+            );
         }
 
         if transcript.sent_authed() != auth_sent {
-            return Err(VerifierError::verify(
+            return Err(Error::internal().with_msg("verification failed: sent auth data mismatch"));
-                "prover sent transcript with incorrect sent authed data",
-            ));
         }
 
         if transcript.received_authed() != auth_recv {
-            return Err(VerifierError::verify(
+            return Err(
-                "prover sent transcript with incorrect received authed data",
+                Error::internal().with_msg("verification failed: received auth data mismatch")
-            ));
+            );
         }
 
         transcript
@@ -79,7 +70,11 @@ pub(crate) async fn verify<T: Vm<Binary> + KeyStore + Send + Sync>(
                 tls_transcript.server_ephemeral_key(),
                 &name,
             )
-            .map_err(VerifierError::verify)?;
+            .map_err(|e| {
+                Error::internal()
+                    .with_msg("verification failed: certificate verification failed")
+                    .with_source(e)
+            })?;
 
         Some(name)
     } else {
@@ -94,11 +89,6 @@ pub(crate) async fn verify<T: Vm<Binary> + KeyStore + Send + Sync>(
                 Direction::Sent => commit_sent.union_mut(idx),
                 Direction::Received => commit_recv.union_mut(idx),
             });
-
-        if let Some((sent, recv)) = commit_config.encoding() {
-            commit_sent.union_mut(sent);
-            commit_recv.union_mut(recv);
-        }
     }
 
     let (sent_refs, sent_proof) = verify_plaintext(
@@ -114,7 +104,11 @@ pub(crate) async fn verify<T: Vm<Binary> + KeyStore + Send + Sync>(
         transcript.sent_authed(),
         &commit_sent,
     )
-    .map_err(VerifierError::zk)?;
+    .map_err(|e| {
+        Error::internal()
+            .with_msg("verification failed during sent plaintext verification")
+            .with_source(e)
+    })?;
     let (recv_refs, recv_proof) = verify_plaintext(
         vm,
         keys.server_write_key,
@@ -128,7 +122,11 @@ pub(crate) async fn verify<T: Vm<Binary> + KeyStore + Send + Sync>(
         transcript.received_authed(),
         &commit_recv,
     )
-    .map_err(VerifierError::zk)?;
+    .map_err(|e| {
+        Error::internal()
+            .with_msg("verification failed during received plaintext verification")
+            .with_source(e)
+    })?;
 
     let transcript_refs = TranscriptRefs {
         sent: sent_refs,
@@ -141,36 +139,37 @@ pub(crate) async fn verify<T: Vm<Binary> + KeyStore + Send + Sync>(
         && commit_config.has_hash()
     {
         hash_commitments = Some(
-            verify_hash(vm, &transcript_refs, commit_config.iter_hash().cloned())
+            verify_hash(vm, &transcript_refs, commit_config.iter_hash().cloned()).map_err(|e| {
-                .map_err(VerifierError::verify)?,
+                Error::internal()
+                    .with_msg("verification failed during hash commitment setup")
+                    .with_source(e)
+            })?,
         );
     }
 
-    vm.execute_all(ctx).await.map_err(VerifierError::zk)?;
+    vm.execute_all(ctx).await.map_err(|e| {
+        Error::internal()
+            .with_msg("verification failed during zk execution")
+            .with_source(e)
+    })?;
 
-    sent_proof.verify().map_err(VerifierError::verify)?;
+    sent_proof.verify().map_err(|e| {
-    recv_proof.verify().map_err(VerifierError::verify)?;
+        Error::internal()
-
+            .with_msg("verification failed: sent plaintext proof invalid")
-    let mut encoder_secret = None;
+            .with_source(e)
-    if let Some(commit_config) = request.transcript_commit()
+    })?;
-        && let Some((sent, recv)) = commit_config.encoding()
+    recv_proof.verify().map_err(|e| {
-    {
+        Error::internal()
-        let sent_map = transcript_refs
+            .with_msg("verification failed: received plaintext proof invalid")
-            .sent
+            .with_source(e)
-            .index(sent)
+    })?;
-            .expect("ranges were authenticated");
-        let recv_map = transcript_refs
-            .recv
-            .index(recv)
-            .expect("ranges were authenticated");
-
-        let (secret, commitment) = encoding::transfer(ctx, vm, &sent_map, &recv_map).await?;
-        encoder_secret = Some(secret);
-        transcript_commitments.push(TranscriptCommitment::Encoding(commitment));
-    }
 
     if let Some(hash_commitments) = hash_commitments {
-        for commitment in hash_commitments.try_recv().map_err(VerifierError::verify)? {
+        for commitment in hash_commitments.try_recv().map_err(|e| {
+            Error::internal()
+                .with_msg("verification failed during hash commitment finalization")
+                .with_source(e)
+        })? {
             transcript_commitments.push(TranscriptCommitment::Hash(commitment));
         }
     }
@@ -178,7 +177,6 @@ pub(crate) async fn verify<T: Vm<Binary> + KeyStore + Send + Sync>(
     Ok(VerifierOutput {
         server_name,
         transcript: request.reveal().is_some().then_some(transcript),
-        encoder_secret,
         transcript_commitments,
     })
 }

crates/tlsn/tests/test.rs

@@ -1,6 +1,6 @@
 use futures::{AsyncReadExt, AsyncWriteExt};
-use rangeset::set::RangeSet;
 use tlsn::{
+    Session,
     config::{
         prove::ProveConfig,
         prover::ProverConfig,
@@ -9,12 +9,9 @@ use tlsn::{
         verifier::VerifierConfig,
     },
     connection::ServerName,
-    hash::{HashAlgId, HashProvider},
+    hash::HashAlgId,
     prover::Prover,
-    transcript::{
+    transcript::{Direction, Transcript, TranscriptCommitConfig, TranscriptCommitmentKind},
-        Direction, Transcript, TranscriptCommitConfig, TranscriptCommitment,
-        TranscriptCommitmentKind, TranscriptSecret,
-    },
     verifier::{Verifier, VerifierOutput},
     webpki::{CertificateDer, RootCertStore},
 };
@@ -22,9 +19,7 @@ use tlsn_core::ProverOutput;
 use tlsn_server_fixture::bind;
 use tlsn_server_fixture_certs::{CA_CERT_DER, SERVER_DOMAIN};
 
-use tokio::io::{AsyncRead, AsyncWrite};
 use tokio_util::compat::TokioAsyncReadCompatExt;
-use tracing::instrument;
 
 // Maximum number of bytes that can be sent from prover to server
 const MAX_SENT_DATA: usize = 1 << 12;
@@ -41,9 +36,34 @@ async fn test() {
     tracing_subscriber::fmt::init();
 
     let (socket_0, socket_1) = tokio::io::duplex(2 << 23);
+    let mut session_p = Session::new(socket_0.compat());
+    let mut session_v = Session::new(socket_1.compat());
 
-    let ((full_transcript, prover_output), verifier_output) =
+    let prover = session_p
-        tokio::join!(prover(socket_0), verifier(socket_1));
+        .new_prover(ProverConfig::builder().build().unwrap())
+        .unwrap();
+    let verifier = session_v
+        .new_verifier(
+            VerifierConfig::builder()
+                .root_store(RootCertStore {
+                    roots: vec![CertificateDer(CA_CERT_DER.to_vec())],
+                })
+                .build()
+                .unwrap(),
+        )
+        .unwrap();
+
+    let (session_p_driver, session_p_handle) = session_p.split();
+    let (session_v_driver, session_v_handle) = session_v.split();
+
+    tokio::spawn(session_p_driver);
+    tokio::spawn(session_v_driver);
+
+    let ((_full_transcript, _prover_output), verifier_output) =
+        tokio::join!(run_prover(prover), run_verifier(verifier));
+
+    session_p_handle.close();
+    session_v_handle.close();
 
     let partial_transcript = verifier_output.transcript.unwrap();
     let ServerName::Dns(server_name) = verifier_output.server_name.unwrap();
@@ -58,61 +78,14 @@ async fn test() {
         partial_transcript.received_authed().iter().next().unwrap(),
         0..10
     );
-
-    let encoding_tree = prover_output
-        .transcript_secrets
-        .iter()
-        .find_map(|secret| {
-            if let TranscriptSecret::Encoding(tree) = secret {
-                Some(tree)
-            } else {
-                None
-            }
-        })
-        .unwrap();
-
-    let encoding_commitment = prover_output
-        .transcript_commitments
-        .iter()
-        .find_map(|commitment| {
-            if let TranscriptCommitment::Encoding(commitment) = commitment {
-                Some(commitment)
-            } else {
-                None
-            }
-        })
-        .unwrap();
-
-    let prove_sent = RangeSet::from(1..full_transcript.sent().len() - 1);
-    let prove_recv = RangeSet::from(1..full_transcript.received().len() - 1);
-    let idxs = [
-        (Direction::Sent, prove_sent.clone()),
-        (Direction::Received, prove_recv.clone()),
-    ];
-    let proof = encoding_tree.proof(idxs.iter()).unwrap();
-    let (auth_sent, auth_recv) = proof
-        .verify_with_provider(
-            &HashProvider::default(),
-            &verifier_output.encoder_secret.unwrap(),
-            encoding_commitment,
-            full_transcript.sent(),
-            full_transcript.received(),
-        )
-        .unwrap();
-
-    assert_eq!(auth_sent, prove_sent);
-    assert_eq!(auth_recv, prove_recv);
 }
 
-#[instrument(skip(verifier_socket))]
+async fn run_prover(prover: Prover) -> (Transcript, ProverOutput) {
-async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
-    verifier_socket: T,
-) -> (Transcript, ProverOutput) {
     let (client_socket, server_socket) = tokio::io::duplex(2 << 16);
 
     let server_task = tokio::spawn(bind(server_socket.compat()));
 
-    let prover = Prover::new(ProverConfig::builder().build().unwrap())
+    let prover = prover
         .commit(
             TlsCommitConfig::builder()
                 .protocol(
@@ -126,7 +99,6 @@ async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
                 )
                 .build()
                 .unwrap(),
-            verifier_socket.compat(),
         )
         .await
         .unwrap();
@@ -163,12 +135,9 @@ async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
 
     let mut builder = TranscriptCommitConfig::builder(prover.transcript());
 
-    for kind in [
+    let kind = TranscriptCommitmentKind::Hash {
-        TranscriptCommitmentKind::Encoding,
-        TranscriptCommitmentKind::Hash {
         alg: HashAlgId::SHA256,
-        },
+    };
-    ] {
     builder
         .commit_with_kind(&(0..sent_tx_len), Direction::Sent, kind)
         .unwrap();
@@ -181,7 +150,6 @@ async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
     builder
         .commit_with_kind(&(1..recv_tx_len - 1), Direction::Received, kind)
         .unwrap();
-    }
 
     let transcript_commit = builder.build().unwrap();
 
@@ -202,21 +170,9 @@ async fn prover<T: AsyncWrite + AsyncRead + Send + Unpin + 'static>(
     (transcript, output)
 }
 
-#[instrument(skip(socket))]
+async fn run_verifier(verifier: Verifier) -> VerifierOutput {
-async fn verifier<T: AsyncWrite + AsyncRead + Send + Sync + Unpin + 'static>(
-    socket: T,
-) -> VerifierOutput {
-    let verifier = Verifier::new(
-        VerifierConfig::builder()
-            .root_store(RootCertStore {
-                roots: vec![CertificateDer(CA_CERT_DER.to_vec())],
-            })
-            .build()
-            .unwrap(),
-    );
-
     let verifier = verifier
-        .commit(socket.compat())
+        .commit()
         .await
         .unwrap()
         .accept()

crates/wasm/Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "tlsn-wasm"
-version = "0.1.0-alpha.14-pre"
+version = "0.1.0-alpha.14"
 edition = "2021"
 repository = "https://github.com/tlsnotary/tlsn.git"
 description = "A core WebAssembly package for TLSNotary."
@@ -26,6 +26,7 @@ tlsn-server-fixture-certs = { workspace = true }
 tlsn-tls-client-async = { workspace = true }
 tlsn-tls-core = { workspace = true }
 
+async_io_stream = { workspace = true }
 bincode = { workspace = true }
 console_error_panic_hook = { version = "0.1" }
 enum-try-as-inner = { workspace = true }

crates/wasm/src/prover/mod.rs

@@ -16,6 +16,7 @@ use tlsn::{
     connection::ServerName,
     prover::{state, Prover},
     webpki::{CertificateDer, PrivateKeyDer, RootCertStore},
+    Session, SessionHandle,
 };
 use tracing::info;
 use wasm_bindgen::{prelude::*, JsError};
@@ -32,16 +33,34 @@ pub struct JsProver {
     state: State,
 }
 
-#[derive(Debug, EnumTryAsInner)]
+#[derive(EnumTryAsInner)]
 #[derive_err(Debug)]
 enum State {
-    Initialized(Prover<state::Initialized>),
+    Initialized,
-    CommitAccepted(Prover<state::CommitAccepted>),
+    CommitAccepted {
-    Committed(Prover<state::Committed>),
+        prover: Prover<state::CommitAccepted>,
+        handle: SessionHandle,
+    },
+    Committed {
+        prover: Prover<state::Committed>,
+        handle: SessionHandle,
+    },
     Complete,
     Error,
 }
 
+impl std::fmt::Debug for State {
+    fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
+        match self {
+            State::Initialized => write!(f, "Initialized"),
+            State::CommitAccepted { .. } => write!(f, "CommitAccepted"),
+            State::Committed { .. } => write!(f, "Committed"),
+            State::Complete => write!(f, "Complete"),
+            State::Error => write!(f, "Error"),
+        }
+    }
+}
+
 impl State {
     fn take(&mut self) -> Self {
         std::mem::replace(self, State::Error)
@@ -54,9 +73,7 @@ impl JsProver {
     pub fn new(config: ProverConfig) -> Result<JsProver> {
         Ok(JsProver {
             config,
-            state: State::Initialized(Prover::new(
+            state: State::Initialized,
-                tlsn::config::prover::ProverConfig::builder().build()?,
-            )),
         })
     }
 
@@ -65,9 +82,11 @@ impl JsProver {
     /// This performs all MPC setup prior to establishing the connection to the
     /// application server.
     pub async fn setup(&mut self, verifier_url: &str) -> Result<()> {
-        let prover = self.state.take().try_into_initialized()?;
+        let State::Initialized = self.state.take() else {
+            return Err(JsError::new("prover is not in initialized state"));
+        };
 
-        let config = TlsCommitConfig::builder()
+        let tls_commit_config = TlsCommitConfig::builder()
             .protocol({
                 let mut builder = MpcTlsConfig::builder()
                     .max_sent_data(self.config.max_sent_data)
@@ -99,9 +118,23 @@ impl JsProver {
 
         info!("connected to verifier");
 
-        let prover = prover.commit(config, verifier_conn.into_io()).await?;
+        let session = Session::new(verifier_conn.into_io());
+        let (driver, mut handle) = session.split();
+        spawn_local(async move {
+            if let Err(e) = driver.await {
+                tracing::error!("session driver error: {e}");
+            }
+        });
 
-        self.state = State::CommitAccepted(prover);
+        let prover_config = tlsn::config::prover::ProverConfig::builder().build()?;
+        let prover = handle.new_prover(prover_config)?;
+
+        let prover = prover
+            .commit(tls_commit_config)
+            .await
+            .map_err(|e| JsError::new(&e.to_string()))?;
+
+        self.state = State::CommitAccepted { prover, handle };
 
         Ok(())
     }
@@ -112,7 +145,9 @@ impl JsProver {
         ws_proxy_url: &str,
         request: HttpRequest,
     ) -> Result<HttpResponse> {
-        let prover = self.state.take().try_into_commit_accepted()?;
+        let State::CommitAccepted { prover, handle } = self.state.take() else {
+            return Err(JsError::new("prover is not in commit accepted state"));
+        };
 
         let mut builder = TlsClientConfig::builder()
             .server_name(ServerName::Dns(
@@ -140,7 +175,7 @@ impl JsProver {
             builder = builder.client_auth((certs, key));
         }
 
-        let config = builder.build()?;
+        let tls_config = builder.build()?;
 
         info!("connecting to server");
 
@@ -148,32 +183,39 @@ impl JsProver {
 
         info!("connected to server");
 
-        let (tls_conn, prover_fut) = prover.connect(config, server_conn.into_io()).await?;
+        let (tls_conn, prover_fut) = prover
+            .connect(tls_config, server_conn.into_io())
+            .await
+            .map_err(|e| JsError::new(&e.to_string()))?;
 
         info!("sending request");
 
         let (response, prover) = futures::try_join!(
             send_request(tls_conn, request),
-            prover_fut.map_err(Into::into)
+            prover_fut.map_err(|e| JsError::new(&e.to_string()))
         )?;
 
         info!("response received");
 
-        self.state = State::Committed(prover);
+        self.state = State::Committed { prover, handle };
 
         Ok(response)
     }
 
     /// Returns the transcript.
     pub fn transcript(&self) -> Result<Transcript> {
-        let prover = self.state.try_as_committed()?;
+        let State::Committed { prover, .. } = &self.state else {
+            return Err(JsError::new("prover is not in committed state"));
+        };
 
         Ok(Transcript::from(prover.transcript()))
     }
 
     /// Reveals data to the verifier and finalizes the protocol.
     pub async fn reveal(&mut self, reveal: Reveal) -> Result<()> {
-        let mut prover = self.state.take().try_into_committed()?;
+        let State::Committed { mut prover, handle } = self.state.take() else {
+            return Err(JsError::new("prover is not in committed state"));
+        };
 
         info!("revealing data");
 
@@ -193,8 +235,16 @@ impl JsProver {
 
         let config = builder.build()?;
 
-        prover.prove(&config).await?;
+        prover
-        prover.close().await?;
+            .prove(&config)
+            .await
+            .map_err(|e| JsError::new(&e.to_string()))?;
+        prover
+            .close()
+            .await
+            .map_err(|e| JsError::new(&e.to_string()))?;
+
+        handle.close();
 
         info!("Finalized");
 

crates/wasm/src/verifier/mod.rs

@@ -9,10 +9,12 @@ use tlsn::{
     transcript::ContentType,
     verifier::{state, Verifier},
     webpki::RootCertStore,
+    Session, SessionHandle,
 };
 use tracing::info;
 use wasm_bindgen::prelude::*;
-use ws_stream_wasm::{WsMeta, WsStream};
+use wasm_bindgen_futures::spawn_local;
+use ws_stream_wasm::WsMeta;
 
 use crate::types::VerifierOutput;
 
@@ -27,15 +29,23 @@ pub struct JsVerifier {
 #[derive(EnumTryAsInner)]
 #[derive_err(Debug)]
 enum State {
-    Initialized(Verifier<state::Initialized>),
+    Initialized,
-    Connected((Verifier<state::Initialized>, WsStream)),
+    Connected {
+        verifier: Verifier<state::Initialized>,
+        handle: SessionHandle,
+    },
     Complete,
     Error,
 }
 
 impl std::fmt::Debug for State {
     fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
-        write!(f, "State")
+        match self {
+            State::Initialized => write!(f, "Initialized"),
+            State::Connected { .. } => write!(f, "Connected"),
+            State::Complete => write!(f, "Complete"),
+            State::Error => write!(f, "Error"),
+        }
     }
 }
 
@@ -49,19 +59,17 @@ impl State {
 impl JsVerifier {
     #[wasm_bindgen(constructor)]
     pub fn new(config: VerifierConfig) -> JsVerifier {
-        let tlsn_config = tlsn::config::verifier::VerifierConfig::builder()
-            .root_store(RootCertStore::mozilla())
-            .build()
-            .unwrap();
         JsVerifier {
-            state: State::Initialized(Verifier::new(tlsn_config)),
+            state: State::Initialized,
             config,
         }
     }
 
     /// Connect to the prover.
     pub async fn connect(&mut self, prover_url: &str) -> Result<()> {
-        let verifier = self.state.take().try_into_initialized()?;
+        let State::Initialized = self.state.take() else {
+            return Err(JsError::new("verifier is not in initialized state"));
+        };
 
         info!("Connecting to prover");
 
@@ -69,40 +77,75 @@ impl JsVerifier {
 
         info!("Connected to prover");
 
-        self.state = State::Connected((verifier, prover_conn));
+        let session = Session::new(prover_conn.into_io());
+        let (driver, mut handle) = session.split();
+        spawn_local(async move {
+            if let Err(e) = driver.await {
+                tracing::error!("session driver error: {e}");
+            }
+        });
+
+        let verifier_config = tlsn::config::verifier::VerifierConfig::builder()
+            .root_store(RootCertStore::mozilla())
+            .build()
+            .map_err(|e| JsError::new(&e.to_string()))?;
+        let verifier = handle
+            .new_verifier(verifier_config)
+            .map_err(|e| JsError::new(&e.to_string()))?;
+
+        self.state = State::Connected { verifier, handle };
 
         Ok(())
     }
 
     /// Verifies the connection and finalizes the protocol.
     pub async fn verify(&mut self) -> Result<VerifierOutput> {
-        let (verifier, prover_conn) = self.state.take().try_into_connected()?;
+        let State::Connected { verifier, handle } = self.state.take() else {
+            return Err(JsError::new("verifier is not in connected state"));
+        };
 
-        let verifier = verifier.commit(prover_conn.into_io()).await?;
+        let max_sent_data = self.config.max_sent_data;
+        let max_recv_data = self.config.max_recv_data;
+        let max_sent_records = self.config.max_sent_records;
+        let max_recv_records_online = self.config.max_recv_records_online;
+
+        let verifier = verifier
+            .commit()
+            .await
+            .map_err(|e| JsError::new(&e.to_string()))?;
         let request = verifier.request();
 
         let TlsCommitProtocolConfig::Mpc(mpc_tls_config) = request.protocol() else {
-            unimplemented!("only MPC protocol is supported");
+            return Err(JsError::new("only MPC protocol is supported"));
         };
 
-        let reject = if mpc_tls_config.max_sent_data() > self.config.max_sent_data {
+        let reject = if mpc_tls_config.max_sent_data() > max_sent_data {
             Some("max_sent_data is too large")
-        } else if mpc_tls_config.max_recv_data() > self.config.max_recv_data {
+        } else if mpc_tls_config.max_recv_data() > max_recv_data {
             Some("max_recv_data is too large")
-        } else if mpc_tls_config.max_sent_records() > self.config.max_sent_records {
+        } else if mpc_tls_config.max_sent_records() > max_sent_records {
             Some("max_sent_records is too large")
-        } else if mpc_tls_config.max_recv_records_online() > self.config.max_recv_records_online {
+        } else if mpc_tls_config.max_recv_records_online() > max_recv_records_online {
             Some("max_recv_records_online is too large")
         } else {
             None
         };
 
         if reject.is_some() {
-            verifier.reject(reject).await?;
+            verifier
+                .reject(reject)
+                .await
+                .map_err(|e| JsError::new(&e.to_string()))?;
             return Err(JsError::new("protocol configuration rejected"));
         }
 
-        let verifier = verifier.accept().await?.run().await?;
+        let verifier = verifier
+            .accept()
+            .await
+            .map_err(|e| JsError::new(&e.to_string()))?
+            .run()
+            .await
+            .map_err(|e| JsError::new(&e.to_string()))?;
 
         let sent = verifier
             .tls_transcript()
@@ -129,8 +172,19 @@ impl JsVerifier {
             },
         };
 
-        let (output, verifier) = verifier.verify().await?.accept().await?;
+        let (output, verifier) = verifier
-        verifier.close().await?;
+            .verify()
+            .await
+            .map_err(|e| JsError::new(&e.to_string()))?
+            .accept()
+            .await
+            .map_err(|e| JsError::new(&e.to_string()))?;
+        verifier
+            .close()
+            .await
+            .map_err(|e| JsError::new(&e.to_string()))?;
+
+        handle.close();
 
         self.state = State::Complete;
 
@@ -139,8 +193,8 @@ impl JsVerifier {
                 let ServerName::Dns(name) = name;
                 name.to_string()
             }),
-            connection_info: connection_info.into(),
+            connection_info: crate::types::ConnectionInfo::from(connection_info),
-            transcript: output.transcript.map(|t| t.into()),
+            transcript: output.transcript.map(crate::types::PartialTranscript::from),
         })
     }
 }